Merge branch 'develop' into imu-examples
commit
d79ddb6858
|
|
@ -63,7 +63,7 @@ function configure()
|
||||||
-DGTSAM_BUILD_EXAMPLES_ALWAYS=${GTSAM_BUILD_EXAMPLES_ALWAYS:-ON} \
|
-DGTSAM_BUILD_EXAMPLES_ALWAYS=${GTSAM_BUILD_EXAMPLES_ALWAYS:-ON} \
|
||||||
-DGTSAM_ALLOW_DEPRECATED_SINCE_V4=${GTSAM_ALLOW_DEPRECATED_SINCE_V4:-OFF} \
|
-DGTSAM_ALLOW_DEPRECATED_SINCE_V4=${GTSAM_ALLOW_DEPRECATED_SINCE_V4:-OFF} \
|
||||||
-DGTSAM_BUILD_WITH_MARCH_NATIVE=OFF \
|
-DGTSAM_BUILD_WITH_MARCH_NATIVE=OFF \
|
||||||
-DCMAKE_VERBOSE_MAKEFILE=ON
|
-DCMAKE_VERBOSE_MAKEFILE=OFF
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -14,7 +14,8 @@ addons:
|
||||||
- clang-9
|
- clang-9
|
||||||
- build-essential pkg-config
|
- build-essential pkg-config
|
||||||
- cmake
|
- cmake
|
||||||
- libpython-dev python-numpy
|
- python3-dev libpython-dev
|
||||||
|
- python3-numpy
|
||||||
- libboost-all-dev
|
- libboost-all-dev
|
||||||
|
|
||||||
# before_install:
|
# before_install:
|
||||||
|
|
|
||||||
|
|
@ -1,3 +1,3 @@
|
||||||
Cython>=0.25.2
|
Cython>=0.25.2
|
||||||
backports_abc>=0.5
|
backports_abc>=0.5
|
||||||
numpy>=1.12.0
|
numpy>=1.11.0
|
||||||
|
|
|
||||||
|
|
@ -1,12 +0,0 @@
|
||||||
# How to build a GTSAM debian package
|
|
||||||
|
|
||||||
To use the ``debuild`` command, install the ``devscripts`` package
|
|
||||||
|
|
||||||
sudo apt install devscripts
|
|
||||||
|
|
||||||
Change into the gtsam directory, then run:
|
|
||||||
|
|
||||||
debuild -us -uc -j4
|
|
||||||
|
|
||||||
Adjust the ``-j4`` depending on how many CPUs you want to build on in
|
|
||||||
parallel.
|
|
||||||
|
|
@ -1,5 +0,0 @@
|
||||||
gtsam (4.0.0-1berndpfrommer) bionic; urgency=medium
|
|
||||||
|
|
||||||
* initial release
|
|
||||||
|
|
||||||
-- Bernd Pfrommer <bernd.pfrommer@gmail.com> Wed, 18 Jul 2018 20:36:44 -0400
|
|
||||||
|
|
@ -1 +0,0 @@
|
||||||
9
|
|
||||||
|
|
@ -1,15 +0,0 @@
|
||||||
Source: gtsam
|
|
||||||
Section: libs
|
|
||||||
Priority: optional
|
|
||||||
Maintainer: Frank Dellaert <frank@cc.gatech.edu>
|
|
||||||
Uploaders: Jose Luis Blanco Claraco <joseluisblancoc@gmail.com>, Bernd Pfrommer <bernd.pfrommer@gmail.com>
|
|
||||||
Build-Depends: cmake, libboost-all-dev (>= 1.58), libeigen3-dev, libtbb-dev, debhelper (>=9)
|
|
||||||
Standards-Version: 3.9.7
|
|
||||||
Homepage: https://github.com/borglab/gtsam
|
|
||||||
Vcs-Browser: https://github.com/borglab/gtsam
|
|
||||||
|
|
||||||
Package: libgtsam-dev
|
|
||||||
Architecture: any
|
|
||||||
Depends: ${shlibs:Depends}, ${misc:Depends}, libboost-serialization-dev, libboost-system-dev, libboost-filesystem-dev, libboost-thread-dev, libboost-program-options-dev, libboost-date-time-dev, libboost-timer-dev, libboost-chrono-dev, libboost-regex-dev
|
|
||||||
Description: Georgia Tech Smoothing and Mapping Library
|
|
||||||
gtsam: Georgia Tech Smoothing and Mapping library for SLAM type applications
|
|
||||||
|
|
@ -1,15 +0,0 @@
|
||||||
Format: https://www.debian.org/doc/packaging-manuals/copyright-format/1.0/
|
|
||||||
Upstream-Name: gtsam
|
|
||||||
Source: https://bitbucket.org/gtborg/gtsam.git
|
|
||||||
|
|
||||||
Files: *
|
|
||||||
Copyright: 2017, Frank Dellaert
|
|
||||||
License: BSD
|
|
||||||
|
|
||||||
Files: gtsam/3rdparty/CCOLAMD/*
|
|
||||||
Copyright: 2005-2011, Univ. of Florida. Authors: Timothy A. Davis, Sivasankaran Rajamanickam, and Stefan Larimore. Closely based on COLAMD by Davis, Stefan Larimore, in collaboration with Esmond Ng, and John Gilbert. http://www.cise.ufl.edu/research/sparse
|
|
||||||
License: GNU LESSER GENERAL PUBLIC LICENSE
|
|
||||||
|
|
||||||
Files: gtsam/3rdparty/Eigen/*
|
|
||||||
Copyright: 2017, Multiple Authors
|
|
||||||
License: MPL2
|
|
||||||
|
|
@ -1,29 +0,0 @@
|
||||||
#!/usr/bin/make -f
|
|
||||||
# See debhelper(7) (uncomment to enable)
|
|
||||||
# output every command that modifies files on the build system.
|
|
||||||
export DH_VERBOSE = 1
|
|
||||||
|
|
||||||
# Makefile target name for running unit tests:
|
|
||||||
GTSAM_TEST_TARGET = check
|
|
||||||
|
|
||||||
# see FEATURE AREAS in dpkg-buildflags(1)
|
|
||||||
#export DEB_BUILD_MAINT_OPTIONS = hardening=+all
|
|
||||||
|
|
||||||
# see ENVIRONMENT in dpkg-buildflags(1)
|
|
||||||
# package maintainers to append CFLAGS
|
|
||||||
#export DEB_CFLAGS_MAINT_APPEND = -Wall -pedantic
|
|
||||||
# package maintainers to append LDFLAGS
|
|
||||||
#export DEB_LDFLAGS_MAINT_APPEND = -Wl,--as-needed
|
|
||||||
|
|
||||||
%:
|
|
||||||
dh $@ --parallel
|
|
||||||
|
|
||||||
# dh_make generated override targets
|
|
||||||
# This is example for Cmake (See https://bugs.debian.org/641051 )
|
|
||||||
override_dh_auto_configure:
|
|
||||||
dh_auto_configure -- -DCMAKE_BUILD_TYPE=RelWithDebInfo -DCMAKE_INSTALL_PREFIX=/usr -DGTSAM_BUILD_EXAMPLES_ALWAYS=OFF -DGTSAM_BUILD_TESTS=ON -DGTSAM_BUILD_WRAP=OFF -DGTSAM_BUILD_DOCS=OFF -DGTSAM_INSTALL_CPPUNITLITE=OFF -DGTSAM_INSTALL_GEOGRAPHICLIB=OFF -DGTSAM_BUILD_TYPE_POSTFIXES=OFF -DGTSAM_BUILD_WITH_MARCH_NATIVE=OFF
|
|
||||||
|
|
||||||
override_dh_auto_test-arch:
|
|
||||||
# Tests for arch-dependent :
|
|
||||||
echo "[override_dh_auto_test-arch]"
|
|
||||||
dh_auto_build -O--buildsystem=cmake -- $(GTSAM_TEST_TARGET)
|
|
||||||
|
|
@ -1 +0,0 @@
|
||||||
3.0 (quilt)
|
|
||||||
|
|
@ -2291,15 +2291,11 @@ uncalibration
|
||||||
used in the residual).
|
used in the residual).
|
||||||
\end_layout
|
\end_layout
|
||||||
|
|
||||||
\begin_layout Standard
|
|
||||||
\begin_inset Note Note
|
|
||||||
status collapsed
|
|
||||||
|
|
||||||
\begin_layout Section
|
\begin_layout Section
|
||||||
Noise models of prior factors
|
Noise models of prior factors
|
||||||
\end_layout
|
\end_layout
|
||||||
|
|
||||||
\begin_layout Plain Layout
|
\begin_layout Standard
|
||||||
The simplest way to describe noise models is by an example.
|
The simplest way to describe noise models is by an example.
|
||||||
Let's take a prior factor on a 3D pose
|
Let's take a prior factor on a 3D pose
|
||||||
\begin_inset Formula $x\in\SE 3$
|
\begin_inset Formula $x\in\SE 3$
|
||||||
|
|
@ -2353,7 +2349,7 @@ e\left(x\right)=\norm{h\left(x\right)}_{\Sigma}^{2}=h\left(x\right)^{\t}\Sigma^{
|
||||||
useful answer out quickly ]
|
useful answer out quickly ]
|
||||||
\end_layout
|
\end_layout
|
||||||
|
|
||||||
\begin_layout Plain Layout
|
\begin_layout Standard
|
||||||
The density induced by a noise model on the prior factor is Gaussian in
|
The density induced by a noise model on the prior factor is Gaussian in
|
||||||
the tangent space about the linearization point.
|
the tangent space about the linearization point.
|
||||||
Suppose that the pose is linearized at
|
Suppose that the pose is linearized at
|
||||||
|
|
@ -2431,7 +2427,7 @@ Here we see that the update
|
||||||
.
|
.
|
||||||
\end_layout
|
\end_layout
|
||||||
|
|
||||||
\begin_layout Plain Layout
|
\begin_layout Standard
|
||||||
This means that to draw random pose samples, we actually draw random samples
|
This means that to draw random pose samples, we actually draw random samples
|
||||||
of
|
of
|
||||||
\begin_inset Formula $\delta x$
|
\begin_inset Formula $\delta x$
|
||||||
|
|
@ -2456,7 +2452,7 @@ This means that to draw random pose samples, we actually draw random samples
|
||||||
Noise models of between factors
|
Noise models of between factors
|
||||||
\end_layout
|
\end_layout
|
||||||
|
|
||||||
\begin_layout Plain Layout
|
\begin_layout Standard
|
||||||
The noise model of a BetweenFactor is a bit more complicated.
|
The noise model of a BetweenFactor is a bit more complicated.
|
||||||
The unwhitened error is
|
The unwhitened error is
|
||||||
\begin_inset Formula
|
\begin_inset Formula
|
||||||
|
|
@ -2516,11 +2512,6 @@ e\left(\delta x_{1}\right) & \approx\norm{\log\left(z^{-1}\left(x_{1}\exp\delta
|
||||||
\end_inset
|
\end_inset
|
||||||
|
|
||||||
|
|
||||||
\end_layout
|
|
||||||
|
|
||||||
\end_inset
|
|
||||||
|
|
||||||
|
|
||||||
\end_layout
|
\end_layout
|
||||||
|
|
||||||
\end_body
|
\end_body
|
||||||
|
|
|
||||||
Binary file not shown.
4
gtsam.h
4
gtsam.h
|
|
@ -281,7 +281,7 @@ virtual class Value {
|
||||||
};
|
};
|
||||||
|
|
||||||
#include <gtsam/base/GenericValue.h>
|
#include <gtsam/base/GenericValue.h>
|
||||||
template<T = {Vector, gtsam::Point2, gtsam::Point3, gtsam::Rot2, gtsam::Rot3, gtsam::Pose2, gtsam::Pose3, gtsam::StereoPoint2, gtsam::Cal3_S2, gtsam::CalibratedCamera, gtsam::SimpleCamera, gtsam::imuBias::ConstantBias}>
|
template<T = {Vector, Matrix, gtsam::Point2, gtsam::Point3, gtsam::Rot2, gtsam::Rot3, gtsam::Pose2, gtsam::Pose3, gtsam::StereoPoint2, gtsam::Cal3_S2, gtsam::Cal3DS2, gtsam::Cal3Bundler, gtsam::EssentialMatrix, gtsam::CalibratedCamera, gtsam::SimpleCamera, gtsam::imuBias::ConstantBias}>
|
||||||
virtual class GenericValue : gtsam::Value {
|
virtual class GenericValue : gtsam::Value {
|
||||||
void serializable() const;
|
void serializable() const;
|
||||||
};
|
};
|
||||||
|
|
@ -2955,6 +2955,7 @@ class PreintegratedImuMeasurements {
|
||||||
gtsam::Rot3 deltaRij() const;
|
gtsam::Rot3 deltaRij() const;
|
||||||
Vector deltaPij() const;
|
Vector deltaPij() const;
|
||||||
Vector deltaVij() const;
|
Vector deltaVij() const;
|
||||||
|
gtsam::imuBias::ConstantBias biasHat() const;
|
||||||
Vector biasHatVector() const;
|
Vector biasHatVector() const;
|
||||||
gtsam::NavState predict(const gtsam::NavState& state_i,
|
gtsam::NavState predict(const gtsam::NavState& state_i,
|
||||||
const gtsam::imuBias::ConstantBias& bias) const;
|
const gtsam::imuBias::ConstantBias& bias) const;
|
||||||
|
|
@ -3016,6 +3017,7 @@ class PreintegratedCombinedMeasurements {
|
||||||
gtsam::Rot3 deltaRij() const;
|
gtsam::Rot3 deltaRij() const;
|
||||||
Vector deltaPij() const;
|
Vector deltaPij() const;
|
||||||
Vector deltaVij() const;
|
Vector deltaVij() const;
|
||||||
|
gtsam::imuBias::ConstantBias biasHat() const;
|
||||||
Vector biasHatVector() const;
|
Vector biasHatVector() const;
|
||||||
gtsam::NavState predict(const gtsam::NavState& state_i,
|
gtsam::NavState predict(const gtsam::NavState& state_i,
|
||||||
const gtsam::imuBias::ConstantBias& bias) const;
|
const gtsam::imuBias::ConstantBias& bias) const;
|
||||||
|
|
|
||||||
|
|
@ -17,7 +17,7 @@ if(NOT GTSAM_USE_SYSTEM_EIGEN)
|
||||||
endforeach(eigen_dir)
|
endforeach(eigen_dir)
|
||||||
|
|
||||||
if(GTSAM_WITH_EIGEN_UNSUPPORTED)
|
if(GTSAM_WITH_EIGEN_UNSUPPORTED)
|
||||||
message("-- Installing Eigen Unsupported modules")
|
message(STATUS "Installing Eigen Unsupported modules")
|
||||||
# do the same for the unsupported eigen folder
|
# do the same for the unsupported eigen folder
|
||||||
file(GLOB_RECURSE unsupported_eigen_headers "${CMAKE_CURRENT_SOURCE_DIR}/Eigen/unsupported/Eigen/*.h")
|
file(GLOB_RECURSE unsupported_eigen_headers "${CMAKE_CURRENT_SOURCE_DIR}/Eigen/unsupported/Eigen/*.h")
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -181,7 +181,7 @@ public:
|
||||||
// Alignment, see https://eigen.tuxfamily.org/dox/group__TopicStructHavingEigenMembers.html
|
// Alignment, see https://eigen.tuxfamily.org/dox/group__TopicStructHavingEigenMembers.html
|
||||||
enum { NeedsToAlign = (sizeof(T) % 16) == 0 };
|
enum { NeedsToAlign = (sizeof(T) % 16) == 0 };
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
||||||
};
|
};
|
||||||
|
|
||||||
/// use this macro instead of BOOST_CLASS_EXPORT for GenericValues
|
/// use this macro instead of BOOST_CLASS_EXPORT for GenericValues
|
||||||
|
|
|
||||||
|
|
@ -214,7 +214,7 @@ public:
|
||||||
enum { NeedsToAlign = (sizeof(M1) % 16) == 0 || (sizeof(M2) % 16) == 0
|
enum { NeedsToAlign = (sizeof(M1) % 16) == 0 || (sizeof(M2) % 16) == 0
|
||||||
};
|
};
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
||||||
};
|
};
|
||||||
|
|
||||||
// Define any direct product group to be a model of the multiplicative Group concept
|
// Define any direct product group to be a model of the multiplicative Group concept
|
||||||
|
|
|
||||||
|
|
@ -76,7 +76,7 @@ namespace gtsam {
|
||||||
blockStart_(0)
|
blockStart_(0)
|
||||||
{
|
{
|
||||||
fillOffsets(dimensions.begin(), dimensions.end(), appendOneDimension);
|
fillOffsets(dimensions.begin(), dimensions.end(), appendOneDimension);
|
||||||
matrix_.setZero(variableColOffsets_.back(), variableColOffsets_.back());
|
matrix_.resize(variableColOffsets_.back(), variableColOffsets_.back());
|
||||||
assertInvariants();
|
assertInvariants();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
@ -86,7 +86,7 @@ namespace gtsam {
|
||||||
blockStart_(0)
|
blockStart_(0)
|
||||||
{
|
{
|
||||||
fillOffsets(firstBlockDim, lastBlockDim, appendOneDimension);
|
fillOffsets(firstBlockDim, lastBlockDim, appendOneDimension);
|
||||||
matrix_.setZero(variableColOffsets_.back(), variableColOffsets_.back());
|
matrix_.resize(variableColOffsets_.back(), variableColOffsets_.back());
|
||||||
assertInvariants();
|
assertInvariants();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
@ -95,7 +95,7 @@ namespace gtsam {
|
||||||
SymmetricBlockMatrix(const CONTAINER& dimensions, const Matrix& matrix, bool appendOneDimension = false) :
|
SymmetricBlockMatrix(const CONTAINER& dimensions, const Matrix& matrix, bool appendOneDimension = false) :
|
||||||
blockStart_(0)
|
blockStart_(0)
|
||||||
{
|
{
|
||||||
matrix_.setZero(matrix.rows(), matrix.cols());
|
matrix_.resize(matrix.rows(), matrix.cols());
|
||||||
matrix_.triangularView<Eigen::Upper>() = matrix.triangularView<Eigen::Upper>();
|
matrix_.triangularView<Eigen::Upper>() = matrix.triangularView<Eigen::Upper>();
|
||||||
fillOffsets(dimensions.begin(), dimensions.end(), appendOneDimension);
|
fillOffsets(dimensions.begin(), dimensions.end(), appendOneDimension);
|
||||||
if(matrix_.rows() != matrix_.cols())
|
if(matrix_.rows() != matrix_.cols())
|
||||||
|
|
@ -416,4 +416,3 @@ namespace gtsam {
|
||||||
class CholeskyFailed;
|
class CholeskyFailed;
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -0,0 +1,67 @@
|
||||||
|
/* ----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
* GTSAM Copyright 2020, Georgia Tech Research Corporation,
|
||||||
|
* Atlanta, Georgia 30332-0415
|
||||||
|
* All Rights Reserved
|
||||||
|
* Authors: Frank Dellaert, et al. (see THANKS for the full author list)
|
||||||
|
|
||||||
|
* See LICENSE for the license information
|
||||||
|
|
||||||
|
* -------------------------------------------------------------------------- */
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @file make_shared.h
|
||||||
|
* @brief make_shared trampoline function to ensure proper alignment
|
||||||
|
* @author Fan Jiang
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include <gtsam/base/types.h>
|
||||||
|
|
||||||
|
#include <Eigen/Core>
|
||||||
|
|
||||||
|
#include <boost/make_shared.hpp>
|
||||||
|
|
||||||
|
#include <type_traits>
|
||||||
|
|
||||||
|
namespace gtsam {
|
||||||
|
/// An shorthand alias for accessing the ::type inside std::enable_if that can be used in a template directly
|
||||||
|
template<bool B, class T = void>
|
||||||
|
using enable_if_t = typename std::enable_if<B, T>::type;
|
||||||
|
}
|
||||||
|
|
||||||
|
namespace gtsam {
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Add our own `make_shared` as a layer of wrapping on `boost::make_shared`
|
||||||
|
* This solves the problem with the stock `make_shared` that custom alignment is not respected, causing SEGFAULTs
|
||||||
|
* at runtime, which is notoriously hard to debug.
|
||||||
|
*
|
||||||
|
* Explanation
|
||||||
|
* ===============
|
||||||
|
* The template `needs_eigen_aligned_allocator<T>::value` will evaluate to `std::true_type` if the type alias
|
||||||
|
* `_eigen_aligned_allocator_trait = void` is present in a class, which is automatically added by the
|
||||||
|
* `GTSAM_MAKE_ALIGNED_OPERATOR_NEW` macro.
|
||||||
|
*
|
||||||
|
* This function declaration will only be taken when the above condition is true, so if some object does not need to
|
||||||
|
* be aligned, `gtsam::make_shared` will fall back to the next definition, which is a simple wrapper for
|
||||||
|
* `boost::make_shared`.
|
||||||
|
*
|
||||||
|
* @tparam T The type of object being constructed
|
||||||
|
* @tparam Args Type of the arguments of the constructor
|
||||||
|
* @param args Arguments of the constructor
|
||||||
|
* @return The object created as a boost::shared_ptr<T>
|
||||||
|
*/
|
||||||
|
template<typename T, typename ... Args>
|
||||||
|
gtsam::enable_if_t<needs_eigen_aligned_allocator<T>::value, boost::shared_ptr<T>> make_shared(Args &&... args) {
|
||||||
|
return boost::allocate_shared<T>(Eigen::aligned_allocator<T>(), std::forward<Args>(args)...);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Fall back to the boost version if no need for alignment
|
||||||
|
template<typename T, typename ... Args>
|
||||||
|
gtsam::enable_if_t<!needs_eigen_aligned_allocator<T>::value, boost::shared_ptr<T>> make_shared(Args &&... args) {
|
||||||
|
return boost::make_shared<T>(std::forward<Args>(args)...);
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
|
@ -42,123 +42,218 @@
|
||||||
|
|
||||||
namespace gtsam {
|
namespace gtsam {
|
||||||
|
|
||||||
// Serialization directly to strings in compressed format
|
/** @name Standard serialization
|
||||||
|
* Serialization in default compressed format
|
||||||
|
*/
|
||||||
|
///@{
|
||||||
|
/// serializes to a stream
|
||||||
template <class T>
|
template <class T>
|
||||||
std::string serialize(const T& input) {
|
void serializeToStream(const T& input, std::ostream& out_archive_stream) {
|
||||||
std::ostringstream out_archive_stream;
|
|
||||||
boost::archive::text_oarchive out_archive(out_archive_stream);
|
boost::archive::text_oarchive out_archive(out_archive_stream);
|
||||||
out_archive << input;
|
out_archive << input;
|
||||||
return out_archive_stream.str();
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// deserializes from a stream
|
||||||
template <class T>
|
template <class T>
|
||||||
void deserialize(const std::string& serialized, T& output) {
|
void deserializeFromStream(std::istream& in_archive_stream, T& output) {
|
||||||
std::istringstream in_archive_stream(serialized);
|
|
||||||
boost::archive::text_iarchive in_archive(in_archive_stream);
|
boost::archive::text_iarchive in_archive(in_archive_stream);
|
||||||
in_archive >> output;
|
in_archive >> output;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// serializes to a string
|
||||||
|
template <class T>
|
||||||
|
std::string serializeToString(const T& input) {
|
||||||
|
std::ostringstream out_archive_stream;
|
||||||
|
serializeToStream(input, out_archive_stream);
|
||||||
|
return out_archive_stream.str();
|
||||||
|
}
|
||||||
|
|
||||||
|
/// deserializes from a string
|
||||||
|
template <class T>
|
||||||
|
void deserializeFromString(const std::string& serialized, T& output) {
|
||||||
|
std::istringstream in_archive_stream(serialized);
|
||||||
|
deserializeFromStream(in_archive_stream, output);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// serializes to a file
|
||||||
template <class T>
|
template <class T>
|
||||||
bool serializeToFile(const T& input, const std::string& filename) {
|
bool serializeToFile(const T& input, const std::string& filename) {
|
||||||
std::ofstream out_archive_stream(filename.c_str());
|
std::ofstream out_archive_stream(filename.c_str());
|
||||||
if (!out_archive_stream.is_open())
|
if (!out_archive_stream.is_open()) return false;
|
||||||
return false;
|
serializeToStream(input, out_archive_stream);
|
||||||
boost::archive::text_oarchive out_archive(out_archive_stream);
|
|
||||||
out_archive << input;
|
|
||||||
out_archive_stream.close();
|
out_archive_stream.close();
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// deserializes from a file
|
||||||
template <class T>
|
template <class T>
|
||||||
bool deserializeFromFile(const std::string& filename, T& output) {
|
bool deserializeFromFile(const std::string& filename, T& output) {
|
||||||
std::ifstream in_archive_stream(filename.c_str());
|
std::ifstream in_archive_stream(filename.c_str());
|
||||||
if (!in_archive_stream.is_open())
|
if (!in_archive_stream.is_open()) return false;
|
||||||
return false;
|
deserializeFromStream(in_archive_stream, output);
|
||||||
boost::archive::text_iarchive in_archive(in_archive_stream);
|
|
||||||
in_archive >> output;
|
|
||||||
in_archive_stream.close();
|
in_archive_stream.close();
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
|
|
||||||
// Serialization to XML format with named structures
|
/// serializes to a string
|
||||||
template <class T>
|
template <class T>
|
||||||
std::string serializeXML(const T& input, const std::string& name="data") {
|
std::string serialize(const T& input) {
|
||||||
std::ostringstream out_archive_stream;
|
return serializeToString(input);
|
||||||
// braces to flush out_archive as it goes out of scope before taking str()
|
}
|
||||||
// fixes crash with boost 1.66-1.68
|
|
||||||
// see https://github.com/boostorg/serialization/issues/82
|
/// deserializes from a string
|
||||||
{
|
template <class T>
|
||||||
|
void deserialize(const std::string& serialized, T& output) {
|
||||||
|
deserializeFromString(serialized, output);
|
||||||
|
}
|
||||||
|
///@}
|
||||||
|
|
||||||
|
/** @name XML Serialization
|
||||||
|
* Serialization to XML format with named structures
|
||||||
|
*/
|
||||||
|
///@{
|
||||||
|
/// serializes to a stream in XML
|
||||||
|
template <class T>
|
||||||
|
void serializeToXMLStream(const T& input, std::ostream& out_archive_stream,
|
||||||
|
const std::string& name = "data") {
|
||||||
boost::archive::xml_oarchive out_archive(out_archive_stream);
|
boost::archive::xml_oarchive out_archive(out_archive_stream);
|
||||||
out_archive << boost::serialization::make_nvp(name.c_str(), input);
|
out_archive << boost::serialization::make_nvp(name.c_str(), input);
|
||||||
}
|
}
|
||||||
return out_archive_stream.str();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
/// deserializes from a stream in XML
|
||||||
template <class T>
|
template <class T>
|
||||||
void deserializeXML(const std::string& serialized, T& output, const std::string& name="data") {
|
void deserializeFromXMLStream(std::istream& in_archive_stream, T& output,
|
||||||
std::istringstream in_archive_stream(serialized);
|
const std::string& name = "data") {
|
||||||
boost::archive::xml_iarchive in_archive(in_archive_stream);
|
boost::archive::xml_iarchive in_archive(in_archive_stream);
|
||||||
in_archive >> boost::serialization::make_nvp(name.c_str(), output);
|
in_archive >> boost::serialization::make_nvp(name.c_str(), output);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// serializes to a string in XML
|
||||||
template <class T>
|
template <class T>
|
||||||
bool serializeToXMLFile(const T& input, const std::string& filename, const std::string& name="data") {
|
std::string serializeToXMLString(const T& input,
|
||||||
std::ofstream out_archive_stream(filename.c_str());
|
const std::string& name = "data") {
|
||||||
if (!out_archive_stream.is_open())
|
|
||||||
return false;
|
|
||||||
boost::archive::xml_oarchive out_archive(out_archive_stream);
|
|
||||||
out_archive << boost::serialization::make_nvp(name.c_str(), input);;
|
|
||||||
out_archive_stream.close();
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
template<class T>
|
|
||||||
bool deserializeFromXMLFile(const std::string& filename, T& output, const std::string& name="data") {
|
|
||||||
std::ifstream in_archive_stream(filename.c_str());
|
|
||||||
if (!in_archive_stream.is_open())
|
|
||||||
return false;
|
|
||||||
boost::archive::xml_iarchive in_archive(in_archive_stream);
|
|
||||||
in_archive >> boost::serialization::make_nvp(name.c_str(), output);
|
|
||||||
in_archive_stream.close();
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Serialization to binary format with named structures
|
|
||||||
template<class T>
|
|
||||||
std::string serializeBinary(const T& input, const std::string& name="data") {
|
|
||||||
std::ostringstream out_archive_stream;
|
std::ostringstream out_archive_stream;
|
||||||
boost::archive::binary_oarchive out_archive(out_archive_stream);
|
serializeToXMLStream(input, out_archive_stream, name);
|
||||||
out_archive << boost::serialization::make_nvp(name.c_str(), input);
|
|
||||||
return out_archive_stream.str();
|
return out_archive_stream.str();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// deserializes from a string in XML
|
||||||
template <class T>
|
template <class T>
|
||||||
void deserializeBinary(const std::string& serialized, T& output, const std::string& name="data") {
|
void deserializeFromXMLString(const std::string& serialized, T& output,
|
||||||
|
const std::string& name = "data") {
|
||||||
std::istringstream in_archive_stream(serialized);
|
std::istringstream in_archive_stream(serialized);
|
||||||
boost::archive::binary_iarchive in_archive(in_archive_stream);
|
deserializeFromXMLStream(in_archive_stream, output, name);
|
||||||
in_archive >> boost::serialization::make_nvp(name.c_str(), output);
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// serializes to an XML file
|
||||||
template <class T>
|
template <class T>
|
||||||
bool serializeToBinaryFile(const T& input, const std::string& filename, const std::string& name="data") {
|
bool serializeToXMLFile(const T& input, const std::string& filename,
|
||||||
|
const std::string& name = "data") {
|
||||||
std::ofstream out_archive_stream(filename.c_str());
|
std::ofstream out_archive_stream(filename.c_str());
|
||||||
if (!out_archive_stream.is_open())
|
if (!out_archive_stream.is_open()) return false;
|
||||||
return false;
|
serializeToXMLStream(input, out_archive_stream, name);
|
||||||
boost::archive::binary_oarchive out_archive(out_archive_stream);
|
|
||||||
out_archive << boost::serialization::make_nvp(name.c_str(), input);
|
|
||||||
out_archive_stream.close();
|
out_archive_stream.close();
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// deserializes from an XML file
|
||||||
template <class T>
|
template <class T>
|
||||||
bool deserializeFromBinaryFile(const std::string& filename, T& output, const std::string& name="data") {
|
bool deserializeFromXMLFile(const std::string& filename, T& output,
|
||||||
|
const std::string& name = "data") {
|
||||||
std::ifstream in_archive_stream(filename.c_str());
|
std::ifstream in_archive_stream(filename.c_str());
|
||||||
if (!in_archive_stream.is_open())
|
if (!in_archive_stream.is_open()) return false;
|
||||||
return false;
|
deserializeFromXMLStream(in_archive_stream, output, name);
|
||||||
boost::archive::binary_iarchive in_archive(in_archive_stream);
|
|
||||||
in_archive >> boost::serialization::make_nvp(name.c_str(), output);
|
|
||||||
in_archive_stream.close();
|
in_archive_stream.close();
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
|
|
||||||
} // \namespace gtsam
|
/// serializes to a string in XML
|
||||||
|
template <class T>
|
||||||
|
std::string serializeXML(const T& input,
|
||||||
|
const std::string& name = "data") {
|
||||||
|
return serializeToXMLString(input, name);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// deserializes from a string in XML
|
||||||
|
template <class T>
|
||||||
|
void deserializeXML(const std::string& serialized, T& output,
|
||||||
|
const std::string& name = "data") {
|
||||||
|
deserializeFromXMLString(serialized, output, name);
|
||||||
|
}
|
||||||
|
///@}
|
||||||
|
|
||||||
|
/** @name Binary Serialization
|
||||||
|
* Serialization to binary format with named structures
|
||||||
|
*/
|
||||||
|
///@{
|
||||||
|
/// serializes to a stream in binary
|
||||||
|
template <class T>
|
||||||
|
void serializeToBinaryStream(const T& input, std::ostream& out_archive_stream,
|
||||||
|
const std::string& name = "data") {
|
||||||
|
boost::archive::binary_oarchive out_archive(out_archive_stream);
|
||||||
|
out_archive << boost::serialization::make_nvp(name.c_str(), input);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// deserializes from a stream in binary
|
||||||
|
template <class T>
|
||||||
|
void deserializeFromBinaryStream(std::istream& in_archive_stream, T& output,
|
||||||
|
const std::string& name = "data") {
|
||||||
|
boost::archive::binary_iarchive in_archive(in_archive_stream);
|
||||||
|
in_archive >> boost::serialization::make_nvp(name.c_str(), output);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// serializes to a string in binary
|
||||||
|
template <class T>
|
||||||
|
std::string serializeToBinaryString(const T& input,
|
||||||
|
const std::string& name = "data") {
|
||||||
|
std::ostringstream out_archive_stream;
|
||||||
|
serializeToBinaryStream(input, out_archive_stream, name);
|
||||||
|
return out_archive_stream.str();
|
||||||
|
}
|
||||||
|
|
||||||
|
/// deserializes from a string in binary
|
||||||
|
template <class T>
|
||||||
|
void deserializeFromBinaryString(const std::string& serialized, T& output,
|
||||||
|
const std::string& name = "data") {
|
||||||
|
std::istringstream in_archive_stream(serialized);
|
||||||
|
deserializeFromBinaryStream(in_archive_stream, output, name);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// serializes to a binary file
|
||||||
|
template <class T>
|
||||||
|
bool serializeToBinaryFile(const T& input, const std::string& filename,
|
||||||
|
const std::string& name = "data") {
|
||||||
|
std::ofstream out_archive_stream(filename.c_str());
|
||||||
|
if (!out_archive_stream.is_open()) return false;
|
||||||
|
serializeToBinaryStream(input, out_archive_stream, name);
|
||||||
|
out_archive_stream.close();
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// deserializes from a binary file
|
||||||
|
template <class T>
|
||||||
|
bool deserializeFromBinaryFile(const std::string& filename, T& output,
|
||||||
|
const std::string& name = "data") {
|
||||||
|
std::ifstream in_archive_stream(filename.c_str());
|
||||||
|
if (!in_archive_stream.is_open()) return false;
|
||||||
|
deserializeFromBinaryStream(in_archive_stream, output, name);
|
||||||
|
in_archive_stream.close();
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// serializes to a string in binary
|
||||||
|
template <class T>
|
||||||
|
std::string serializeBinary(const T& input,
|
||||||
|
const std::string& name = "data") {
|
||||||
|
return serializeToBinaryString(input, name);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// deserializes from a string in binary
|
||||||
|
template <class T>
|
||||||
|
void deserializeBinary(const std::string& serialized, T& output,
|
||||||
|
const std::string& name = "data") {
|
||||||
|
deserializeFromBinaryString(serialized, output, name);
|
||||||
|
}
|
||||||
|
///@}
|
||||||
|
|
||||||
|
} // namespace gtsam
|
||||||
|
|
|
||||||
|
|
@ -26,6 +26,7 @@
|
||||||
#include <gtsam/base/serialization.h>
|
#include <gtsam/base/serialization.h>
|
||||||
|
|
||||||
#include <boost/serialization/serialization.hpp>
|
#include <boost/serialization/serialization.hpp>
|
||||||
|
#include <boost/filesystem.hpp>
|
||||||
|
|
||||||
|
|
||||||
// whether to print the serialized text to stdout
|
// whether to print the serialized text to stdout
|
||||||
|
|
@ -40,22 +41,37 @@ T create() {
|
||||||
return T();
|
return T();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Creates or empties a folder in the build folder and returns the relative path
|
||||||
|
boost::filesystem::path resetFilesystem(
|
||||||
|
boost::filesystem::path folder = "actual") {
|
||||||
|
boost::filesystem::remove_all(folder);
|
||||||
|
boost::filesystem::create_directory(folder);
|
||||||
|
return folder;
|
||||||
|
}
|
||||||
|
|
||||||
// Templated round-trip serialization
|
// Templated round-trip serialization
|
||||||
template<class T>
|
template<class T>
|
||||||
void roundtrip(const T& input, T& output) {
|
void roundtrip(const T& input, T& output) {
|
||||||
// Serialize
|
|
||||||
std::string serialized = serialize(input);
|
std::string serialized = serialize(input);
|
||||||
if (verbose) std::cout << serialized << std::endl << std::endl;
|
if (verbose) std::cout << serialized << std::endl << std::endl;
|
||||||
|
|
||||||
deserialize(serialized, output);
|
deserialize(serialized, output);
|
||||||
}
|
}
|
||||||
|
|
||||||
// This version requires equality operator
|
// Templated round-trip serialization using a file
|
||||||
|
template<class T>
|
||||||
|
void roundtripFile(const T& input, T& output) {
|
||||||
|
boost::filesystem::path path = resetFilesystem()/"graph.dat";
|
||||||
|
serializeToFile(input, path.string());
|
||||||
|
deserializeFromFile(path.string(), output);
|
||||||
|
}
|
||||||
|
|
||||||
|
// This version requires equality operator and uses string and file round-trips
|
||||||
template<class T>
|
template<class T>
|
||||||
bool equality(const T& input = T()) {
|
bool equality(const T& input = T()) {
|
||||||
T output = create<T>();
|
T output = create<T>(), outputf = create<T>();
|
||||||
roundtrip<T>(input,output);
|
roundtrip<T>(input,output);
|
||||||
return input==output;
|
roundtripFile<T>(input,outputf);
|
||||||
|
return (input==output) && (input==outputf);
|
||||||
}
|
}
|
||||||
|
|
||||||
// This version requires Testable
|
// This version requires Testable
|
||||||
|
|
@ -77,20 +93,26 @@ bool equalsDereferenced(const T& input) {
|
||||||
// Templated round-trip serialization using XML
|
// Templated round-trip serialization using XML
|
||||||
template<class T>
|
template<class T>
|
||||||
void roundtripXML(const T& input, T& output) {
|
void roundtripXML(const T& input, T& output) {
|
||||||
// Serialize
|
|
||||||
std::string serialized = serializeXML<T>(input);
|
std::string serialized = serializeXML<T>(input);
|
||||||
if (verbose) std::cout << serialized << std::endl << std::endl;
|
if (verbose) std::cout << serialized << std::endl << std::endl;
|
||||||
|
|
||||||
// De-serialize
|
|
||||||
deserializeXML(serialized, output);
|
deserializeXML(serialized, output);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Templated round-trip serialization using XML File
|
||||||
|
template<class T>
|
||||||
|
void roundtripXMLFile(const T& input, T& output) {
|
||||||
|
boost::filesystem::path path = resetFilesystem()/"graph.xml";
|
||||||
|
serializeToXMLFile(input, path.string());
|
||||||
|
deserializeFromXMLFile(path.string(), output);
|
||||||
|
}
|
||||||
|
|
||||||
// This version requires equality operator
|
// This version requires equality operator
|
||||||
template<class T>
|
template<class T>
|
||||||
bool equalityXML(const T& input = T()) {
|
bool equalityXML(const T& input = T()) {
|
||||||
T output = create<T>();
|
T output = create<T>(), outputf = create<T>();
|
||||||
roundtripXML<T>(input,output);
|
roundtripXML<T>(input,output);
|
||||||
return input==output;
|
roundtripXMLFile<T>(input,outputf);
|
||||||
|
return (input==output) && (input==outputf);
|
||||||
}
|
}
|
||||||
|
|
||||||
// This version requires Testable
|
// This version requires Testable
|
||||||
|
|
@ -112,20 +134,26 @@ bool equalsDereferencedXML(const T& input = T()) {
|
||||||
// Templated round-trip serialization using XML
|
// Templated round-trip serialization using XML
|
||||||
template<class T>
|
template<class T>
|
||||||
void roundtripBinary(const T& input, T& output) {
|
void roundtripBinary(const T& input, T& output) {
|
||||||
// Serialize
|
|
||||||
std::string serialized = serializeBinary<T>(input);
|
std::string serialized = serializeBinary<T>(input);
|
||||||
if (verbose) std::cout << serialized << std::endl << std::endl;
|
if (verbose) std::cout << serialized << std::endl << std::endl;
|
||||||
|
|
||||||
// De-serialize
|
|
||||||
deserializeBinary(serialized, output);
|
deserializeBinary(serialized, output);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Templated round-trip serialization using Binary file
|
||||||
|
template<class T>
|
||||||
|
void roundtripBinaryFile(const T& input, T& output) {
|
||||||
|
boost::filesystem::path path = resetFilesystem()/"graph.bin";
|
||||||
|
serializeToBinaryFile(input, path.string());
|
||||||
|
deserializeFromBinaryFile(path.string(), output);
|
||||||
|
}
|
||||||
|
|
||||||
// This version requires equality operator
|
// This version requires equality operator
|
||||||
template<class T>
|
template<class T>
|
||||||
bool equalityBinary(const T& input = T()) {
|
bool equalityBinary(const T& input = T()) {
|
||||||
T output = create<T>();
|
T output = create<T>(), outputf = create<T>();
|
||||||
roundtripBinary<T>(input,output);
|
roundtripBinary<T>(input,output);
|
||||||
return input==output;
|
roundtripBinaryFile<T>(input,outputf);
|
||||||
|
return (input==output) && (input==outputf);
|
||||||
}
|
}
|
||||||
|
|
||||||
// This version requires Testable
|
// This version requires Testable
|
||||||
|
|
|
||||||
|
|
@ -230,3 +230,50 @@ namespace std {
|
||||||
#ifdef ERROR
|
#ifdef ERROR
|
||||||
#undef ERROR
|
#undef ERROR
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
|
namespace gtsam {
|
||||||
|
|
||||||
|
/// Convenience void_t as we assume C++11, it will not conflict the std one in C++17 as this is in `gtsam::`
|
||||||
|
template<typename ...> using void_t = void;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A SFINAE trait to mark classes that need special alignment.
|
||||||
|
*
|
||||||
|
* This is required to make boost::make_shared and etc respect alignment, which is essential for the Python
|
||||||
|
* wrappers to work properly.
|
||||||
|
*
|
||||||
|
* Explanation
|
||||||
|
* =============
|
||||||
|
* When a GTSAM type is not declared with the type alias `_eigen_aligned_allocator_trait = void`, the first template
|
||||||
|
* will be taken so `needs_eigen_aligned_allocator` will be resolved to `std::false_type`.
|
||||||
|
*
|
||||||
|
* Otherwise, it will resolve to the second template, which will be resolved to `std::true_type`.
|
||||||
|
*
|
||||||
|
* Please refer to `gtsam/base/make_shared.h` for an example.
|
||||||
|
*/
|
||||||
|
template<typename, typename = void_t<>>
|
||||||
|
struct needs_eigen_aligned_allocator : std::false_type {
|
||||||
|
};
|
||||||
|
template<typename T>
|
||||||
|
struct needs_eigen_aligned_allocator<T, void_t<typename T::_eigen_aligned_allocator_trait>> : std::true_type {
|
||||||
|
};
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* This marks a GTSAM object to require alignment. With this macro an object will automatically be allocated in aligned
|
||||||
|
* memory when one uses `gtsam::make_shared`. It reduces future misalignment problems that is hard to debug.
|
||||||
|
* See https://eigen.tuxfamily.org/dox/group__DenseMatrixManipulation__Alignement.html for detailed explanation.
|
||||||
|
*/
|
||||||
|
#define GTSAM_MAKE_ALIGNED_OPERATOR_NEW \
|
||||||
|
EIGEN_MAKE_ALIGNED_OPERATOR_NEW \
|
||||||
|
using _eigen_aligned_allocator_trait = void;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* This marks a GTSAM object to require alignment. With this macro an object will automatically be allocated in aligned
|
||||||
|
* memory when one uses `gtsam::make_shared`. It reduces future misalignment problems that is hard to debug.
|
||||||
|
* See https://eigen.tuxfamily.org/dox/group__DenseMatrixManipulation__Alignement.html for detailed explanation.
|
||||||
|
*/
|
||||||
|
#define GTSAM_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign) \
|
||||||
|
EIGEN_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign) \
|
||||||
|
using _eigen_aligned_allocator_trait = void;
|
||||||
|
|
|
||||||
|
|
@ -162,7 +162,7 @@ private:
|
||||||
NeedsToAlign = (sizeof(B) % 16) == 0 || (sizeof(R) % 16) == 0
|
NeedsToAlign = (sizeof(B) % 16) == 0 || (sizeof(R) % 16) == 0
|
||||||
};
|
};
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
||||||
};
|
};
|
||||||
|
|
||||||
// Declare this to be both Testable and a Manifold
|
// Declare this to be both Testable and a Manifold
|
||||||
|
|
|
||||||
|
|
@ -24,7 +24,7 @@
|
||||||
namespace gtsam {
|
namespace gtsam {
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
Cal3Fisheye::Cal3Fisheye(const Vector& v)
|
Cal3Fisheye::Cal3Fisheye(const Vector9& v)
|
||||||
: fx_(v[0]),
|
: fx_(v[0]),
|
||||||
fy_(v[1]),
|
fy_(v[1]),
|
||||||
s_(v[2]),
|
s_(v[2]),
|
||||||
|
|
@ -50,76 +50,73 @@ Matrix3 Cal3Fisheye::K() const {
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
static Matrix29 D2dcalibration(const double xd, const double yd,
|
double Cal3Fisheye::Scaling(double r) {
|
||||||
const double xi, const double yi,
|
static constexpr double threshold = 1e-8;
|
||||||
const double t3, const double t5,
|
if (r > threshold || r < -threshold) {
|
||||||
const double t7, const double t9, const double r,
|
return atan(r) / r;
|
||||||
Matrix2& DK) {
|
} else {
|
||||||
// order: fx, fy, s, u0, v0
|
// Taylor expansion close to 0
|
||||||
Matrix25 DR1;
|
double r2 = r * r, r4 = r2 * r2;
|
||||||
DR1 << xd, 0.0, yd, 1.0, 0.0, 0.0, yd, 0.0, 0.0, 1.0;
|
return 1.0 - r2 / 3 + r4 / 5;
|
||||||
|
|
||||||
// order: k1, k2, k3, k4
|
|
||||||
Matrix24 DR2;
|
|
||||||
DR2 << t3 * xi, t5 * xi, t7 * xi, t9 * xi, t3 * yi, t5 * yi, t7 * yi, t9 * yi;
|
|
||||||
DR2 /= r;
|
|
||||||
Matrix29 D;
|
|
||||||
D << DR1, DK * DR2;
|
|
||||||
return D;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
|
||||||
static Matrix2 D2dintrinsic(const double xi, const double yi, const double r,
|
|
||||||
const double td, const double t, const double tt,
|
|
||||||
const double t4, const double t6, const double t8,
|
|
||||||
const double k1, const double k2, const double k3,
|
|
||||||
const double k4, const Matrix2& DK) {
|
|
||||||
const double dr_dxi = xi / sqrt(xi * xi + yi * yi);
|
|
||||||
const double dr_dyi = yi / sqrt(xi * xi + yi * yi);
|
|
||||||
const double dt_dr = 1 / (1 + r * r);
|
|
||||||
const double dtd_dt =
|
|
||||||
1 + 3 * k1 * tt + 5 * k2 * t4 + 7 * k3 * t6 + 9 * k4 * t8;
|
|
||||||
const double dtd_dxi = dtd_dt * dt_dr * dr_dxi;
|
|
||||||
const double dtd_dyi = dtd_dt * dt_dr * dr_dyi;
|
|
||||||
|
|
||||||
const double rinv = 1 / r;
|
|
||||||
const double rrinv = 1 / (r * r);
|
|
||||||
const double dxd_dxi =
|
|
||||||
dtd_dxi * xi * rinv + td * rinv + td * xi * (-rrinv) * dr_dxi;
|
|
||||||
const double dxd_dyi = dtd_dyi * xi * rinv - td * xi * rrinv * dr_dyi;
|
|
||||||
const double dyd_dxi = dtd_dxi * yi * rinv - td * yi * rrinv * dr_dxi;
|
|
||||||
const double dyd_dyi =
|
|
||||||
dtd_dyi * yi * rinv + td * rinv + td * yi * (-rrinv) * dr_dyi;
|
|
||||||
|
|
||||||
Matrix2 DR;
|
|
||||||
DR << dxd_dxi, dxd_dyi, dyd_dxi, dyd_dyi;
|
|
||||||
|
|
||||||
return DK * DR;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
Point2 Cal3Fisheye::uncalibrate(const Point2& p, OptionalJacobian<2, 9> H1,
|
Point2 Cal3Fisheye::uncalibrate(const Point2& p, OptionalJacobian<2, 9> H1,
|
||||||
OptionalJacobian<2, 2> H2) const {
|
OptionalJacobian<2, 2> H2) const {
|
||||||
const double xi = p.x(), yi = p.y();
|
const double xi = p.x(), yi = p.y();
|
||||||
const double r = sqrt(xi * xi + yi * yi);
|
const double r2 = xi * xi + yi * yi, r = sqrt(r2);
|
||||||
const double t = atan(r);
|
const double t = atan(r);
|
||||||
const double tt = t * t, t4 = tt * tt, t6 = tt * t4, t8 = t4 * t4;
|
const double t2 = t * t, t4 = t2 * t2, t6 = t2 * t4, t8 = t4 * t4;
|
||||||
const double td = t * (1 + k1_ * tt + k2_ * t4 + k3_ * t6 + k4_ * t8);
|
Vector5 K, T;
|
||||||
const double td_o_r = r > 1e-8 ? td / r : 1;
|
K << 1, k1_, k2_, k3_, k4_;
|
||||||
const double xd = td_o_r * xi, yd = td_o_r * yi;
|
T << 1, t2, t4, t6, t8;
|
||||||
|
const double scaling = Scaling(r);
|
||||||
|
const double s = scaling * K.dot(T);
|
||||||
|
const double xd = s * xi, yd = s * yi;
|
||||||
Point2 uv(fx_ * xd + s_ * yd + u0_, fy_ * yd + v0_);
|
Point2 uv(fx_ * xd + s_ * yd + u0_, fy_ * yd + v0_);
|
||||||
|
|
||||||
Matrix2 DK;
|
Matrix2 DK;
|
||||||
if (H1 || H2) DK << fx_, s_, 0.0, fy_;
|
if (H1 || H2) DK << fx_, s_, 0.0, fy_;
|
||||||
|
|
||||||
// Derivative for calibration parameters (2 by 9)
|
// Derivative for calibration parameters (2 by 9)
|
||||||
if (H1)
|
if (H1) {
|
||||||
*H1 = D2dcalibration(xd, yd, xi, yi, t * tt, t * t4, t * t6, t * t8, r, DK);
|
Matrix25 DR1;
|
||||||
|
// order: fx, fy, s, u0, v0
|
||||||
|
DR1 << xd, 0.0, yd, 1.0, 0.0, 0.0, yd, 0.0, 0.0, 1.0;
|
||||||
|
|
||||||
|
// order: k1, k2, k3, k4
|
||||||
|
Matrix24 DR2;
|
||||||
|
auto T4 = T.tail<4>().transpose();
|
||||||
|
DR2 << xi * T4, yi * T4;
|
||||||
|
*H1 << DR1, DK * scaling * DR2;
|
||||||
|
}
|
||||||
|
|
||||||
// Derivative for points in intrinsic coords (2 by 2)
|
// Derivative for points in intrinsic coords (2 by 2)
|
||||||
if (H2)
|
if (H2) {
|
||||||
*H2 =
|
const double dtd_dt =
|
||||||
D2dintrinsic(xi, yi, r, td, t, tt, t4, t6, t8, k1_, k2_, k3_, k4_, DK);
|
1 + 3 * k1_ * t2 + 5 * k2_ * t4 + 7 * k3_ * t6 + 9 * k4_ * t8;
|
||||||
|
const double dt_dr = 1 / (1 + r2);
|
||||||
|
const double rinv = 1 / r;
|
||||||
|
const double dr_dxi = xi * rinv;
|
||||||
|
const double dr_dyi = yi * rinv;
|
||||||
|
const double dtd_dxi = dtd_dt * dt_dr * dr_dxi;
|
||||||
|
const double dtd_dyi = dtd_dt * dt_dr * dr_dyi;
|
||||||
|
|
||||||
|
const double td = t * K.dot(T);
|
||||||
|
const double rrinv = 1 / r2;
|
||||||
|
const double dxd_dxi =
|
||||||
|
dtd_dxi * dr_dxi + td * rinv - td * xi * rrinv * dr_dxi;
|
||||||
|
const double dxd_dyi = dtd_dyi * dr_dxi - td * xi * rrinv * dr_dyi;
|
||||||
|
const double dyd_dxi = dtd_dxi * dr_dyi - td * yi * rrinv * dr_dxi;
|
||||||
|
const double dyd_dyi =
|
||||||
|
dtd_dyi * dr_dyi + td * rinv - td * yi * rrinv * dr_dyi;
|
||||||
|
|
||||||
|
Matrix2 DR;
|
||||||
|
DR << dxd_dxi, dxd_dyi, dyd_dxi, dyd_dyi;
|
||||||
|
|
||||||
|
*H2 = DK * DR;
|
||||||
|
}
|
||||||
|
|
||||||
return uv;
|
return uv;
|
||||||
}
|
}
|
||||||
|
|
@ -157,39 +154,10 @@ Point2 Cal3Fisheye::calibrate(const Point2& uv, const double tol) const {
|
||||||
return pi;
|
return pi;
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
|
||||||
Matrix2 Cal3Fisheye::D2d_intrinsic(const Point2& p) const {
|
|
||||||
const double xi = p.x(), yi = p.y();
|
|
||||||
const double r = sqrt(xi * xi + yi * yi);
|
|
||||||
const double t = atan(r);
|
|
||||||
const double tt = t * t, t4 = tt * tt, t6 = t4 * tt, t8 = t4 * t4;
|
|
||||||
const double td = t * (1 + k1_ * tt + k2_ * t4 + k3_ * t6 + k4_ * t8);
|
|
||||||
|
|
||||||
Matrix2 DK;
|
|
||||||
DK << fx_, s_, 0.0, fy_;
|
|
||||||
|
|
||||||
return D2dintrinsic(xi, yi, r, td, t, tt, t4, t6, t8, k1_, k2_, k3_, k4_, DK);
|
|
||||||
}
|
|
||||||
|
|
||||||
/* ************************************************************************* */
|
|
||||||
Matrix29 Cal3Fisheye::D2d_calibration(const Point2& p) const {
|
|
||||||
const double xi = p.x(), yi = p.y();
|
|
||||||
const double r = sqrt(xi * xi + yi * yi);
|
|
||||||
const double t = atan(r);
|
|
||||||
const double tt = t * t, t4 = tt * tt, t6 = tt * t4, t8 = t4 * t4;
|
|
||||||
const double td = t * (1 + k1_ * tt + k2_ * t4 + k3_ * t6 + k4_ * t8);
|
|
||||||
const double xd = td / r * xi, yd = td / r * yi;
|
|
||||||
|
|
||||||
Matrix2 DK;
|
|
||||||
DK << fx_, s_, 0.0, fy_;
|
|
||||||
return D2dcalibration(xd, yd, xi, yi, t * tt, t * t4, t * t6, t * t8, r, DK);
|
|
||||||
}
|
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
void Cal3Fisheye::print(const std::string& s_) const {
|
void Cal3Fisheye::print(const std::string& s_) const {
|
||||||
gtsam::print((Matrix)K(), s_ + ".K");
|
gtsam::print((Matrix)K(), s_ + ".K");
|
||||||
gtsam::print(Vector(k()), s_ + ".k");
|
gtsam::print(Vector(k()), s_ + ".k");
|
||||||
;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
|
|
|
||||||
|
|
@ -20,6 +20,8 @@
|
||||||
|
|
||||||
#include <gtsam/geometry/Point2.h>
|
#include <gtsam/geometry/Point2.h>
|
||||||
|
|
||||||
|
#include <string>
|
||||||
|
|
||||||
namespace gtsam {
|
namespace gtsam {
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|
@ -43,7 +45,7 @@ namespace gtsam {
|
||||||
* [u; v; 1] = K*[x_d; y_d; 1]
|
* [u; v; 1] = K*[x_d; y_d; 1]
|
||||||
*/
|
*/
|
||||||
class GTSAM_EXPORT Cal3Fisheye {
|
class GTSAM_EXPORT Cal3Fisheye {
|
||||||
protected:
|
private:
|
||||||
double fx_, fy_, s_, u0_, v0_; // focal length, skew and principal point
|
double fx_, fy_, s_, u0_, v0_; // focal length, skew and principal point
|
||||||
double k1_, k2_, k3_, k4_; // fisheye distortion coefficients
|
double k1_, k2_, k3_, k4_; // fisheye distortion coefficients
|
||||||
|
|
||||||
|
|
@ -78,7 +80,7 @@ class GTSAM_EXPORT Cal3Fisheye {
|
||||||
/// @name Advanced Constructors
|
/// @name Advanced Constructors
|
||||||
/// @{
|
/// @{
|
||||||
|
|
||||||
Cal3Fisheye(const Vector& v);
|
explicit Cal3Fisheye(const Vector9& v);
|
||||||
|
|
||||||
/// @}
|
/// @}
|
||||||
/// @name Standard Interface
|
/// @name Standard Interface
|
||||||
|
|
@ -120,6 +122,9 @@ class GTSAM_EXPORT Cal3Fisheye {
|
||||||
/// Return all parameters as a vector
|
/// Return all parameters as a vector
|
||||||
Vector9 vector() const;
|
Vector9 vector() const;
|
||||||
|
|
||||||
|
/// Helper function that calculates atan(r)/r
|
||||||
|
static double Scaling(double r);
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* @brief convert intrinsic coordinates [x_i; y_i] to (distorted) image
|
* @brief convert intrinsic coordinates [x_i; y_i] to (distorted) image
|
||||||
* coordinates [u; v]
|
* coordinates [u; v]
|
||||||
|
|
@ -136,13 +141,6 @@ class GTSAM_EXPORT Cal3Fisheye {
|
||||||
/// y_i]
|
/// y_i]
|
||||||
Point2 calibrate(const Point2& p, const double tol = 1e-5) const;
|
Point2 calibrate(const Point2& p, const double tol = 1e-5) const;
|
||||||
|
|
||||||
/// Derivative of uncalibrate wrpt intrinsic coordinates [x_i; y_i]
|
|
||||||
Matrix2 D2d_intrinsic(const Point2& p) const;
|
|
||||||
|
|
||||||
/// Derivative of uncalibrate wrpt the calibration parameters
|
|
||||||
/// [fx, fy, s, u0, v0, k1, k2, k3, k4]
|
|
||||||
Matrix29 D2d_calibration(const Point2& p) const;
|
|
||||||
|
|
||||||
/// @}
|
/// @}
|
||||||
/// @name Testable
|
/// @name Testable
|
||||||
/// @{
|
/// @{
|
||||||
|
|
|
||||||
|
|
@ -319,7 +319,7 @@ private:
|
||||||
}
|
}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
|
|
||||||
template<class CAMERA>
|
template<class CAMERA>
|
||||||
|
|
|
||||||
|
|
@ -212,7 +212,7 @@ class EssentialMatrix {
|
||||||
/// @}
|
/// @}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
|
|
||||||
template<>
|
template<>
|
||||||
|
|
|
||||||
|
|
@ -325,7 +325,7 @@ private:
|
||||||
}
|
}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
|
|
||||||
// manifold traits
|
// manifold traits
|
||||||
|
|
|
||||||
|
|
@ -222,7 +222,7 @@ private:
|
||||||
}
|
}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
// end of class PinholeBaseK
|
// end of class PinholeBaseK
|
||||||
|
|
||||||
|
|
@ -425,7 +425,7 @@ private:
|
||||||
}
|
}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
// end of class PinholePose
|
// end of class PinholePose
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -317,7 +317,7 @@ public:
|
||||||
|
|
||||||
public:
|
public:
|
||||||
// Align for Point2, which is either derived from, or is typedef, of Vector2
|
// Align for Point2, which is either derived from, or is typedef, of Vector2
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
}; // Pose2
|
}; // Pose2
|
||||||
|
|
||||||
/** specialization for pose2 wedge function (generic template in Lie.h) */
|
/** specialization for pose2 wedge function (generic template in Lie.h) */
|
||||||
|
|
|
||||||
|
|
@ -355,7 +355,7 @@ public:
|
||||||
#ifdef GTSAM_USE_QUATERNIONS
|
#ifdef GTSAM_USE_QUATERNIONS
|
||||||
// Align if we are using Quaternions
|
// Align if we are using Quaternions
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
#endif
|
#endif
|
||||||
};
|
};
|
||||||
// Pose3 class
|
// Pose3 class
|
||||||
|
|
|
||||||
|
|
@ -544,7 +544,7 @@ namespace gtsam {
|
||||||
#ifdef GTSAM_USE_QUATERNIONS
|
#ifdef GTSAM_USE_QUATERNIONS
|
||||||
// only align if quaternion, Matrix3 has no alignment requirements
|
// only align if quaternion, Matrix3 has no alignment requirements
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
#endif
|
#endif
|
||||||
};
|
};
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -20,8 +20,8 @@
|
||||||
|
|
||||||
#include <gtsam/base/Lie.h>
|
#include <gtsam/base/Lie.h>
|
||||||
#include <gtsam/base/Manifold.h>
|
#include <gtsam/base/Manifold.h>
|
||||||
|
#include <gtsam/base/make_shared.h>
|
||||||
#include <gtsam/dllexport.h>
|
#include <gtsam/dllexport.h>
|
||||||
|
|
||||||
#include <Eigen/Core>
|
#include <Eigen/Core>
|
||||||
|
|
||||||
#include <iostream> // TODO(frank): how to avoid?
|
#include <iostream> // TODO(frank): how to avoid?
|
||||||
|
|
@ -54,7 +54,7 @@ class SO : public LieGroup<SO<N>, internal::DimensionSO(N)> {
|
||||||
using VectorN2 = Eigen::Matrix<double, internal::NSquaredSO(N), 1>;
|
using VectorN2 = Eigen::Matrix<double, internal::NSquaredSO(N), 1>;
|
||||||
using MatrixDD = Eigen::Matrix<double, dimension, dimension>;
|
using MatrixDD = Eigen::Matrix<double, dimension, dimension>;
|
||||||
|
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW_IF(true)
|
||||||
|
|
||||||
protected:
|
protected:
|
||||||
MatrixNN matrix_; ///< Rotation matrix
|
MatrixNN matrix_; ///< Rotation matrix
|
||||||
|
|
|
||||||
|
|
@ -214,7 +214,7 @@ private:
|
||||||
/// @}
|
/// @}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
|
|
||||||
// Define GTSAM traits
|
// Define GTSAM traits
|
||||||
|
|
|
||||||
|
|
@ -10,17 +10,18 @@
|
||||||
* -------------------------------------------------------------------------- */
|
* -------------------------------------------------------------------------- */
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* @file testCal3Fisheye.cpp
|
* @file testCal3DFisheye.cpp
|
||||||
* @brief Unit tests for fisheye calibration class
|
* @brief Unit tests for fisheye calibration class
|
||||||
* @author ghaggin
|
* @author ghaggin
|
||||||
*/
|
*/
|
||||||
|
|
||||||
#include <CppUnitLite/TestHarness.h>
|
|
||||||
#include <gtsam/base/Testable.h>
|
#include <gtsam/base/Testable.h>
|
||||||
#include <gtsam/base/numericalDerivative.h>
|
#include <gtsam/base/numericalDerivative.h>
|
||||||
#include <gtsam/geometry/Cal3Fisheye.h>
|
#include <gtsam/geometry/Cal3Fisheye.h>
|
||||||
#include <gtsam/geometry/Point3.h>
|
#include <gtsam/geometry/Point3.h>
|
||||||
|
|
||||||
|
#include <CppUnitLite/TestHarness.h>
|
||||||
|
|
||||||
using namespace gtsam;
|
using namespace gtsam;
|
||||||
|
|
||||||
GTSAM_CONCEPT_TESTABLE_INST(Cal3Fisheye)
|
GTSAM_CONCEPT_TESTABLE_INST(Cal3Fisheye)
|
||||||
|
|
@ -30,12 +31,27 @@ static const double fx = 250, fy = 260, s = 0.1, u0 = 320, v0 = 240;
|
||||||
static Cal3Fisheye K(fx, fy, s, u0, v0, -0.013721808247486035,
|
static Cal3Fisheye K(fx, fy, s, u0, v0, -0.013721808247486035,
|
||||||
0.020727425669427896, -0.012786476702685545,
|
0.020727425669427896, -0.012786476702685545,
|
||||||
0.0025242267320687625);
|
0.0025242267320687625);
|
||||||
static Point2 p(2, 3);
|
static Point2 kTestPoint2(2, 3);
|
||||||
|
|
||||||
|
/* ************************************************************************* */
|
||||||
|
TEST(Cal3Fisheye, assert_equal) { CHECK(assert_equal(K, K, 1e-5)); }
|
||||||
|
|
||||||
|
/* ************************************************************************* */
|
||||||
|
TEST(Cal3Fisheye, retract) {
|
||||||
|
Cal3Fisheye expected(K.fx() + 1, K.fy() + 2, K.skew() + 3, K.px() + 4,
|
||||||
|
K.py() + 5, K.k1() + 6, K.k2() + 7, K.k3() + 8,
|
||||||
|
K.k4() + 9);
|
||||||
|
Vector d(9);
|
||||||
|
d << 1, 2, 3, 4, 5, 6, 7, 8, 9;
|
||||||
|
Cal3Fisheye actual = K.retract(d);
|
||||||
|
CHECK(assert_equal(expected, actual, 1e-7));
|
||||||
|
CHECK(assert_equal(d, K.localCoordinates(actual), 1e-7));
|
||||||
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
TEST(Cal3Fisheye, uncalibrate1) {
|
TEST(Cal3Fisheye, uncalibrate1) {
|
||||||
// Calculate the solution
|
// Calculate the solution
|
||||||
const double xi = p.x(), yi = p.y();
|
const double xi = kTestPoint2.x(), yi = kTestPoint2.y();
|
||||||
const double r = sqrt(xi * xi + yi * yi);
|
const double r = sqrt(xi * xi + yi * yi);
|
||||||
const double t = atan(r);
|
const double t = atan(r);
|
||||||
const double tt = t * t, t4 = tt * tt, t6 = tt * t4, t8 = t4 * t4;
|
const double tt = t * t, t4 = tt * tt, t6 = tt * t4, t8 = t4 * t4;
|
||||||
|
|
@ -46,32 +62,42 @@ TEST(Cal3Fisheye, uncalibrate1) {
|
||||||
|
|
||||||
Point2 uv_sol(v[0] / v[2], v[1] / v[2]);
|
Point2 uv_sol(v[0] / v[2], v[1] / v[2]);
|
||||||
|
|
||||||
Point2 uv = K.uncalibrate(p);
|
Point2 uv = K.uncalibrate(kTestPoint2);
|
||||||
CHECK(assert_equal(uv, uv_sol));
|
CHECK(assert_equal(uv, uv_sol));
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
/**
|
// For numerical derivatives
|
||||||
* Check that a point at (0,0) projects to the
|
Point2 f(const Cal3Fisheye& k, const Point2& pt) { return k.uncalibrate(pt); }
|
||||||
* image center.
|
|
||||||
*/
|
/* ************************************************************************* */
|
||||||
TEST(Cal3Fisheye, uncalibrate2) {
|
TEST(Cal3Fisheye, Derivatives) {
|
||||||
Point2 pz(0, 0);
|
Matrix H1, H2;
|
||||||
auto uv = K.uncalibrate(pz);
|
K.uncalibrate(kTestPoint2, H1, H2);
|
||||||
CHECK(assert_equal(uv, Point2(u0, v0)));
|
CHECK(assert_equal(numericalDerivative21(f, K, kTestPoint2, 1e-7), H1, 1e-5));
|
||||||
|
CHECK(assert_equal(numericalDerivative22(f, K, kTestPoint2, 1e-7), H2, 1e-5));
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
/**
|
// Check that a point at (0,0) projects to the image center.
|
||||||
* This test uses cv2::fisheye::projectPoints to test that uncalibrate
|
TEST(Cal3Fisheye, uncalibrate2) {
|
||||||
* properly projects a point into the image plane. One notable difference
|
Point2 pz(0, 0);
|
||||||
* between opencv and the Cal3Fisheye::uncalibrate function is the skew
|
Matrix H1, H2;
|
||||||
* parameter. The equivalence is alpha = s/fx.
|
auto uv = K.uncalibrate(pz, H1, H2);
|
||||||
*
|
CHECK(assert_equal(uv, Point2(u0, v0)));
|
||||||
*
|
CHECK(assert_equal(numericalDerivative21(f, K, pz, 1e-7), H1, 1e-5));
|
||||||
* Python script to project points with fisheye model in OpenCv
|
// TODO(frank): the second jacobian is all NaN for the image center!
|
||||||
* (script run with OpenCv version 4.2.0 and Numpy version 1.18.2)
|
// CHECK(assert_equal(numericalDerivative22(f, K, pz, 1e-7), H2, 1e-5));
|
||||||
*/
|
}
|
||||||
|
|
||||||
|
/* ************************************************************************* */
|
||||||
|
// This test uses cv2::fisheye::projectPoints to test that uncalibrate
|
||||||
|
// properly projects a point into the image plane. One notable difference
|
||||||
|
// between opencv and the Cal3Fisheye::uncalibrate function is the skew
|
||||||
|
// parameter. The equivalence is alpha = s/fx.
|
||||||
|
//
|
||||||
|
// Python script to project points with fisheye model in OpenCv
|
||||||
|
// (script run with OpenCv version 4.2.0 and Numpy version 1.18.2)
|
||||||
// clang-format off
|
// clang-format off
|
||||||
/*
|
/*
|
||||||
===========================================================
|
===========================================================
|
||||||
|
|
@ -94,6 +120,7 @@ tvec = np.float64([[0.,0.,0.]]);
|
||||||
imagePoints, jacobian = cv2.fisheye.projectPoints(objpts, rvec, tvec, cameraMatrix, distCoeffs, alpha=alpha)
|
imagePoints, jacobian = cv2.fisheye.projectPoints(objpts, rvec, tvec, cameraMatrix, distCoeffs, alpha=alpha)
|
||||||
np.set_printoptions(precision=14)
|
np.set_printoptions(precision=14)
|
||||||
print(imagePoints)
|
print(imagePoints)
|
||||||
|
|
||||||
===========================================================
|
===========================================================
|
||||||
* Script output: [[[457.82638130304935 408.18905848512986]]]
|
* Script output: [[[457.82638130304935 408.18905848512986]]]
|
||||||
*/
|
*/
|
||||||
|
|
@ -134,21 +161,18 @@ TEST(Cal3Fisheye, calibrate1) {
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
/**
|
// Check that calibrate returns (0,0) for the image center
|
||||||
* Check that calibrate returns (0,0) for the image center
|
|
||||||
*/
|
|
||||||
TEST(Cal3Fisheye, calibrate2) {
|
TEST(Cal3Fisheye, calibrate2) {
|
||||||
Point2 uv(u0, v0);
|
Point2 uv(u0, v0);
|
||||||
auto xi_hat = K.calibrate(uv);
|
auto xi_hat = K.calibrate(uv);
|
||||||
CHECK(assert_equal(xi_hat, Point2(0, 0)))
|
CHECK(assert_equal(xi_hat, Point2(0, 0)))
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/* ************************************************************************* */
|
||||||
* Run calibrate on OpenCv test from uncalibrate3
|
// Run calibrate on OpenCv test from uncalibrate3
|
||||||
* (script shown above)
|
// (script shown above)
|
||||||
* 3d point: (23, 27, 31)
|
// 3d point: (23, 27, 31)
|
||||||
* 2d point in image plane: (457.82638130304935, 408.18905848512986)
|
// 2d point in image plane: (457.82638130304935, 408.18905848512986)
|
||||||
*/
|
|
||||||
TEST(Cal3Fisheye, calibrate3) {
|
TEST(Cal3Fisheye, calibrate3) {
|
||||||
Point3 p3(23, 27, 31);
|
Point3 p3(23, 27, 31);
|
||||||
Point2 xi(p3.x() / p3.z(), p3.y() / p3.z());
|
Point2 xi(p3.x() / p3.z(), p3.y() / p3.z());
|
||||||
|
|
@ -157,47 +181,6 @@ TEST(Cal3Fisheye, calibrate3) {
|
||||||
CHECK(assert_equal(xi_hat, xi));
|
CHECK(assert_equal(xi_hat, xi));
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
|
||||||
// For numerical derivatives
|
|
||||||
Point2 uncalibrate_(const Cal3Fisheye& k, const Point2& pt) {
|
|
||||||
return k.uncalibrate(pt);
|
|
||||||
}
|
|
||||||
|
|
||||||
/* ************************************************************************* */
|
|
||||||
TEST(Cal3Fisheye, Duncalibrate1) {
|
|
||||||
Matrix computed;
|
|
||||||
K.uncalibrate(p, computed, boost::none);
|
|
||||||
Matrix numerical = numericalDerivative21(uncalibrate_, K, p, 1e-7);
|
|
||||||
CHECK(assert_equal(numerical, computed, 1e-5));
|
|
||||||
Matrix separate = K.D2d_calibration(p);
|
|
||||||
CHECK(assert_equal(numerical, separate, 1e-5));
|
|
||||||
}
|
|
||||||
|
|
||||||
/* ************************************************************************* */
|
|
||||||
TEST(Cal3Fisheye, Duncalibrate2) {
|
|
||||||
Matrix computed;
|
|
||||||
K.uncalibrate(p, boost::none, computed);
|
|
||||||
Matrix numerical = numericalDerivative22(uncalibrate_, K, p, 1e-7);
|
|
||||||
CHECK(assert_equal(numerical, computed, 1e-5));
|
|
||||||
Matrix separate = K.D2d_intrinsic(p);
|
|
||||||
CHECK(assert_equal(numerical, separate, 1e-5));
|
|
||||||
}
|
|
||||||
|
|
||||||
/* ************************************************************************* */
|
|
||||||
TEST(Cal3Fisheye, assert_equal) { CHECK(assert_equal(K, K, 1e-5)); }
|
|
||||||
|
|
||||||
/* ************************************************************************* */
|
|
||||||
TEST(Cal3Fisheye, retract) {
|
|
||||||
Cal3Fisheye expected(K.fx() + 1, K.fy() + 2, K.skew() + 3, K.px() + 4,
|
|
||||||
K.py() + 5, K.k1() + 6, K.k2() + 7, K.k3() + 8,
|
|
||||||
K.k4() + 9);
|
|
||||||
Vector d(9);
|
|
||||||
d << 1, 2, 3, 4, 5, 6, 7, 8, 9;
|
|
||||||
Cal3Fisheye actual = K.retract(d);
|
|
||||||
CHECK(assert_equal(expected, actual, 1e-7));
|
|
||||||
CHECK(assert_equal(d, K.localCoordinates(actual), 1e-7));
|
|
||||||
}
|
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
int main() {
|
int main() {
|
||||||
TestResult tr;
|
TestResult tr;
|
||||||
|
|
|
||||||
|
|
@ -215,7 +215,7 @@ struct CameraProjectionMatrix {
|
||||||
private:
|
private:
|
||||||
const Matrix3 K_;
|
const Matrix3 K_;
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|
|
||||||
|
|
@ -139,7 +139,7 @@ private:
|
||||||
}
|
}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
|
|
||||||
/// traits
|
/// traits
|
||||||
|
|
@ -219,7 +219,7 @@ private:
|
||||||
}
|
}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
|
|
||||||
/// traits
|
/// traits
|
||||||
|
|
|
||||||
|
|
@ -100,7 +100,7 @@ private:
|
||||||
}
|
}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
|
|
||||||
|
|
||||||
|
|
@ -210,7 +210,7 @@ public:
|
||||||
}
|
}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|
@ -332,7 +332,7 @@ private:
|
||||||
}
|
}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
// class CombinedImuFactor
|
// class CombinedImuFactor
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -171,7 +171,7 @@ private:
|
||||||
|
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
/// @}
|
/// @}
|
||||||
|
|
||||||
}; // ConstantBias class
|
}; // ConstantBias class
|
||||||
|
|
|
||||||
|
|
@ -69,7 +69,7 @@ struct GTSAM_EXPORT PreintegratedRotationParams {
|
||||||
#ifdef GTSAM_USE_QUATERNIONS
|
#ifdef GTSAM_USE_QUATERNIONS
|
||||||
// Align if we are using Quaternions
|
// Align if we are using Quaternions
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
#endif
|
#endif
|
||||||
};
|
};
|
||||||
|
|
||||||
|
|
@ -182,7 +182,7 @@ class GTSAM_EXPORT PreintegratedRotation {
|
||||||
#ifdef GTSAM_USE_QUATERNIONS
|
#ifdef GTSAM_USE_QUATERNIONS
|
||||||
// Align if we are using Quaternions
|
// Align if we are using Quaternions
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
#endif
|
#endif
|
||||||
};
|
};
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -214,7 +214,7 @@ class GTSAM_EXPORT PreintegrationBase {
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
|
|
||||||
} /// namespace gtsam
|
} /// namespace gtsam
|
||||||
|
|
|
||||||
|
|
@ -84,7 +84,7 @@ protected:
|
||||||
#ifdef GTSAM_USE_QUATERNIONS
|
#ifdef GTSAM_USE_QUATERNIONS
|
||||||
// Align if we are using Quaternions
|
// Align if we are using Quaternions
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
#endif
|
#endif
|
||||||
};
|
};
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -141,7 +141,7 @@ private:
|
||||||
}
|
}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
|
|
||||||
} /// namespace gtsam
|
} /// namespace gtsam
|
||||||
|
|
|
||||||
|
|
@ -209,7 +209,7 @@ private:
|
||||||
// Alignment, see https://eigen.tuxfamily.org/dox/group__TopicStructHavingEigenMembers.html
|
// Alignment, see https://eigen.tuxfamily.org/dox/group__TopicStructHavingEigenMembers.html
|
||||||
enum { NeedsToAlign = (sizeof(T) % 16) == 0 };
|
enum { NeedsToAlign = (sizeof(T) % 16) == 0 };
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
||||||
};
|
};
|
||||||
// ExpressionFactor
|
// ExpressionFactor
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -175,7 +175,7 @@ public:
|
||||||
|
|
||||||
/// @}
|
/// @}
|
||||||
|
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
|
|
||||||
private:
|
private:
|
||||||
|
|
||||||
|
|
@ -265,7 +265,7 @@ public:
|
||||||
traits<X>::Print(value_, "Value");
|
traits<X>::Print(value_, "Value");
|
||||||
}
|
}
|
||||||
|
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
|
|
||||||
private:
|
private:
|
||||||
|
|
||||||
|
|
@ -331,7 +331,7 @@ public:
|
||||||
return traits<X>::Local(x1,x2);
|
return traits<X>::Local(x1,x2);
|
||||||
}
|
}
|
||||||
|
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
|
|
||||||
private:
|
private:
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -114,7 +114,7 @@ namespace gtsam {
|
||||||
// Alignment, see https://eigen.tuxfamily.org/dox/group__TopicStructHavingEigenMembers.html
|
// Alignment, see https://eigen.tuxfamily.org/dox/group__TopicStructHavingEigenMembers.html
|
||||||
enum { NeedsToAlign = (sizeof(T) % 16) == 0 };
|
enum { NeedsToAlign = (sizeof(T) % 16) == 0 };
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
||||||
};
|
};
|
||||||
|
|
||||||
} /// namespace gtsam
|
} /// namespace gtsam
|
||||||
|
|
|
||||||
|
|
@ -150,7 +150,7 @@ public:
|
||||||
return constant_;
|
return constant_;
|
||||||
}
|
}
|
||||||
|
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
|
|
||||||
//-----------------------------------------------------------------------------
|
//-----------------------------------------------------------------------------
|
||||||
|
|
|
||||||
|
|
@ -126,7 +126,7 @@ namespace gtsam {
|
||||||
// Alignment, see https://eigen.tuxfamily.org/dox/group__TopicStructHavingEigenMembers.html
|
// Alignment, see https://eigen.tuxfamily.org/dox/group__TopicStructHavingEigenMembers.html
|
||||||
enum { NeedsToAlign = (sizeof(VALUE) % 16) == 0 };
|
enum { NeedsToAlign = (sizeof(VALUE) % 16) == 0 };
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
||||||
}; // \class BetweenFactor
|
}; // \class BetweenFactor
|
||||||
|
|
||||||
/// traits
|
/// traits
|
||||||
|
|
|
||||||
|
|
@ -105,7 +105,7 @@ private:
|
||||||
}
|
}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
// \class EssentialMatrixConstraint
|
// \class EssentialMatrixConstraint
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -81,7 +81,7 @@ public:
|
||||||
}
|
}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|
@ -201,7 +201,7 @@ public:
|
||||||
}
|
}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
// EssentialMatrixFactor2
|
// EssentialMatrixFactor2
|
||||||
|
|
||||||
|
|
@ -286,7 +286,7 @@ public:
|
||||||
}
|
}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
// EssentialMatrixFactor3
|
// EssentialMatrixFactor3
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -189,7 +189,7 @@ namespace gtsam {
|
||||||
}
|
}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
|
|
||||||
/// traits
|
/// traits
|
||||||
|
|
|
||||||
|
|
@ -10,7 +10,11 @@
|
||||||
#include <gtsam/geometry/CameraSet.h>
|
#include <gtsam/geometry/CameraSet.h>
|
||||||
#include <gtsam/linear/JacobianFactor.h>
|
#include <gtsam/linear/JacobianFactor.h>
|
||||||
#include <gtsam/linear/VectorValues.h>
|
#include <gtsam/linear/VectorValues.h>
|
||||||
|
|
||||||
#include <iosfwd>
|
#include <iosfwd>
|
||||||
|
#include <map>
|
||||||
|
#include <string>
|
||||||
|
#include <vector>
|
||||||
|
|
||||||
namespace gtsam {
|
namespace gtsam {
|
||||||
|
|
||||||
|
|
@ -76,7 +80,7 @@ public:
|
||||||
|
|
||||||
/// print
|
/// print
|
||||||
void print(const std::string& s = "", const KeyFormatter& keyFormatter =
|
void print(const std::string& s = "", const KeyFormatter& keyFormatter =
|
||||||
DefaultKeyFormatter) const {
|
DefaultKeyFormatter) const override {
|
||||||
std::cout << " RegularImplicitSchurFactor " << std::endl;
|
std::cout << " RegularImplicitSchurFactor " << std::endl;
|
||||||
Factor::print(s);
|
Factor::print(s);
|
||||||
for (size_t pos = 0; pos < size(); ++pos) {
|
for (size_t pos = 0; pos < size(); ++pos) {
|
||||||
|
|
@ -88,7 +92,7 @@ public:
|
||||||
}
|
}
|
||||||
|
|
||||||
/// equals
|
/// equals
|
||||||
bool equals(const GaussianFactor& lf, double tol) const {
|
bool equals(const GaussianFactor& lf, double tol) const override {
|
||||||
const This* f = dynamic_cast<const This*>(&lf);
|
const This* f = dynamic_cast<const This*>(&lf);
|
||||||
if (!f)
|
if (!f)
|
||||||
return false;
|
return false;
|
||||||
|
|
@ -104,37 +108,36 @@ public:
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Degrees of freedom of camera
|
/// Degrees of freedom of camera
|
||||||
virtual DenseIndex getDim(const_iterator variable) const {
|
DenseIndex getDim(const_iterator variable) const override {
|
||||||
return D;
|
return D;
|
||||||
}
|
}
|
||||||
|
|
||||||
virtual void updateHessian(const KeyVector& keys,
|
void updateHessian(const KeyVector& keys,
|
||||||
SymmetricBlockMatrix* info) const {
|
SymmetricBlockMatrix* info) const override {
|
||||||
throw std::runtime_error(
|
throw std::runtime_error(
|
||||||
"RegularImplicitSchurFactor::updateHessian non implemented");
|
"RegularImplicitSchurFactor::updateHessian non implemented");
|
||||||
}
|
}
|
||||||
virtual Matrix augmentedJacobian() const {
|
Matrix augmentedJacobian() const override {
|
||||||
throw std::runtime_error(
|
throw std::runtime_error(
|
||||||
"RegularImplicitSchurFactor::augmentedJacobian non implemented");
|
"RegularImplicitSchurFactor::augmentedJacobian non implemented");
|
||||||
return Matrix();
|
return Matrix();
|
||||||
}
|
}
|
||||||
virtual std::pair<Matrix, Vector> jacobian() const {
|
std::pair<Matrix, Vector> jacobian() const override {
|
||||||
throw std::runtime_error(
|
throw std::runtime_error(
|
||||||
"RegularImplicitSchurFactor::jacobian non implemented");
|
"RegularImplicitSchurFactor::jacobian non implemented");
|
||||||
return std::make_pair(Matrix(), Vector());
|
return std::make_pair(Matrix(), Vector());
|
||||||
}
|
}
|
||||||
|
|
||||||
/// *Compute* full augmented information matrix
|
/// *Compute* full augmented information matrix
|
||||||
virtual Matrix augmentedInformation() const {
|
Matrix augmentedInformation() const override {
|
||||||
|
|
||||||
// Do the Schur complement
|
// Do the Schur complement
|
||||||
SymmetricBlockMatrix augmentedHessian = //
|
SymmetricBlockMatrix augmentedHessian =
|
||||||
Set::SchurComplement(FBlocks_, E_, b_);
|
Set::SchurComplement(FBlocks_, E_, b_);
|
||||||
return augmentedHessian.selfadjointView();
|
return augmentedHessian.selfadjointView();
|
||||||
}
|
}
|
||||||
|
|
||||||
/// *Compute* full information matrix
|
/// *Compute* full information matrix
|
||||||
virtual Matrix information() const {
|
Matrix information() const override {
|
||||||
Matrix augmented = augmentedInformation();
|
Matrix augmented = augmentedInformation();
|
||||||
int m = this->keys_.size();
|
int m = this->keys_.size();
|
||||||
size_t M = D * m;
|
size_t M = D * m;
|
||||||
|
|
@ -145,7 +148,7 @@ public:
|
||||||
using GaussianFactor::hessianDiagonal;
|
using GaussianFactor::hessianDiagonal;
|
||||||
|
|
||||||
/// Add the diagonal of the Hessian for this factor to existing VectorValues
|
/// Add the diagonal of the Hessian for this factor to existing VectorValues
|
||||||
virtual void hessianDiagonalAdd(VectorValues &d) const override {
|
void hessianDiagonalAdd(VectorValues &d) const override {
|
||||||
// diag(Hessian) = diag(F' * (I - E * PointCov * E') * F);
|
// diag(Hessian) = diag(F' * (I - E * PointCov * E') * F);
|
||||||
for (size_t k = 0; k < size(); ++k) { // for each camera
|
for (size_t k = 0; k < size(); ++k) { // for each camera
|
||||||
Key j = keys_[k];
|
Key j = keys_[k];
|
||||||
|
|
@ -176,7 +179,7 @@ public:
|
||||||
* @brief add the contribution of this factor to the diagonal of the hessian
|
* @brief add the contribution of this factor to the diagonal of the hessian
|
||||||
* d(output) = d(input) + deltaHessianFactor
|
* d(output) = d(input) + deltaHessianFactor
|
||||||
*/
|
*/
|
||||||
virtual void hessianDiagonal(double* d) const {
|
void hessianDiagonal(double* d) const override {
|
||||||
// diag(Hessian) = diag(F' * (I - E * PointCov * E') * F);
|
// diag(Hessian) = diag(F' * (I - E * PointCov * E') * F);
|
||||||
// Use eigen magic to access raw memory
|
// Use eigen magic to access raw memory
|
||||||
typedef Eigen::Matrix<double, D, 1> DVector;
|
typedef Eigen::Matrix<double, D, 1> DVector;
|
||||||
|
|
@ -202,7 +205,7 @@ public:
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Return the block diagonal of the Hessian for this factor
|
/// Return the block diagonal of the Hessian for this factor
|
||||||
virtual std::map<Key, Matrix> hessianBlockDiagonal() const {
|
std::map<Key, Matrix> hessianBlockDiagonal() const override {
|
||||||
std::map<Key, Matrix> blocks;
|
std::map<Key, Matrix> blocks;
|
||||||
// F'*(I - E*P*E')*F
|
// F'*(I - E*P*E')*F
|
||||||
for (size_t pos = 0; pos < size(); ++pos) {
|
for (size_t pos = 0; pos < size(); ++pos) {
|
||||||
|
|
@ -227,17 +230,18 @@ public:
|
||||||
return blocks;
|
return blocks;
|
||||||
}
|
}
|
||||||
|
|
||||||
virtual GaussianFactor::shared_ptr clone() const {
|
GaussianFactor::shared_ptr clone() const override {
|
||||||
return boost::make_shared<RegularImplicitSchurFactor<CAMERA> >(keys_,
|
return boost::make_shared<RegularImplicitSchurFactor<CAMERA> >(keys_,
|
||||||
FBlocks_, PointCovariance_, E_, b_);
|
FBlocks_, PointCovariance_, E_, b_);
|
||||||
throw std::runtime_error(
|
throw std::runtime_error(
|
||||||
"RegularImplicitSchurFactor::clone non implemented");
|
"RegularImplicitSchurFactor::clone non implemented");
|
||||||
}
|
}
|
||||||
virtual bool empty() const {
|
|
||||||
|
bool empty() const override {
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
|
|
||||||
virtual GaussianFactor::shared_ptr negate() const {
|
GaussianFactor::shared_ptr negate() const override {
|
||||||
return boost::make_shared<RegularImplicitSchurFactor<CAMERA> >(keys_,
|
return boost::make_shared<RegularImplicitSchurFactor<CAMERA> >(keys_,
|
||||||
FBlocks_, PointCovariance_, E_, b_);
|
FBlocks_, PointCovariance_, E_, b_);
|
||||||
throw std::runtime_error(
|
throw std::runtime_error(
|
||||||
|
|
@ -288,7 +292,7 @@ public:
|
||||||
* f = nonlinear error
|
* f = nonlinear error
|
||||||
* (x'*H*x - 2*x'*eta + f) = x'*F'*Q*F*x - 2*x'*F'*Q *b + f = x'*F'*Q*(F*x - 2*b) + f
|
* (x'*H*x - 2*x'*eta + f) = x'*F'*Q*F*x - 2*x'*F'*Q *b + f = x'*F'*Q*(F*x - 2*b) + f
|
||||||
*/
|
*/
|
||||||
virtual double error(const VectorValues& x) const {
|
double error(const VectorValues& x) const override {
|
||||||
|
|
||||||
// resize does not do malloc if correct size
|
// resize does not do malloc if correct size
|
||||||
e1.resize(size());
|
e1.resize(size());
|
||||||
|
|
@ -383,13 +387,12 @@ public:
|
||||||
void multiplyHessianAdd(double alpha, const double* x, double* y,
|
void multiplyHessianAdd(double alpha, const double* x, double* y,
|
||||||
std::vector<size_t> keys) const {
|
std::vector<size_t> keys) const {
|
||||||
}
|
}
|
||||||
;
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* @brief Hessian-vector multiply, i.e. y += F'*alpha*(I - E*P*E')*F*x
|
* @brief Hessian-vector multiply, i.e. y += F'*alpha*(I - E*P*E')*F*x
|
||||||
*/
|
*/
|
||||||
void multiplyHessianAdd(double alpha, const VectorValues& x,
|
void multiplyHessianAdd(double alpha, const VectorValues& x,
|
||||||
VectorValues& y) const {
|
VectorValues& y) const override {
|
||||||
|
|
||||||
// resize does not do malloc if correct size
|
// resize does not do malloc if correct size
|
||||||
e1.resize(size());
|
e1.resize(size());
|
||||||
|
|
@ -432,7 +435,7 @@ public:
|
||||||
/**
|
/**
|
||||||
* Calculate gradient, which is -F'Q*b, see paper
|
* Calculate gradient, which is -F'Q*b, see paper
|
||||||
*/
|
*/
|
||||||
VectorValues gradientAtZero() const {
|
VectorValues gradientAtZero() const override {
|
||||||
// calculate Q*b
|
// calculate Q*b
|
||||||
e1.resize(size());
|
e1.resize(size());
|
||||||
e2.resize(size());
|
e2.resize(size());
|
||||||
|
|
@ -454,7 +457,7 @@ public:
|
||||||
/**
|
/**
|
||||||
* Calculate gradient, which is -F'Q*b, see paper - RAW MEMORY ACCESS
|
* Calculate gradient, which is -F'Q*b, see paper - RAW MEMORY ACCESS
|
||||||
*/
|
*/
|
||||||
virtual void gradientAtZero(double* d) const {
|
void gradientAtZero(double* d) const override {
|
||||||
|
|
||||||
// Use eigen magic to access raw memory
|
// Use eigen magic to access raw memory
|
||||||
typedef Eigen::Matrix<double, D, 1> DVector;
|
typedef Eigen::Matrix<double, D, 1> DVector;
|
||||||
|
|
@ -474,7 +477,7 @@ public:
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Gradient wrt a key at any values
|
/// Gradient wrt a key at any values
|
||||||
Vector gradient(Key key, const VectorValues& x) const {
|
Vector gradient(Key key, const VectorValues& x) const override {
|
||||||
throw std::runtime_error(
|
throw std::runtime_error(
|
||||||
"gradient for RegularImplicitSchurFactor is not implemented yet");
|
"gradient for RegularImplicitSchurFactor is not implemented yet");
|
||||||
}
|
}
|
||||||
|
|
|
||||||
|
|
@ -113,7 +113,7 @@ public:
|
||||||
return error;
|
return error;
|
||||||
}
|
}
|
||||||
|
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
};
|
};
|
||||||
} // namespace gtsam
|
} // namespace gtsam
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -81,7 +81,7 @@ protected:
|
||||||
mutable FBlocks Fs;
|
mutable FBlocks Fs;
|
||||||
|
|
||||||
public:
|
public:
|
||||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||||
|
|
||||||
/// shorthand for a smart pointer to a factor
|
/// shorthand for a smart pointer to a factor
|
||||||
typedef boost::shared_ptr<This> shared_ptr;
|
typedef boost::shared_ptr<This> shared_ptr;
|
||||||
|
|
|
||||||
|
|
@ -37,6 +37,7 @@
|
||||||
#include <boost/assign/list_inserter.hpp>
|
#include <boost/assign/list_inserter.hpp>
|
||||||
#include <boost/filesystem/operations.hpp>
|
#include <boost/filesystem/operations.hpp>
|
||||||
#include <boost/filesystem/path.hpp>
|
#include <boost/filesystem/path.hpp>
|
||||||
|
#include <boost/optional.hpp>
|
||||||
|
|
||||||
#include <cmath>
|
#include <cmath>
|
||||||
#include <fstream>
|
#include <fstream>
|
||||||
|
|
@ -541,10 +542,16 @@ std::map<Key, Pose3> parse3DPoses(const string& filename) {
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
BetweenFactorPose3s parse3DFactors(const string& filename) {
|
BetweenFactorPose3s parse3DFactors(const string& filename,
|
||||||
|
const noiseModel::Diagonal::shared_ptr& corruptingNoise) {
|
||||||
ifstream is(filename.c_str());
|
ifstream is(filename.c_str());
|
||||||
if (!is) throw invalid_argument("parse3DFactors: can not find file " + filename);
|
if (!is) throw invalid_argument("parse3DFactors: can not find file " + filename);
|
||||||
|
|
||||||
|
boost::optional<Sampler> sampler;
|
||||||
|
if (corruptingNoise) {
|
||||||
|
sampler = Sampler(corruptingNoise);
|
||||||
|
}
|
||||||
|
|
||||||
std::vector<BetweenFactor<Pose3>::shared_ptr> factors;
|
std::vector<BetweenFactor<Pose3>::shared_ptr> factors;
|
||||||
while (!is.eof()) {
|
while (!is.eof()) {
|
||||||
char buf[LINESIZE];
|
char buf[LINESIZE];
|
||||||
|
|
@ -585,8 +592,13 @@ BetweenFactorPose3s parse3DFactors(const string& filename) {
|
||||||
mgtsam.block<3, 3>(3, 0) = m.block<3, 3>(3, 0); // off diagonal
|
mgtsam.block<3, 3>(3, 0) = m.block<3, 3>(3, 0); // off diagonal
|
||||||
|
|
||||||
SharedNoiseModel model = noiseModel::Gaussian::Information(mgtsam);
|
SharedNoiseModel model = noiseModel::Gaussian::Information(mgtsam);
|
||||||
|
auto R12 = Rot3::Quaternion(qw, qx, qy, qz);
|
||||||
|
if (sampler) {
|
||||||
|
R12 = R12.retract(sampler->sample());
|
||||||
|
}
|
||||||
|
|
||||||
factors.emplace_back(new BetweenFactor<Pose3>(
|
factors.emplace_back(new BetweenFactor<Pose3>(
|
||||||
id1, id2, Pose3(Rot3::Quaternion(qw, qx, qy, qz), {x, y, z}), model));
|
id1, id2, Pose3(R12, {x, y, z}), model));
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return factors;
|
return factors;
|
||||||
|
|
|
||||||
|
|
@ -159,7 +159,8 @@ GTSAM_EXPORT void writeG2o(const NonlinearFactorGraph& graph,
|
||||||
|
|
||||||
/// Parse edges in 3D TORO graph file into a set of BetweenFactors.
|
/// Parse edges in 3D TORO graph file into a set of BetweenFactors.
|
||||||
using BetweenFactorPose3s = std::vector<gtsam::BetweenFactor<Pose3>::shared_ptr>;
|
using BetweenFactorPose3s = std::vector<gtsam::BetweenFactor<Pose3>::shared_ptr>;
|
||||||
GTSAM_EXPORT BetweenFactorPose3s parse3DFactors(const std::string& filename);
|
GTSAM_EXPORT BetweenFactorPose3s parse3DFactors(const std::string& filename,
|
||||||
|
const noiseModel::Diagonal::shared_ptr& corruptingNoise=nullptr);
|
||||||
|
|
||||||
/// Parse vertices in 3D TORO graph file into a map of Pose3s.
|
/// Parse vertices in 3D TORO graph file into a map of Pose3s.
|
||||||
GTSAM_EXPORT std::map<Key, Pose3> parse3DPoses(const std::string& filename);
|
GTSAM_EXPORT std::map<Key, Pose3> parse3DPoses(const std::string& filename);
|
||||||
|
|
|
||||||
|
|
@ -9,5 +9,6 @@ set (GTSAM_USE_TBB @GTSAM_USE_TBB@)
|
||||||
set (GTSAM_DEFAULT_ALLOCATOR @GTSAM_DEFAULT_ALLOCATOR@)
|
set (GTSAM_DEFAULT_ALLOCATOR @GTSAM_DEFAULT_ALLOCATOR@)
|
||||||
|
|
||||||
if("@GTSAM_INSTALL_CYTHON_TOOLBOX@")
|
if("@GTSAM_INSTALL_CYTHON_TOOLBOX@")
|
||||||
|
list(APPEND GTSAM_CYTHON_INSTALL_PATH "@GTSAM_CYTHON_INSTALL_PATH@")
|
||||||
list(APPEND GTSAM_EIGENCY_INSTALL_PATH "@GTSAM_EIGENCY_INSTALL_PATH@")
|
list(APPEND GTSAM_EIGENCY_INSTALL_PATH "@GTSAM_EIGENCY_INSTALL_PATH@")
|
||||||
endif()
|
endif()
|
||||||
|
|
|
||||||
|
|
@ -0,0 +1,90 @@
|
||||||
|
/**
|
||||||
|
* @file PoseToPointFactor.hpp
|
||||||
|
* @brief This factor can be used to track a 3D landmark over time by
|
||||||
|
*providing local measurements of its location.
|
||||||
|
* @author David Wisth
|
||||||
|
**/
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include <gtsam/geometry/Point3.h>
|
||||||
|
#include <gtsam/geometry/Pose3.h>
|
||||||
|
#include <gtsam/nonlinear/NonlinearFactor.h>
|
||||||
|
#include <ostream>
|
||||||
|
|
||||||
|
namespace gtsam {
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A class for a measurement between a pose and a point.
|
||||||
|
* @addtogroup SLAM
|
||||||
|
*/
|
||||||
|
class PoseToPointFactor : public NoiseModelFactor2<Pose3, Point3> {
|
||||||
|
private:
|
||||||
|
typedef PoseToPointFactor This;
|
||||||
|
typedef NoiseModelFactor2<Pose3, Point3> Base;
|
||||||
|
|
||||||
|
Point3 measured_; /** the point measurement in local coordinates */
|
||||||
|
|
||||||
|
public:
|
||||||
|
// shorthand for a smart pointer to a factor
|
||||||
|
typedef boost::shared_ptr<PoseToPointFactor> shared_ptr;
|
||||||
|
|
||||||
|
/** default constructor - only use for serialization */
|
||||||
|
PoseToPointFactor() {}
|
||||||
|
|
||||||
|
/** Constructor */
|
||||||
|
PoseToPointFactor(Key key1, Key key2, const Point3& measured,
|
||||||
|
const SharedNoiseModel& model)
|
||||||
|
: Base(model, key1, key2), measured_(measured) {}
|
||||||
|
|
||||||
|
virtual ~PoseToPointFactor() {}
|
||||||
|
|
||||||
|
/** implement functions needed for Testable */
|
||||||
|
|
||||||
|
/** print */
|
||||||
|
virtual void print(const std::string& s, const KeyFormatter& keyFormatter =
|
||||||
|
DefaultKeyFormatter) const {
|
||||||
|
std::cout << s << "PoseToPointFactor(" << keyFormatter(this->key1()) << ","
|
||||||
|
<< keyFormatter(this->key2()) << ")\n"
|
||||||
|
<< " measured: " << measured_.transpose() << std::endl;
|
||||||
|
this->noiseModel_->print(" noise model: ");
|
||||||
|
}
|
||||||
|
|
||||||
|
/** equals */
|
||||||
|
virtual bool equals(const NonlinearFactor& expected,
|
||||||
|
double tol = 1e-9) const {
|
||||||
|
const This* e = dynamic_cast<const This*>(&expected);
|
||||||
|
return e != nullptr && Base::equals(*e, tol) &&
|
||||||
|
traits<Point3>::Equals(this->measured_, e->measured_, tol);
|
||||||
|
}
|
||||||
|
|
||||||
|
/** implement functions needed to derive from Factor */
|
||||||
|
|
||||||
|
/** vector of errors
|
||||||
|
* @brief Error = wTwi.inverse()*wPwp - measured_
|
||||||
|
* @param wTwi The pose of the sensor in world coordinates
|
||||||
|
* @param wPwp The estimated point location in world coordinates
|
||||||
|
*
|
||||||
|
* Note: measured_ and the error are in local coordiantes.
|
||||||
|
*/
|
||||||
|
Vector evaluateError(const Pose3& wTwi, const Point3& wPwp,
|
||||||
|
boost::optional<Matrix&> H1 = boost::none,
|
||||||
|
boost::optional<Matrix&> H2 = boost::none) const {
|
||||||
|
return wTwi.transformTo(wPwp, H1, H2) - measured_;
|
||||||
|
}
|
||||||
|
|
||||||
|
/** return the measured */
|
||||||
|
const Point3& measured() const { return measured_; }
|
||||||
|
|
||||||
|
private:
|
||||||
|
/** Serialization function */
|
||||||
|
friend class boost::serialization::access;
|
||||||
|
template <class ARCHIVE>
|
||||||
|
void serialize(ARCHIVE& ar, const unsigned int /*version*/) {
|
||||||
|
ar& boost::serialization::make_nvp(
|
||||||
|
"NoiseModelFactor2", boost::serialization::base_object<Base>(*this));
|
||||||
|
ar& BOOST_SERIALIZATION_NVP(measured_);
|
||||||
|
}
|
||||||
|
|
||||||
|
}; // \class PoseToPointFactor
|
||||||
|
|
||||||
|
} // namespace gtsam
|
||||||
|
|
@ -0,0 +1,86 @@
|
||||||
|
/**
|
||||||
|
* @file testPoseToPointFactor.cpp
|
||||||
|
* @brief
|
||||||
|
* @author David Wisth
|
||||||
|
* @date June 20, 2020
|
||||||
|
*/
|
||||||
|
|
||||||
|
#include <CppUnitLite/TestHarness.h>
|
||||||
|
#include <gtsam/base/numericalDerivative.h>
|
||||||
|
#include <gtsam_unstable/slam/PoseToPointFactor.h>
|
||||||
|
|
||||||
|
using namespace gtsam;
|
||||||
|
using namespace gtsam::noiseModel;
|
||||||
|
|
||||||
|
/// Verify zero error when there is no noise
|
||||||
|
TEST(PoseToPointFactor, errorNoiseless) {
|
||||||
|
Pose3 pose = Pose3::identity();
|
||||||
|
Point3 point(1.0, 2.0, 3.0);
|
||||||
|
Point3 noise(0.0, 0.0, 0.0);
|
||||||
|
Point3 measured = t + noise;
|
||||||
|
|
||||||
|
Key pose_key(1);
|
||||||
|
Key point_key(2);
|
||||||
|
PoseToPointFactor factor(pose_key, point_key, measured,
|
||||||
|
Isotropic::Sigma(3, 0.05));
|
||||||
|
Vector expectedError = Vector3(0.0, 0.0, 0.0);
|
||||||
|
Vector actualError = factor.evaluateError(pose, point);
|
||||||
|
EXPECT(assert_equal(expectedError, actualError, 1E-5));
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Verify expected error in test scenario
|
||||||
|
TEST(PoseToPointFactor, errorNoise) {
|
||||||
|
Pose3 pose = Pose3::identity();
|
||||||
|
Point3 point(1.0, 2.0, 3.0);
|
||||||
|
Point3 noise(-1.0, 0.5, 0.3);
|
||||||
|
Point3 measured = t + noise;
|
||||||
|
|
||||||
|
Key pose_key(1);
|
||||||
|
Key point_key(2);
|
||||||
|
PoseToPointFactor factor(pose_key, point_key, measured,
|
||||||
|
Isotropic::Sigma(3, 0.05));
|
||||||
|
Vector expectedError = noise;
|
||||||
|
Vector actualError = factor.evaluateError(pose, point);
|
||||||
|
EXPECT(assert_equal(expectedError, actualError, 1E-5));
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Check Jacobians are correct
|
||||||
|
TEST(PoseToPointFactor, jacobian) {
|
||||||
|
// Measurement
|
||||||
|
gtsam::Point3 l_meas = gtsam::Point3(1, 2, 3);
|
||||||
|
|
||||||
|
// Linearisation point
|
||||||
|
gtsam::Point3 p_t = gtsam::Point3(-5, 12, 2);
|
||||||
|
gtsam::Rot3 p_R = gtsam::Rot3::RzRyRx(1.5 * M_PI, -0.3 * M_PI, 0.4 * M_PI);
|
||||||
|
Pose3 p(p_R, p_t);
|
||||||
|
|
||||||
|
gtsam::Point3 l = gtsam::Point3(3, 0, 5);
|
||||||
|
|
||||||
|
// Factor
|
||||||
|
Key pose_key(1);
|
||||||
|
Key point_key(2);
|
||||||
|
SharedGaussian noise = noiseModel::Diagonal::Sigmas(Vector3(0.1, 0.1, 0.1));
|
||||||
|
PoseToPointFactor factor(pose_key, point_key, l_meas, noise);
|
||||||
|
|
||||||
|
// Calculate numerical derivatives
|
||||||
|
auto f = boost::bind(&PoseToPointFactor::evaluateError, factor, _1, _2,
|
||||||
|
boost::none, boost::none);
|
||||||
|
Matrix numerical_H1 = numericalDerivative21<Vector, Pose3, Point3>(f, p, l);
|
||||||
|
Matrix numerical_H2 = numericalDerivative22<Vector, Pose3, Point3>(f, p, l);
|
||||||
|
|
||||||
|
// Use the factor to calculate the derivative
|
||||||
|
Matrix actual_H1;
|
||||||
|
Matrix actual_H2;
|
||||||
|
factor.evaluateError(p, l, actual_H1, actual_H2);
|
||||||
|
|
||||||
|
// Verify we get the expected error
|
||||||
|
EXPECT_TRUE(assert_equal(numerical_H1, actual_H1, 1e-8));
|
||||||
|
EXPECT_TRUE(assert_equal(numerical_H2, actual_H2, 1e-8));
|
||||||
|
}
|
||||||
|
|
||||||
|
/* ************************************************************************* */
|
||||||
|
int main() {
|
||||||
|
TestResult tr;
|
||||||
|
return TestRegistry::runAllTests(tr);
|
||||||
|
}
|
||||||
|
/* ************************************************************************* */
|
||||||
|
|
@ -1,44 +0,0 @@
|
||||||
# How to build Debian and Ubuntu Packages
|
|
||||||
|
|
||||||
## Preparations
|
|
||||||
|
|
||||||
Packages must be signed with a GPG key. First have a look of the keys
|
|
||||||
you have available:
|
|
||||||
|
|
||||||
gpg --list-secret-keys
|
|
||||||
|
|
||||||
If you don't have one, create one, then list again.
|
|
||||||
|
|
||||||
Pick a secret key you like from the listed keys, for instance
|
|
||||||
"Your Name <your.email@yourprovider.com>". Then unlock that key by
|
|
||||||
signing a dummy file. The following line should pop up a window to
|
|
||||||
enter the passphrase:
|
|
||||||
|
|
||||||
echo | gpg --local-user "Your Name <your.email@yourprovider.com>" -s >/dev/null
|
|
||||||
|
|
||||||
Now you can run the below scripts. Without this step they will fail
|
|
||||||
with "No secret key" or similar messages.
|
|
||||||
|
|
||||||
## How to generate a Debian package
|
|
||||||
|
|
||||||
Run the package script, providing a name/email that matches your PGP key.
|
|
||||||
|
|
||||||
cd [GTSAM_SOURCE_ROOT]
|
|
||||||
bash package_scripts/prepare_debian.sh -e "Your Name <your.email@yourprovider.com>"
|
|
||||||
|
|
||||||
|
|
||||||
## How to generate Ubuntu packages for a PPA
|
|
||||||
|
|
||||||
Run the packaging script, passing the name of the gpg key
|
|
||||||
(see above) with the "-e" option:
|
|
||||||
|
|
||||||
cd [GTSAM_SOURCE_ROOT]
|
|
||||||
bash package_scripts/prepare_ubuntu_pkgs_for_ppa.sh -e "Your Name <your.email@yourprovider.com>"
|
|
||||||
|
|
||||||
Check that you have uploaded this key to the ubuntu key server, and
|
|
||||||
have added the key to your account.
|
|
||||||
|
|
||||||
Upload the package to your ppa:
|
|
||||||
|
|
||||||
cd ~/gtsam_ubuntu
|
|
||||||
bash [GTSAM_SOURCE_ROOT]/package_scripts/upload_all_gtsam_ppa.sh -p "ppa:your-name/ppa-name"
|
|
||||||
|
|
@ -1,8 +0,0 @@
|
||||||
#!/bin/sh
|
|
||||||
|
|
||||||
# Compile boost statically, with -fPIC to allow linking it into the mex
|
|
||||||
# module (which is a dynamic library). --disable-icu prevents depending
|
|
||||||
# on libicu, which is unneeded and would require then linking the mex
|
|
||||||
# module with it as well. We just stage instead of install, then the
|
|
||||||
# toolbox_package_unix.sh script uses the staged boost.
|
|
||||||
./b2 link=static threading=multi cxxflags=-fPIC cflags=-fPIC --disable-icu -a -j4 stage
|
|
||||||
|
|
@ -1,187 +0,0 @@
|
||||||
#!/bin/bash
|
|
||||||
# Prepare to build a Debian package.
|
|
||||||
# Jose Luis Blanco Claraco, 2019 (for GTSAM)
|
|
||||||
# Jose Luis Blanco Claraco, 2008-2018 (for MRPT)
|
|
||||||
|
|
||||||
set -e # end on error
|
|
||||||
#set -x # for debugging
|
|
||||||
|
|
||||||
APPEND_SNAPSHOT_NUM=0
|
|
||||||
IS_FOR_UBUNTU=0
|
|
||||||
APPEND_LINUX_DISTRO=""
|
|
||||||
VALUE_EXTRA_CMAKE_PARAMS=""
|
|
||||||
while getopts "sud:c:e:" OPTION
|
|
||||||
do
|
|
||||||
case $OPTION in
|
|
||||||
s)
|
|
||||||
APPEND_SNAPSHOT_NUM=1
|
|
||||||
;;
|
|
||||||
u)
|
|
||||||
IS_FOR_UBUNTU=1
|
|
||||||
;;
|
|
||||||
d)
|
|
||||||
APPEND_LINUX_DISTRO=$OPTARG
|
|
||||||
;;
|
|
||||||
c)
|
|
||||||
VALUE_EXTRA_CMAKE_PARAMS=$OPTARG
|
|
||||||
;;
|
|
||||||
e)
|
|
||||||
PACKAGER_EMAIL=$OPTARG
|
|
||||||
;;
|
|
||||||
?)
|
|
||||||
echo "Unknown command line argument!"
|
|
||||||
exit 1
|
|
||||||
;;
|
|
||||||
esac
|
|
||||||
done
|
|
||||||
|
|
||||||
if [ -z ${PACKAGER_EMAIL+x} ]; then
|
|
||||||
echo "must specify packager email via -e option!"
|
|
||||||
exit -1
|
|
||||||
fi
|
|
||||||
|
|
||||||
if [ -f CMakeLists.txt ];
|
|
||||||
then
|
|
||||||
source package_scripts/prepare_debian_gen_snapshot_version.sh
|
|
||||||
else
|
|
||||||
echo "Error: cannot find CMakeList.txt. This script is intended to be run from the root of the source tree."
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Append snapshot?
|
|
||||||
if [ $APPEND_SNAPSHOT_NUM == "1" ];
|
|
||||||
then
|
|
||||||
CUR_SCRIPT_DIR="$( cd "$( dirname "${BASH_SOURCE[0]}" )" && pwd )"
|
|
||||||
source $CUR_SCRIPT_DIR/prepare_debian_gen_snapshot_version.sh # populate GTSAM_SNAPSHOT_VERSION
|
|
||||||
|
|
||||||
GTSAM_VERSION_STR="${GTSAM_VERSION_STR}~snapshot${GTSAM_SNAPSHOT_VERSION}${APPEND_LINUX_DISTRO}"
|
|
||||||
else
|
|
||||||
GTSAM_VERSION_STR="${GTSAM_VERSION_STR}${APPEND_LINUX_DISTRO}"
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Call prepare_release
|
|
||||||
GTSAMSRC=`pwd`
|
|
||||||
|
|
||||||
if [ -f $HOME/gtsam_release/gtsam*.tar.gz ];
|
|
||||||
then
|
|
||||||
echo "## release file already exists. Reusing it."
|
|
||||||
else
|
|
||||||
source package_scripts/prepare_release.sh
|
|
||||||
echo
|
|
||||||
echo "## Done prepare_release.sh"
|
|
||||||
fi
|
|
||||||
|
|
||||||
echo "=========== Generating GTSAM ${GTSAM_VER_MMP} Debian package =============="
|
|
||||||
cd $GTSAMSRC
|
|
||||||
|
|
||||||
set -x
|
|
||||||
if [ -z "$GTSAM_DEB_DIR" ]; then
|
|
||||||
GTSAM_DEB_DIR="$HOME/gtsam_debian"
|
|
||||||
fi
|
|
||||||
GTSAM_EXTERN_DEBIAN_DIR="$GTSAMSRC/debian/"
|
|
||||||
GTSAM_EXTERN_UBUNTU_PPA_DIR="$GTSAMSRC/debian/"
|
|
||||||
|
|
||||||
if [ -f ${GTSAM_EXTERN_DEBIAN_DIR}/control ];
|
|
||||||
then
|
|
||||||
echo "Using debian dir: ${GTSAM_EXTERN_DEBIAN_DIR}"
|
|
||||||
else
|
|
||||||
echo "ERROR: Cannot find ${GTSAM_EXTERN_DEBIAN_DIR}"
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
GTSAM_DEBSRC_DIR=$GTSAM_DEB_DIR/gtsam-${GTSAM_VERSION_STR}
|
|
||||||
|
|
||||||
echo "GTSAM_VERSION_STR: ${GTSAM_VERSION_STR}"
|
|
||||||
echo "GTSAM_DEBSRC_DIR: ${GTSAM_DEBSRC_DIR}"
|
|
||||||
|
|
||||||
# Prepare a directory for building the debian package:
|
|
||||||
#
|
|
||||||
rm -fR $GTSAM_DEB_DIR || true
|
|
||||||
mkdir -p $GTSAM_DEB_DIR || true
|
|
||||||
|
|
||||||
# Orig tarball:
|
|
||||||
echo "Copying orig tarball: gtsam_${GTSAM_VERSION_STR}.orig.tar.gz"
|
|
||||||
cp $HOME/gtsam_release/gtsam*.tar.gz $GTSAM_DEB_DIR/gtsam_${GTSAM_VERSION_STR}.orig.tar.gz
|
|
||||||
cd ${GTSAM_DEB_DIR}
|
|
||||||
tar -xf gtsam_${GTSAM_VERSION_STR}.orig.tar.gz
|
|
||||||
|
|
||||||
if [ ! -d "${GTSAM_DEBSRC_DIR}" ];
|
|
||||||
then
|
|
||||||
mv gtsam-* ${GTSAM_DEBSRC_DIR} # fix different dir names for Ubuntu PPA packages
|
|
||||||
fi
|
|
||||||
|
|
||||||
if [ ! -f "${GTSAM_DEBSRC_DIR}/CMakeLists.txt" ];
|
|
||||||
then
|
|
||||||
echo "*ERROR*: Seems there was a problem copying sources to ${GTSAM_DEBSRC_DIR}... aborting script."
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
cd ${GTSAM_DEBSRC_DIR}
|
|
||||||
|
|
||||||
# Copy debian directory:
|
|
||||||
#mkdir debian
|
|
||||||
cp -r ${GTSAM_EXTERN_DEBIAN_DIR}/* debian
|
|
||||||
|
|
||||||
# Use modified control & rules files for Ubuntu PPA packages:
|
|
||||||
#if [ $IS_FOR_UBUNTU == "1" ];
|
|
||||||
#then
|
|
||||||
# already done: cp ${GTSAM_EXTERN_UBUNTU_PPA_DIR}/control.in debian/
|
|
||||||
# Ubuntu: force use of gcc-7:
|
|
||||||
#sed -i '9i\export CXX=/usr/bin/g++-7\' debian/rules
|
|
||||||
#sed -i '9i\export CC=/usr/bin/gcc-7\' debian/rules7
|
|
||||||
#fi
|
|
||||||
|
|
||||||
# Export signing pub key:
|
|
||||||
mkdir debian/upstream/
|
|
||||||
gpg --export --export-options export-minimal --armor > debian/upstream/signing-key.asc
|
|
||||||
|
|
||||||
# Parse debian/ control.in --> control
|
|
||||||
#mv debian/control.in debian/control
|
|
||||||
#sed -i "s/@GTSAM_VER_MM@/${GTSAM_VER_MM}/g" debian/control
|
|
||||||
|
|
||||||
# Replace the text "REPLACE_HERE_EXTRA_CMAKE_PARAMS" in the "debian/rules" file
|
|
||||||
# with: ${${VALUE_EXTRA_CMAKE_PARAMS}}
|
|
||||||
RULES_FILE=debian/rules
|
|
||||||
sed -i -e "s/REPLACE_HERE_EXTRA_CMAKE_PARAMS/${VALUE_EXTRA_CMAKE_PARAMS}/g" $RULES_FILE
|
|
||||||
echo "Using these extra parameters for CMake: '${VALUE_EXTRA_CMAKE_PARAMS}'"
|
|
||||||
|
|
||||||
# Strip my custom files...
|
|
||||||
rm debian/*.new || true
|
|
||||||
|
|
||||||
|
|
||||||
# Figure out the next Debian version number:
|
|
||||||
echo "Detecting next Debian version number..."
|
|
||||||
|
|
||||||
CHANGELOG_UPSTREAM_VER=$( dpkg-parsechangelog | sed -n 's/Version:.*\([0-9]\.[0-9]*\.[0-9]*.*snapshot.*\)-.*/\1/p' )
|
|
||||||
CHANGELOG_LAST_DEBIAN_VER=$( dpkg-parsechangelog | sed -n 's/Version:.*\([0-9]\.[0-9]*\.[0-9]*\).*-\([0-9]*\).*/\2/p' )
|
|
||||||
|
|
||||||
echo " -> PREVIOUS UPSTREAM: $CHANGELOG_UPSTREAM_VER -> New: ${GTSAM_VERSION_STR}"
|
|
||||||
echo " -> PREVIOUS DEBIAN VERSION: $CHANGELOG_LAST_DEBIAN_VER"
|
|
||||||
|
|
||||||
# If we have the same upstream versions, increase the Debian version, otherwise create a new entry:
|
|
||||||
if [ "$CHANGELOG_UPSTREAM_VER" = "$GTSAM_VERSION_STR" ];
|
|
||||||
then
|
|
||||||
NEW_DEBIAN_VER=$[$CHANGELOG_LAST_DEBIAN_VER + 1]
|
|
||||||
echo "Changing to a new Debian version: ${GTSAM_VERSION_STR}-${NEW_DEBIAN_VER}"
|
|
||||||
DEBCHANGE_CMD="--newversion ${GTSAM_VERSION_STR}-${NEW_DEBIAN_VER}"
|
|
||||||
else
|
|
||||||
DEBCHANGE_CMD="--newversion ${GTSAM_VERSION_STR}-1"
|
|
||||||
fi
|
|
||||||
|
|
||||||
echo "Adding a new entry to debian/changelog..."
|
|
||||||
|
|
||||||
DEBEMAIL=${PACKAGER_EMAIL} debchange $DEBCHANGE_CMD -b --distribution unstable --force-distribution New version of upstream sources.
|
|
||||||
|
|
||||||
echo "Copying back the new changelog to a temporary file in: ${GTSAM_EXTERN_DEBIAN_DIR}changelog.new"
|
|
||||||
cp debian/changelog ${GTSAM_EXTERN_DEBIAN_DIR}changelog.new
|
|
||||||
|
|
||||||
set +x
|
|
||||||
|
|
||||||
echo "=============================================================="
|
|
||||||
echo "Now, you can build the source Deb package with 'debuild -S -sa'"
|
|
||||||
echo "=============================================================="
|
|
||||||
|
|
||||||
cd ..
|
|
||||||
ls -lh
|
|
||||||
|
|
||||||
exit 0
|
|
||||||
|
|
@ -1,25 +0,0 @@
|
||||||
#!/bin/bash
|
|
||||||
|
|
||||||
# See https://reproducible-builds.org/specs/source-date-epoch/
|
|
||||||
# get SOURCE_DATE_EPOCH with UNIX time_t
|
|
||||||
if [ -d ".git" ];
|
|
||||||
then
|
|
||||||
SOURCE_DATE_EPOCH=$(git log -1 --pretty=%ct)
|
|
||||||
else
|
|
||||||
echo "Error: intended for use from within a git repository"
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
GTSAM_SNAPSHOT_VERSION=$(date -d @$SOURCE_DATE_EPOCH +%Y%m%d-%H%M)
|
|
||||||
|
|
||||||
GTSAM_SNAPSHOT_VERSION+="-git-"
|
|
||||||
GTSAM_SNAPSHOT_VERSION+=`git rev-parse --short=8 HEAD`
|
|
||||||
GTSAM_SNAPSHOT_VERSION+="-"
|
|
||||||
|
|
||||||
# x.y.z version components:
|
|
||||||
GTSAM_VERSION_MAJOR=$(grep "(GTSAM_VERSION_MAJOR" CMakeLists.txt | sed -r 's/^.*GTSAM_VERSION_MAJOR\s*([0-9])*.*$/\1/g')
|
|
||||||
GTSAM_VERSION_MINOR=$(grep "(GTSAM_VERSION_MINOR" CMakeLists.txt | sed -r 's/^.*GTSAM_VERSION_MINOR\s*([0-9])*.*$/\1/g')
|
|
||||||
GTSAM_VERSION_PATCH=$(grep "(GTSAM_VERSION_PATCH" CMakeLists.txt | sed -r 's/^.*GTSAM_VERSION_PATCH\s*([0-9])*.*$/\1/g')
|
|
||||||
|
|
||||||
GTSAM_VER_MM="${GTSAM_VERSION_MAJOR}.${GTSAM_VERSION_MINOR}"
|
|
||||||
GTSAM_VER_MMP="${GTSAM_VERSION_MAJOR}.${GTSAM_VERSION_MINOR}.${GTSAM_VERSION_PATCH}"
|
|
||||||
GTSAM_VERSION_STR=$GTSAM_VER_MMP
|
|
||||||
|
|
@ -1,71 +0,0 @@
|
||||||
#!/bin/bash
|
|
||||||
# Export sources from a git tree and prepare it for a public release.
|
|
||||||
# Jose Luis Blanco Claraco, 2019 (for GTSAM)
|
|
||||||
# Jose Luis Blanco Claraco, 2008-2018 (for MRPT)
|
|
||||||
|
|
||||||
set -e # exit on error
|
|
||||||
#set -x # for debugging
|
|
||||||
|
|
||||||
# Checks
|
|
||||||
# --------------------------------
|
|
||||||
if [ -f version_prefix.txt ];
|
|
||||||
then
|
|
||||||
if [ -z ${GTSAM_VERSION_STR+x} ];
|
|
||||||
then
|
|
||||||
source package_scripts/prepare_debian_gen_snapshot_version.sh
|
|
||||||
fi
|
|
||||||
echo "ERROR: Run this script from the GTSAM source tree root directory."
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
GTSAM_SRC=`pwd`
|
|
||||||
OUT_RELEASES_DIR="$HOME/gtsam_release"
|
|
||||||
|
|
||||||
OUT_DIR=$OUT_RELEASES_DIR/gtsam-${GTSAM_VERSION_STR}
|
|
||||||
|
|
||||||
echo "=========== Generating GTSAM release ${GTSAM_VER_MMP} =================="
|
|
||||||
echo "GTSAM_VERSION_STR : ${GTSAM_VERSION_STR}"
|
|
||||||
echo "OUT_DIR : ${OUT_DIR}"
|
|
||||||
echo "============================================================"
|
|
||||||
echo
|
|
||||||
|
|
||||||
# Prepare output directory:
|
|
||||||
rm -fR $OUT_RELEASES_DIR || true
|
|
||||||
mkdir -p ${OUT_DIR}
|
|
||||||
|
|
||||||
# Export / copy sources to target dir:
|
|
||||||
if [ -d "$GTSAM_SRC/.git" ];
|
|
||||||
then
|
|
||||||
echo "# Exporting git source tree to ${OUT_DIR}"
|
|
||||||
git archive --format=tar HEAD | tar -x -C ${OUT_DIR}
|
|
||||||
|
|
||||||
# Remove VCS control files:
|
|
||||||
find ${OUT_DIR} -name '.gitignore' | xargs rm
|
|
||||||
|
|
||||||
# Generate ./SOURCE_DATE_EPOCH with UNIX time_t
|
|
||||||
SOURCE_DATE_EPOCH=$(git log -1 --pretty=%ct)
|
|
||||||
else
|
|
||||||
echo "# Copying sources to ${OUT_DIR}"
|
|
||||||
cp -R . ${OUT_DIR}
|
|
||||||
|
|
||||||
# Generate ./SOURCE_DATE_EPOCH with UNIX time_t
|
|
||||||
SOURCE_DATE_EPOCH=$(date +%s)
|
|
||||||
fi
|
|
||||||
|
|
||||||
# See https://reproducible-builds.org/specs/source-date-epoch/
|
|
||||||
echo $SOURCE_DATE_EPOCH > ${OUT_DIR}/SOURCE_DATE_EPOCH
|
|
||||||
|
|
||||||
cd ${OUT_DIR}
|
|
||||||
|
|
||||||
# Dont include Debian files in releases:
|
|
||||||
rm -fR package_scripts
|
|
||||||
|
|
||||||
# Orig tarball:
|
|
||||||
cd ..
|
|
||||||
echo "# Creating orig tarball: gtsam-${GTSAM_VERSION_STR}.tar.gz"
|
|
||||||
tar czf gtsam-${GTSAM_VERSION_STR}.tar.gz gtsam-${GTSAM_VERSION_STR}
|
|
||||||
|
|
||||||
rm -fr gtsam-${GTSAM_VERSION_STR}
|
|
||||||
|
|
||||||
# GPG signature:
|
|
||||||
gpg --armor --detach-sign gtsam-${GTSAM_VERSION_STR}.tar.gz
|
|
||||||
|
|
@ -1,123 +0,0 @@
|
||||||
#!/bin/bash
|
|
||||||
# Creates a set of packages for each different Ubuntu distribution, with the
|
|
||||||
# intention of uploading them to a PPA on launchpad
|
|
||||||
#
|
|
||||||
# JLBC, 2010
|
|
||||||
# [Addition 2012:]
|
|
||||||
#
|
|
||||||
# You can declare a variable (in the caller shell) with extra flags for the
|
|
||||||
# CMake in the final ./configure like:
|
|
||||||
#
|
|
||||||
# GTSAM_PKG_CUSTOM_CMAKE_PARAMS="\"-DDISABLE_SSE3=ON\""
|
|
||||||
#
|
|
||||||
|
|
||||||
|
|
||||||
function show_help {
|
|
||||||
echo "USAGE:"
|
|
||||||
echo ""
|
|
||||||
echo "- to display this help: "
|
|
||||||
echo "prepare_ubuntu_packages_for_ppa.sh -h or -?"
|
|
||||||
echo ""
|
|
||||||
echo "- to package to your PPA: "
|
|
||||||
echo "prepare_ubuntu_packages_for_ppa.sh -e email_of_your_gpg_key"
|
|
||||||
echo ""
|
|
||||||
echo "to pass custom config for GTSAM, set the following"
|
|
||||||
echo "environment variable beforehand: "
|
|
||||||
echo ""
|
|
||||||
echo "GTSAM_PKG_CUSTOM_CMAKE_PARAMS=\"\"-DDISABLE_SSE3=ON\"\""
|
|
||||||
echo ""
|
|
||||||
}
|
|
||||||
|
|
||||||
while getopts "h?e:" opt; do
|
|
||||||
case "$opt" in
|
|
||||||
h|\?)
|
|
||||||
show_help
|
|
||||||
exit 0
|
|
||||||
;;
|
|
||||||
e) PACKAGER_EMAIL=$OPTARG
|
|
||||||
;;
|
|
||||||
esac
|
|
||||||
done
|
|
||||||
|
|
||||||
if [ -z ${PACKAGER_EMAIL+x} ]; then
|
|
||||||
show_help
|
|
||||||
exit -1
|
|
||||||
fi
|
|
||||||
|
|
||||||
|
|
||||||
set -e
|
|
||||||
|
|
||||||
# List of distributions to create PPA packages for:
|
|
||||||
LST_DISTROS=(xenial bionic eoan focal)
|
|
||||||
|
|
||||||
# Checks
|
|
||||||
# --------------------------------
|
|
||||||
if [ -f CMakeLists.txt ];
|
|
||||||
then
|
|
||||||
source package_scripts/prepare_debian_gen_snapshot_version.sh
|
|
||||||
echo "GTSAM version: ${GTSAM_VER_MMP}"
|
|
||||||
else
|
|
||||||
echo "ERROR: Run this script from the GTSAM root directory."
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
if [ -z "${gtsam_ubuntu_OUT_DIR}" ]; then
|
|
||||||
export gtsam_ubuntu_OUT_DIR="$HOME/gtsam_ubuntu"
|
|
||||||
fi
|
|
||||||
GTSAMSRC=`pwd`
|
|
||||||
if [ -z "${GTSAM_DEB_DIR}" ]; then
|
|
||||||
export GTSAM_DEB_DIR="$HOME/gtsam_debian"
|
|
||||||
fi
|
|
||||||
GTSAM_EXTERN_DEBIAN_DIR="$GTSAMSRC/debian/"
|
|
||||||
|
|
||||||
# Clean out dirs:
|
|
||||||
rm -fr $gtsam_ubuntu_OUT_DIR/
|
|
||||||
|
|
||||||
# -------------------------------------------------------------------
|
|
||||||
# And now create the custom packages for each Ubuntu distribution:
|
|
||||||
# -------------------------------------------------------------------
|
|
||||||
count=${#LST_DISTROS[@]}
|
|
||||||
IDXS=$(seq 0 $(expr $count - 1))
|
|
||||||
|
|
||||||
cp ${GTSAM_EXTERN_DEBIAN_DIR}/changelog /tmp/my_changelog
|
|
||||||
|
|
||||||
for IDX in ${IDXS};
|
|
||||||
do
|
|
||||||
DEBIAN_DIST=${LST_DISTROS[$IDX]}
|
|
||||||
|
|
||||||
# -------------------------------------------------------------------
|
|
||||||
# Call the standard "prepare_debian.sh" script:
|
|
||||||
# -------------------------------------------------------------------
|
|
||||||
cd ${GTSAMSRC}
|
|
||||||
bash package_scripts/prepare_debian.sh -e "$PACKAGER_EMAIL" -s -u -d ${DEBIAN_DIST} -c "${GTSAM_PKG_CUSTOM_CMAKE_PARAMS}"
|
|
||||||
|
|
||||||
CUR_SCRIPT_DIR="$( cd "$( dirname "${BASH_SOURCE[0]}" )" && pwd )"
|
|
||||||
source $CUR_SCRIPT_DIR/prepare_debian_gen_snapshot_version.sh # populate GTSAM_SNAPSHOT_VERSION
|
|
||||||
|
|
||||||
echo "===== Distribution: ${DEBIAN_DIST} ========="
|
|
||||||
cd ${GTSAM_DEB_DIR}/gtsam-${GTSAM_VER_MMP}~snapshot${GTSAM_SNAPSHOT_VERSION}${DEBIAN_DIST}/debian
|
|
||||||
#cp ${GTSAM_EXTERN_DEBIAN_DIR}/changelog changelog
|
|
||||||
cp /tmp/my_changelog changelog
|
|
||||||
DEBCHANGE_CMD="--newversion ${GTSAM_VERSION_STR}~snapshot${GTSAM_SNAPSHOT_VERSION}${DEBIAN_DIST}-1"
|
|
||||||
echo "Changing to a new Debian version: ${DEBCHANGE_CMD}"
|
|
||||||
echo "Adding a new entry to debian/changelog for distribution ${DEBIAN_DIST}"
|
|
||||||
DEBEMAIL="${PACKAGER_EMAIL}" debchange $DEBCHANGE_CMD -b --distribution ${DEBIAN_DIST} --force-distribution New version of upstream sources.
|
|
||||||
|
|
||||||
cp changelog /tmp/my_changelog
|
|
||||||
|
|
||||||
echo "Now, let's build the source Deb package with 'debuild -S -sa':"
|
|
||||||
cd ..
|
|
||||||
# -S: source package
|
|
||||||
# -sa: force inclusion of sources
|
|
||||||
# -d: don't check dependencies in this system
|
|
||||||
debuild -S -sa -d
|
|
||||||
|
|
||||||
# Make a copy of all these packages:
|
|
||||||
cd ..
|
|
||||||
mkdir -p $gtsam_ubuntu_OUT_DIR/$DEBIAN_DIST
|
|
||||||
cp gtsam_* $gtsam_ubuntu_OUT_DIR/${DEBIAN_DIST}/
|
|
||||||
echo ">>>>>> Saving packages to: $gtsam_ubuntu_OUT_DIR/$DEBIAN_DIST/"
|
|
||||||
done
|
|
||||||
|
|
||||||
|
|
||||||
exit 0
|
|
||||||
|
|
@ -1,64 +0,0 @@
|
||||||
#!/bin/sh
|
|
||||||
|
|
||||||
# Script to build a tarball with the matlab toolbox
|
|
||||||
|
|
||||||
# Detect platform
|
|
||||||
os=`uname -s`
|
|
||||||
arch=`uname -m`
|
|
||||||
if [ "$os" = "Linux" -a "$arch" = "x86_64" ]; then
|
|
||||||
platform=lin64
|
|
||||||
elif [ "$os" = "Linux" -a "$arch" = "i686" ]; then
|
|
||||||
platform=lin32
|
|
||||||
elif [ "$os" = "Darwin" -a "$arch" = "x86_64" ]; then
|
|
||||||
platform=mac64
|
|
||||||
else
|
|
||||||
echo "Unrecognized platform"
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
echo "Platform is ${platform}"
|
|
||||||
|
|
||||||
# Check for empty diectory
|
|
||||||
if [ ! -z "`ls`" ]; then
|
|
||||||
echo "Please run this script from an empty build directory"
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Check for boost
|
|
||||||
if [ -z "$1" ]; then
|
|
||||||
echo "Usage: $0 BOOSTTREE"
|
|
||||||
echo "BOOSTTREE should be a boost source tree compiled with toolbox_build_boost."
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Run cmake
|
|
||||||
cmake -DCMAKE_BUILD_TYPE=Release \
|
|
||||||
-DGTSAM_INSTALL_MATLAB_TOOLBOX:BOOL=ON \
|
|
||||||
-DCMAKE_INSTALL_PREFIX="$PWD/stage" \
|
|
||||||
-DBoost_NO_SYSTEM_PATHS:BOOL=ON \
|
|
||||||
-DBoost_USE_STATIC_LIBS:BOOL=ON \
|
|
||||||
-DBOOST_ROOT="$1" \
|
|
||||||
-DGTSAM_BUILD_TESTS:BOOL=OFF \
|
|
||||||
-DGTSAM_BUILD_TIMING:BOOL=OFF \
|
|
||||||
-DGTSAM_BUILD_EXAMPLES_ALWAYS:BOOL=OFF \
|
|
||||||
-DGTSAM_WITH_TBB:BOOL=OFF \
|
|
||||||
-DGTSAM_SUPPORT_NESTED_DISSECTION:BOOL=OFF \
|
|
||||||
-DGTSAM_INSTALL_GEOGRAPHICLIB:BOOL=OFF \
|
|
||||||
-DGTSAM_BUILD_UNSTABLE:BOOL=OFF \
|
|
||||||
-DGTSAM_MEX_BUILD_STATIC_MODULE:BOOL=ON ..
|
|
||||||
|
|
||||||
if [ $? -ne 0 ]; then
|
|
||||||
echo "CMake failed"
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Compile
|
|
||||||
make -j8 install
|
|
||||||
|
|
||||||
if [ $? -ne 0 ]; then
|
|
||||||
echo "Compile failed"
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Create package
|
|
||||||
tar czf gtsam-toolbox-3.2.0-$platform.tgz -C stage/gtsam_toolbox toolbox
|
|
||||||
|
|
@ -1,31 +0,0 @@
|
||||||
#!/bin/bash
|
|
||||||
|
|
||||||
function show_help {
|
|
||||||
echo "USAGE:"
|
|
||||||
echo ""
|
|
||||||
echo "- to display this help: "
|
|
||||||
echo "upload_all_gtsam_ppa.sh -h or -?"
|
|
||||||
echo ""
|
|
||||||
echo "- to upload to your PPA: "
|
|
||||||
echo "upload_all_gtsam_ppa.sh -p ppa:your_name/name_of_ppa"
|
|
||||||
echo ""
|
|
||||||
}
|
|
||||||
|
|
||||||
while getopts "h?p:" opt; do
|
|
||||||
case "$opt" in
|
|
||||||
h|\?)
|
|
||||||
show_help
|
|
||||||
exit 0
|
|
||||||
;;
|
|
||||||
p) ppa_name=$OPTARG
|
|
||||||
;;
|
|
||||||
esac
|
|
||||||
done
|
|
||||||
|
|
||||||
if [ -z ${ppa_name+x} ]; then
|
|
||||||
show_help
|
|
||||||
exit -1
|
|
||||||
fi
|
|
||||||
|
|
||||||
|
|
||||||
find . -name '*.changes' | xargs -I FIL dput ${ppa_name} FIL
|
|
||||||
|
|
@ -350,7 +350,10 @@ void Module::emit_cython_pxd(FileWriter& pxdFile) const {
|
||||||
" T* get()\n"
|
" T* get()\n"
|
||||||
" long use_count() const\n"
|
" long use_count() const\n"
|
||||||
" T& operator*()\n\n"
|
" T& operator*()\n\n"
|
||||||
" cdef shared_ptr[T] dynamic_pointer_cast[T,U](const shared_ptr[U]& r)\n"
|
" cdef shared_ptr[T] dynamic_pointer_cast[T,U](const shared_ptr[U]& r)\n\n";
|
||||||
|
|
||||||
|
// gtsam alignment-friendly shared_ptr
|
||||||
|
pxdFile.oss << "cdef extern from \"gtsam/base/make_shared.h\" namespace \"gtsam\":\n"
|
||||||
" cdef shared_ptr[T] make_shared[T](const T& r)\n\n";
|
" cdef shared_ptr[T] make_shared[T](const T& r)\n\n";
|
||||||
|
|
||||||
for(const TypedefPair& types: typedefs)
|
for(const TypedefPair& types: typedefs)
|
||||||
|
|
|
||||||
|
|
@ -1 +0,0 @@
|
||||||
Subproject commit b3bf248eec9cad8260753c982e1ae6cb72fff470
|
|
||||||
|
|
@ -0,0 +1,70 @@
|
||||||
|
version: 1.0.{build}
|
||||||
|
image:
|
||||||
|
- Visual Studio 2017
|
||||||
|
- Visual Studio 2015
|
||||||
|
test: off
|
||||||
|
skip_branch_with_pr: true
|
||||||
|
build:
|
||||||
|
parallel: true
|
||||||
|
platform:
|
||||||
|
- x64
|
||||||
|
- x86
|
||||||
|
environment:
|
||||||
|
matrix:
|
||||||
|
- PYTHON: 36
|
||||||
|
CPP: 14
|
||||||
|
CONFIG: Debug
|
||||||
|
- PYTHON: 27
|
||||||
|
CPP: 14
|
||||||
|
CONFIG: Debug
|
||||||
|
- CONDA: 36
|
||||||
|
CPP: latest
|
||||||
|
CONFIG: Release
|
||||||
|
matrix:
|
||||||
|
exclude:
|
||||||
|
- image: Visual Studio 2015
|
||||||
|
platform: x86
|
||||||
|
- image: Visual Studio 2015
|
||||||
|
CPP: latest
|
||||||
|
- image: Visual Studio 2017
|
||||||
|
CPP: latest
|
||||||
|
platform: x86
|
||||||
|
install:
|
||||||
|
- ps: |
|
||||||
|
if ($env:PLATFORM -eq "x64") { $env:CMAKE_ARCH = "x64" }
|
||||||
|
if ($env:APPVEYOR_JOB_NAME -like "*Visual Studio 2017*") {
|
||||||
|
$env:CMAKE_GENERATOR = "Visual Studio 15 2017"
|
||||||
|
$env:CMAKE_INCLUDE_PATH = "C:\Libraries\boost_1_64_0"
|
||||||
|
$env:CXXFLAGS = "-permissive-"
|
||||||
|
} else {
|
||||||
|
$env:CMAKE_GENERATOR = "Visual Studio 14 2015"
|
||||||
|
}
|
||||||
|
if ($env:PYTHON) {
|
||||||
|
if ($env:PLATFORM -eq "x64") { $env:PYTHON = "$env:PYTHON-x64" }
|
||||||
|
$env:PATH = "C:\Python$env:PYTHON\;C:\Python$env:PYTHON\Scripts\;$env:PATH"
|
||||||
|
python -W ignore -m pip install --upgrade pip wheel
|
||||||
|
python -W ignore -m pip install pytest numpy --no-warn-script-location
|
||||||
|
} elseif ($env:CONDA) {
|
||||||
|
if ($env:CONDA -eq "27") { $env:CONDA = "" }
|
||||||
|
if ($env:PLATFORM -eq "x64") { $env:CONDA = "$env:CONDA-x64" }
|
||||||
|
$env:PATH = "C:\Miniconda$env:CONDA\;C:\Miniconda$env:CONDA\Scripts\;$env:PATH"
|
||||||
|
$env:PYTHONHOME = "C:\Miniconda$env:CONDA"
|
||||||
|
conda --version
|
||||||
|
conda install -y -q pytest numpy scipy
|
||||||
|
}
|
||||||
|
- ps: |
|
||||||
|
Start-FileDownload 'http://bitbucket.org/eigen/eigen/get/3.3.3.zip'
|
||||||
|
7z x 3.3.3.zip -y > $null
|
||||||
|
$env:CMAKE_INCLUDE_PATH = "eigen-eigen-67e894c6cd8f;$env:CMAKE_INCLUDE_PATH"
|
||||||
|
build_script:
|
||||||
|
- cmake -G "%CMAKE_GENERATOR%" -A "%CMAKE_ARCH%"
|
||||||
|
-DPYBIND11_CPP_STANDARD=/std:c++%CPP%
|
||||||
|
-DPYBIND11_WERROR=ON
|
||||||
|
-DDOWNLOAD_CATCH=ON
|
||||||
|
-DCMAKE_SUPPRESS_REGENERATION=1
|
||||||
|
.
|
||||||
|
- set MSBuildLogger="C:\Program Files\AppVeyor\BuildAgent\Appveyor.MSBuildLogger.dll"
|
||||||
|
- cmake --build . --config %CONFIG% --target pytest -- /m /v:m /logger:%MSBuildLogger%
|
||||||
|
- cmake --build . --config %CONFIG% --target cpptest -- /m /v:m /logger:%MSBuildLogger%
|
||||||
|
- if "%CPP%"=="latest" (cmake --build . --config %CONFIG% --target test_cmake_build -- /m /v:m /logger:%MSBuildLogger%)
|
||||||
|
on_failure: if exist "tests\test_cmake_build" type tests\test_cmake_build\*.log*
|
||||||
|
|
@ -0,0 +1,38 @@
|
||||||
|
CMakeCache.txt
|
||||||
|
CMakeFiles
|
||||||
|
Makefile
|
||||||
|
cmake_install.cmake
|
||||||
|
.DS_Store
|
||||||
|
*.so
|
||||||
|
*.pyd
|
||||||
|
*.dll
|
||||||
|
*.sln
|
||||||
|
*.sdf
|
||||||
|
*.opensdf
|
||||||
|
*.vcxproj
|
||||||
|
*.filters
|
||||||
|
example.dir
|
||||||
|
Win32
|
||||||
|
x64
|
||||||
|
Release
|
||||||
|
Debug
|
||||||
|
.vs
|
||||||
|
CTestTestfile.cmake
|
||||||
|
Testing
|
||||||
|
autogen
|
||||||
|
MANIFEST
|
||||||
|
/.ninja_*
|
||||||
|
/*.ninja
|
||||||
|
/docs/.build
|
||||||
|
*.py[co]
|
||||||
|
*.egg-info
|
||||||
|
*~
|
||||||
|
.*.swp
|
||||||
|
.DS_Store
|
||||||
|
/dist
|
||||||
|
/build
|
||||||
|
/cmake/
|
||||||
|
.cache/
|
||||||
|
sosize-*.txt
|
||||||
|
pybind11Config*.cmake
|
||||||
|
pybind11Targets.cmake
|
||||||
|
|
@ -0,0 +1,3 @@
|
||||||
|
[submodule "tools/clang"]
|
||||||
|
path = tools/clang
|
||||||
|
url = ../../wjakob/clang-cindex-python3
|
||||||
|
|
@ -0,0 +1,3 @@
|
||||||
|
python:
|
||||||
|
version: 3
|
||||||
|
requirements_file: docs/requirements.txt
|
||||||
|
|
@ -0,0 +1,280 @@
|
||||||
|
language: cpp
|
||||||
|
matrix:
|
||||||
|
include:
|
||||||
|
# This config does a few things:
|
||||||
|
# - Checks C++ and Python code styles (check-style.sh and flake8).
|
||||||
|
# - Makes sure sphinx can build the docs without any errors or warnings.
|
||||||
|
# - Tests setup.py sdist and install (all header files should be present).
|
||||||
|
# - Makes sure that everything still works without optional deps (numpy/scipy/eigen) and
|
||||||
|
# also tests the automatic discovery functions in CMake (Python version, C++ standard).
|
||||||
|
- os: linux
|
||||||
|
dist: xenial # Necessary to run doxygen 1.8.15
|
||||||
|
name: Style, docs, and pip
|
||||||
|
cache: false
|
||||||
|
before_install:
|
||||||
|
- pyenv global $(pyenv whence 2to3) # activate all python versions
|
||||||
|
- PY_CMD=python3
|
||||||
|
- $PY_CMD -m pip install --user --upgrade pip wheel setuptools
|
||||||
|
install:
|
||||||
|
- $PY_CMD -m pip install --user --upgrade sphinx sphinx_rtd_theme breathe flake8 pep8-naming pytest
|
||||||
|
- curl -fsSL https://sourceforge.net/projects/doxygen/files/rel-1.8.15/doxygen-1.8.15.linux.bin.tar.gz/download | tar xz
|
||||||
|
- export PATH="$PWD/doxygen-1.8.15/bin:$PATH"
|
||||||
|
script:
|
||||||
|
- tools/check-style.sh
|
||||||
|
- flake8
|
||||||
|
- $PY_CMD -m sphinx -W -b html docs docs/.build
|
||||||
|
- |
|
||||||
|
# Make sure setup.py distributes and installs all the headers
|
||||||
|
$PY_CMD setup.py sdist
|
||||||
|
$PY_CMD -m pip install --user -U ./dist/*
|
||||||
|
installed=$($PY_CMD -c "import pybind11; print(pybind11.get_include(True) + '/pybind11')")
|
||||||
|
diff -rq $installed ./include/pybind11
|
||||||
|
- |
|
||||||
|
# Barebones build
|
||||||
|
cmake -DCMAKE_BUILD_TYPE=Debug -DPYBIND11_WERROR=ON -DDOWNLOAD_CATCH=ON -DPYTHON_EXECUTABLE=$(which $PY_CMD) .
|
||||||
|
make pytest -j 2
|
||||||
|
make cpptest -j 2
|
||||||
|
# The following are regular test configurations, including optional dependencies.
|
||||||
|
# With regard to each other they differ in Python version, C++ standard and compiler.
|
||||||
|
- os: linux
|
||||||
|
dist: trusty
|
||||||
|
name: Python 2.7, c++11, gcc 4.8
|
||||||
|
env: PYTHON=2.7 CPP=11 GCC=4.8
|
||||||
|
addons:
|
||||||
|
apt:
|
||||||
|
packages:
|
||||||
|
- cmake=2.\*
|
||||||
|
- cmake-data=2.\*
|
||||||
|
- os: linux
|
||||||
|
dist: trusty
|
||||||
|
name: Python 3.6, c++11, gcc 4.8
|
||||||
|
env: PYTHON=3.6 CPP=11 GCC=4.8
|
||||||
|
addons:
|
||||||
|
apt:
|
||||||
|
sources:
|
||||||
|
- deadsnakes
|
||||||
|
packages:
|
||||||
|
- python3.6-dev
|
||||||
|
- python3.6-venv
|
||||||
|
- cmake=2.\*
|
||||||
|
- cmake-data=2.\*
|
||||||
|
- os: linux
|
||||||
|
dist: trusty
|
||||||
|
env: PYTHON=2.7 CPP=14 GCC=6 CMAKE=1
|
||||||
|
name: Python 2.7, c++14, gcc 4.8, CMake test
|
||||||
|
addons:
|
||||||
|
apt:
|
||||||
|
sources:
|
||||||
|
- ubuntu-toolchain-r-test
|
||||||
|
packages:
|
||||||
|
- g++-6
|
||||||
|
- os: linux
|
||||||
|
dist: trusty
|
||||||
|
name: Python 3.5, c++14, gcc 6, Debug build
|
||||||
|
# N.B. `ensurepip` could be installed transitively by `python3.5-venv`, but
|
||||||
|
# seems to have apt conflicts (at least for Trusty). Use Docker instead.
|
||||||
|
services: docker
|
||||||
|
env: DOCKER=debian:stretch PYTHON=3.5 CPP=14 GCC=6 DEBUG=1
|
||||||
|
- os: linux
|
||||||
|
dist: xenial
|
||||||
|
env: PYTHON=3.6 CPP=17 GCC=7
|
||||||
|
name: Python 3.6, c++17, gcc 7
|
||||||
|
addons:
|
||||||
|
apt:
|
||||||
|
sources:
|
||||||
|
- deadsnakes
|
||||||
|
- ubuntu-toolchain-r-test
|
||||||
|
packages:
|
||||||
|
- g++-7
|
||||||
|
- python3.6-dev
|
||||||
|
- python3.6-venv
|
||||||
|
- os: linux
|
||||||
|
dist: xenial
|
||||||
|
env: PYTHON=3.6 CPP=17 CLANG=7
|
||||||
|
name: Python 3.6, c++17, Clang 7
|
||||||
|
addons:
|
||||||
|
apt:
|
||||||
|
sources:
|
||||||
|
- deadsnakes
|
||||||
|
- llvm-toolchain-xenial-7
|
||||||
|
packages:
|
||||||
|
- python3.6-dev
|
||||||
|
- python3.6-venv
|
||||||
|
- clang-7
|
||||||
|
- libclang-7-dev
|
||||||
|
- llvm-7-dev
|
||||||
|
- lld-7
|
||||||
|
- libc++-7-dev
|
||||||
|
- libc++abi-7-dev # Why is this necessary???
|
||||||
|
- os: osx
|
||||||
|
name: Python 2.7, c++14, AppleClang 7.3, CMake test
|
||||||
|
osx_image: xcode7.3
|
||||||
|
env: PYTHON=2.7 CPP=14 CLANG CMAKE=1
|
||||||
|
- os: osx
|
||||||
|
name: Python 3.7, c++14, AppleClang 9, Debug build
|
||||||
|
osx_image: xcode9
|
||||||
|
env: PYTHON=3.7 CPP=14 CLANG DEBUG=1
|
||||||
|
# Test a PyPy 2.7 build
|
||||||
|
- os: linux
|
||||||
|
dist: trusty
|
||||||
|
env: PYPY=5.8 PYTHON=2.7 CPP=11 GCC=4.8
|
||||||
|
name: PyPy 5.8, Python 2.7, c++11, gcc 4.8
|
||||||
|
addons:
|
||||||
|
apt:
|
||||||
|
packages:
|
||||||
|
- libblas-dev
|
||||||
|
- liblapack-dev
|
||||||
|
- gfortran
|
||||||
|
# Build in 32-bit mode and tests against the CMake-installed version
|
||||||
|
- os: linux
|
||||||
|
dist: trusty
|
||||||
|
services: docker
|
||||||
|
env: DOCKER=i386/debian:stretch PYTHON=3.5 CPP=14 GCC=6 INSTALL=1
|
||||||
|
name: Python 3.4, c++14, gcc 6, 32-bit
|
||||||
|
script:
|
||||||
|
- |
|
||||||
|
# Consolidated 32-bit Docker Build + Install
|
||||||
|
set -ex
|
||||||
|
$SCRIPT_RUN_PREFIX sh -c "
|
||||||
|
set -ex
|
||||||
|
cmake ${CMAKE_EXTRA_ARGS} -DPYBIND11_INSTALL=1 -DPYBIND11_TEST=0 .
|
||||||
|
make install
|
||||||
|
cp -a tests /pybind11-tests
|
||||||
|
mkdir /build-tests && cd /build-tests
|
||||||
|
cmake ../pybind11-tests ${CMAKE_EXTRA_ARGS} -DPYBIND11_WERROR=ON
|
||||||
|
make pytest -j 2"
|
||||||
|
set +ex
|
||||||
|
cache:
|
||||||
|
directories:
|
||||||
|
- $HOME/.local/bin
|
||||||
|
- $HOME/.local/lib
|
||||||
|
- $HOME/.local/include
|
||||||
|
- $HOME/Library/Python
|
||||||
|
before_install:
|
||||||
|
- |
|
||||||
|
# Configure build variables
|
||||||
|
set -ex
|
||||||
|
if [ "$TRAVIS_OS_NAME" = "linux" ]; then
|
||||||
|
if [ -n "$CLANG" ]; then
|
||||||
|
export CXX=clang++-$CLANG CC=clang-$CLANG
|
||||||
|
EXTRA_PACKAGES+=" clang-$CLANG llvm-$CLANG-dev"
|
||||||
|
else
|
||||||
|
if [ -z "$GCC" ]; then GCC=4.8
|
||||||
|
else EXTRA_PACKAGES+=" g++-$GCC"
|
||||||
|
fi
|
||||||
|
export CXX=g++-$GCC CC=gcc-$GCC
|
||||||
|
fi
|
||||||
|
elif [ "$TRAVIS_OS_NAME" = "osx" ]; then
|
||||||
|
export CXX=clang++ CC=clang;
|
||||||
|
fi
|
||||||
|
if [ -n "$CPP" ]; then CPP=-std=c++$CPP; fi
|
||||||
|
if [ "${PYTHON:0:1}" = "3" ]; then PY=3; fi
|
||||||
|
if [ -n "$DEBUG" ]; then CMAKE_EXTRA_ARGS+=" -DCMAKE_BUILD_TYPE=Debug"; fi
|
||||||
|
set +ex
|
||||||
|
- |
|
||||||
|
# Initialize environment
|
||||||
|
set -ex
|
||||||
|
if [ -n "$DOCKER" ]; then
|
||||||
|
docker pull $DOCKER
|
||||||
|
|
||||||
|
containerid=$(docker run --detach --tty \
|
||||||
|
--volume="$PWD":/pybind11 --workdir=/pybind11 \
|
||||||
|
--env="CC=$CC" --env="CXX=$CXX" --env="DEBIAN_FRONTEND=$DEBIAN_FRONTEND" \
|
||||||
|
--env=GCC_COLORS=\ \
|
||||||
|
$DOCKER)
|
||||||
|
SCRIPT_RUN_PREFIX="docker exec --tty $containerid"
|
||||||
|
$SCRIPT_RUN_PREFIX sh -c 'for s in 0 15; do sleep $s; apt-get update && apt-get -qy dist-upgrade && break; done'
|
||||||
|
else
|
||||||
|
if [ "$PYPY" = "5.8" ]; then
|
||||||
|
curl -fSL https://bitbucket.org/pypy/pypy/downloads/pypy2-v5.8.0-linux64.tar.bz2 | tar xj
|
||||||
|
PY_CMD=$(echo `pwd`/pypy2-v5.8.0-linux64/bin/pypy)
|
||||||
|
CMAKE_EXTRA_ARGS+=" -DPYTHON_EXECUTABLE:FILEPATH=$PY_CMD"
|
||||||
|
else
|
||||||
|
PY_CMD=python$PYTHON
|
||||||
|
if [ "$TRAVIS_OS_NAME" = "osx" ]; then
|
||||||
|
if [ "$PY" = "3" ]; then
|
||||||
|
brew update && brew upgrade python
|
||||||
|
else
|
||||||
|
curl -fsSL https://bootstrap.pypa.io/get-pip.py | $PY_CMD - --user
|
||||||
|
fi
|
||||||
|
fi
|
||||||
|
fi
|
||||||
|
if [ "$PY" = 3 ] || [ -n "$PYPY" ]; then
|
||||||
|
$PY_CMD -m ensurepip --user
|
||||||
|
fi
|
||||||
|
$PY_CMD --version
|
||||||
|
$PY_CMD -m pip install --user --upgrade pip wheel
|
||||||
|
fi
|
||||||
|
set +ex
|
||||||
|
install:
|
||||||
|
- |
|
||||||
|
# Install dependencies
|
||||||
|
set -ex
|
||||||
|
cmake --version
|
||||||
|
if [ -n "$DOCKER" ]; then
|
||||||
|
if [ -n "$DEBUG" ]; then
|
||||||
|
PY_DEBUG="python$PYTHON-dbg python$PY-scipy-dbg"
|
||||||
|
CMAKE_EXTRA_ARGS+=" -DPYTHON_EXECUTABLE=/usr/bin/python${PYTHON}dm"
|
||||||
|
fi
|
||||||
|
$SCRIPT_RUN_PREFIX sh -c "for s in 0 15; do sleep \$s; \
|
||||||
|
apt-get -qy --no-install-recommends install \
|
||||||
|
$PY_DEBUG python$PYTHON-dev python$PY-pytest python$PY-scipy \
|
||||||
|
libeigen3-dev libboost-dev cmake make ${EXTRA_PACKAGES} && break; done"
|
||||||
|
else
|
||||||
|
|
||||||
|
if [ "$CLANG" = "7" ]; then
|
||||||
|
export CXXFLAGS="-stdlib=libc++"
|
||||||
|
fi
|
||||||
|
|
||||||
|
export NPY_NUM_BUILD_JOBS=2
|
||||||
|
echo "Installing pytest, numpy, scipy..."
|
||||||
|
local PIP_CMD=""
|
||||||
|
if [ -n $PYPY ]; then
|
||||||
|
# For expediency, install only versions that are available on the extra index.
|
||||||
|
travis_wait 30 \
|
||||||
|
$PY_CMD -m pip install --user --upgrade --extra-index-url https://imaginary.ca/trusty-pypi \
|
||||||
|
pytest numpy==1.15.4 scipy==1.2.0
|
||||||
|
else
|
||||||
|
$PY_CMD -m pip install --user --upgrade pytest numpy scipy
|
||||||
|
fi
|
||||||
|
echo "done."
|
||||||
|
|
||||||
|
mkdir eigen
|
||||||
|
curl -fsSL https://bitbucket.org/eigen/eigen/get/3.3.4.tar.bz2 | \
|
||||||
|
tar --extract -j --directory=eigen --strip-components=1
|
||||||
|
export CMAKE_INCLUDE_PATH="${CMAKE_INCLUDE_PATH:+$CMAKE_INCLUDE_PATH:}$PWD/eigen"
|
||||||
|
fi
|
||||||
|
set +ex
|
||||||
|
script:
|
||||||
|
- |
|
||||||
|
# CMake Configuration
|
||||||
|
set -ex
|
||||||
|
$SCRIPT_RUN_PREFIX cmake ${CMAKE_EXTRA_ARGS} \
|
||||||
|
-DPYBIND11_PYTHON_VERSION=$PYTHON \
|
||||||
|
-DPYBIND11_CPP_STANDARD=$CPP \
|
||||||
|
-DPYBIND11_WERROR=${WERROR:-ON} \
|
||||||
|
-DDOWNLOAD_CATCH=${DOWNLOAD_CATCH:-ON} \
|
||||||
|
.
|
||||||
|
set +ex
|
||||||
|
- |
|
||||||
|
# pytest
|
||||||
|
set -ex
|
||||||
|
$SCRIPT_RUN_PREFIX make pytest -j 2 VERBOSE=1
|
||||||
|
set +ex
|
||||||
|
- |
|
||||||
|
# cpptest
|
||||||
|
set -ex
|
||||||
|
$SCRIPT_RUN_PREFIX make cpptest -j 2
|
||||||
|
set +ex
|
||||||
|
- |
|
||||||
|
# CMake Build Interface
|
||||||
|
set -ex
|
||||||
|
if [ -n "$CMAKE" ]; then $SCRIPT_RUN_PREFIX make test_cmake_build; fi
|
||||||
|
set +ex
|
||||||
|
after_failure: cat tests/test_cmake_build/*.log*
|
||||||
|
after_script:
|
||||||
|
- |
|
||||||
|
# Cleanup (Docker)
|
||||||
|
set -ex
|
||||||
|
if [ -n "$DOCKER" ]; then docker stop "$containerid"; docker rm "$containerid"; fi
|
||||||
|
set +ex
|
||||||
|
|
@ -0,0 +1,157 @@
|
||||||
|
# CMakeLists.txt -- Build system for the pybind11 modules
|
||||||
|
#
|
||||||
|
# Copyright (c) 2015 Wenzel Jakob <wenzel@inf.ethz.ch>
|
||||||
|
#
|
||||||
|
# All rights reserved. Use of this source code is governed by a
|
||||||
|
# BSD-style license that can be found in the LICENSE file.
|
||||||
|
|
||||||
|
cmake_minimum_required(VERSION 2.8.12)
|
||||||
|
|
||||||
|
if (POLICY CMP0048)
|
||||||
|
# cmake warns if loaded from a min-3.0-required parent dir, so silence the warning:
|
||||||
|
cmake_policy(SET CMP0048 NEW)
|
||||||
|
endif()
|
||||||
|
|
||||||
|
# CMake versions < 3.4.0 do not support try_compile/pthread checks without C as active language.
|
||||||
|
if(CMAKE_VERSION VERSION_LESS 3.4.0)
|
||||||
|
project(pybind11)
|
||||||
|
else()
|
||||||
|
project(pybind11 CXX)
|
||||||
|
endif()
|
||||||
|
|
||||||
|
# Check if pybind11 is being used directly or via add_subdirectory
|
||||||
|
set(PYBIND11_MASTER_PROJECT OFF)
|
||||||
|
if (CMAKE_CURRENT_SOURCE_DIR STREQUAL CMAKE_SOURCE_DIR)
|
||||||
|
set(PYBIND11_MASTER_PROJECT ON)
|
||||||
|
endif()
|
||||||
|
|
||||||
|
option(PYBIND11_INSTALL "Install pybind11 header files?" ${PYBIND11_MASTER_PROJECT})
|
||||||
|
option(PYBIND11_TEST "Build pybind11 test suite?" ${PYBIND11_MASTER_PROJECT})
|
||||||
|
|
||||||
|
list(APPEND CMAKE_MODULE_PATH "${CMAKE_CURRENT_LIST_DIR}/tools")
|
||||||
|
|
||||||
|
include(pybind11Tools)
|
||||||
|
|
||||||
|
# Cache variables so pybind11_add_module can be used in parent projects
|
||||||
|
set(PYBIND11_INCLUDE_DIR "${CMAKE_CURRENT_LIST_DIR}/include" CACHE INTERNAL "")
|
||||||
|
set(PYTHON_INCLUDE_DIRS ${PYTHON_INCLUDE_DIRS} CACHE INTERNAL "")
|
||||||
|
set(PYTHON_LIBRARIES ${PYTHON_LIBRARIES} CACHE INTERNAL "")
|
||||||
|
set(PYTHON_MODULE_PREFIX ${PYTHON_MODULE_PREFIX} CACHE INTERNAL "")
|
||||||
|
set(PYTHON_MODULE_EXTENSION ${PYTHON_MODULE_EXTENSION} CACHE INTERNAL "")
|
||||||
|
set(PYTHON_VERSION_MAJOR ${PYTHON_VERSION_MAJOR} CACHE INTERNAL "")
|
||||||
|
set(PYTHON_VERSION_MINOR ${PYTHON_VERSION_MINOR} CACHE INTERNAL "")
|
||||||
|
|
||||||
|
# NB: when adding a header don't forget to also add it to setup.py
|
||||||
|
set(PYBIND11_HEADERS
|
||||||
|
include/pybind11/detail/class.h
|
||||||
|
include/pybind11/detail/common.h
|
||||||
|
include/pybind11/detail/descr.h
|
||||||
|
include/pybind11/detail/init.h
|
||||||
|
include/pybind11/detail/internals.h
|
||||||
|
include/pybind11/detail/typeid.h
|
||||||
|
include/pybind11/attr.h
|
||||||
|
include/pybind11/buffer_info.h
|
||||||
|
include/pybind11/cast.h
|
||||||
|
include/pybind11/chrono.h
|
||||||
|
include/pybind11/common.h
|
||||||
|
include/pybind11/complex.h
|
||||||
|
include/pybind11/options.h
|
||||||
|
include/pybind11/eigen.h
|
||||||
|
include/pybind11/embed.h
|
||||||
|
include/pybind11/eval.h
|
||||||
|
include/pybind11/functional.h
|
||||||
|
include/pybind11/numpy.h
|
||||||
|
include/pybind11/operators.h
|
||||||
|
include/pybind11/pybind11.h
|
||||||
|
include/pybind11/pytypes.h
|
||||||
|
include/pybind11/stl.h
|
||||||
|
include/pybind11/stl_bind.h
|
||||||
|
)
|
||||||
|
string(REPLACE "include/" "${CMAKE_CURRENT_SOURCE_DIR}/include/"
|
||||||
|
PYBIND11_HEADERS "${PYBIND11_HEADERS}")
|
||||||
|
|
||||||
|
if (PYBIND11_TEST)
|
||||||
|
add_subdirectory(tests)
|
||||||
|
endif()
|
||||||
|
|
||||||
|
include(GNUInstallDirs)
|
||||||
|
include(CMakePackageConfigHelpers)
|
||||||
|
|
||||||
|
# extract project version from source
|
||||||
|
file(STRINGS "${PYBIND11_INCLUDE_DIR}/pybind11/detail/common.h" pybind11_version_defines
|
||||||
|
REGEX "#define PYBIND11_VERSION_(MAJOR|MINOR|PATCH) ")
|
||||||
|
foreach(ver ${pybind11_version_defines})
|
||||||
|
if (ver MATCHES "#define PYBIND11_VERSION_(MAJOR|MINOR|PATCH) +([^ ]+)$")
|
||||||
|
set(PYBIND11_VERSION_${CMAKE_MATCH_1} "${CMAKE_MATCH_2}" CACHE INTERNAL "")
|
||||||
|
endif()
|
||||||
|
endforeach()
|
||||||
|
set(${PROJECT_NAME}_VERSION ${PYBIND11_VERSION_MAJOR}.${PYBIND11_VERSION_MINOR}.${PYBIND11_VERSION_PATCH})
|
||||||
|
message(STATUS "pybind11 v${${PROJECT_NAME}_VERSION}")
|
||||||
|
|
||||||
|
option (USE_PYTHON_INCLUDE_DIR "Install pybind11 headers in Python include directory instead of default installation prefix" OFF)
|
||||||
|
if (USE_PYTHON_INCLUDE_DIR)
|
||||||
|
file(RELATIVE_PATH CMAKE_INSTALL_INCLUDEDIR ${CMAKE_INSTALL_PREFIX} ${PYTHON_INCLUDE_DIRS})
|
||||||
|
endif()
|
||||||
|
|
||||||
|
if(NOT (CMAKE_VERSION VERSION_LESS 3.0)) # CMake >= 3.0
|
||||||
|
# Build an interface library target:
|
||||||
|
add_library(pybind11 INTERFACE)
|
||||||
|
add_library(pybind11::pybind11 ALIAS pybind11) # to match exported target
|
||||||
|
target_include_directories(pybind11 INTERFACE $<BUILD_INTERFACE:${PYBIND11_INCLUDE_DIR}>
|
||||||
|
$<BUILD_INTERFACE:${PYTHON_INCLUDE_DIRS}>
|
||||||
|
$<INSTALL_INTERFACE:${CMAKE_INSTALL_INCLUDEDIR}>)
|
||||||
|
target_compile_options(pybind11 INTERFACE $<BUILD_INTERFACE:${PYBIND11_CPP_STANDARD}>)
|
||||||
|
|
||||||
|
add_library(module INTERFACE)
|
||||||
|
add_library(pybind11::module ALIAS module)
|
||||||
|
if(NOT MSVC)
|
||||||
|
target_compile_options(module INTERFACE -fvisibility=hidden)
|
||||||
|
endif()
|
||||||
|
target_link_libraries(module INTERFACE pybind11::pybind11)
|
||||||
|
if(WIN32 OR CYGWIN)
|
||||||
|
target_link_libraries(module INTERFACE $<BUILD_INTERFACE:${PYTHON_LIBRARIES}>)
|
||||||
|
elseif(APPLE)
|
||||||
|
target_link_libraries(module INTERFACE "-undefined dynamic_lookup")
|
||||||
|
endif()
|
||||||
|
|
||||||
|
add_library(embed INTERFACE)
|
||||||
|
add_library(pybind11::embed ALIAS embed)
|
||||||
|
target_link_libraries(embed INTERFACE pybind11::pybind11 $<BUILD_INTERFACE:${PYTHON_LIBRARIES}>)
|
||||||
|
endif()
|
||||||
|
|
||||||
|
if (PYBIND11_INSTALL)
|
||||||
|
install(DIRECTORY ${PYBIND11_INCLUDE_DIR}/pybind11 DESTINATION ${CMAKE_INSTALL_INCLUDEDIR})
|
||||||
|
# GNUInstallDirs "DATADIR" wrong here; CMake search path wants "share".
|
||||||
|
set(PYBIND11_CMAKECONFIG_INSTALL_DIR "share/cmake/${PROJECT_NAME}" CACHE STRING "install path for pybind11Config.cmake")
|
||||||
|
|
||||||
|
configure_package_config_file(tools/${PROJECT_NAME}Config.cmake.in
|
||||||
|
"${CMAKE_CURRENT_BINARY_DIR}/${PROJECT_NAME}Config.cmake"
|
||||||
|
INSTALL_DESTINATION ${PYBIND11_CMAKECONFIG_INSTALL_DIR})
|
||||||
|
# Remove CMAKE_SIZEOF_VOID_P from ConfigVersion.cmake since the library does
|
||||||
|
# not depend on architecture specific settings or libraries.
|
||||||
|
set(_PYBIND11_CMAKE_SIZEOF_VOID_P ${CMAKE_SIZEOF_VOID_P})
|
||||||
|
unset(CMAKE_SIZEOF_VOID_P)
|
||||||
|
write_basic_package_version_file(${CMAKE_CURRENT_BINARY_DIR}/${PROJECT_NAME}ConfigVersion.cmake
|
||||||
|
VERSION ${${PROJECT_NAME}_VERSION}
|
||||||
|
COMPATIBILITY AnyNewerVersion)
|
||||||
|
set(CMAKE_SIZEOF_VOID_P ${_PYBIND11_CMAKE_SIZEOF_VOID_P})
|
||||||
|
install(FILES ${CMAKE_CURRENT_BINARY_DIR}/${PROJECT_NAME}Config.cmake
|
||||||
|
${CMAKE_CURRENT_BINARY_DIR}/${PROJECT_NAME}ConfigVersion.cmake
|
||||||
|
tools/FindPythonLibsNew.cmake
|
||||||
|
tools/pybind11Tools.cmake
|
||||||
|
DESTINATION ${PYBIND11_CMAKECONFIG_INSTALL_DIR})
|
||||||
|
|
||||||
|
if(NOT (CMAKE_VERSION VERSION_LESS 3.0))
|
||||||
|
if(NOT PYBIND11_EXPORT_NAME)
|
||||||
|
set(PYBIND11_EXPORT_NAME "${PROJECT_NAME}Targets")
|
||||||
|
endif()
|
||||||
|
|
||||||
|
install(TARGETS pybind11 module embed
|
||||||
|
EXPORT "${PYBIND11_EXPORT_NAME}")
|
||||||
|
if(PYBIND11_MASTER_PROJECT)
|
||||||
|
install(EXPORT "${PYBIND11_EXPORT_NAME}"
|
||||||
|
NAMESPACE "${PROJECT_NAME}::"
|
||||||
|
DESTINATION ${PYBIND11_CMAKECONFIG_INSTALL_DIR})
|
||||||
|
endif()
|
||||||
|
endif()
|
||||||
|
endif()
|
||||||
|
|
@ -0,0 +1,49 @@
|
||||||
|
Thank you for your interest in this project! Please refer to the following
|
||||||
|
sections on how to contribute code and bug reports.
|
||||||
|
|
||||||
|
### Reporting bugs
|
||||||
|
|
||||||
|
At the moment, this project is run in the spare time of a single person
|
||||||
|
([Wenzel Jakob](http://rgl.epfl.ch/people/wjakob)) with very limited resources
|
||||||
|
for issue tracker tickets. Thus, before submitting a question or bug report,
|
||||||
|
please take a moment of your time and ensure that your issue isn't already
|
||||||
|
discussed in the project documentation provided at
|
||||||
|
[http://pybind11.readthedocs.org/en/latest](http://pybind11.readthedocs.org/en/latest).
|
||||||
|
|
||||||
|
Assuming that you have identified a previously unknown problem or an important
|
||||||
|
question, it's essential that you submit a self-contained and minimal piece of
|
||||||
|
code that reproduces the problem. In other words: no external dependencies,
|
||||||
|
isolate the function(s) that cause breakage, submit matched and complete C++
|
||||||
|
and Python snippets that can be easily compiled and run on my end.
|
||||||
|
|
||||||
|
## Pull requests
|
||||||
|
Contributions are submitted, reviewed, and accepted using Github pull requests.
|
||||||
|
Please refer to [this
|
||||||
|
article](https://help.github.com/articles/using-pull-requests) for details and
|
||||||
|
adhere to the following rules to make the process as smooth as possible:
|
||||||
|
|
||||||
|
* Make a new branch for every feature you're working on.
|
||||||
|
* Make small and clean pull requests that are easy to review but make sure they
|
||||||
|
do add value by themselves.
|
||||||
|
* Add tests for any new functionality and run the test suite (``make pytest``)
|
||||||
|
to ensure that no existing features break.
|
||||||
|
* Please run ``flake8`` and ``tools/check-style.sh`` to check your code matches
|
||||||
|
the project style. (Note that ``check-style.sh`` requires ``gawk``.)
|
||||||
|
* This project has a strong focus on providing general solutions using a
|
||||||
|
minimal amount of code, thus small pull requests are greatly preferred.
|
||||||
|
|
||||||
|
### Licensing of contributions
|
||||||
|
|
||||||
|
pybind11 is provided under a BSD-style license that can be found in the
|
||||||
|
``LICENSE`` file. By using, distributing, or contributing to this project, you
|
||||||
|
agree to the terms and conditions of this license.
|
||||||
|
|
||||||
|
You are under no obligation whatsoever to provide any bug fixes, patches, or
|
||||||
|
upgrades to the features, functionality or performance of the source code
|
||||||
|
("Enhancements") to anyone; however, if you choose to make your Enhancements
|
||||||
|
available either publicly, or directly to the author of this software, without
|
||||||
|
imposing a separate written license agreement for such Enhancements, then you
|
||||||
|
hereby grant the following license: a non-exclusive, royalty-free perpetual
|
||||||
|
license to install, use, modify, prepare derivative works, incorporate into
|
||||||
|
other computer software, distribute, and sublicense such enhancements or
|
||||||
|
derivative works thereof, in binary and source code form.
|
||||||
|
|
@ -0,0 +1,17 @@
|
||||||
|
Make sure you've completed the following steps before submitting your issue -- thank you!
|
||||||
|
|
||||||
|
1. Check if your question has already been answered in the [FAQ](http://pybind11.readthedocs.io/en/latest/faq.html) section.
|
||||||
|
2. Make sure you've read the [documentation](http://pybind11.readthedocs.io/en/latest/). Your issue may be addressed there.
|
||||||
|
3. If those resources didn't help and you only have a short question (not a bug report), consider asking in the [Gitter chat room](https://gitter.im/pybind/Lobby).
|
||||||
|
4. If you have a genuine bug report or a more complex question which is not answered in the previous items (or not suitable for chat), please fill in the details below.
|
||||||
|
5. Include a self-contained and minimal piece of code that reproduces the problem. If that's not possible, try to make the description as clear as possible.
|
||||||
|
|
||||||
|
*After reading, remove this checklist and the template text in parentheses below.*
|
||||||
|
|
||||||
|
## Issue description
|
||||||
|
|
||||||
|
(Provide a short description, state the expected behavior and what actually happens.)
|
||||||
|
|
||||||
|
## Reproducible example code
|
||||||
|
|
||||||
|
(The code should be minimal, have no external dependencies, isolate the function(s) that cause breakage. Submit matched and complete C++ and Python snippets that can be easily compiled and run to diagnose the issue.)
|
||||||
|
|
@ -0,0 +1,29 @@
|
||||||
|
Copyright (c) 2016 Wenzel Jakob <wenzel.jakob@epfl.ch>, All rights reserved.
|
||||||
|
|
||||||
|
Redistribution and use in source and binary forms, with or without
|
||||||
|
modification, are permitted provided that the following conditions are met:
|
||||||
|
|
||||||
|
1. Redistributions of source code must retain the above copyright notice, this
|
||||||
|
list of conditions and the following disclaimer.
|
||||||
|
|
||||||
|
2. Redistributions in binary form must reproduce the above copyright notice,
|
||||||
|
this list of conditions and the following disclaimer in the documentation
|
||||||
|
and/or other materials provided with the distribution.
|
||||||
|
|
||||||
|
3. Neither the name of the copyright holder nor the names of its contributors
|
||||||
|
may be used to endorse or promote products derived from this software
|
||||||
|
without specific prior written permission.
|
||||||
|
|
||||||
|
THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
|
||||||
|
ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
|
||||||
|
WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
|
||||||
|
DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE
|
||||||
|
FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
|
||||||
|
DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
|
||||||
|
SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
|
||||||
|
CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
|
||||||
|
OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
|
||||||
|
OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
|
||||||
|
|
||||||
|
Please also refer to the file CONTRIBUTING.md, which clarifies licensing of
|
||||||
|
external contributions to this project including patches, pull requests, etc.
|
||||||
|
|
@ -0,0 +1,2 @@
|
||||||
|
recursive-include include/pybind11 *.h
|
||||||
|
include LICENSE README.md CONTRIBUTING.md
|
||||||
|
|
@ -0,0 +1,129 @@
|
||||||
|

|
||||||
|
|
||||||
|
# pybind11 — Seamless operability between C++11 and Python
|
||||||
|
|
||||||
|
[](http://pybind11.readthedocs.org/en/master/?badge=master)
|
||||||
|
[](http://pybind11.readthedocs.org/en/stable/?badge=stable)
|
||||||
|
[](https://gitter.im/pybind/Lobby)
|
||||||
|
[](https://travis-ci.org/pybind/pybind11)
|
||||||
|
[](https://ci.appveyor.com/project/wjakob/pybind11)
|
||||||
|
|
||||||
|
**pybind11** is a lightweight header-only library that exposes C++ types in Python
|
||||||
|
and vice versa, mainly to create Python bindings of existing C++ code. Its
|
||||||
|
goals and syntax are similar to the excellent
|
||||||
|
[Boost.Python](http://www.boost.org/doc/libs/1_58_0/libs/python/doc/) library
|
||||||
|
by David Abrahams: to minimize boilerplate code in traditional extension
|
||||||
|
modules by inferring type information using compile-time introspection.
|
||||||
|
|
||||||
|
The main issue with Boost.Python—and the reason for creating such a similar
|
||||||
|
project—is Boost. Boost is an enormously large and complex suite of utility
|
||||||
|
libraries that works with almost every C++ compiler in existence. This
|
||||||
|
compatibility has its cost: arcane template tricks and workarounds are
|
||||||
|
necessary to support the oldest and buggiest of compiler specimens. Now that
|
||||||
|
C++11-compatible compilers are widely available, this heavy machinery has
|
||||||
|
become an excessively large and unnecessary dependency.
|
||||||
|
|
||||||
|
Think of this library as a tiny self-contained version of Boost.Python with
|
||||||
|
everything stripped away that isn't relevant for binding generation. Without
|
||||||
|
comments, the core header files only require ~4K lines of code and depend on
|
||||||
|
Python (2.7 or 3.x, or PyPy2.7 >= 5.7) and the C++ standard library. This
|
||||||
|
compact implementation was possible thanks to some of the new C++11 language
|
||||||
|
features (specifically: tuples, lambda functions and variadic templates). Since
|
||||||
|
its creation, this library has grown beyond Boost.Python in many ways, leading
|
||||||
|
to dramatically simpler binding code in many common situations.
|
||||||
|
|
||||||
|
Tutorial and reference documentation is provided at
|
||||||
|
[http://pybind11.readthedocs.org/en/master](http://pybind11.readthedocs.org/en/master).
|
||||||
|
A PDF version of the manual is available
|
||||||
|
[here](https://media.readthedocs.org/pdf/pybind11/master/pybind11.pdf).
|
||||||
|
|
||||||
|
## Core features
|
||||||
|
pybind11 can map the following core C++ features to Python
|
||||||
|
|
||||||
|
- Functions accepting and returning custom data structures per value, reference, or pointer
|
||||||
|
- Instance methods and static methods
|
||||||
|
- Overloaded functions
|
||||||
|
- Instance attributes and static attributes
|
||||||
|
- Arbitrary exception types
|
||||||
|
- Enumerations
|
||||||
|
- Callbacks
|
||||||
|
- Iterators and ranges
|
||||||
|
- Custom operators
|
||||||
|
- Single and multiple inheritance
|
||||||
|
- STL data structures
|
||||||
|
- Smart pointers with reference counting like ``std::shared_ptr``
|
||||||
|
- Internal references with correct reference counting
|
||||||
|
- C++ classes with virtual (and pure virtual) methods can be extended in Python
|
||||||
|
|
||||||
|
## Goodies
|
||||||
|
In addition to the core functionality, pybind11 provides some extra goodies:
|
||||||
|
|
||||||
|
- Python 2.7, 3.x, and PyPy (PyPy2.7 >= 5.7) are supported with an
|
||||||
|
implementation-agnostic interface.
|
||||||
|
|
||||||
|
- It is possible to bind C++11 lambda functions with captured variables. The
|
||||||
|
lambda capture data is stored inside the resulting Python function object.
|
||||||
|
|
||||||
|
- pybind11 uses C++11 move constructors and move assignment operators whenever
|
||||||
|
possible to efficiently transfer custom data types.
|
||||||
|
|
||||||
|
- It's easy to expose the internal storage of custom data types through
|
||||||
|
Pythons' buffer protocols. This is handy e.g. for fast conversion between
|
||||||
|
C++ matrix classes like Eigen and NumPy without expensive copy operations.
|
||||||
|
|
||||||
|
- pybind11 can automatically vectorize functions so that they are transparently
|
||||||
|
applied to all entries of one or more NumPy array arguments.
|
||||||
|
|
||||||
|
- Python's slice-based access and assignment operations can be supported with
|
||||||
|
just a few lines of code.
|
||||||
|
|
||||||
|
- Everything is contained in just a few header files; there is no need to link
|
||||||
|
against any additional libraries.
|
||||||
|
|
||||||
|
- Binaries are generally smaller by a factor of at least 2 compared to
|
||||||
|
equivalent bindings generated by Boost.Python. A recent pybind11 conversion
|
||||||
|
of PyRosetta, an enormous Boost.Python binding project,
|
||||||
|
[reported](http://graylab.jhu.edu/RosettaCon2016/PyRosetta-4.pdf) a binary
|
||||||
|
size reduction of **5.4x** and compile time reduction by **5.8x**.
|
||||||
|
|
||||||
|
- Function signatures are precomputed at compile time (using ``constexpr``),
|
||||||
|
leading to smaller binaries.
|
||||||
|
|
||||||
|
- With little extra effort, C++ types can be pickled and unpickled similar to
|
||||||
|
regular Python objects.
|
||||||
|
|
||||||
|
## Supported compilers
|
||||||
|
|
||||||
|
1. Clang/LLVM 3.3 or newer (for Apple Xcode's clang, this is 5.0.0 or newer)
|
||||||
|
2. GCC 4.8 or newer
|
||||||
|
3. Microsoft Visual Studio 2015 Update 3 or newer
|
||||||
|
4. Intel C++ compiler 17 or newer (16 with pybind11 v2.0 and 15 with pybind11 v2.0 and a [workaround](https://github.com/pybind/pybind11/issues/276))
|
||||||
|
5. Cygwin/GCC (tested on 2.5.1)
|
||||||
|
|
||||||
|
## About
|
||||||
|
|
||||||
|
This project was created by [Wenzel Jakob](http://rgl.epfl.ch/people/wjakob).
|
||||||
|
Significant features and/or improvements to the code were contributed by
|
||||||
|
Jonas Adler,
|
||||||
|
Lori A. Burns,
|
||||||
|
Sylvain Corlay,
|
||||||
|
Trent Houliston,
|
||||||
|
Axel Huebl,
|
||||||
|
@hulucc,
|
||||||
|
Sergey Lyskov
|
||||||
|
Johan Mabille,
|
||||||
|
Tomasz Miąsko,
|
||||||
|
Dean Moldovan,
|
||||||
|
Ben Pritchard,
|
||||||
|
Jason Rhinelander,
|
||||||
|
Boris Schäling,
|
||||||
|
Pim Schellart,
|
||||||
|
Henry Schreiner,
|
||||||
|
Ivan Smirnov, and
|
||||||
|
Patrick Stewart.
|
||||||
|
|
||||||
|
### License
|
||||||
|
|
||||||
|
pybind11 is provided under a BSD-style license that can be found in the
|
||||||
|
``LICENSE`` file. By using, distributing, or contributing to this project,
|
||||||
|
you agree to the terms and conditions of this license.
|
||||||
|
|
@ -0,0 +1,20 @@
|
||||||
|
PROJECT_NAME = pybind11
|
||||||
|
INPUT = ../include/pybind11/
|
||||||
|
RECURSIVE = YES
|
||||||
|
|
||||||
|
GENERATE_HTML = NO
|
||||||
|
GENERATE_LATEX = NO
|
||||||
|
GENERATE_XML = YES
|
||||||
|
XML_OUTPUT = .build/doxygenxml
|
||||||
|
XML_PROGRAMLISTING = YES
|
||||||
|
|
||||||
|
MACRO_EXPANSION = YES
|
||||||
|
EXPAND_ONLY_PREDEF = YES
|
||||||
|
EXPAND_AS_DEFINED = PYBIND11_RUNTIME_EXCEPTION
|
||||||
|
|
||||||
|
ALIASES = "rst=\verbatim embed:rst"
|
||||||
|
ALIASES += "endrst=\endverbatim"
|
||||||
|
|
||||||
|
QUIET = YES
|
||||||
|
WARNINGS = YES
|
||||||
|
WARN_IF_UNDOCUMENTED = NO
|
||||||
|
|
@ -0,0 +1,11 @@
|
||||||
|
.wy-table-responsive table td,
|
||||||
|
.wy-table-responsive table th {
|
||||||
|
white-space: initial !important;
|
||||||
|
}
|
||||||
|
.rst-content table.docutils td {
|
||||||
|
vertical-align: top !important;
|
||||||
|
}
|
||||||
|
div[class^='highlight'] pre {
|
||||||
|
white-space: pre;
|
||||||
|
white-space: pre-wrap;
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,81 @@
|
||||||
|
Chrono
|
||||||
|
======
|
||||||
|
|
||||||
|
When including the additional header file :file:`pybind11/chrono.h` conversions
|
||||||
|
from C++11 chrono datatypes to python datetime objects are automatically enabled.
|
||||||
|
This header also enables conversions of python floats (often from sources such
|
||||||
|
as ``time.monotonic()``, ``time.perf_counter()`` and ``time.process_time()``)
|
||||||
|
into durations.
|
||||||
|
|
||||||
|
An overview of clocks in C++11
|
||||||
|
------------------------------
|
||||||
|
|
||||||
|
A point of confusion when using these conversions is the differences between
|
||||||
|
clocks provided in C++11. There are three clock types defined by the C++11
|
||||||
|
standard and users can define their own if needed. Each of these clocks have
|
||||||
|
different properties and when converting to and from python will give different
|
||||||
|
results.
|
||||||
|
|
||||||
|
The first clock defined by the standard is ``std::chrono::system_clock``. This
|
||||||
|
clock measures the current date and time. However, this clock changes with to
|
||||||
|
updates to the operating system time. For example, if your time is synchronised
|
||||||
|
with a time server this clock will change. This makes this clock a poor choice
|
||||||
|
for timing purposes but good for measuring the wall time.
|
||||||
|
|
||||||
|
The second clock defined in the standard is ``std::chrono::steady_clock``.
|
||||||
|
This clock ticks at a steady rate and is never adjusted. This makes it excellent
|
||||||
|
for timing purposes, however the value in this clock does not correspond to the
|
||||||
|
current date and time. Often this clock will be the amount of time your system
|
||||||
|
has been on, although it does not have to be. This clock will never be the same
|
||||||
|
clock as the system clock as the system clock can change but steady clocks
|
||||||
|
cannot.
|
||||||
|
|
||||||
|
The third clock defined in the standard is ``std::chrono::high_resolution_clock``.
|
||||||
|
This clock is the clock that has the highest resolution out of the clocks in the
|
||||||
|
system. It is normally a typedef to either the system clock or the steady clock
|
||||||
|
but can be its own independent clock. This is important as when using these
|
||||||
|
conversions as the types you get in python for this clock might be different
|
||||||
|
depending on the system.
|
||||||
|
If it is a typedef of the system clock, python will get datetime objects, but if
|
||||||
|
it is a different clock they will be timedelta objects.
|
||||||
|
|
||||||
|
Provided conversions
|
||||||
|
--------------------
|
||||||
|
|
||||||
|
.. rubric:: C++ to Python
|
||||||
|
|
||||||
|
- ``std::chrono::system_clock::time_point`` → ``datetime.datetime``
|
||||||
|
System clock times are converted to python datetime instances. They are
|
||||||
|
in the local timezone, but do not have any timezone information attached
|
||||||
|
to them (they are naive datetime objects).
|
||||||
|
|
||||||
|
- ``std::chrono::duration`` → ``datetime.timedelta``
|
||||||
|
Durations are converted to timedeltas, any precision in the duration
|
||||||
|
greater than microseconds is lost by rounding towards zero.
|
||||||
|
|
||||||
|
- ``std::chrono::[other_clocks]::time_point`` → ``datetime.timedelta``
|
||||||
|
Any clock time that is not the system clock is converted to a time delta.
|
||||||
|
This timedelta measures the time from the clocks epoch to now.
|
||||||
|
|
||||||
|
.. rubric:: Python to C++
|
||||||
|
|
||||||
|
- ``datetime.datetime`` → ``std::chrono::system_clock::time_point``
|
||||||
|
Date/time objects are converted into system clock timepoints. Any
|
||||||
|
timezone information is ignored and the type is treated as a naive
|
||||||
|
object.
|
||||||
|
|
||||||
|
- ``datetime.timedelta`` → ``std::chrono::duration``
|
||||||
|
Time delta are converted into durations with microsecond precision.
|
||||||
|
|
||||||
|
- ``datetime.timedelta`` → ``std::chrono::[other_clocks]::time_point``
|
||||||
|
Time deltas that are converted into clock timepoints are treated as
|
||||||
|
the amount of time from the start of the clocks epoch.
|
||||||
|
|
||||||
|
- ``float`` → ``std::chrono::duration``
|
||||||
|
Floats that are passed to C++ as durations be interpreted as a number of
|
||||||
|
seconds. These will be converted to the duration using ``duration_cast``
|
||||||
|
from the float.
|
||||||
|
|
||||||
|
- ``float`` → ``std::chrono::[other_clocks]::time_point``
|
||||||
|
Floats that are passed to C++ as time points will be interpreted as the
|
||||||
|
number of seconds from the start of the clocks epoch.
|
||||||
|
|
@ -0,0 +1,91 @@
|
||||||
|
Custom type casters
|
||||||
|
===================
|
||||||
|
|
||||||
|
In very rare cases, applications may require custom type casters that cannot be
|
||||||
|
expressed using the abstractions provided by pybind11, thus requiring raw
|
||||||
|
Python C API calls. This is fairly advanced usage and should only be pursued by
|
||||||
|
experts who are familiar with the intricacies of Python reference counting.
|
||||||
|
|
||||||
|
The following snippets demonstrate how this works for a very simple ``inty``
|
||||||
|
type that that should be convertible from Python types that provide a
|
||||||
|
``__int__(self)`` method.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
struct inty { long long_value; };
|
||||||
|
|
||||||
|
void print(inty s) {
|
||||||
|
std::cout << s.long_value << std::endl;
|
||||||
|
}
|
||||||
|
|
||||||
|
The following Python snippet demonstrates the intended usage from the Python side:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
class A:
|
||||||
|
def __int__(self):
|
||||||
|
return 123
|
||||||
|
|
||||||
|
from example import print
|
||||||
|
print(A())
|
||||||
|
|
||||||
|
To register the necessary conversion routines, it is necessary to add
|
||||||
|
a partial overload to the ``pybind11::detail::type_caster<T>`` template.
|
||||||
|
Although this is an implementation detail, adding partial overloads to this
|
||||||
|
type is explicitly allowed.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
namespace pybind11 { namespace detail {
|
||||||
|
template <> struct type_caster<inty> {
|
||||||
|
public:
|
||||||
|
/**
|
||||||
|
* This macro establishes the name 'inty' in
|
||||||
|
* function signatures and declares a local variable
|
||||||
|
* 'value' of type inty
|
||||||
|
*/
|
||||||
|
PYBIND11_TYPE_CASTER(inty, _("inty"));
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Conversion part 1 (Python->C++): convert a PyObject into a inty
|
||||||
|
* instance or return false upon failure. The second argument
|
||||||
|
* indicates whether implicit conversions should be applied.
|
||||||
|
*/
|
||||||
|
bool load(handle src, bool) {
|
||||||
|
/* Extract PyObject from handle */
|
||||||
|
PyObject *source = src.ptr();
|
||||||
|
/* Try converting into a Python integer value */
|
||||||
|
PyObject *tmp = PyNumber_Long(source);
|
||||||
|
if (!tmp)
|
||||||
|
return false;
|
||||||
|
/* Now try to convert into a C++ int */
|
||||||
|
value.long_value = PyLong_AsLong(tmp);
|
||||||
|
Py_DECREF(tmp);
|
||||||
|
/* Ensure return code was OK (to avoid out-of-range errors etc) */
|
||||||
|
return !(value.long_value == -1 && !PyErr_Occurred());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Conversion part 2 (C++ -> Python): convert an inty instance into
|
||||||
|
* a Python object. The second and third arguments are used to
|
||||||
|
* indicate the return value policy and parent object (for
|
||||||
|
* ``return_value_policy::reference_internal``) and are generally
|
||||||
|
* ignored by implicit casters.
|
||||||
|
*/
|
||||||
|
static handle cast(inty src, return_value_policy /* policy */, handle /* parent */) {
|
||||||
|
return PyLong_FromLong(src.long_value);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}} // namespace pybind11::detail
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
A ``type_caster<T>`` defined with ``PYBIND11_TYPE_CASTER(T, ...)`` requires
|
||||||
|
that ``T`` is default-constructible (``value`` is first default constructed
|
||||||
|
and then ``load()`` assigns to it).
|
||||||
|
|
||||||
|
.. warning::
|
||||||
|
|
||||||
|
When using custom type casters, it's important to declare them consistently
|
||||||
|
in every compilation unit of the Python extension module. Otherwise,
|
||||||
|
undefined behavior can ensue.
|
||||||
|
|
@ -0,0 +1,310 @@
|
||||||
|
Eigen
|
||||||
|
#####
|
||||||
|
|
||||||
|
`Eigen <http://eigen.tuxfamily.org>`_ is C++ header-based library for dense and
|
||||||
|
sparse linear algebra. Due to its popularity and widespread adoption, pybind11
|
||||||
|
provides transparent conversion and limited mapping support between Eigen and
|
||||||
|
Scientific Python linear algebra data types.
|
||||||
|
|
||||||
|
To enable the built-in Eigen support you must include the optional header file
|
||||||
|
:file:`pybind11/eigen.h`.
|
||||||
|
|
||||||
|
Pass-by-value
|
||||||
|
=============
|
||||||
|
|
||||||
|
When binding a function with ordinary Eigen dense object arguments (for
|
||||||
|
example, ``Eigen::MatrixXd``), pybind11 will accept any input value that is
|
||||||
|
already (or convertible to) a ``numpy.ndarray`` with dimensions compatible with
|
||||||
|
the Eigen type, copy its values into a temporary Eigen variable of the
|
||||||
|
appropriate type, then call the function with this temporary variable.
|
||||||
|
|
||||||
|
Sparse matrices are similarly copied to or from
|
||||||
|
``scipy.sparse.csr_matrix``/``scipy.sparse.csc_matrix`` objects.
|
||||||
|
|
||||||
|
Pass-by-reference
|
||||||
|
=================
|
||||||
|
|
||||||
|
One major limitation of the above is that every data conversion implicitly
|
||||||
|
involves a copy, which can be both expensive (for large matrices) and disallows
|
||||||
|
binding functions that change their (Matrix) arguments. Pybind11 allows you to
|
||||||
|
work around this by using Eigen's ``Eigen::Ref<MatrixType>`` class much as you
|
||||||
|
would when writing a function taking a generic type in Eigen itself (subject to
|
||||||
|
some limitations discussed below).
|
||||||
|
|
||||||
|
When calling a bound function accepting a ``Eigen::Ref<const MatrixType>``
|
||||||
|
type, pybind11 will attempt to avoid copying by using an ``Eigen::Map`` object
|
||||||
|
that maps into the source ``numpy.ndarray`` data: this requires both that the
|
||||||
|
data types are the same (e.g. ``dtype='float64'`` and ``MatrixType::Scalar`` is
|
||||||
|
``double``); and that the storage is layout compatible. The latter limitation
|
||||||
|
is discussed in detail in the section below, and requires careful
|
||||||
|
consideration: by default, numpy matrices and Eigen matrices are *not* storage
|
||||||
|
compatible.
|
||||||
|
|
||||||
|
If the numpy matrix cannot be used as is (either because its types differ, e.g.
|
||||||
|
passing an array of integers to an Eigen parameter requiring doubles, or
|
||||||
|
because the storage is incompatible), pybind11 makes a temporary copy and
|
||||||
|
passes the copy instead.
|
||||||
|
|
||||||
|
When a bound function parameter is instead ``Eigen::Ref<MatrixType>`` (note the
|
||||||
|
lack of ``const``), pybind11 will only allow the function to be called if it
|
||||||
|
can be mapped *and* if the numpy array is writeable (that is
|
||||||
|
``a.flags.writeable`` is true). Any access (including modification) made to
|
||||||
|
the passed variable will be transparently carried out directly on the
|
||||||
|
``numpy.ndarray``.
|
||||||
|
|
||||||
|
This means you can can write code such as the following and have it work as
|
||||||
|
expected:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void scale_by_2(Eigen::Ref<Eigen::VectorXd> v) {
|
||||||
|
v *= 2;
|
||||||
|
}
|
||||||
|
|
||||||
|
Note, however, that you will likely run into limitations due to numpy and
|
||||||
|
Eigen's difference default storage order for data; see the below section on
|
||||||
|
:ref:`storage_orders` for details on how to bind code that won't run into such
|
||||||
|
limitations.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
Passing by reference is not supported for sparse types.
|
||||||
|
|
||||||
|
Returning values to Python
|
||||||
|
==========================
|
||||||
|
|
||||||
|
When returning an ordinary dense Eigen matrix type to numpy (e.g.
|
||||||
|
``Eigen::MatrixXd`` or ``Eigen::RowVectorXf``) pybind11 keeps the matrix and
|
||||||
|
returns a numpy array that directly references the Eigen matrix: no copy of the
|
||||||
|
data is performed. The numpy array will have ``array.flags.owndata`` set to
|
||||||
|
``False`` to indicate that it does not own the data, and the lifetime of the
|
||||||
|
stored Eigen matrix will be tied to the returned ``array``.
|
||||||
|
|
||||||
|
If you bind a function with a non-reference, ``const`` return type (e.g.
|
||||||
|
``const Eigen::MatrixXd``), the same thing happens except that pybind11 also
|
||||||
|
sets the numpy array's ``writeable`` flag to false.
|
||||||
|
|
||||||
|
If you return an lvalue reference or pointer, the usual pybind11 rules apply,
|
||||||
|
as dictated by the binding function's return value policy (see the
|
||||||
|
documentation on :ref:`return_value_policies` for full details). That means,
|
||||||
|
without an explicit return value policy, lvalue references will be copied and
|
||||||
|
pointers will be managed by pybind11. In order to avoid copying, you should
|
||||||
|
explicitly specify an appropriate return value policy, as in the following
|
||||||
|
example:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
class MyClass {
|
||||||
|
Eigen::MatrixXd big_mat = Eigen::MatrixXd::Zero(10000, 10000);
|
||||||
|
public:
|
||||||
|
Eigen::MatrixXd &getMatrix() { return big_mat; }
|
||||||
|
const Eigen::MatrixXd &viewMatrix() { return big_mat; }
|
||||||
|
};
|
||||||
|
|
||||||
|
// Later, in binding code:
|
||||||
|
py::class_<MyClass>(m, "MyClass")
|
||||||
|
.def(py::init<>())
|
||||||
|
.def("copy_matrix", &MyClass::getMatrix) // Makes a copy!
|
||||||
|
.def("get_matrix", &MyClass::getMatrix, py::return_value_policy::reference_internal)
|
||||||
|
.def("view_matrix", &MyClass::viewMatrix, py::return_value_policy::reference_internal)
|
||||||
|
;
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
a = MyClass()
|
||||||
|
m = a.get_matrix() # flags.writeable = True, flags.owndata = False
|
||||||
|
v = a.view_matrix() # flags.writeable = False, flags.owndata = False
|
||||||
|
c = a.copy_matrix() # flags.writeable = True, flags.owndata = True
|
||||||
|
# m[5,6] and v[5,6] refer to the same element, c[5,6] does not.
|
||||||
|
|
||||||
|
Note in this example that ``py::return_value_policy::reference_internal`` is
|
||||||
|
used to tie the life of the MyClass object to the life of the returned arrays.
|
||||||
|
|
||||||
|
You may also return an ``Eigen::Ref``, ``Eigen::Map`` or other map-like Eigen
|
||||||
|
object (for example, the return value of ``matrix.block()`` and related
|
||||||
|
methods) that map into a dense Eigen type. When doing so, the default
|
||||||
|
behaviour of pybind11 is to simply reference the returned data: you must take
|
||||||
|
care to ensure that this data remains valid! You may ask pybind11 to
|
||||||
|
explicitly *copy* such a return value by using the
|
||||||
|
``py::return_value_policy::copy`` policy when binding the function. You may
|
||||||
|
also use ``py::return_value_policy::reference_internal`` or a
|
||||||
|
``py::keep_alive`` to ensure the data stays valid as long as the returned numpy
|
||||||
|
array does.
|
||||||
|
|
||||||
|
When returning such a reference of map, pybind11 additionally respects the
|
||||||
|
readonly-status of the returned value, marking the numpy array as non-writeable
|
||||||
|
if the reference or map was itself read-only.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
Sparse types are always copied when returned.
|
||||||
|
|
||||||
|
.. _storage_orders:
|
||||||
|
|
||||||
|
Storage orders
|
||||||
|
==============
|
||||||
|
|
||||||
|
Passing arguments via ``Eigen::Ref`` has some limitations that you must be
|
||||||
|
aware of in order to effectively pass matrices by reference. First and
|
||||||
|
foremost is that the default ``Eigen::Ref<MatrixType>`` class requires
|
||||||
|
contiguous storage along columns (for column-major types, the default in Eigen)
|
||||||
|
or rows if ``MatrixType`` is specifically an ``Eigen::RowMajor`` storage type.
|
||||||
|
The former, Eigen's default, is incompatible with ``numpy``'s default row-major
|
||||||
|
storage, and so you will not be able to pass numpy arrays to Eigen by reference
|
||||||
|
without making one of two changes.
|
||||||
|
|
||||||
|
(Note that this does not apply to vectors (or column or row matrices): for such
|
||||||
|
types the "row-major" and "column-major" distinction is meaningless).
|
||||||
|
|
||||||
|
The first approach is to change the use of ``Eigen::Ref<MatrixType>`` to the
|
||||||
|
more general ``Eigen::Ref<MatrixType, 0, Eigen::Stride<Eigen::Dynamic,
|
||||||
|
Eigen::Dynamic>>`` (or similar type with a fully dynamic stride type in the
|
||||||
|
third template argument). Since this is a rather cumbersome type, pybind11
|
||||||
|
provides a ``py::EigenDRef<MatrixType>`` type alias for your convenience (along
|
||||||
|
with EigenDMap for the equivalent Map, and EigenDStride for just the stride
|
||||||
|
type).
|
||||||
|
|
||||||
|
This type allows Eigen to map into any arbitrary storage order. This is not
|
||||||
|
the default in Eigen for performance reasons: contiguous storage allows
|
||||||
|
vectorization that cannot be done when storage is not known to be contiguous at
|
||||||
|
compile time. The default ``Eigen::Ref`` stride type allows non-contiguous
|
||||||
|
storage along the outer dimension (that is, the rows of a column-major matrix
|
||||||
|
or columns of a row-major matrix), but not along the inner dimension.
|
||||||
|
|
||||||
|
This type, however, has the added benefit of also being able to map numpy array
|
||||||
|
slices. For example, the following (contrived) example uses Eigen with a numpy
|
||||||
|
slice to multiply by 2 all coefficients that are both on even rows (0, 2, 4,
|
||||||
|
...) and in columns 2, 5, or 8:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("scale", [](py::EigenDRef<Eigen::MatrixXd> m, double c) { m *= c; });
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
# a = np.array(...)
|
||||||
|
scale_by_2(myarray[0::2, 2:9:3])
|
||||||
|
|
||||||
|
The second approach to avoid copying is more intrusive: rearranging the
|
||||||
|
underlying data types to not run into the non-contiguous storage problem in the
|
||||||
|
first place. In particular, that means using matrices with ``Eigen::RowMajor``
|
||||||
|
storage, where appropriate, such as:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
using RowMatrixXd = Eigen::Matrix<double, Eigen::Dynamic, Eigen::Dynamic, Eigen::RowMajor>;
|
||||||
|
// Use RowMatrixXd instead of MatrixXd
|
||||||
|
|
||||||
|
Now bound functions accepting ``Eigen::Ref<RowMatrixXd>`` arguments will be
|
||||||
|
callable with numpy's (default) arrays without involving a copying.
|
||||||
|
|
||||||
|
You can, alternatively, change the storage order that numpy arrays use by
|
||||||
|
adding the ``order='F'`` option when creating an array:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
myarray = np.array(source, order='F')
|
||||||
|
|
||||||
|
Such an object will be passable to a bound function accepting an
|
||||||
|
``Eigen::Ref<MatrixXd>`` (or similar column-major Eigen type).
|
||||||
|
|
||||||
|
One major caveat with this approach, however, is that it is not entirely as
|
||||||
|
easy as simply flipping all Eigen or numpy usage from one to the other: some
|
||||||
|
operations may alter the storage order of a numpy array. For example, ``a2 =
|
||||||
|
array.transpose()`` results in ``a2`` being a view of ``array`` that references
|
||||||
|
the same data, but in the opposite storage order!
|
||||||
|
|
||||||
|
While this approach allows fully optimized vectorized calculations in Eigen, it
|
||||||
|
cannot be used with array slices, unlike the first approach.
|
||||||
|
|
||||||
|
When *returning* a matrix to Python (either a regular matrix, a reference via
|
||||||
|
``Eigen::Ref<>``, or a map/block into a matrix), no special storage
|
||||||
|
consideration is required: the created numpy array will have the required
|
||||||
|
stride that allows numpy to properly interpret the array, whatever its storage
|
||||||
|
order.
|
||||||
|
|
||||||
|
Failing rather than copying
|
||||||
|
===========================
|
||||||
|
|
||||||
|
The default behaviour when binding ``Eigen::Ref<const MatrixType>`` Eigen
|
||||||
|
references is to copy matrix values when passed a numpy array that does not
|
||||||
|
conform to the element type of ``MatrixType`` or does not have a compatible
|
||||||
|
stride layout. If you want to explicitly avoid copying in such a case, you
|
||||||
|
should bind arguments using the ``py::arg().noconvert()`` annotation (as
|
||||||
|
described in the :ref:`nonconverting_arguments` documentation).
|
||||||
|
|
||||||
|
The following example shows an example of arguments that don't allow data
|
||||||
|
copying to take place:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// The method and function to be bound:
|
||||||
|
class MyClass {
|
||||||
|
// ...
|
||||||
|
double some_method(const Eigen::Ref<const MatrixXd> &matrix) { /* ... */ }
|
||||||
|
};
|
||||||
|
float some_function(const Eigen::Ref<const MatrixXf> &big,
|
||||||
|
const Eigen::Ref<const MatrixXf> &small) {
|
||||||
|
// ...
|
||||||
|
}
|
||||||
|
|
||||||
|
// The associated binding code:
|
||||||
|
using namespace pybind11::literals; // for "arg"_a
|
||||||
|
py::class_<MyClass>(m, "MyClass")
|
||||||
|
// ... other class definitions
|
||||||
|
.def("some_method", &MyClass::some_method, py::arg().noconvert());
|
||||||
|
|
||||||
|
m.def("some_function", &some_function,
|
||||||
|
"big"_a.noconvert(), // <- Don't allow copying for this arg
|
||||||
|
"small"_a // <- This one can be copied if needed
|
||||||
|
);
|
||||||
|
|
||||||
|
With the above binding code, attempting to call the the ``some_method(m)``
|
||||||
|
method on a ``MyClass`` object, or attempting to call ``some_function(m, m2)``
|
||||||
|
will raise a ``RuntimeError`` rather than making a temporary copy of the array.
|
||||||
|
It will, however, allow the ``m2`` argument to be copied into a temporary if
|
||||||
|
necessary.
|
||||||
|
|
||||||
|
Note that explicitly specifying ``.noconvert()`` is not required for *mutable*
|
||||||
|
Eigen references (e.g. ``Eigen::Ref<MatrixXd>`` without ``const`` on the
|
||||||
|
``MatrixXd``): mutable references will never be called with a temporary copy.
|
||||||
|
|
||||||
|
Vectors versus column/row matrices
|
||||||
|
==================================
|
||||||
|
|
||||||
|
Eigen and numpy have fundamentally different notions of a vector. In Eigen, a
|
||||||
|
vector is simply a matrix with the number of columns or rows set to 1 at
|
||||||
|
compile time (for a column vector or row vector, respectively). Numpy, in
|
||||||
|
contrast, has comparable 2-dimensional 1xN and Nx1 arrays, but *also* has
|
||||||
|
1-dimensional arrays of size N.
|
||||||
|
|
||||||
|
When passing a 2-dimensional 1xN or Nx1 array to Eigen, the Eigen type must
|
||||||
|
have matching dimensions: That is, you cannot pass a 2-dimensional Nx1 numpy
|
||||||
|
array to an Eigen value expecting a row vector, or a 1xN numpy array as a
|
||||||
|
column vector argument.
|
||||||
|
|
||||||
|
On the other hand, pybind11 allows you to pass 1-dimensional arrays of length N
|
||||||
|
as Eigen parameters. If the Eigen type can hold a column vector of length N it
|
||||||
|
will be passed as such a column vector. If not, but the Eigen type constraints
|
||||||
|
will accept a row vector, it will be passed as a row vector. (The column
|
||||||
|
vector takes precedence when both are supported, for example, when passing a
|
||||||
|
1D numpy array to a MatrixXd argument). Note that the type need not be
|
||||||
|
explicitly a vector: it is permitted to pass a 1D numpy array of size 5 to an
|
||||||
|
Eigen ``Matrix<double, Dynamic, 5>``: you would end up with a 1x5 Eigen matrix.
|
||||||
|
Passing the same to an ``Eigen::MatrixXd`` would result in a 5x1 Eigen matrix.
|
||||||
|
|
||||||
|
When returning an Eigen vector to numpy, the conversion is ambiguous: a row
|
||||||
|
vector of length 4 could be returned as either a 1D array of length 4, or as a
|
||||||
|
2D array of size 1x4. When encountering such a situation, pybind11 compromises
|
||||||
|
by considering the returned Eigen type: if it is a compile-time vector--that
|
||||||
|
is, the type has either the number of rows or columns set to 1 at compile
|
||||||
|
time--pybind11 converts to a 1D numpy array when returning the value. For
|
||||||
|
instances that are a vector only at run-time (e.g. ``MatrixXd``,
|
||||||
|
``Matrix<float, Dynamic, 4>``), pybind11 returns the vector as a 2D array to
|
||||||
|
numpy. If this isn't want you want, you can use ``array.reshape(...)`` to get
|
||||||
|
a view of the same data in the desired dimensions.
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_eigen.cpp` contains a complete example that
|
||||||
|
shows how to pass Eigen sparse and dense data types in more detail.
|
||||||
|
|
@ -0,0 +1,109 @@
|
||||||
|
Functional
|
||||||
|
##########
|
||||||
|
|
||||||
|
The following features must be enabled by including :file:`pybind11/functional.h`.
|
||||||
|
|
||||||
|
|
||||||
|
Callbacks and passing anonymous functions
|
||||||
|
=========================================
|
||||||
|
|
||||||
|
The C++11 standard brought lambda functions and the generic polymorphic
|
||||||
|
function wrapper ``std::function<>`` to the C++ programming language, which
|
||||||
|
enable powerful new ways of working with functions. Lambda functions come in
|
||||||
|
two flavors: stateless lambda function resemble classic function pointers that
|
||||||
|
link to an anonymous piece of code, while stateful lambda functions
|
||||||
|
additionally depend on captured variables that are stored in an anonymous
|
||||||
|
*lambda closure object*.
|
||||||
|
|
||||||
|
Here is a simple example of a C++ function that takes an arbitrary function
|
||||||
|
(stateful or stateless) with signature ``int -> int`` as an argument and runs
|
||||||
|
it with the value 10.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
int func_arg(const std::function<int(int)> &f) {
|
||||||
|
return f(10);
|
||||||
|
}
|
||||||
|
|
||||||
|
The example below is more involved: it takes a function of signature ``int -> int``
|
||||||
|
and returns another function of the same kind. The return value is a stateful
|
||||||
|
lambda function, which stores the value ``f`` in the capture object and adds 1 to
|
||||||
|
its return value upon execution.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
std::function<int(int)> func_ret(const std::function<int(int)> &f) {
|
||||||
|
return [f](int i) {
|
||||||
|
return f(i) + 1;
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
This example demonstrates using python named parameters in C++ callbacks which
|
||||||
|
requires using ``py::cpp_function`` as a wrapper. Usage is similar to defining
|
||||||
|
methods of classes:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::cpp_function func_cpp() {
|
||||||
|
return py::cpp_function([](int i) { return i+1; },
|
||||||
|
py::arg("number"));
|
||||||
|
}
|
||||||
|
|
||||||
|
After including the extra header file :file:`pybind11/functional.h`, it is almost
|
||||||
|
trivial to generate binding code for all of these functions.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/functional.h>
|
||||||
|
|
||||||
|
PYBIND11_MODULE(example, m) {
|
||||||
|
m.def("func_arg", &func_arg);
|
||||||
|
m.def("func_ret", &func_ret);
|
||||||
|
m.def("func_cpp", &func_cpp);
|
||||||
|
}
|
||||||
|
|
||||||
|
The following interactive session shows how to call them from Python.
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
$ python
|
||||||
|
>>> import example
|
||||||
|
>>> def square(i):
|
||||||
|
... return i * i
|
||||||
|
...
|
||||||
|
>>> example.func_arg(square)
|
||||||
|
100L
|
||||||
|
>>> square_plus_1 = example.func_ret(square)
|
||||||
|
>>> square_plus_1(4)
|
||||||
|
17L
|
||||||
|
>>> plus_1 = func_cpp()
|
||||||
|
>>> plus_1(number=43)
|
||||||
|
44L
|
||||||
|
|
||||||
|
.. warning::
|
||||||
|
|
||||||
|
Keep in mind that passing a function from C++ to Python (or vice versa)
|
||||||
|
will instantiate a piece of wrapper code that translates function
|
||||||
|
invocations between the two languages. Naturally, this translation
|
||||||
|
increases the computational cost of each function call somewhat. A
|
||||||
|
problematic situation can arise when a function is copied back and forth
|
||||||
|
between Python and C++ many times in a row, in which case the underlying
|
||||||
|
wrappers will accumulate correspondingly. The resulting long sequence of
|
||||||
|
C++ -> Python -> C++ -> ... roundtrips can significantly decrease
|
||||||
|
performance.
|
||||||
|
|
||||||
|
There is one exception: pybind11 detects case where a stateless function
|
||||||
|
(i.e. a function pointer or a lambda function without captured variables)
|
||||||
|
is passed as an argument to another C++ function exposed in Python. In this
|
||||||
|
case, there is no overhead. Pybind11 will extract the underlying C++
|
||||||
|
function pointer from the wrapped function to sidestep a potential C++ ->
|
||||||
|
Python -> C++ roundtrip. This is demonstrated in :file:`tests/test_callbacks.cpp`.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
This functionality is very useful when generating bindings for callbacks in
|
||||||
|
C++ libraries (e.g. GUI libraries, asynchronous networking libraries, etc.).
|
||||||
|
|
||||||
|
The file :file:`tests/test_callbacks.cpp` contains a complete example
|
||||||
|
that demonstrates how to work with callbacks and anonymous functions in
|
||||||
|
more detail.
|
||||||
|
|
@ -0,0 +1,42 @@
|
||||||
|
Type conversions
|
||||||
|
################
|
||||||
|
|
||||||
|
Apart from enabling cross-language function calls, a fundamental problem
|
||||||
|
that a binding tool like pybind11 must address is to provide access to
|
||||||
|
native Python types in C++ and vice versa. There are three fundamentally
|
||||||
|
different ways to do this—which approach is preferable for a particular type
|
||||||
|
depends on the situation at hand.
|
||||||
|
|
||||||
|
1. Use a native C++ type everywhere. In this case, the type must be wrapped
|
||||||
|
using pybind11-generated bindings so that Python can interact with it.
|
||||||
|
|
||||||
|
2. Use a native Python type everywhere. It will need to be wrapped so that
|
||||||
|
C++ functions can interact with it.
|
||||||
|
|
||||||
|
3. Use a native C++ type on the C++ side and a native Python type on the
|
||||||
|
Python side. pybind11 refers to this as a *type conversion*.
|
||||||
|
|
||||||
|
Type conversions are the most "natural" option in the sense that native
|
||||||
|
(non-wrapped) types are used everywhere. The main downside is that a copy
|
||||||
|
of the data must be made on every Python ↔ C++ transition: this is
|
||||||
|
needed since the C++ and Python versions of the same type generally won't
|
||||||
|
have the same memory layout.
|
||||||
|
|
||||||
|
pybind11 can perform many kinds of conversions automatically. An overview
|
||||||
|
is provided in the table ":ref:`conversion_table`".
|
||||||
|
|
||||||
|
The following subsections discuss the differences between these options in more
|
||||||
|
detail. The main focus in this section is on type conversions, which represent
|
||||||
|
the last case of the above list.
|
||||||
|
|
||||||
|
.. toctree::
|
||||||
|
:maxdepth: 1
|
||||||
|
|
||||||
|
overview
|
||||||
|
strings
|
||||||
|
stl
|
||||||
|
functional
|
||||||
|
chrono
|
||||||
|
eigen
|
||||||
|
custom
|
||||||
|
|
||||||
|
|
@ -0,0 +1,165 @@
|
||||||
|
Overview
|
||||||
|
########
|
||||||
|
|
||||||
|
.. rubric:: 1. Native type in C++, wrapper in Python
|
||||||
|
|
||||||
|
Exposing a custom C++ type using :class:`py::class_` was covered in detail
|
||||||
|
in the :doc:`/classes` section. There, the underlying data structure is
|
||||||
|
always the original C++ class while the :class:`py::class_` wrapper provides
|
||||||
|
a Python interface. Internally, when an object like this is sent from C++ to
|
||||||
|
Python, pybind11 will just add the outer wrapper layer over the native C++
|
||||||
|
object. Getting it back from Python is just a matter of peeling off the
|
||||||
|
wrapper.
|
||||||
|
|
||||||
|
.. rubric:: 2. Wrapper in C++, native type in Python
|
||||||
|
|
||||||
|
This is the exact opposite situation. Now, we have a type which is native to
|
||||||
|
Python, like a ``tuple`` or a ``list``. One way to get this data into C++ is
|
||||||
|
with the :class:`py::object` family of wrappers. These are explained in more
|
||||||
|
detail in the :doc:`/advanced/pycpp/object` section. We'll just give a quick
|
||||||
|
example here:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void print_list(py::list my_list) {
|
||||||
|
for (auto item : my_list)
|
||||||
|
std::cout << item << " ";
|
||||||
|
}
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> print_list([1, 2, 3])
|
||||||
|
1 2 3
|
||||||
|
|
||||||
|
The Python ``list`` is not converted in any way -- it's just wrapped in a C++
|
||||||
|
:class:`py::list` class. At its core it's still a Python object. Copying a
|
||||||
|
:class:`py::list` will do the usual reference-counting like in Python.
|
||||||
|
Returning the object to Python will just remove the thin wrapper.
|
||||||
|
|
||||||
|
.. rubric:: 3. Converting between native C++ and Python types
|
||||||
|
|
||||||
|
In the previous two cases we had a native type in one language and a wrapper in
|
||||||
|
the other. Now, we have native types on both sides and we convert between them.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void print_vector(const std::vector<int> &v) {
|
||||||
|
for (auto item : v)
|
||||||
|
std::cout << item << "\n";
|
||||||
|
}
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> print_vector([1, 2, 3])
|
||||||
|
1 2 3
|
||||||
|
|
||||||
|
In this case, pybind11 will construct a new ``std::vector<int>`` and copy each
|
||||||
|
element from the Python ``list``. The newly constructed object will be passed
|
||||||
|
to ``print_vector``. The same thing happens in the other direction: a new
|
||||||
|
``list`` is made to match the value returned from C++.
|
||||||
|
|
||||||
|
Lots of these conversions are supported out of the box, as shown in the table
|
||||||
|
below. They are very convenient, but keep in mind that these conversions are
|
||||||
|
fundamentally based on copying data. This is perfectly fine for small immutable
|
||||||
|
types but it may become quite expensive for large data structures. This can be
|
||||||
|
avoided by overriding the automatic conversion with a custom wrapper (i.e. the
|
||||||
|
above-mentioned approach 1). This requires some manual effort and more details
|
||||||
|
are available in the :ref:`opaque` section.
|
||||||
|
|
||||||
|
.. _conversion_table:
|
||||||
|
|
||||||
|
List of all builtin conversions
|
||||||
|
-------------------------------
|
||||||
|
|
||||||
|
The following basic data types are supported out of the box (some may require
|
||||||
|
an additional extension header to be included). To pass other data structures
|
||||||
|
as arguments and return values, refer to the section on binding :ref:`classes`.
|
||||||
|
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| Data type | Description | Header file |
|
||||||
|
+====================================+===========================+===============================+
|
||||||
|
| ``int8_t``, ``uint8_t`` | 8-bit integers | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``int16_t``, ``uint16_t`` | 16-bit integers | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``int32_t``, ``uint32_t`` | 32-bit integers | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``int64_t``, ``uint64_t`` | 64-bit integers | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``ssize_t``, ``size_t`` | Platform-dependent size | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``float``, ``double`` | Floating point types | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``bool`` | Two-state Boolean type | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``char`` | Character literal | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``char16_t`` | UTF-16 character literal | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``char32_t`` | UTF-32 character literal | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``wchar_t`` | Wide character literal | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``const char *`` | UTF-8 string literal | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``const char16_t *`` | UTF-16 string literal | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``const char32_t *`` | UTF-32 string literal | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``const wchar_t *`` | Wide string literal | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::string`` | STL dynamic UTF-8 string | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::u16string`` | STL dynamic UTF-16 string | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::u32string`` | STL dynamic UTF-32 string | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::wstring`` | STL dynamic wide string | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::string_view``, | STL C++17 string views | :file:`pybind11/pybind11.h` |
|
||||||
|
| ``std::u16string_view``, etc. | | |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::pair<T1, T2>`` | Pair of two custom types | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::tuple<...>`` | Arbitrary tuple of types | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::reference_wrapper<...>`` | Reference type wrapper | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::complex<T>`` | Complex numbers | :file:`pybind11/complex.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::array<T, Size>`` | STL static array | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::vector<T>`` | STL dynamic array | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::deque<T>`` | STL double-ended queue | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::valarray<T>`` | STL value array | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::list<T>`` | STL linked list | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::map<T1, T2>`` | STL ordered map | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::unordered_map<T1, T2>`` | STL unordered map | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::set<T>`` | STL ordered set | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::unordered_set<T>`` | STL unordered set | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::optional<T>`` | STL optional type (C++17) | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::experimental::optional<T>`` | STL optional type (exp.) | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::variant<...>`` | Type-safe union (C++17) | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::function<...>`` | STL polymorphic function | :file:`pybind11/functional.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::chrono::duration<...>`` | STL time duration | :file:`pybind11/chrono.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::chrono::time_point<...>`` | STL date/time | :file:`pybind11/chrono.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``Eigen::Matrix<...>`` | Eigen: dense matrix | :file:`pybind11/eigen.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``Eigen::Map<...>`` | Eigen: mapped memory | :file:`pybind11/eigen.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``Eigen::SparseMatrix<...>`` | Eigen: sparse matrix | :file:`pybind11/eigen.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
|
@ -0,0 +1,240 @@
|
||||||
|
STL containers
|
||||||
|
##############
|
||||||
|
|
||||||
|
Automatic conversion
|
||||||
|
====================
|
||||||
|
|
||||||
|
When including the additional header file :file:`pybind11/stl.h`, conversions
|
||||||
|
between ``std::vector<>``/``std::deque<>``/``std::list<>``/``std::array<>``,
|
||||||
|
``std::set<>``/``std::unordered_set<>``, and
|
||||||
|
``std::map<>``/``std::unordered_map<>`` and the Python ``list``, ``set`` and
|
||||||
|
``dict`` data structures are automatically enabled. The types ``std::pair<>``
|
||||||
|
and ``std::tuple<>`` are already supported out of the box with just the core
|
||||||
|
:file:`pybind11/pybind11.h` header.
|
||||||
|
|
||||||
|
The major downside of these implicit conversions is that containers must be
|
||||||
|
converted (i.e. copied) on every Python->C++ and C++->Python transition, which
|
||||||
|
can have implications on the program semantics and performance. Please read the
|
||||||
|
next sections for more details and alternative approaches that avoid this.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
Arbitrary nesting of any of these types is possible.
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_stl.cpp` contains a complete
|
||||||
|
example that demonstrates how to pass STL data types in more detail.
|
||||||
|
|
||||||
|
.. _cpp17_container_casters:
|
||||||
|
|
||||||
|
C++17 library containers
|
||||||
|
========================
|
||||||
|
|
||||||
|
The :file:`pybind11/stl.h` header also includes support for ``std::optional<>``
|
||||||
|
and ``std::variant<>``. These require a C++17 compiler and standard library.
|
||||||
|
In C++14 mode, ``std::experimental::optional<>`` is supported if available.
|
||||||
|
|
||||||
|
Various versions of these containers also exist for C++11 (e.g. in Boost).
|
||||||
|
pybind11 provides an easy way to specialize the ``type_caster`` for such
|
||||||
|
types:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// `boost::optional` as an example -- can be any `std::optional`-like container
|
||||||
|
namespace pybind11 { namespace detail {
|
||||||
|
template <typename T>
|
||||||
|
struct type_caster<boost::optional<T>> : optional_caster<boost::optional<T>> {};
|
||||||
|
}}
|
||||||
|
|
||||||
|
The above should be placed in a header file and included in all translation units
|
||||||
|
where automatic conversion is needed. Similarly, a specialization can be provided
|
||||||
|
for custom variant types:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// `boost::variant` as an example -- can be any `std::variant`-like container
|
||||||
|
namespace pybind11 { namespace detail {
|
||||||
|
template <typename... Ts>
|
||||||
|
struct type_caster<boost::variant<Ts...>> : variant_caster<boost::variant<Ts...>> {};
|
||||||
|
|
||||||
|
// Specifies the function used to visit the variant -- `apply_visitor` instead of `visit`
|
||||||
|
template <>
|
||||||
|
struct visit_helper<boost::variant> {
|
||||||
|
template <typename... Args>
|
||||||
|
static auto call(Args &&...args) -> decltype(boost::apply_visitor(args...)) {
|
||||||
|
return boost::apply_visitor(args...);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}} // namespace pybind11::detail
|
||||||
|
|
||||||
|
The ``visit_helper`` specialization is not required if your ``name::variant`` provides
|
||||||
|
a ``name::visit()`` function. For any other function name, the specialization must be
|
||||||
|
included to tell pybind11 how to visit the variant.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
pybind11 only supports the modern implementation of ``boost::variant``
|
||||||
|
which makes use of variadic templates. This requires Boost 1.56 or newer.
|
||||||
|
Additionally, on Windows, MSVC 2017 is required because ``boost::variant``
|
||||||
|
falls back to the old non-variadic implementation on MSVC 2015.
|
||||||
|
|
||||||
|
.. _opaque:
|
||||||
|
|
||||||
|
Making opaque types
|
||||||
|
===================
|
||||||
|
|
||||||
|
pybind11 heavily relies on a template matching mechanism to convert parameters
|
||||||
|
and return values that are constructed from STL data types such as vectors,
|
||||||
|
linked lists, hash tables, etc. This even works in a recursive manner, for
|
||||||
|
instance to deal with lists of hash maps of pairs of elementary and custom
|
||||||
|
types, etc.
|
||||||
|
|
||||||
|
However, a fundamental limitation of this approach is that internal conversions
|
||||||
|
between Python and C++ types involve a copy operation that prevents
|
||||||
|
pass-by-reference semantics. What does this mean?
|
||||||
|
|
||||||
|
Suppose we bind the following function
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void append_1(std::vector<int> &v) {
|
||||||
|
v.push_back(1);
|
||||||
|
}
|
||||||
|
|
||||||
|
and call it from Python, the following happens:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> v = [5, 6]
|
||||||
|
>>> append_1(v)
|
||||||
|
>>> print(v)
|
||||||
|
[5, 6]
|
||||||
|
|
||||||
|
As you can see, when passing STL data structures by reference, modifications
|
||||||
|
are not propagated back the Python side. A similar situation arises when
|
||||||
|
exposing STL data structures using the ``def_readwrite`` or ``def_readonly``
|
||||||
|
functions:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
/* ... definition ... */
|
||||||
|
|
||||||
|
class MyClass {
|
||||||
|
std::vector<int> contents;
|
||||||
|
};
|
||||||
|
|
||||||
|
/* ... binding code ... */
|
||||||
|
|
||||||
|
py::class_<MyClass>(m, "MyClass")
|
||||||
|
.def(py::init<>())
|
||||||
|
.def_readwrite("contents", &MyClass::contents);
|
||||||
|
|
||||||
|
In this case, properties can be read and written in their entirety. However, an
|
||||||
|
``append`` operation involving such a list type has no effect:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> m = MyClass()
|
||||||
|
>>> m.contents = [5, 6]
|
||||||
|
>>> print(m.contents)
|
||||||
|
[5, 6]
|
||||||
|
>>> m.contents.append(7)
|
||||||
|
>>> print(m.contents)
|
||||||
|
[5, 6]
|
||||||
|
|
||||||
|
Finally, the involved copy operations can be costly when dealing with very
|
||||||
|
large lists. To deal with all of the above situations, pybind11 provides a
|
||||||
|
macro named ``PYBIND11_MAKE_OPAQUE(T)`` that disables the template-based
|
||||||
|
conversion machinery of types, thus rendering them *opaque*. The contents of
|
||||||
|
opaque objects are never inspected or extracted, hence they *can* be passed by
|
||||||
|
reference. For instance, to turn ``std::vector<int>`` into an opaque type, add
|
||||||
|
the declaration
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
PYBIND11_MAKE_OPAQUE(std::vector<int>);
|
||||||
|
|
||||||
|
before any binding code (e.g. invocations to ``class_::def()``, etc.). This
|
||||||
|
macro must be specified at the top level (and outside of any namespaces), since
|
||||||
|
it instantiates a partial template overload. If your binding code consists of
|
||||||
|
multiple compilation units, it must be present in every file (typically via a
|
||||||
|
common header) preceding any usage of ``std::vector<int>``. Opaque types must
|
||||||
|
also have a corresponding ``class_`` declaration to associate them with a name
|
||||||
|
in Python, and to define a set of available operations, e.g.:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<std::vector<int>>(m, "IntVector")
|
||||||
|
.def(py::init<>())
|
||||||
|
.def("clear", &std::vector<int>::clear)
|
||||||
|
.def("pop_back", &std::vector<int>::pop_back)
|
||||||
|
.def("__len__", [](const std::vector<int> &v) { return v.size(); })
|
||||||
|
.def("__iter__", [](std::vector<int> &v) {
|
||||||
|
return py::make_iterator(v.begin(), v.end());
|
||||||
|
}, py::keep_alive<0, 1>()) /* Keep vector alive while iterator is used */
|
||||||
|
// ....
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_opaque_types.cpp` contains a complete
|
||||||
|
example that demonstrates how to create and expose opaque types using
|
||||||
|
pybind11 in more detail.
|
||||||
|
|
||||||
|
.. _stl_bind:
|
||||||
|
|
||||||
|
Binding STL containers
|
||||||
|
======================
|
||||||
|
|
||||||
|
The ability to expose STL containers as native Python objects is a fairly
|
||||||
|
common request, hence pybind11 also provides an optional header file named
|
||||||
|
:file:`pybind11/stl_bind.h` that does exactly this. The mapped containers try
|
||||||
|
to match the behavior of their native Python counterparts as much as possible.
|
||||||
|
|
||||||
|
The following example showcases usage of :file:`pybind11/stl_bind.h`:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// Don't forget this
|
||||||
|
#include <pybind11/stl_bind.h>
|
||||||
|
|
||||||
|
PYBIND11_MAKE_OPAQUE(std::vector<int>);
|
||||||
|
PYBIND11_MAKE_OPAQUE(std::map<std::string, double>);
|
||||||
|
|
||||||
|
// ...
|
||||||
|
|
||||||
|
// later in binding code:
|
||||||
|
py::bind_vector<std::vector<int>>(m, "VectorInt");
|
||||||
|
py::bind_map<std::map<std::string, double>>(m, "MapStringDouble");
|
||||||
|
|
||||||
|
When binding STL containers pybind11 considers the types of the container's
|
||||||
|
elements to decide whether the container should be confined to the local module
|
||||||
|
(via the :ref:`module_local` feature). If the container element types are
|
||||||
|
anything other than already-bound custom types bound without
|
||||||
|
``py::module_local()`` the container binding will have ``py::module_local()``
|
||||||
|
applied. This includes converting types such as numeric types, strings, Eigen
|
||||||
|
types; and types that have not yet been bound at the time of the stl container
|
||||||
|
binding. This module-local binding is designed to avoid potential conflicts
|
||||||
|
between module bindings (for example, from two separate modules each attempting
|
||||||
|
to bind ``std::vector<int>`` as a python type).
|
||||||
|
|
||||||
|
It is possible to override this behavior to force a definition to be either
|
||||||
|
module-local or global. To do so, you can pass the attributes
|
||||||
|
``py::module_local()`` (to make the binding module-local) or
|
||||||
|
``py::module_local(false)`` (to make the binding global) into the
|
||||||
|
``py::bind_vector`` or ``py::bind_map`` arguments:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::bind_vector<std::vector<int>>(m, "VectorInt", py::module_local(false));
|
||||||
|
|
||||||
|
Note, however, that such a global binding would make it impossible to load this
|
||||||
|
module at the same time as any other pybind module that also attempts to bind
|
||||||
|
the same container type (``std::vector<int>`` in the above example).
|
||||||
|
|
||||||
|
See :ref:`module_local` for more details on module-local bindings.
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_stl_binders.cpp` shows how to use the
|
||||||
|
convenience STL container wrappers.
|
||||||
|
|
@ -0,0 +1,305 @@
|
||||||
|
Strings, bytes and Unicode conversions
|
||||||
|
######################################
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
This section discusses string handling in terms of Python 3 strings. For
|
||||||
|
Python 2.7, replace all occurrences of ``str`` with ``unicode`` and
|
||||||
|
``bytes`` with ``str``. Python 2.7 users may find it best to use ``from
|
||||||
|
__future__ import unicode_literals`` to avoid unintentionally using ``str``
|
||||||
|
instead of ``unicode``.
|
||||||
|
|
||||||
|
Passing Python strings to C++
|
||||||
|
=============================
|
||||||
|
|
||||||
|
When a Python ``str`` is passed from Python to a C++ function that accepts
|
||||||
|
``std::string`` or ``char *`` as arguments, pybind11 will encode the Python
|
||||||
|
string to UTF-8. All Python ``str`` can be encoded in UTF-8, so this operation
|
||||||
|
does not fail.
|
||||||
|
|
||||||
|
The C++ language is encoding agnostic. It is the responsibility of the
|
||||||
|
programmer to track encodings. It's often easiest to simply `use UTF-8
|
||||||
|
everywhere <http://utf8everywhere.org/>`_.
|
||||||
|
|
||||||
|
.. code-block:: c++
|
||||||
|
|
||||||
|
m.def("utf8_test",
|
||||||
|
[](const std::string &s) {
|
||||||
|
cout << "utf-8 is icing on the cake.\n";
|
||||||
|
cout << s;
|
||||||
|
}
|
||||||
|
);
|
||||||
|
m.def("utf8_charptr",
|
||||||
|
[](const char *s) {
|
||||||
|
cout << "My favorite food is\n";
|
||||||
|
cout << s;
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
>>> utf8_test('🎂')
|
||||||
|
utf-8 is icing on the cake.
|
||||||
|
🎂
|
||||||
|
|
||||||
|
>>> utf8_charptr('🍕')
|
||||||
|
My favorite food is
|
||||||
|
🍕
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
Some terminal emulators do not support UTF-8 or emoji fonts and may not
|
||||||
|
display the example above correctly.
|
||||||
|
|
||||||
|
The results are the same whether the C++ function accepts arguments by value or
|
||||||
|
reference, and whether or not ``const`` is used.
|
||||||
|
|
||||||
|
Passing bytes to C++
|
||||||
|
--------------------
|
||||||
|
|
||||||
|
A Python ``bytes`` object will be passed to C++ functions that accept
|
||||||
|
``std::string`` or ``char*`` *without* conversion. On Python 3, in order to
|
||||||
|
make a function *only* accept ``bytes`` (and not ``str``), declare it as taking
|
||||||
|
a ``py::bytes`` argument.
|
||||||
|
|
||||||
|
|
||||||
|
Returning C++ strings to Python
|
||||||
|
===============================
|
||||||
|
|
||||||
|
When a C++ function returns a ``std::string`` or ``char*`` to a Python caller,
|
||||||
|
**pybind11 will assume that the string is valid UTF-8** and will decode it to a
|
||||||
|
native Python ``str``, using the same API as Python uses to perform
|
||||||
|
``bytes.decode('utf-8')``. If this implicit conversion fails, pybind11 will
|
||||||
|
raise a ``UnicodeDecodeError``.
|
||||||
|
|
||||||
|
.. code-block:: c++
|
||||||
|
|
||||||
|
m.def("std_string_return",
|
||||||
|
[]() {
|
||||||
|
return std::string("This string needs to be UTF-8 encoded");
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
>>> isinstance(example.std_string_return(), str)
|
||||||
|
True
|
||||||
|
|
||||||
|
|
||||||
|
Because UTF-8 is inclusive of pure ASCII, there is never any issue with
|
||||||
|
returning a pure ASCII string to Python. If there is any possibility that the
|
||||||
|
string is not pure ASCII, it is necessary to ensure the encoding is valid
|
||||||
|
UTF-8.
|
||||||
|
|
||||||
|
.. warning::
|
||||||
|
|
||||||
|
Implicit conversion assumes that a returned ``char *`` is null-terminated.
|
||||||
|
If there is no null terminator a buffer overrun will occur.
|
||||||
|
|
||||||
|
Explicit conversions
|
||||||
|
--------------------
|
||||||
|
|
||||||
|
If some C++ code constructs a ``std::string`` that is not a UTF-8 string, one
|
||||||
|
can perform a explicit conversion and return a ``py::str`` object. Explicit
|
||||||
|
conversion has the same overhead as implicit conversion.
|
||||||
|
|
||||||
|
.. code-block:: c++
|
||||||
|
|
||||||
|
// This uses the Python C API to convert Latin-1 to Unicode
|
||||||
|
m.def("str_output",
|
||||||
|
[]() {
|
||||||
|
std::string s = "Send your r\xe9sum\xe9 to Alice in HR"; // Latin-1
|
||||||
|
py::str py_s = PyUnicode_DecodeLatin1(s.data(), s.length());
|
||||||
|
return py_s;
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
>>> str_output()
|
||||||
|
'Send your résumé to Alice in HR'
|
||||||
|
|
||||||
|
The `Python C API
|
||||||
|
<https://docs.python.org/3/c-api/unicode.html#built-in-codecs>`_ provides
|
||||||
|
several built-in codecs.
|
||||||
|
|
||||||
|
|
||||||
|
One could also use a third party encoding library such as libiconv to transcode
|
||||||
|
to UTF-8.
|
||||||
|
|
||||||
|
Return C++ strings without conversion
|
||||||
|
-------------------------------------
|
||||||
|
|
||||||
|
If the data in a C++ ``std::string`` does not represent text and should be
|
||||||
|
returned to Python as ``bytes``, then one can return the data as a
|
||||||
|
``py::bytes`` object.
|
||||||
|
|
||||||
|
.. code-block:: c++
|
||||||
|
|
||||||
|
m.def("return_bytes",
|
||||||
|
[]() {
|
||||||
|
std::string s("\xba\xd0\xba\xd0"); // Not valid UTF-8
|
||||||
|
return py::bytes(s); // Return the data without transcoding
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
>>> example.return_bytes()
|
||||||
|
b'\xba\xd0\xba\xd0'
|
||||||
|
|
||||||
|
|
||||||
|
Note the asymmetry: pybind11 will convert ``bytes`` to ``std::string`` without
|
||||||
|
encoding, but cannot convert ``std::string`` back to ``bytes`` implicitly.
|
||||||
|
|
||||||
|
.. code-block:: c++
|
||||||
|
|
||||||
|
m.def("asymmetry",
|
||||||
|
[](std::string s) { // Accepts str or bytes from Python
|
||||||
|
return s; // Looks harmless, but implicitly converts to str
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
>>> isinstance(example.asymmetry(b"have some bytes"), str)
|
||||||
|
True
|
||||||
|
|
||||||
|
>>> example.asymmetry(b"\xba\xd0\xba\xd0") # invalid utf-8 as bytes
|
||||||
|
UnicodeDecodeError: 'utf-8' codec can't decode byte 0xba in position 0: invalid start byte
|
||||||
|
|
||||||
|
|
||||||
|
Wide character strings
|
||||||
|
======================
|
||||||
|
|
||||||
|
When a Python ``str`` is passed to a C++ function expecting ``std::wstring``,
|
||||||
|
``wchar_t*``, ``std::u16string`` or ``std::u32string``, the ``str`` will be
|
||||||
|
encoded to UTF-16 or UTF-32 depending on how the C++ compiler implements each
|
||||||
|
type, in the platform's native endianness. When strings of these types are
|
||||||
|
returned, they are assumed to contain valid UTF-16 or UTF-32, and will be
|
||||||
|
decoded to Python ``str``.
|
||||||
|
|
||||||
|
.. code-block:: c++
|
||||||
|
|
||||||
|
#define UNICODE
|
||||||
|
#include <windows.h>
|
||||||
|
|
||||||
|
m.def("set_window_text",
|
||||||
|
[](HWND hwnd, std::wstring s) {
|
||||||
|
// Call SetWindowText with null-terminated UTF-16 string
|
||||||
|
::SetWindowText(hwnd, s.c_str());
|
||||||
|
}
|
||||||
|
);
|
||||||
|
m.def("get_window_text",
|
||||||
|
[](HWND hwnd) {
|
||||||
|
const int buffer_size = ::GetWindowTextLength(hwnd) + 1;
|
||||||
|
auto buffer = std::make_unique< wchar_t[] >(buffer_size);
|
||||||
|
|
||||||
|
::GetWindowText(hwnd, buffer.data(), buffer_size);
|
||||||
|
|
||||||
|
std::wstring text(buffer.get());
|
||||||
|
|
||||||
|
// wstring will be converted to Python str
|
||||||
|
return text;
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
.. warning::
|
||||||
|
|
||||||
|
Wide character strings may not work as described on Python 2.7 or Python
|
||||||
|
3.3 compiled with ``--enable-unicode=ucs2``.
|
||||||
|
|
||||||
|
Strings in multibyte encodings such as Shift-JIS must transcoded to a
|
||||||
|
UTF-8/16/32 before being returned to Python.
|
||||||
|
|
||||||
|
|
||||||
|
Character literals
|
||||||
|
==================
|
||||||
|
|
||||||
|
C++ functions that accept character literals as input will receive the first
|
||||||
|
character of a Python ``str`` as their input. If the string is longer than one
|
||||||
|
Unicode character, trailing characters will be ignored.
|
||||||
|
|
||||||
|
When a character literal is returned from C++ (such as a ``char`` or a
|
||||||
|
``wchar_t``), it will be converted to a ``str`` that represents the single
|
||||||
|
character.
|
||||||
|
|
||||||
|
.. code-block:: c++
|
||||||
|
|
||||||
|
m.def("pass_char", [](char c) { return c; });
|
||||||
|
m.def("pass_wchar", [](wchar_t w) { return w; });
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
>>> example.pass_char('A')
|
||||||
|
'A'
|
||||||
|
|
||||||
|
While C++ will cast integers to character types (``char c = 0x65;``), pybind11
|
||||||
|
does not convert Python integers to characters implicitly. The Python function
|
||||||
|
``chr()`` can be used to convert integers to characters.
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
>>> example.pass_char(0x65)
|
||||||
|
TypeError
|
||||||
|
|
||||||
|
>>> example.pass_char(chr(0x65))
|
||||||
|
'A'
|
||||||
|
|
||||||
|
If the desire is to work with an 8-bit integer, use ``int8_t`` or ``uint8_t``
|
||||||
|
as the argument type.
|
||||||
|
|
||||||
|
Grapheme clusters
|
||||||
|
-----------------
|
||||||
|
|
||||||
|
A single grapheme may be represented by two or more Unicode characters. For
|
||||||
|
example 'é' is usually represented as U+00E9 but can also be expressed as the
|
||||||
|
combining character sequence U+0065 U+0301 (that is, the letter 'e' followed by
|
||||||
|
a combining acute accent). The combining character will be lost if the
|
||||||
|
two-character sequence is passed as an argument, even though it renders as a
|
||||||
|
single grapheme.
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
>>> example.pass_wchar('é')
|
||||||
|
'é'
|
||||||
|
|
||||||
|
>>> combining_e_acute = 'e' + '\u0301'
|
||||||
|
|
||||||
|
>>> combining_e_acute
|
||||||
|
'é'
|
||||||
|
|
||||||
|
>>> combining_e_acute == 'é'
|
||||||
|
False
|
||||||
|
|
||||||
|
>>> example.pass_wchar(combining_e_acute)
|
||||||
|
'e'
|
||||||
|
|
||||||
|
Normalizing combining characters before passing the character literal to C++
|
||||||
|
may resolve *some* of these issues:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
>>> example.pass_wchar(unicodedata.normalize('NFC', combining_e_acute))
|
||||||
|
'é'
|
||||||
|
|
||||||
|
In some languages (Thai for example), there are `graphemes that cannot be
|
||||||
|
expressed as a single Unicode code point
|
||||||
|
<http://unicode.org/reports/tr29/#Grapheme_Cluster_Boundaries>`_, so there is
|
||||||
|
no way to capture them in a C++ character type.
|
||||||
|
|
||||||
|
|
||||||
|
C++17 string views
|
||||||
|
==================
|
||||||
|
|
||||||
|
C++17 string views are automatically supported when compiling in C++17 mode.
|
||||||
|
They follow the same rules for encoding and decoding as the corresponding STL
|
||||||
|
string type (for example, a ``std::u16string_view`` argument will be passed
|
||||||
|
UTF-16-encoded data, and a returned ``std::string_view`` will be decoded as
|
||||||
|
UTF-8).
|
||||||
|
|
||||||
|
References
|
||||||
|
==========
|
||||||
|
|
||||||
|
* `The Absolute Minimum Every Software Developer Absolutely, Positively Must Know About Unicode and Character Sets (No Excuses!) <https://www.joelonsoftware.com/2003/10/08/the-absolute-minimum-every-software-developer-absolutely-positively-must-know-about-unicode-and-character-sets-no-excuses/>`_
|
||||||
|
* `C++ - Using STL Strings at Win32 API Boundaries <https://msdn.microsoft.com/en-ca/magazine/mt238407.aspx>`_
|
||||||
File diff suppressed because it is too large
Load Diff
|
|
@ -0,0 +1,261 @@
|
||||||
|
.. _embedding:
|
||||||
|
|
||||||
|
Embedding the interpreter
|
||||||
|
#########################
|
||||||
|
|
||||||
|
While pybind11 is mainly focused on extending Python using C++, it's also
|
||||||
|
possible to do the reverse: embed the Python interpreter into a C++ program.
|
||||||
|
All of the other documentation pages still apply here, so refer to them for
|
||||||
|
general pybind11 usage. This section will cover a few extra things required
|
||||||
|
for embedding.
|
||||||
|
|
||||||
|
Getting started
|
||||||
|
===============
|
||||||
|
|
||||||
|
A basic executable with an embedded interpreter can be created with just a few
|
||||||
|
lines of CMake and the ``pybind11::embed`` target, as shown below. For more
|
||||||
|
information, see :doc:`/compiling`.
|
||||||
|
|
||||||
|
.. code-block:: cmake
|
||||||
|
|
||||||
|
cmake_minimum_required(VERSION 3.0)
|
||||||
|
project(example)
|
||||||
|
|
||||||
|
find_package(pybind11 REQUIRED) # or `add_subdirectory(pybind11)`
|
||||||
|
|
||||||
|
add_executable(example main.cpp)
|
||||||
|
target_link_libraries(example PRIVATE pybind11::embed)
|
||||||
|
|
||||||
|
The essential structure of the ``main.cpp`` file looks like this:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/embed.h> // everything needed for embedding
|
||||||
|
namespace py = pybind11;
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
py::scoped_interpreter guard{}; // start the interpreter and keep it alive
|
||||||
|
|
||||||
|
py::print("Hello, World!"); // use the Python API
|
||||||
|
}
|
||||||
|
|
||||||
|
The interpreter must be initialized before using any Python API, which includes
|
||||||
|
all the functions and classes in pybind11. The RAII guard class `scoped_interpreter`
|
||||||
|
takes care of the interpreter lifetime. After the guard is destroyed, the interpreter
|
||||||
|
shuts down and clears its memory. No Python functions can be called after this.
|
||||||
|
|
||||||
|
Executing Python code
|
||||||
|
=====================
|
||||||
|
|
||||||
|
There are a few different ways to run Python code. One option is to use `eval`,
|
||||||
|
`exec` or `eval_file`, as explained in :ref:`eval`. Here is a quick example in
|
||||||
|
the context of an executable with an embedded interpreter:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/embed.h>
|
||||||
|
namespace py = pybind11;
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
py::scoped_interpreter guard{};
|
||||||
|
|
||||||
|
py::exec(R"(
|
||||||
|
kwargs = dict(name="World", number=42)
|
||||||
|
message = "Hello, {name}! The answer is {number}".format(**kwargs)
|
||||||
|
print(message)
|
||||||
|
)");
|
||||||
|
}
|
||||||
|
|
||||||
|
Alternatively, similar results can be achieved using pybind11's API (see
|
||||||
|
:doc:`/advanced/pycpp/index` for more details).
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/embed.h>
|
||||||
|
namespace py = pybind11;
|
||||||
|
using namespace py::literals;
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
py::scoped_interpreter guard{};
|
||||||
|
|
||||||
|
auto kwargs = py::dict("name"_a="World", "number"_a=42);
|
||||||
|
auto message = "Hello, {name}! The answer is {number}"_s.format(**kwargs);
|
||||||
|
py::print(message);
|
||||||
|
}
|
||||||
|
|
||||||
|
The two approaches can also be combined:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/embed.h>
|
||||||
|
#include <iostream>
|
||||||
|
|
||||||
|
namespace py = pybind11;
|
||||||
|
using namespace py::literals;
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
py::scoped_interpreter guard{};
|
||||||
|
|
||||||
|
auto locals = py::dict("name"_a="World", "number"_a=42);
|
||||||
|
py::exec(R"(
|
||||||
|
message = "Hello, {name}! The answer is {number}".format(**locals())
|
||||||
|
)", py::globals(), locals);
|
||||||
|
|
||||||
|
auto message = locals["message"].cast<std::string>();
|
||||||
|
std::cout << message;
|
||||||
|
}
|
||||||
|
|
||||||
|
Importing modules
|
||||||
|
=================
|
||||||
|
|
||||||
|
Python modules can be imported using `module::import()`:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::module sys = py::module::import("sys");
|
||||||
|
py::print(sys.attr("path"));
|
||||||
|
|
||||||
|
For convenience, the current working directory is included in ``sys.path`` when
|
||||||
|
embedding the interpreter. This makes it easy to import local Python files:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
"""calc.py located in the working directory"""
|
||||||
|
|
||||||
|
def add(i, j):
|
||||||
|
return i + j
|
||||||
|
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::module calc = py::module::import("calc");
|
||||||
|
py::object result = calc.attr("add")(1, 2);
|
||||||
|
int n = result.cast<int>();
|
||||||
|
assert(n == 3);
|
||||||
|
|
||||||
|
Modules can be reloaded using `module::reload()` if the source is modified e.g.
|
||||||
|
by an external process. This can be useful in scenarios where the application
|
||||||
|
imports a user defined data processing script which needs to be updated after
|
||||||
|
changes by the user. Note that this function does not reload modules recursively.
|
||||||
|
|
||||||
|
.. _embedding_modules:
|
||||||
|
|
||||||
|
Adding embedded modules
|
||||||
|
=======================
|
||||||
|
|
||||||
|
Embedded binary modules can be added using the `PYBIND11_EMBEDDED_MODULE` macro.
|
||||||
|
Note that the definition must be placed at global scope. They can be imported
|
||||||
|
like any other module.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/embed.h>
|
||||||
|
namespace py = pybind11;
|
||||||
|
|
||||||
|
PYBIND11_EMBEDDED_MODULE(fast_calc, m) {
|
||||||
|
// `m` is a `py::module` which is used to bind functions and classes
|
||||||
|
m.def("add", [](int i, int j) {
|
||||||
|
return i + j;
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
py::scoped_interpreter guard{};
|
||||||
|
|
||||||
|
auto fast_calc = py::module::import("fast_calc");
|
||||||
|
auto result = fast_calc.attr("add")(1, 2).cast<int>();
|
||||||
|
assert(result == 3);
|
||||||
|
}
|
||||||
|
|
||||||
|
Unlike extension modules where only a single binary module can be created, on
|
||||||
|
the embedded side an unlimited number of modules can be added using multiple
|
||||||
|
`PYBIND11_EMBEDDED_MODULE` definitions (as long as they have unique names).
|
||||||
|
|
||||||
|
These modules are added to Python's list of builtins, so they can also be
|
||||||
|
imported in pure Python files loaded by the interpreter. Everything interacts
|
||||||
|
naturally:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
"""py_module.py located in the working directory"""
|
||||||
|
import cpp_module
|
||||||
|
|
||||||
|
a = cpp_module.a
|
||||||
|
b = a + 1
|
||||||
|
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/embed.h>
|
||||||
|
namespace py = pybind11;
|
||||||
|
|
||||||
|
PYBIND11_EMBEDDED_MODULE(cpp_module, m) {
|
||||||
|
m.attr("a") = 1;
|
||||||
|
}
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
py::scoped_interpreter guard{};
|
||||||
|
|
||||||
|
auto py_module = py::module::import("py_module");
|
||||||
|
|
||||||
|
auto locals = py::dict("fmt"_a="{} + {} = {}", **py_module.attr("__dict__"));
|
||||||
|
assert(locals["a"].cast<int>() == 1);
|
||||||
|
assert(locals["b"].cast<int>() == 2);
|
||||||
|
|
||||||
|
py::exec(R"(
|
||||||
|
c = a + b
|
||||||
|
message = fmt.format(a, b, c)
|
||||||
|
)", py::globals(), locals);
|
||||||
|
|
||||||
|
assert(locals["c"].cast<int>() == 3);
|
||||||
|
assert(locals["message"].cast<std::string>() == "1 + 2 = 3");
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
Interpreter lifetime
|
||||||
|
====================
|
||||||
|
|
||||||
|
The Python interpreter shuts down when `scoped_interpreter` is destroyed. After
|
||||||
|
this, creating a new instance will restart the interpreter. Alternatively, the
|
||||||
|
`initialize_interpreter` / `finalize_interpreter` pair of functions can be used
|
||||||
|
to directly set the state at any time.
|
||||||
|
|
||||||
|
Modules created with pybind11 can be safely re-initialized after the interpreter
|
||||||
|
has been restarted. However, this may not apply to third-party extension modules.
|
||||||
|
The issue is that Python itself cannot completely unload extension modules and
|
||||||
|
there are several caveats with regard to interpreter restarting. In short, not
|
||||||
|
all memory may be freed, either due to Python reference cycles or user-created
|
||||||
|
global data. All the details can be found in the CPython documentation.
|
||||||
|
|
||||||
|
.. warning::
|
||||||
|
|
||||||
|
Creating two concurrent `scoped_interpreter` guards is a fatal error. So is
|
||||||
|
calling `initialize_interpreter` for a second time after the interpreter
|
||||||
|
has already been initialized.
|
||||||
|
|
||||||
|
Do not use the raw CPython API functions ``Py_Initialize`` and
|
||||||
|
``Py_Finalize`` as these do not properly handle the lifetime of
|
||||||
|
pybind11's internal data.
|
||||||
|
|
||||||
|
|
||||||
|
Sub-interpreter support
|
||||||
|
=======================
|
||||||
|
|
||||||
|
Creating multiple copies of `scoped_interpreter` is not possible because it
|
||||||
|
represents the main Python interpreter. Sub-interpreters are something different
|
||||||
|
and they do permit the existence of multiple interpreters. This is an advanced
|
||||||
|
feature of the CPython API and should be handled with care. pybind11 does not
|
||||||
|
currently offer a C++ interface for sub-interpreters, so refer to the CPython
|
||||||
|
documentation for all the details regarding this feature.
|
||||||
|
|
||||||
|
We'll just mention a couple of caveats the sub-interpreters support in pybind11:
|
||||||
|
|
||||||
|
1. Sub-interpreters will not receive independent copies of embedded modules.
|
||||||
|
Instead, these are shared and modifications in one interpreter may be
|
||||||
|
reflected in another.
|
||||||
|
|
||||||
|
2. Managing multiple threads, multiple interpreters and the GIL can be
|
||||||
|
challenging and there are several caveats here, even within the pure
|
||||||
|
CPython API (please refer to the Python docs for details). As for
|
||||||
|
pybind11, keep in mind that `gil_scoped_release` and `gil_scoped_acquire`
|
||||||
|
do not take sub-interpreters into account.
|
||||||
|
|
@ -0,0 +1,142 @@
|
||||||
|
Exceptions
|
||||||
|
##########
|
||||||
|
|
||||||
|
Built-in exception translation
|
||||||
|
==============================
|
||||||
|
|
||||||
|
When C++ code invoked from Python throws an ``std::exception``, it is
|
||||||
|
automatically converted into a Python ``Exception``. pybind11 defines multiple
|
||||||
|
special exception classes that will map to different types of Python
|
||||||
|
exceptions:
|
||||||
|
|
||||||
|
.. tabularcolumns:: |p{0.5\textwidth}|p{0.45\textwidth}|
|
||||||
|
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| C++ exception type | Python exception type |
|
||||||
|
+======================================+======================================+
|
||||||
|
| :class:`std::exception` | ``RuntimeError`` |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`std::bad_alloc` | ``MemoryError`` |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`std::domain_error` | ``ValueError`` |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`std::invalid_argument` | ``ValueError`` |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`std::length_error` | ``ValueError`` |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`std::out_of_range` | ``IndexError`` |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`std::range_error` | ``ValueError`` |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`pybind11::stop_iteration` | ``StopIteration`` (used to implement |
|
||||||
|
| | custom iterators) |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`pybind11::index_error` | ``IndexError`` (used to indicate out |
|
||||||
|
| | of bounds access in ``__getitem__``, |
|
||||||
|
| | ``__setitem__``, etc.) |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`pybind11::value_error` | ``ValueError`` (used to indicate |
|
||||||
|
| | wrong value passed in |
|
||||||
|
| | ``container.remove(...)``) |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`pybind11::key_error` | ``KeyError`` (used to indicate out |
|
||||||
|
| | of bounds access in ``__getitem__``, |
|
||||||
|
| | ``__setitem__`` in dict-like |
|
||||||
|
| | objects, etc.) |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`pybind11::error_already_set` | Indicates that the Python exception |
|
||||||
|
| | flag has already been set via Python |
|
||||||
|
| | API calls from C++ code; this C++ |
|
||||||
|
| | exception is used to propagate such |
|
||||||
|
| | a Python exception back to Python. |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
|
||||||
|
When a Python function invoked from C++ throws an exception, it is converted
|
||||||
|
into a C++ exception of type :class:`error_already_set` whose string payload
|
||||||
|
contains a textual summary.
|
||||||
|
|
||||||
|
There is also a special exception :class:`cast_error` that is thrown by
|
||||||
|
:func:`handle::call` when the input arguments cannot be converted to Python
|
||||||
|
objects.
|
||||||
|
|
||||||
|
Registering custom translators
|
||||||
|
==============================
|
||||||
|
|
||||||
|
If the default exception conversion policy described above is insufficient,
|
||||||
|
pybind11 also provides support for registering custom exception translators.
|
||||||
|
To register a simple exception conversion that translates a C++ exception into
|
||||||
|
a new Python exception using the C++ exception's ``what()`` method, a helper
|
||||||
|
function is available:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::register_exception<CppExp>(module, "PyExp");
|
||||||
|
|
||||||
|
This call creates a Python exception class with the name ``PyExp`` in the given
|
||||||
|
module and automatically converts any encountered exceptions of type ``CppExp``
|
||||||
|
into Python exceptions of type ``PyExp``.
|
||||||
|
|
||||||
|
When more advanced exception translation is needed, the function
|
||||||
|
``py::register_exception_translator(translator)`` can be used to register
|
||||||
|
functions that can translate arbitrary exception types (and which may include
|
||||||
|
additional logic to do so). The function takes a stateless callable (e.g. a
|
||||||
|
function pointer or a lambda function without captured variables) with the call
|
||||||
|
signature ``void(std::exception_ptr)``.
|
||||||
|
|
||||||
|
When a C++ exception is thrown, the registered exception translators are tried
|
||||||
|
in reverse order of registration (i.e. the last registered translator gets the
|
||||||
|
first shot at handling the exception).
|
||||||
|
|
||||||
|
Inside the translator, ``std::rethrow_exception`` should be used within
|
||||||
|
a try block to re-throw the exception. One or more catch clauses to catch
|
||||||
|
the appropriate exceptions should then be used with each clause using
|
||||||
|
``PyErr_SetString`` to set a Python exception or ``ex(string)`` to set
|
||||||
|
the python exception to a custom exception type (see below).
|
||||||
|
|
||||||
|
To declare a custom Python exception type, declare a ``py::exception`` variable
|
||||||
|
and use this in the associated exception translator (note: it is often useful
|
||||||
|
to make this a static declaration when using it inside a lambda expression
|
||||||
|
without requiring capturing).
|
||||||
|
|
||||||
|
|
||||||
|
The following example demonstrates this for a hypothetical exception classes
|
||||||
|
``MyCustomException`` and ``OtherException``: the first is translated to a
|
||||||
|
custom python exception ``MyCustomError``, while the second is translated to a
|
||||||
|
standard python RuntimeError:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
static py::exception<MyCustomException> exc(m, "MyCustomError");
|
||||||
|
py::register_exception_translator([](std::exception_ptr p) {
|
||||||
|
try {
|
||||||
|
if (p) std::rethrow_exception(p);
|
||||||
|
} catch (const MyCustomException &e) {
|
||||||
|
exc(e.what());
|
||||||
|
} catch (const OtherException &e) {
|
||||||
|
PyErr_SetString(PyExc_RuntimeError, e.what());
|
||||||
|
}
|
||||||
|
});
|
||||||
|
|
||||||
|
Multiple exceptions can be handled by a single translator, as shown in the
|
||||||
|
example above. If the exception is not caught by the current translator, the
|
||||||
|
previously registered one gets a chance.
|
||||||
|
|
||||||
|
If none of the registered exception translators is able to handle the
|
||||||
|
exception, it is handled by the default converter as described in the previous
|
||||||
|
section.
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_exceptions.cpp` contains examples
|
||||||
|
of various custom exception translators and custom exception types.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
You must call either ``PyErr_SetString`` or a custom exception's call
|
||||||
|
operator (``exc(string)``) for every exception caught in a custom exception
|
||||||
|
translator. Failure to do so will cause Python to crash with ``SystemError:
|
||||||
|
error return without exception set``.
|
||||||
|
|
||||||
|
Exceptions that you do not plan to handle should simply not be caught, or
|
||||||
|
may be explicitly (re-)thrown to delegate it to the other,
|
||||||
|
previously-declared existing exception translators.
|
||||||
|
|
@ -0,0 +1,507 @@
|
||||||
|
Functions
|
||||||
|
#########
|
||||||
|
|
||||||
|
Before proceeding with this section, make sure that you are already familiar
|
||||||
|
with the basics of binding functions and classes, as explained in :doc:`/basics`
|
||||||
|
and :doc:`/classes`. The following guide is applicable to both free and member
|
||||||
|
functions, i.e. *methods* in Python.
|
||||||
|
|
||||||
|
.. _return_value_policies:
|
||||||
|
|
||||||
|
Return value policies
|
||||||
|
=====================
|
||||||
|
|
||||||
|
Python and C++ use fundamentally different ways of managing the memory and
|
||||||
|
lifetime of objects managed by them. This can lead to issues when creating
|
||||||
|
bindings for functions that return a non-trivial type. Just by looking at the
|
||||||
|
type information, it is not clear whether Python should take charge of the
|
||||||
|
returned value and eventually free its resources, or if this is handled on the
|
||||||
|
C++ side. For this reason, pybind11 provides a several *return value policy*
|
||||||
|
annotations that can be passed to the :func:`module::def` and
|
||||||
|
:func:`class_::def` functions. The default policy is
|
||||||
|
:enum:`return_value_policy::automatic`.
|
||||||
|
|
||||||
|
Return value policies are tricky, and it's very important to get them right.
|
||||||
|
Just to illustrate what can go wrong, consider the following simple example:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
/* Function declaration */
|
||||||
|
Data *get_data() { return _data; /* (pointer to a static data structure) */ }
|
||||||
|
...
|
||||||
|
|
||||||
|
/* Binding code */
|
||||||
|
m.def("get_data", &get_data); // <-- KABOOM, will cause crash when called from Python
|
||||||
|
|
||||||
|
What's going on here? When ``get_data()`` is called from Python, the return
|
||||||
|
value (a native C++ type) must be wrapped to turn it into a usable Python type.
|
||||||
|
In this case, the default return value policy (:enum:`return_value_policy::automatic`)
|
||||||
|
causes pybind11 to assume ownership of the static ``_data`` instance.
|
||||||
|
|
||||||
|
When Python's garbage collector eventually deletes the Python
|
||||||
|
wrapper, pybind11 will also attempt to delete the C++ instance (via ``operator
|
||||||
|
delete()``) due to the implied ownership. At this point, the entire application
|
||||||
|
will come crashing down, though errors could also be more subtle and involve
|
||||||
|
silent data corruption.
|
||||||
|
|
||||||
|
In the above example, the policy :enum:`return_value_policy::reference` should have
|
||||||
|
been specified so that the global data instance is only *referenced* without any
|
||||||
|
implied transfer of ownership, i.e.:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("get_data", &get_data, return_value_policy::reference);
|
||||||
|
|
||||||
|
On the other hand, this is not the right policy for many other situations,
|
||||||
|
where ignoring ownership could lead to resource leaks.
|
||||||
|
As a developer using pybind11, it's important to be familiar with the different
|
||||||
|
return value policies, including which situation calls for which one of them.
|
||||||
|
The following table provides an overview of available policies:
|
||||||
|
|
||||||
|
.. tabularcolumns:: |p{0.5\textwidth}|p{0.45\textwidth}|
|
||||||
|
|
||||||
|
+--------------------------------------------------+----------------------------------------------------------------------------+
|
||||||
|
| Return value policy | Description |
|
||||||
|
+==================================================+============================================================================+
|
||||||
|
| :enum:`return_value_policy::take_ownership` | Reference an existing object (i.e. do not create a new copy) and take |
|
||||||
|
| | ownership. Python will call the destructor and delete operator when the |
|
||||||
|
| | object's reference count reaches zero. Undefined behavior ensues when the |
|
||||||
|
| | C++ side does the same, or when the data was not dynamically allocated. |
|
||||||
|
+--------------------------------------------------+----------------------------------------------------------------------------+
|
||||||
|
| :enum:`return_value_policy::copy` | Create a new copy of the returned object, which will be owned by Python. |
|
||||||
|
| | This policy is comparably safe because the lifetimes of the two instances |
|
||||||
|
| | are decoupled. |
|
||||||
|
+--------------------------------------------------+----------------------------------------------------------------------------+
|
||||||
|
| :enum:`return_value_policy::move` | Use ``std::move`` to move the return value contents into a new instance |
|
||||||
|
| | that will be owned by Python. This policy is comparably safe because the |
|
||||||
|
| | lifetimes of the two instances (move source and destination) are decoupled.|
|
||||||
|
+--------------------------------------------------+----------------------------------------------------------------------------+
|
||||||
|
| :enum:`return_value_policy::reference` | Reference an existing object, but do not take ownership. The C++ side is |
|
||||||
|
| | responsible for managing the object's lifetime and deallocating it when |
|
||||||
|
| | it is no longer used. Warning: undefined behavior will ensue when the C++ |
|
||||||
|
| | side deletes an object that is still referenced and used by Python. |
|
||||||
|
+--------------------------------------------------+----------------------------------------------------------------------------+
|
||||||
|
| :enum:`return_value_policy::reference_internal` | Indicates that the lifetime of the return value is tied to the lifetime |
|
||||||
|
| | of a parent object, namely the implicit ``this``, or ``self`` argument of |
|
||||||
|
| | the called method or property. Internally, this policy works just like |
|
||||||
|
| | :enum:`return_value_policy::reference` but additionally applies a |
|
||||||
|
| | ``keep_alive<0, 1>`` *call policy* (described in the next section) that |
|
||||||
|
| | prevents the parent object from being garbage collected as long as the |
|
||||||
|
| | return value is referenced by Python. This is the default policy for |
|
||||||
|
| | property getters created via ``def_property``, ``def_readwrite``, etc. |
|
||||||
|
+--------------------------------------------------+----------------------------------------------------------------------------+
|
||||||
|
| :enum:`return_value_policy::automatic` | **Default policy.** This policy falls back to the policy |
|
||||||
|
| | :enum:`return_value_policy::take_ownership` when the return value is a |
|
||||||
|
| | pointer. Otherwise, it uses :enum:`return_value_policy::move` or |
|
||||||
|
| | :enum:`return_value_policy::copy` for rvalue and lvalue references, |
|
||||||
|
| | respectively. See above for a description of what all of these different |
|
||||||
|
| | policies do. |
|
||||||
|
+--------------------------------------------------+----------------------------------------------------------------------------+
|
||||||
|
| :enum:`return_value_policy::automatic_reference` | As above, but use policy :enum:`return_value_policy::reference` when the |
|
||||||
|
| | return value is a pointer. This is the default conversion policy for |
|
||||||
|
| | function arguments when calling Python functions manually from C++ code |
|
||||||
|
| | (i.e. via handle::operator()). You probably won't need to use this. |
|
||||||
|
+--------------------------------------------------+----------------------------------------------------------------------------+
|
||||||
|
|
||||||
|
Return value policies can also be applied to properties:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
class_<MyClass>(m, "MyClass")
|
||||||
|
.def_property("data", &MyClass::getData, &MyClass::setData,
|
||||||
|
py::return_value_policy::copy);
|
||||||
|
|
||||||
|
Technically, the code above applies the policy to both the getter and the
|
||||||
|
setter function, however, the setter doesn't really care about *return*
|
||||||
|
value policies which makes this a convenient terse syntax. Alternatively,
|
||||||
|
targeted arguments can be passed through the :class:`cpp_function` constructor:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
class_<MyClass>(m, "MyClass")
|
||||||
|
.def_property("data"
|
||||||
|
py::cpp_function(&MyClass::getData, py::return_value_policy::copy),
|
||||||
|
py::cpp_function(&MyClass::setData)
|
||||||
|
);
|
||||||
|
|
||||||
|
.. warning::
|
||||||
|
|
||||||
|
Code with invalid return value policies might access uninitialized memory or
|
||||||
|
free data structures multiple times, which can lead to hard-to-debug
|
||||||
|
non-determinism and segmentation faults, hence it is worth spending the
|
||||||
|
time to understand all the different options in the table above.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
One important aspect of the above policies is that they only apply to
|
||||||
|
instances which pybind11 has *not* seen before, in which case the policy
|
||||||
|
clarifies essential questions about the return value's lifetime and
|
||||||
|
ownership. When pybind11 knows the instance already (as identified by its
|
||||||
|
type and address in memory), it will return the existing Python object
|
||||||
|
wrapper rather than creating a new copy.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
The next section on :ref:`call_policies` discusses *call policies* that can be
|
||||||
|
specified *in addition* to a return value policy from the list above. Call
|
||||||
|
policies indicate reference relationships that can involve both return values
|
||||||
|
and parameters of functions.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
As an alternative to elaborate call policies and lifetime management logic,
|
||||||
|
consider using smart pointers (see the section on :ref:`smart_pointers` for
|
||||||
|
details). Smart pointers can tell whether an object is still referenced from
|
||||||
|
C++ or Python, which generally eliminates the kinds of inconsistencies that
|
||||||
|
can lead to crashes or undefined behavior. For functions returning smart
|
||||||
|
pointers, it is not necessary to specify a return value policy.
|
||||||
|
|
||||||
|
.. _call_policies:
|
||||||
|
|
||||||
|
Additional call policies
|
||||||
|
========================
|
||||||
|
|
||||||
|
In addition to the above return value policies, further *call policies* can be
|
||||||
|
specified to indicate dependencies between parameters or ensure a certain state
|
||||||
|
for the function call.
|
||||||
|
|
||||||
|
Keep alive
|
||||||
|
----------
|
||||||
|
|
||||||
|
In general, this policy is required when the C++ object is any kind of container
|
||||||
|
and another object is being added to the container. ``keep_alive<Nurse, Patient>``
|
||||||
|
indicates that the argument with index ``Patient`` should be kept alive at least
|
||||||
|
until the argument with index ``Nurse`` is freed by the garbage collector. Argument
|
||||||
|
indices start at one, while zero refers to the return value. For methods, index
|
||||||
|
``1`` refers to the implicit ``this`` pointer, while regular arguments begin at
|
||||||
|
index ``2``. Arbitrarily many call policies can be specified. When a ``Nurse``
|
||||||
|
with value ``None`` is detected at runtime, the call policy does nothing.
|
||||||
|
|
||||||
|
When the nurse is not a pybind11-registered type, the implementation internally
|
||||||
|
relies on the ability to create a *weak reference* to the nurse object. When
|
||||||
|
the nurse object is not a pybind11-registered type and does not support weak
|
||||||
|
references, an exception will be thrown.
|
||||||
|
|
||||||
|
Consider the following example: here, the binding code for a list append
|
||||||
|
operation ties the lifetime of the newly added element to the underlying
|
||||||
|
container:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<List>(m, "List")
|
||||||
|
.def("append", &List::append, py::keep_alive<1, 2>());
|
||||||
|
|
||||||
|
For consistency, the argument indexing is identical for constructors. Index
|
||||||
|
``1`` still refers to the implicit ``this`` pointer, i.e. the object which is
|
||||||
|
being constructed. Index ``0`` refers to the return type which is presumed to
|
||||||
|
be ``void`` when a constructor is viewed like a function. The following example
|
||||||
|
ties the lifetime of the constructor element to the constructed object:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Nurse>(m, "Nurse")
|
||||||
|
.def(py::init<Patient &>(), py::keep_alive<1, 2>());
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
``keep_alive`` is analogous to the ``with_custodian_and_ward`` (if Nurse,
|
||||||
|
Patient != 0) and ``with_custodian_and_ward_postcall`` (if Nurse/Patient ==
|
||||||
|
0) policies from Boost.Python.
|
||||||
|
|
||||||
|
Call guard
|
||||||
|
----------
|
||||||
|
|
||||||
|
The ``call_guard<T>`` policy allows any scope guard type ``T`` to be placed
|
||||||
|
around the function call. For example, this definition:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("foo", foo, py::call_guard<T>());
|
||||||
|
|
||||||
|
is equivalent to the following pseudocode:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("foo", [](args...) {
|
||||||
|
T scope_guard;
|
||||||
|
return foo(args...); // forwarded arguments
|
||||||
|
});
|
||||||
|
|
||||||
|
The only requirement is that ``T`` is default-constructible, but otherwise any
|
||||||
|
scope guard will work. This is very useful in combination with `gil_scoped_release`.
|
||||||
|
See :ref:`gil`.
|
||||||
|
|
||||||
|
Multiple guards can also be specified as ``py::call_guard<T1, T2, T3...>``. The
|
||||||
|
constructor order is left to right and destruction happens in reverse.
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_call_policies.cpp` contains a complete example
|
||||||
|
that demonstrates using `keep_alive` and `call_guard` in more detail.
|
||||||
|
|
||||||
|
.. _python_objects_as_args:
|
||||||
|
|
||||||
|
Python objects as arguments
|
||||||
|
===========================
|
||||||
|
|
||||||
|
pybind11 exposes all major Python types using thin C++ wrapper classes. These
|
||||||
|
wrapper classes can also be used as parameters of functions in bindings, which
|
||||||
|
makes it possible to directly work with native Python types on the C++ side.
|
||||||
|
For instance, the following statement iterates over a Python ``dict``:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void print_dict(py::dict dict) {
|
||||||
|
/* Easily interact with Python types */
|
||||||
|
for (auto item : dict)
|
||||||
|
std::cout << "key=" << std::string(py::str(item.first)) << ", "
|
||||||
|
<< "value=" << std::string(py::str(item.second)) << std::endl;
|
||||||
|
}
|
||||||
|
|
||||||
|
It can be exported:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("print_dict", &print_dict);
|
||||||
|
|
||||||
|
And used in Python as usual:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> print_dict({'foo': 123, 'bar': 'hello'})
|
||||||
|
key=foo, value=123
|
||||||
|
key=bar, value=hello
|
||||||
|
|
||||||
|
For more information on using Python objects in C++, see :doc:`/advanced/pycpp/index`.
|
||||||
|
|
||||||
|
Accepting \*args and \*\*kwargs
|
||||||
|
===============================
|
||||||
|
|
||||||
|
Python provides a useful mechanism to define functions that accept arbitrary
|
||||||
|
numbers of arguments and keyword arguments:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
def generic(*args, **kwargs):
|
||||||
|
... # do something with args and kwargs
|
||||||
|
|
||||||
|
Such functions can also be created using pybind11:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void generic(py::args args, py::kwargs kwargs) {
|
||||||
|
/// .. do something with args
|
||||||
|
if (kwargs)
|
||||||
|
/// .. do something with kwargs
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Binding code
|
||||||
|
m.def("generic", &generic);
|
||||||
|
|
||||||
|
The class ``py::args`` derives from ``py::tuple`` and ``py::kwargs`` derives
|
||||||
|
from ``py::dict``.
|
||||||
|
|
||||||
|
You may also use just one or the other, and may combine these with other
|
||||||
|
arguments as long as the ``py::args`` and ``py::kwargs`` arguments are the last
|
||||||
|
arguments accepted by the function.
|
||||||
|
|
||||||
|
Please refer to the other examples for details on how to iterate over these,
|
||||||
|
and on how to cast their entries into C++ objects. A demonstration is also
|
||||||
|
available in ``tests/test_kwargs_and_defaults.cpp``.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
When combining \*args or \*\*kwargs with :ref:`keyword_args` you should
|
||||||
|
*not* include ``py::arg`` tags for the ``py::args`` and ``py::kwargs``
|
||||||
|
arguments.
|
||||||
|
|
||||||
|
Default arguments revisited
|
||||||
|
===========================
|
||||||
|
|
||||||
|
The section on :ref:`default_args` previously discussed basic usage of default
|
||||||
|
arguments using pybind11. One noteworthy aspect of their implementation is that
|
||||||
|
default arguments are converted to Python objects right at declaration time.
|
||||||
|
Consider the following example:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<MyClass>("MyClass")
|
||||||
|
.def("myFunction", py::arg("arg") = SomeType(123));
|
||||||
|
|
||||||
|
In this case, pybind11 must already be set up to deal with values of the type
|
||||||
|
``SomeType`` (via a prior instantiation of ``py::class_<SomeType>``), or an
|
||||||
|
exception will be thrown.
|
||||||
|
|
||||||
|
Another aspect worth highlighting is that the "preview" of the default argument
|
||||||
|
in the function signature is generated using the object's ``__repr__`` method.
|
||||||
|
If not available, the signature may not be very helpful, e.g.:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
FUNCTIONS
|
||||||
|
...
|
||||||
|
| myFunction(...)
|
||||||
|
| Signature : (MyClass, arg : SomeType = <SomeType object at 0x101b7b080>) -> NoneType
|
||||||
|
...
|
||||||
|
|
||||||
|
The first way of addressing this is by defining ``SomeType.__repr__``.
|
||||||
|
Alternatively, it is possible to specify the human-readable preview of the
|
||||||
|
default argument manually using the ``arg_v`` notation:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<MyClass>("MyClass")
|
||||||
|
.def("myFunction", py::arg_v("arg", SomeType(123), "SomeType(123)"));
|
||||||
|
|
||||||
|
Sometimes it may be necessary to pass a null pointer value as a default
|
||||||
|
argument. In this case, remember to cast it to the underlying type in question,
|
||||||
|
like so:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<MyClass>("MyClass")
|
||||||
|
.def("myFunction", py::arg("arg") = (SomeType *) nullptr);
|
||||||
|
|
||||||
|
.. _nonconverting_arguments:
|
||||||
|
|
||||||
|
Non-converting arguments
|
||||||
|
========================
|
||||||
|
|
||||||
|
Certain argument types may support conversion from one type to another. Some
|
||||||
|
examples of conversions are:
|
||||||
|
|
||||||
|
* :ref:`implicit_conversions` declared using ``py::implicitly_convertible<A,B>()``
|
||||||
|
* Calling a method accepting a double with an integer argument
|
||||||
|
* Calling a ``std::complex<float>`` argument with a non-complex python type
|
||||||
|
(for example, with a float). (Requires the optional ``pybind11/complex.h``
|
||||||
|
header).
|
||||||
|
* Calling a function taking an Eigen matrix reference with a numpy array of the
|
||||||
|
wrong type or of an incompatible data layout. (Requires the optional
|
||||||
|
``pybind11/eigen.h`` header).
|
||||||
|
|
||||||
|
This behaviour is sometimes undesirable: the binding code may prefer to raise
|
||||||
|
an error rather than convert the argument. This behaviour can be obtained
|
||||||
|
through ``py::arg`` by calling the ``.noconvert()`` method of the ``py::arg``
|
||||||
|
object, such as:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("floats_only", [](double f) { return 0.5 * f; }, py::arg("f").noconvert());
|
||||||
|
m.def("floats_preferred", [](double f) { return 0.5 * f; }, py::arg("f"));
|
||||||
|
|
||||||
|
Attempting the call the second function (the one without ``.noconvert()``) with
|
||||||
|
an integer will succeed, but attempting to call the ``.noconvert()`` version
|
||||||
|
will fail with a ``TypeError``:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> floats_preferred(4)
|
||||||
|
2.0
|
||||||
|
>>> floats_only(4)
|
||||||
|
Traceback (most recent call last):
|
||||||
|
File "<stdin>", line 1, in <module>
|
||||||
|
TypeError: floats_only(): incompatible function arguments. The following argument types are supported:
|
||||||
|
1. (f: float) -> float
|
||||||
|
|
||||||
|
Invoked with: 4
|
||||||
|
|
||||||
|
You may, of course, combine this with the :var:`_a` shorthand notation (see
|
||||||
|
:ref:`keyword_args`) and/or :ref:`default_args`. It is also permitted to omit
|
||||||
|
the argument name by using the ``py::arg()`` constructor without an argument
|
||||||
|
name, i.e. by specifying ``py::arg().noconvert()``.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
When specifying ``py::arg`` options it is necessary to provide the same
|
||||||
|
number of options as the bound function has arguments. Thus if you want to
|
||||||
|
enable no-convert behaviour for just one of several arguments, you will
|
||||||
|
need to specify a ``py::arg()`` annotation for each argument with the
|
||||||
|
no-convert argument modified to ``py::arg().noconvert()``.
|
||||||
|
|
||||||
|
.. _none_arguments:
|
||||||
|
|
||||||
|
Allow/Prohibiting None arguments
|
||||||
|
================================
|
||||||
|
|
||||||
|
When a C++ type registered with :class:`py::class_` is passed as an argument to
|
||||||
|
a function taking the instance as pointer or shared holder (e.g. ``shared_ptr``
|
||||||
|
or a custom, copyable holder as described in :ref:`smart_pointers`), pybind
|
||||||
|
allows ``None`` to be passed from Python which results in calling the C++
|
||||||
|
function with ``nullptr`` (or an empty holder) for the argument.
|
||||||
|
|
||||||
|
To explicitly enable or disable this behaviour, using the
|
||||||
|
``.none`` method of the :class:`py::arg` object:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Dog>(m, "Dog").def(py::init<>());
|
||||||
|
py::class_<Cat>(m, "Cat").def(py::init<>());
|
||||||
|
m.def("bark", [](Dog *dog) -> std::string {
|
||||||
|
if (dog) return "woof!"; /* Called with a Dog instance */
|
||||||
|
else return "(no dog)"; /* Called with None, dog == nullptr */
|
||||||
|
}, py::arg("dog").none(true));
|
||||||
|
m.def("meow", [](Cat *cat) -> std::string {
|
||||||
|
// Can't be called with None argument
|
||||||
|
return "meow";
|
||||||
|
}, py::arg("cat").none(false));
|
||||||
|
|
||||||
|
With the above, the Python call ``bark(None)`` will return the string ``"(no
|
||||||
|
dog)"``, while attempting to call ``meow(None)`` will raise a ``TypeError``:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> from animals import Dog, Cat, bark, meow
|
||||||
|
>>> bark(Dog())
|
||||||
|
'woof!'
|
||||||
|
>>> meow(Cat())
|
||||||
|
'meow'
|
||||||
|
>>> bark(None)
|
||||||
|
'(no dog)'
|
||||||
|
>>> meow(None)
|
||||||
|
Traceback (most recent call last):
|
||||||
|
File "<stdin>", line 1, in <module>
|
||||||
|
TypeError: meow(): incompatible function arguments. The following argument types are supported:
|
||||||
|
1. (cat: animals.Cat) -> str
|
||||||
|
|
||||||
|
Invoked with: None
|
||||||
|
|
||||||
|
The default behaviour when the tag is unspecified is to allow ``None``.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
Even when ``.none(true)`` is specified for an argument, ``None`` will be converted to a
|
||||||
|
``nullptr`` *only* for custom and :ref:`opaque <opaque>` types. Pointers to built-in types
|
||||||
|
(``double *``, ``int *``, ...) and STL types (``std::vector<T> *``, ...; if ``pybind11/stl.h``
|
||||||
|
is included) are copied when converted to C++ (see :doc:`/advanced/cast/overview`) and will
|
||||||
|
not allow ``None`` as argument. To pass optional argument of these copied types consider
|
||||||
|
using ``std::optional<T>``
|
||||||
|
|
||||||
|
Overload resolution order
|
||||||
|
=========================
|
||||||
|
|
||||||
|
When a function or method with multiple overloads is called from Python,
|
||||||
|
pybind11 determines which overload to call in two passes. The first pass
|
||||||
|
attempts to call each overload without allowing argument conversion (as if
|
||||||
|
every argument had been specified as ``py::arg().noconvert()`` as described
|
||||||
|
above).
|
||||||
|
|
||||||
|
If no overload succeeds in the no-conversion first pass, a second pass is
|
||||||
|
attempted in which argument conversion is allowed (except where prohibited via
|
||||||
|
an explicit ``py::arg().noconvert()`` attribute in the function definition).
|
||||||
|
|
||||||
|
If the second pass also fails a ``TypeError`` is raised.
|
||||||
|
|
||||||
|
Within each pass, overloads are tried in the order they were registered with
|
||||||
|
pybind11.
|
||||||
|
|
||||||
|
What this means in practice is that pybind11 will prefer any overload that does
|
||||||
|
not require conversion of arguments to an overload that does, but otherwise prefers
|
||||||
|
earlier-defined overloads to later-defined ones.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
pybind11 does *not* further prioritize based on the number/pattern of
|
||||||
|
overloaded arguments. That is, pybind11 does not prioritize a function
|
||||||
|
requiring one conversion over one requiring three, but only prioritizes
|
||||||
|
overloads requiring no conversion at all to overloads that require
|
||||||
|
conversion of at least one argument.
|
||||||
|
|
@ -0,0 +1,306 @@
|
||||||
|
Miscellaneous
|
||||||
|
#############
|
||||||
|
|
||||||
|
.. _macro_notes:
|
||||||
|
|
||||||
|
General notes regarding convenience macros
|
||||||
|
==========================================
|
||||||
|
|
||||||
|
pybind11 provides a few convenience macros such as
|
||||||
|
:func:`PYBIND11_DECLARE_HOLDER_TYPE` and ``PYBIND11_OVERLOAD_*``. Since these
|
||||||
|
are "just" macros that are evaluated in the preprocessor (which has no concept
|
||||||
|
of types), they *will* get confused by commas in a template argument; for
|
||||||
|
example, consider:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
PYBIND11_OVERLOAD(MyReturnType<T1, T2>, Class<T3, T4>, func)
|
||||||
|
|
||||||
|
The limitation of the C preprocessor interprets this as five arguments (with new
|
||||||
|
arguments beginning after each comma) rather than three. To get around this,
|
||||||
|
there are two alternatives: you can use a type alias, or you can wrap the type
|
||||||
|
using the ``PYBIND11_TYPE`` macro:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// Version 1: using a type alias
|
||||||
|
using ReturnType = MyReturnType<T1, T2>;
|
||||||
|
using ClassType = Class<T3, T4>;
|
||||||
|
PYBIND11_OVERLOAD(ReturnType, ClassType, func);
|
||||||
|
|
||||||
|
// Version 2: using the PYBIND11_TYPE macro:
|
||||||
|
PYBIND11_OVERLOAD(PYBIND11_TYPE(MyReturnType<T1, T2>),
|
||||||
|
PYBIND11_TYPE(Class<T3, T4>), func)
|
||||||
|
|
||||||
|
The ``PYBIND11_MAKE_OPAQUE`` macro does *not* require the above workarounds.
|
||||||
|
|
||||||
|
.. _gil:
|
||||||
|
|
||||||
|
Global Interpreter Lock (GIL)
|
||||||
|
=============================
|
||||||
|
|
||||||
|
When calling a C++ function from Python, the GIL is always held.
|
||||||
|
The classes :class:`gil_scoped_release` and :class:`gil_scoped_acquire` can be
|
||||||
|
used to acquire and release the global interpreter lock in the body of a C++
|
||||||
|
function call. In this way, long-running C++ code can be parallelized using
|
||||||
|
multiple Python threads. Taking :ref:`overriding_virtuals` as an example, this
|
||||||
|
could be realized as follows (important changes highlighted):
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
:emphasize-lines: 8,9,31,32
|
||||||
|
|
||||||
|
class PyAnimal : public Animal {
|
||||||
|
public:
|
||||||
|
/* Inherit the constructors */
|
||||||
|
using Animal::Animal;
|
||||||
|
|
||||||
|
/* Trampoline (need one for each virtual function) */
|
||||||
|
std::string go(int n_times) {
|
||||||
|
/* Acquire GIL before calling Python code */
|
||||||
|
py::gil_scoped_acquire acquire;
|
||||||
|
|
||||||
|
PYBIND11_OVERLOAD_PURE(
|
||||||
|
std::string, /* Return type */
|
||||||
|
Animal, /* Parent class */
|
||||||
|
go, /* Name of function */
|
||||||
|
n_times /* Argument(s) */
|
||||||
|
);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
PYBIND11_MODULE(example, m) {
|
||||||
|
py::class_<Animal, PyAnimal> animal(m, "Animal");
|
||||||
|
animal
|
||||||
|
.def(py::init<>())
|
||||||
|
.def("go", &Animal::go);
|
||||||
|
|
||||||
|
py::class_<Dog>(m, "Dog", animal)
|
||||||
|
.def(py::init<>());
|
||||||
|
|
||||||
|
m.def("call_go", [](Animal *animal) -> std::string {
|
||||||
|
/* Release GIL before calling into (potentially long-running) C++ code */
|
||||||
|
py::gil_scoped_release release;
|
||||||
|
return call_go(animal);
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
The ``call_go`` wrapper can also be simplified using the `call_guard` policy
|
||||||
|
(see :ref:`call_policies`) which yields the same result:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("call_go", &call_go, py::call_guard<py::gil_scoped_release>());
|
||||||
|
|
||||||
|
|
||||||
|
Binding sequence data types, iterators, the slicing protocol, etc.
|
||||||
|
==================================================================
|
||||||
|
|
||||||
|
Please refer to the supplemental example for details.
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_sequences_and_iterators.cpp` contains a
|
||||||
|
complete example that shows how to bind a sequence data type, including
|
||||||
|
length queries (``__len__``), iterators (``__iter__``), the slicing
|
||||||
|
protocol and other kinds of useful operations.
|
||||||
|
|
||||||
|
|
||||||
|
Partitioning code over multiple extension modules
|
||||||
|
=================================================
|
||||||
|
|
||||||
|
It's straightforward to split binding code over multiple extension modules,
|
||||||
|
while referencing types that are declared elsewhere. Everything "just" works
|
||||||
|
without any special precautions. One exception to this rule occurs when
|
||||||
|
extending a type declared in another extension module. Recall the basic example
|
||||||
|
from Section :ref:`inheritance`.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Pet> pet(m, "Pet");
|
||||||
|
pet.def(py::init<const std::string &>())
|
||||||
|
.def_readwrite("name", &Pet::name);
|
||||||
|
|
||||||
|
py::class_<Dog>(m, "Dog", pet /* <- specify parent */)
|
||||||
|
.def(py::init<const std::string &>())
|
||||||
|
.def("bark", &Dog::bark);
|
||||||
|
|
||||||
|
Suppose now that ``Pet`` bindings are defined in a module named ``basic``,
|
||||||
|
whereas the ``Dog`` bindings are defined somewhere else. The challenge is of
|
||||||
|
course that the variable ``pet`` is not available anymore though it is needed
|
||||||
|
to indicate the inheritance relationship to the constructor of ``class_<Dog>``.
|
||||||
|
However, it can be acquired as follows:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::object pet = (py::object) py::module::import("basic").attr("Pet");
|
||||||
|
|
||||||
|
py::class_<Dog>(m, "Dog", pet)
|
||||||
|
.def(py::init<const std::string &>())
|
||||||
|
.def("bark", &Dog::bark);
|
||||||
|
|
||||||
|
Alternatively, you can specify the base class as a template parameter option to
|
||||||
|
``class_``, which performs an automated lookup of the corresponding Python
|
||||||
|
type. Like the above code, however, this also requires invoking the ``import``
|
||||||
|
function once to ensure that the pybind11 binding code of the module ``basic``
|
||||||
|
has been executed:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::module::import("basic");
|
||||||
|
|
||||||
|
py::class_<Dog, Pet>(m, "Dog")
|
||||||
|
.def(py::init<const std::string &>())
|
||||||
|
.def("bark", &Dog::bark);
|
||||||
|
|
||||||
|
Naturally, both methods will fail when there are cyclic dependencies.
|
||||||
|
|
||||||
|
Note that pybind11 code compiled with hidden-by-default symbol visibility (e.g.
|
||||||
|
via the command line flag ``-fvisibility=hidden`` on GCC/Clang), which is
|
||||||
|
required for proper pybind11 functionality, can interfere with the ability to
|
||||||
|
access types defined in another extension module. Working around this requires
|
||||||
|
manually exporting types that are accessed by multiple extension modules;
|
||||||
|
pybind11 provides a macro to do just this:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
class PYBIND11_EXPORT Dog : public Animal {
|
||||||
|
...
|
||||||
|
};
|
||||||
|
|
||||||
|
Note also that it is possible (although would rarely be required) to share arbitrary
|
||||||
|
C++ objects between extension modules at runtime. Internal library data is shared
|
||||||
|
between modules using capsule machinery [#f6]_ which can be also utilized for
|
||||||
|
storing, modifying and accessing user-defined data. Note that an extension module
|
||||||
|
will "see" other extensions' data if and only if they were built with the same
|
||||||
|
pybind11 version. Consider the following example:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
auto data = (MyData *) py::get_shared_data("mydata");
|
||||||
|
if (!data)
|
||||||
|
data = (MyData *) py::set_shared_data("mydata", new MyData(42));
|
||||||
|
|
||||||
|
If the above snippet was used in several separately compiled extension modules,
|
||||||
|
the first one to be imported would create a ``MyData`` instance and associate
|
||||||
|
a ``"mydata"`` key with a pointer to it. Extensions that are imported later
|
||||||
|
would be then able to access the data behind the same pointer.
|
||||||
|
|
||||||
|
.. [#f6] https://docs.python.org/3/extending/extending.html#using-capsules
|
||||||
|
|
||||||
|
Module Destructors
|
||||||
|
==================
|
||||||
|
|
||||||
|
pybind11 does not provide an explicit mechanism to invoke cleanup code at
|
||||||
|
module destruction time. In rare cases where such functionality is required, it
|
||||||
|
is possible to emulate it using Python capsules or weak references with a
|
||||||
|
destruction callback.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
auto cleanup_callback = []() {
|
||||||
|
// perform cleanup here -- this function is called with the GIL held
|
||||||
|
};
|
||||||
|
|
||||||
|
m.add_object("_cleanup", py::capsule(cleanup_callback));
|
||||||
|
|
||||||
|
This approach has the potential downside that instances of classes exposed
|
||||||
|
within the module may still be alive when the cleanup callback is invoked
|
||||||
|
(whether this is acceptable will generally depend on the application).
|
||||||
|
|
||||||
|
Alternatively, the capsule may also be stashed within a type object, which
|
||||||
|
ensures that it not called before all instances of that type have been
|
||||||
|
collected:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
auto cleanup_callback = []() { /* ... */ };
|
||||||
|
m.attr("BaseClass").attr("_cleanup") = py::capsule(cleanup_callback);
|
||||||
|
|
||||||
|
Both approaches also expose a potentially dangerous ``_cleanup`` attribute in
|
||||||
|
Python, which may be undesirable from an API standpoint (a premature explicit
|
||||||
|
call from Python might lead to undefined behavior). Yet another approach that
|
||||||
|
avoids this issue involves weak reference with a cleanup callback:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// Register a callback function that is invoked when the BaseClass object is colelcted
|
||||||
|
py::cpp_function cleanup_callback(
|
||||||
|
[](py::handle weakref) {
|
||||||
|
// perform cleanup here -- this function is called with the GIL held
|
||||||
|
|
||||||
|
weakref.dec_ref(); // release weak reference
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
// Create a weak reference with a cleanup callback and initially leak it
|
||||||
|
(void) py::weakref(m.attr("BaseClass"), cleanup_callback).release();
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
PyPy (at least version 5.9) does not garbage collect objects when the
|
||||||
|
interpreter exits. An alternative approach (which also works on CPython) is to use
|
||||||
|
the :py:mod:`atexit` module [#f7]_, for example:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
auto atexit = py::module::import("atexit");
|
||||||
|
atexit.attr("register")(py::cpp_function([]() {
|
||||||
|
// perform cleanup here -- this function is called with the GIL held
|
||||||
|
}));
|
||||||
|
|
||||||
|
.. [#f7] https://docs.python.org/3/library/atexit.html
|
||||||
|
|
||||||
|
|
||||||
|
Generating documentation using Sphinx
|
||||||
|
=====================================
|
||||||
|
|
||||||
|
Sphinx [#f4]_ has the ability to inspect the signatures and documentation
|
||||||
|
strings in pybind11-based extension modules to automatically generate beautiful
|
||||||
|
documentation in a variety formats. The python_example repository [#f5]_ contains a
|
||||||
|
simple example repository which uses this approach.
|
||||||
|
|
||||||
|
There are two potential gotchas when using this approach: first, make sure that
|
||||||
|
the resulting strings do not contain any :kbd:`TAB` characters, which break the
|
||||||
|
docstring parsing routines. You may want to use C++11 raw string literals,
|
||||||
|
which are convenient for multi-line comments. Conveniently, any excess
|
||||||
|
indentation will be automatically be removed by Sphinx. However, for this to
|
||||||
|
work, it is important that all lines are indented consistently, i.e.:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// ok
|
||||||
|
m.def("foo", &foo, R"mydelimiter(
|
||||||
|
The foo function
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
)mydelimiter");
|
||||||
|
|
||||||
|
// *not ok*
|
||||||
|
m.def("foo", &foo, R"mydelimiter(The foo function
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
)mydelimiter");
|
||||||
|
|
||||||
|
By default, pybind11 automatically generates and prepends a signature to the docstring of a function
|
||||||
|
registered with ``module::def()`` and ``class_::def()``. Sometimes this
|
||||||
|
behavior is not desirable, because you want to provide your own signature or remove
|
||||||
|
the docstring completely to exclude the function from the Sphinx documentation.
|
||||||
|
The class ``options`` allows you to selectively suppress auto-generated signatures:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
PYBIND11_MODULE(example, m) {
|
||||||
|
py::options options;
|
||||||
|
options.disable_function_signatures();
|
||||||
|
|
||||||
|
m.def("add", [](int a, int b) { return a + b; }, "A function which adds two numbers");
|
||||||
|
}
|
||||||
|
|
||||||
|
Note that changes to the settings affect only function bindings created during the
|
||||||
|
lifetime of the ``options`` instance. When it goes out of scope at the end of the module's init function,
|
||||||
|
the default settings are restored to prevent unwanted side effects.
|
||||||
|
|
||||||
|
.. [#f4] http://www.sphinx-doc.org
|
||||||
|
.. [#f5] http://github.com/pybind/python_example
|
||||||
|
|
@ -0,0 +1,13 @@
|
||||||
|
Python C++ interface
|
||||||
|
####################
|
||||||
|
|
||||||
|
pybind11 exposes Python types and functions using thin C++ wrappers, which
|
||||||
|
makes it possible to conveniently call Python code from C++ without resorting
|
||||||
|
to Python's C API.
|
||||||
|
|
||||||
|
.. toctree::
|
||||||
|
:maxdepth: 2
|
||||||
|
|
||||||
|
object
|
||||||
|
numpy
|
||||||
|
utilities
|
||||||
|
|
@ -0,0 +1,386 @@
|
||||||
|
.. _numpy:
|
||||||
|
|
||||||
|
NumPy
|
||||||
|
#####
|
||||||
|
|
||||||
|
Buffer protocol
|
||||||
|
===============
|
||||||
|
|
||||||
|
Python supports an extremely general and convenient approach for exchanging
|
||||||
|
data between plugin libraries. Types can expose a buffer view [#f2]_, which
|
||||||
|
provides fast direct access to the raw internal data representation. Suppose we
|
||||||
|
want to bind the following simplistic Matrix class:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
class Matrix {
|
||||||
|
public:
|
||||||
|
Matrix(size_t rows, size_t cols) : m_rows(rows), m_cols(cols) {
|
||||||
|
m_data = new float[rows*cols];
|
||||||
|
}
|
||||||
|
float *data() { return m_data; }
|
||||||
|
size_t rows() const { return m_rows; }
|
||||||
|
size_t cols() const { return m_cols; }
|
||||||
|
private:
|
||||||
|
size_t m_rows, m_cols;
|
||||||
|
float *m_data;
|
||||||
|
};
|
||||||
|
|
||||||
|
The following binding code exposes the ``Matrix`` contents as a buffer object,
|
||||||
|
making it possible to cast Matrices into NumPy arrays. It is even possible to
|
||||||
|
completely avoid copy operations with Python expressions like
|
||||||
|
``np.array(matrix_instance, copy = False)``.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Matrix>(m, "Matrix", py::buffer_protocol())
|
||||||
|
.def_buffer([](Matrix &m) -> py::buffer_info {
|
||||||
|
return py::buffer_info(
|
||||||
|
m.data(), /* Pointer to buffer */
|
||||||
|
sizeof(float), /* Size of one scalar */
|
||||||
|
py::format_descriptor<float>::format(), /* Python struct-style format descriptor */
|
||||||
|
2, /* Number of dimensions */
|
||||||
|
{ m.rows(), m.cols() }, /* Buffer dimensions */
|
||||||
|
{ sizeof(float) * m.cols(), /* Strides (in bytes) for each index */
|
||||||
|
sizeof(float) }
|
||||||
|
);
|
||||||
|
});
|
||||||
|
|
||||||
|
Supporting the buffer protocol in a new type involves specifying the special
|
||||||
|
``py::buffer_protocol()`` tag in the ``py::class_`` constructor and calling the
|
||||||
|
``def_buffer()`` method with a lambda function that creates a
|
||||||
|
``py::buffer_info`` description record on demand describing a given matrix
|
||||||
|
instance. The contents of ``py::buffer_info`` mirror the Python buffer protocol
|
||||||
|
specification.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
struct buffer_info {
|
||||||
|
void *ptr;
|
||||||
|
ssize_t itemsize;
|
||||||
|
std::string format;
|
||||||
|
ssize_t ndim;
|
||||||
|
std::vector<ssize_t> shape;
|
||||||
|
std::vector<ssize_t> strides;
|
||||||
|
};
|
||||||
|
|
||||||
|
To create a C++ function that can take a Python buffer object as an argument,
|
||||||
|
simply use the type ``py::buffer`` as one of its arguments. Buffers can exist
|
||||||
|
in a great variety of configurations, hence some safety checks are usually
|
||||||
|
necessary in the function body. Below, you can see an basic example on how to
|
||||||
|
define a custom constructor for the Eigen double precision matrix
|
||||||
|
(``Eigen::MatrixXd``) type, which supports initialization from compatible
|
||||||
|
buffer objects (e.g. a NumPy matrix).
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
/* Bind MatrixXd (or some other Eigen type) to Python */
|
||||||
|
typedef Eigen::MatrixXd Matrix;
|
||||||
|
|
||||||
|
typedef Matrix::Scalar Scalar;
|
||||||
|
constexpr bool rowMajor = Matrix::Flags & Eigen::RowMajorBit;
|
||||||
|
|
||||||
|
py::class_<Matrix>(m, "Matrix", py::buffer_protocol())
|
||||||
|
.def("__init__", [](Matrix &m, py::buffer b) {
|
||||||
|
typedef Eigen::Stride<Eigen::Dynamic, Eigen::Dynamic> Strides;
|
||||||
|
|
||||||
|
/* Request a buffer descriptor from Python */
|
||||||
|
py::buffer_info info = b.request();
|
||||||
|
|
||||||
|
/* Some sanity checks ... */
|
||||||
|
if (info.format != py::format_descriptor<Scalar>::format())
|
||||||
|
throw std::runtime_error("Incompatible format: expected a double array!");
|
||||||
|
|
||||||
|
if (info.ndim != 2)
|
||||||
|
throw std::runtime_error("Incompatible buffer dimension!");
|
||||||
|
|
||||||
|
auto strides = Strides(
|
||||||
|
info.strides[rowMajor ? 0 : 1] / (py::ssize_t)sizeof(Scalar),
|
||||||
|
info.strides[rowMajor ? 1 : 0] / (py::ssize_t)sizeof(Scalar));
|
||||||
|
|
||||||
|
auto map = Eigen::Map<Matrix, 0, Strides>(
|
||||||
|
static_cast<Scalar *>(info.ptr), info.shape[0], info.shape[1], strides);
|
||||||
|
|
||||||
|
new (&m) Matrix(map);
|
||||||
|
});
|
||||||
|
|
||||||
|
For reference, the ``def_buffer()`` call for this Eigen data type should look
|
||||||
|
as follows:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
.def_buffer([](Matrix &m) -> py::buffer_info {
|
||||||
|
return py::buffer_info(
|
||||||
|
m.data(), /* Pointer to buffer */
|
||||||
|
sizeof(Scalar), /* Size of one scalar */
|
||||||
|
py::format_descriptor<Scalar>::format(), /* Python struct-style format descriptor */
|
||||||
|
2, /* Number of dimensions */
|
||||||
|
{ m.rows(), m.cols() }, /* Buffer dimensions */
|
||||||
|
{ sizeof(Scalar) * (rowMajor ? m.cols() : 1),
|
||||||
|
sizeof(Scalar) * (rowMajor ? 1 : m.rows()) }
|
||||||
|
/* Strides (in bytes) for each index */
|
||||||
|
);
|
||||||
|
})
|
||||||
|
|
||||||
|
For a much easier approach of binding Eigen types (although with some
|
||||||
|
limitations), refer to the section on :doc:`/advanced/cast/eigen`.
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_buffers.cpp` contains a complete example
|
||||||
|
that demonstrates using the buffer protocol with pybind11 in more detail.
|
||||||
|
|
||||||
|
.. [#f2] http://docs.python.org/3/c-api/buffer.html
|
||||||
|
|
||||||
|
Arrays
|
||||||
|
======
|
||||||
|
|
||||||
|
By exchanging ``py::buffer`` with ``py::array`` in the above snippet, we can
|
||||||
|
restrict the function so that it only accepts NumPy arrays (rather than any
|
||||||
|
type of Python object satisfying the buffer protocol).
|
||||||
|
|
||||||
|
In many situations, we want to define a function which only accepts a NumPy
|
||||||
|
array of a certain data type. This is possible via the ``py::array_t<T>``
|
||||||
|
template. For instance, the following function requires the argument to be a
|
||||||
|
NumPy array containing double precision values.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void f(py::array_t<double> array);
|
||||||
|
|
||||||
|
When it is invoked with a different type (e.g. an integer or a list of
|
||||||
|
integers), the binding code will attempt to cast the input into a NumPy array
|
||||||
|
of the requested type. Note that this feature requires the
|
||||||
|
:file:`pybind11/numpy.h` header to be included.
|
||||||
|
|
||||||
|
Data in NumPy arrays is not guaranteed to packed in a dense manner;
|
||||||
|
furthermore, entries can be separated by arbitrary column and row strides.
|
||||||
|
Sometimes, it can be useful to require a function to only accept dense arrays
|
||||||
|
using either the C (row-major) or Fortran (column-major) ordering. This can be
|
||||||
|
accomplished via a second template argument with values ``py::array::c_style``
|
||||||
|
or ``py::array::f_style``.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void f(py::array_t<double, py::array::c_style | py::array::forcecast> array);
|
||||||
|
|
||||||
|
The ``py::array::forcecast`` argument is the default value of the second
|
||||||
|
template parameter, and it ensures that non-conforming arguments are converted
|
||||||
|
into an array satisfying the specified requirements instead of trying the next
|
||||||
|
function overload.
|
||||||
|
|
||||||
|
Structured types
|
||||||
|
================
|
||||||
|
|
||||||
|
In order for ``py::array_t`` to work with structured (record) types, we first
|
||||||
|
need to register the memory layout of the type. This can be done via
|
||||||
|
``PYBIND11_NUMPY_DTYPE`` macro, called in the plugin definition code, which
|
||||||
|
expects the type followed by field names:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
struct A {
|
||||||
|
int x;
|
||||||
|
double y;
|
||||||
|
};
|
||||||
|
|
||||||
|
struct B {
|
||||||
|
int z;
|
||||||
|
A a;
|
||||||
|
};
|
||||||
|
|
||||||
|
// ...
|
||||||
|
PYBIND11_MODULE(test, m) {
|
||||||
|
// ...
|
||||||
|
|
||||||
|
PYBIND11_NUMPY_DTYPE(A, x, y);
|
||||||
|
PYBIND11_NUMPY_DTYPE(B, z, a);
|
||||||
|
/* now both A and B can be used as template arguments to py::array_t */
|
||||||
|
}
|
||||||
|
|
||||||
|
The structure should consist of fundamental arithmetic types, ``std::complex``,
|
||||||
|
previously registered substructures, and arrays of any of the above. Both C++
|
||||||
|
arrays and ``std::array`` are supported. While there is a static assertion to
|
||||||
|
prevent many types of unsupported structures, it is still the user's
|
||||||
|
responsibility to use only "plain" structures that can be safely manipulated as
|
||||||
|
raw memory without violating invariants.
|
||||||
|
|
||||||
|
Vectorizing functions
|
||||||
|
=====================
|
||||||
|
|
||||||
|
Suppose we want to bind a function with the following signature to Python so
|
||||||
|
that it can process arbitrary NumPy array arguments (vectors, matrices, general
|
||||||
|
N-D arrays) in addition to its normal arguments:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
double my_func(int x, float y, double z);
|
||||||
|
|
||||||
|
After including the ``pybind11/numpy.h`` header, this is extremely simple:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("vectorized_func", py::vectorize(my_func));
|
||||||
|
|
||||||
|
Invoking the function like below causes 4 calls to be made to ``my_func`` with
|
||||||
|
each of the array elements. The significant advantage of this compared to
|
||||||
|
solutions like ``numpy.vectorize()`` is that the loop over the elements runs
|
||||||
|
entirely on the C++ side and can be crunched down into a tight, optimized loop
|
||||||
|
by the compiler. The result is returned as a NumPy array of type
|
||||||
|
``numpy.dtype.float64``.
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> x = np.array([[1, 3],[5, 7]])
|
||||||
|
>>> y = np.array([[2, 4],[6, 8]])
|
||||||
|
>>> z = 3
|
||||||
|
>>> result = vectorized_func(x, y, z)
|
||||||
|
|
||||||
|
The scalar argument ``z`` is transparently replicated 4 times. The input
|
||||||
|
arrays ``x`` and ``y`` are automatically converted into the right types (they
|
||||||
|
are of type ``numpy.dtype.int64`` but need to be ``numpy.dtype.int32`` and
|
||||||
|
``numpy.dtype.float32``, respectively).
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
Only arithmetic, complex, and POD types passed by value or by ``const &``
|
||||||
|
reference are vectorized; all other arguments are passed through as-is.
|
||||||
|
Functions taking rvalue reference arguments cannot be vectorized.
|
||||||
|
|
||||||
|
In cases where the computation is too complicated to be reduced to
|
||||||
|
``vectorize``, it will be necessary to create and access the buffer contents
|
||||||
|
manually. The following snippet contains a complete example that shows how this
|
||||||
|
works (the code is somewhat contrived, since it could have been done more
|
||||||
|
simply using ``vectorize``).
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/pybind11.h>
|
||||||
|
#include <pybind11/numpy.h>
|
||||||
|
|
||||||
|
namespace py = pybind11;
|
||||||
|
|
||||||
|
py::array_t<double> add_arrays(py::array_t<double> input1, py::array_t<double> input2) {
|
||||||
|
py::buffer_info buf1 = input1.request(), buf2 = input2.request();
|
||||||
|
|
||||||
|
if (buf1.ndim != 1 || buf2.ndim != 1)
|
||||||
|
throw std::runtime_error("Number of dimensions must be one");
|
||||||
|
|
||||||
|
if (buf1.size != buf2.size)
|
||||||
|
throw std::runtime_error("Input shapes must match");
|
||||||
|
|
||||||
|
/* No pointer is passed, so NumPy will allocate the buffer */
|
||||||
|
auto result = py::array_t<double>(buf1.size);
|
||||||
|
|
||||||
|
py::buffer_info buf3 = result.request();
|
||||||
|
|
||||||
|
double *ptr1 = (double *) buf1.ptr,
|
||||||
|
*ptr2 = (double *) buf2.ptr,
|
||||||
|
*ptr3 = (double *) buf3.ptr;
|
||||||
|
|
||||||
|
for (size_t idx = 0; idx < buf1.shape[0]; idx++)
|
||||||
|
ptr3[idx] = ptr1[idx] + ptr2[idx];
|
||||||
|
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
|
||||||
|
PYBIND11_MODULE(test, m) {
|
||||||
|
m.def("add_arrays", &add_arrays, "Add two NumPy arrays");
|
||||||
|
}
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_numpy_vectorize.cpp` contains a complete
|
||||||
|
example that demonstrates using :func:`vectorize` in more detail.
|
||||||
|
|
||||||
|
Direct access
|
||||||
|
=============
|
||||||
|
|
||||||
|
For performance reasons, particularly when dealing with very large arrays, it
|
||||||
|
is often desirable to directly access array elements without internal checking
|
||||||
|
of dimensions and bounds on every access when indices are known to be already
|
||||||
|
valid. To avoid such checks, the ``array`` class and ``array_t<T>`` template
|
||||||
|
class offer an unchecked proxy object that can be used for this unchecked
|
||||||
|
access through the ``unchecked<N>`` and ``mutable_unchecked<N>`` methods,
|
||||||
|
where ``N`` gives the required dimensionality of the array:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("sum_3d", [](py::array_t<double> x) {
|
||||||
|
auto r = x.unchecked<3>(); // x must have ndim = 3; can be non-writeable
|
||||||
|
double sum = 0;
|
||||||
|
for (ssize_t i = 0; i < r.shape(0); i++)
|
||||||
|
for (ssize_t j = 0; j < r.shape(1); j++)
|
||||||
|
for (ssize_t k = 0; k < r.shape(2); k++)
|
||||||
|
sum += r(i, j, k);
|
||||||
|
return sum;
|
||||||
|
});
|
||||||
|
m.def("increment_3d", [](py::array_t<double> x) {
|
||||||
|
auto r = x.mutable_unchecked<3>(); // Will throw if ndim != 3 or flags.writeable is false
|
||||||
|
for (ssize_t i = 0; i < r.shape(0); i++)
|
||||||
|
for (ssize_t j = 0; j < r.shape(1); j++)
|
||||||
|
for (ssize_t k = 0; k < r.shape(2); k++)
|
||||||
|
r(i, j, k) += 1.0;
|
||||||
|
}, py::arg().noconvert());
|
||||||
|
|
||||||
|
To obtain the proxy from an ``array`` object, you must specify both the data
|
||||||
|
type and number of dimensions as template arguments, such as ``auto r =
|
||||||
|
myarray.mutable_unchecked<float, 2>()``.
|
||||||
|
|
||||||
|
If the number of dimensions is not known at compile time, you can omit the
|
||||||
|
dimensions template parameter (i.e. calling ``arr_t.unchecked()`` or
|
||||||
|
``arr.unchecked<T>()``. This will give you a proxy object that works in the
|
||||||
|
same way, but results in less optimizable code and thus a small efficiency
|
||||||
|
loss in tight loops.
|
||||||
|
|
||||||
|
Note that the returned proxy object directly references the array's data, and
|
||||||
|
only reads its shape, strides, and writeable flag when constructed. You must
|
||||||
|
take care to ensure that the referenced array is not destroyed or reshaped for
|
||||||
|
the duration of the returned object, typically by limiting the scope of the
|
||||||
|
returned instance.
|
||||||
|
|
||||||
|
The returned proxy object supports some of the same methods as ``py::array`` so
|
||||||
|
that it can be used as a drop-in replacement for some existing, index-checked
|
||||||
|
uses of ``py::array``:
|
||||||
|
|
||||||
|
- ``r.ndim()`` returns the number of dimensions
|
||||||
|
|
||||||
|
- ``r.data(1, 2, ...)`` and ``r.mutable_data(1, 2, ...)``` returns a pointer to
|
||||||
|
the ``const T`` or ``T`` data, respectively, at the given indices. The
|
||||||
|
latter is only available to proxies obtained via ``a.mutable_unchecked()``.
|
||||||
|
|
||||||
|
- ``itemsize()`` returns the size of an item in bytes, i.e. ``sizeof(T)``.
|
||||||
|
|
||||||
|
- ``ndim()`` returns the number of dimensions.
|
||||||
|
|
||||||
|
- ``shape(n)`` returns the size of dimension ``n``
|
||||||
|
|
||||||
|
- ``size()`` returns the total number of elements (i.e. the product of the shapes).
|
||||||
|
|
||||||
|
- ``nbytes()`` returns the number of bytes used by the referenced elements
|
||||||
|
(i.e. ``itemsize()`` times ``size()``).
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_numpy_array.cpp` contains additional examples
|
||||||
|
demonstrating the use of this feature.
|
||||||
|
|
||||||
|
Ellipsis
|
||||||
|
========
|
||||||
|
|
||||||
|
Python 3 provides a convenient ``...`` ellipsis notation that is often used to
|
||||||
|
slice multidimensional arrays. For instance, the following snippet extracts the
|
||||||
|
middle dimensions of a tensor with the first and last index set to zero.
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
a = # a NumPy array
|
||||||
|
b = a[0, ..., 0]
|
||||||
|
|
||||||
|
The function ``py::ellipsis()`` function can be used to perform the same
|
||||||
|
operation on the C++ side:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::array a = /* A NumPy array */;
|
||||||
|
py::array b = a[py::make_tuple(0, py::ellipsis(), 0)];
|
||||||
|
|
@ -0,0 +1,170 @@
|
||||||
|
Python types
|
||||||
|
############
|
||||||
|
|
||||||
|
Available wrappers
|
||||||
|
==================
|
||||||
|
|
||||||
|
All major Python types are available as thin C++ wrapper classes. These
|
||||||
|
can also be used as function parameters -- see :ref:`python_objects_as_args`.
|
||||||
|
|
||||||
|
Available types include :class:`handle`, :class:`object`, :class:`bool_`,
|
||||||
|
:class:`int_`, :class:`float_`, :class:`str`, :class:`bytes`, :class:`tuple`,
|
||||||
|
:class:`list`, :class:`dict`, :class:`slice`, :class:`none`, :class:`capsule`,
|
||||||
|
:class:`iterable`, :class:`iterator`, :class:`function`, :class:`buffer`,
|
||||||
|
:class:`array`, and :class:`array_t`.
|
||||||
|
|
||||||
|
Casting back and forth
|
||||||
|
======================
|
||||||
|
|
||||||
|
In this kind of mixed code, it is often necessary to convert arbitrary C++
|
||||||
|
types to Python, which can be done using :func:`py::cast`:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
MyClass *cls = ..;
|
||||||
|
py::object obj = py::cast(cls);
|
||||||
|
|
||||||
|
The reverse direction uses the following syntax:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::object obj = ...;
|
||||||
|
MyClass *cls = obj.cast<MyClass *>();
|
||||||
|
|
||||||
|
When conversion fails, both directions throw the exception :class:`cast_error`.
|
||||||
|
|
||||||
|
.. _python_libs:
|
||||||
|
|
||||||
|
Accessing Python libraries from C++
|
||||||
|
===================================
|
||||||
|
|
||||||
|
It is also possible to import objects defined in the Python standard
|
||||||
|
library or available in the current Python environment (``sys.path``) and work
|
||||||
|
with these in C++.
|
||||||
|
|
||||||
|
This example obtains a reference to the Python ``Decimal`` class.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// Equivalent to "from decimal import Decimal"
|
||||||
|
py::object Decimal = py::module::import("decimal").attr("Decimal");
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// Try to import scipy
|
||||||
|
py::object scipy = py::module::import("scipy");
|
||||||
|
return scipy.attr("__version__");
|
||||||
|
|
||||||
|
.. _calling_python_functions:
|
||||||
|
|
||||||
|
Calling Python functions
|
||||||
|
========================
|
||||||
|
|
||||||
|
It is also possible to call Python classes, functions and methods
|
||||||
|
via ``operator()``.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// Construct a Python object of class Decimal
|
||||||
|
py::object pi = Decimal("3.14159");
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// Use Python to make our directories
|
||||||
|
py::object os = py::module::import("os");
|
||||||
|
py::object makedirs = os.attr("makedirs");
|
||||||
|
makedirs("/tmp/path/to/somewhere");
|
||||||
|
|
||||||
|
One can convert the result obtained from Python to a pure C++ version
|
||||||
|
if a ``py::class_`` or type conversion is defined.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::function f = <...>;
|
||||||
|
py::object result_py = f(1234, "hello", some_instance);
|
||||||
|
MyClass &result = result_py.cast<MyClass>();
|
||||||
|
|
||||||
|
.. _calling_python_methods:
|
||||||
|
|
||||||
|
Calling Python methods
|
||||||
|
========================
|
||||||
|
|
||||||
|
To call an object's method, one can again use ``.attr`` to obtain access to the
|
||||||
|
Python method.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// Calculate e^π in decimal
|
||||||
|
py::object exp_pi = pi.attr("exp")();
|
||||||
|
py::print(py::str(exp_pi));
|
||||||
|
|
||||||
|
In the example above ``pi.attr("exp")`` is a *bound method*: it will always call
|
||||||
|
the method for that same instance of the class. Alternately one can create an
|
||||||
|
*unbound method* via the Python class (instead of instance) and pass the ``self``
|
||||||
|
object explicitly, followed by other arguments.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::object decimal_exp = Decimal.attr("exp");
|
||||||
|
|
||||||
|
// Compute the e^n for n=0..4
|
||||||
|
for (int n = 0; n < 5; n++) {
|
||||||
|
py::print(decimal_exp(Decimal(n));
|
||||||
|
}
|
||||||
|
|
||||||
|
Keyword arguments
|
||||||
|
=================
|
||||||
|
|
||||||
|
Keyword arguments are also supported. In Python, there is the usual call syntax:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
def f(number, say, to):
|
||||||
|
... # function code
|
||||||
|
|
||||||
|
f(1234, say="hello", to=some_instance) # keyword call in Python
|
||||||
|
|
||||||
|
In C++, the same call can be made using:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
using namespace pybind11::literals; // to bring in the `_a` literal
|
||||||
|
f(1234, "say"_a="hello", "to"_a=some_instance); // keyword call in C++
|
||||||
|
|
||||||
|
Unpacking arguments
|
||||||
|
===================
|
||||||
|
|
||||||
|
Unpacking of ``*args`` and ``**kwargs`` is also possible and can be mixed with
|
||||||
|
other arguments:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// * unpacking
|
||||||
|
py::tuple args = py::make_tuple(1234, "hello", some_instance);
|
||||||
|
f(*args);
|
||||||
|
|
||||||
|
// ** unpacking
|
||||||
|
py::dict kwargs = py::dict("number"_a=1234, "say"_a="hello", "to"_a=some_instance);
|
||||||
|
f(**kwargs);
|
||||||
|
|
||||||
|
// mixed keywords, * and ** unpacking
|
||||||
|
py::tuple args = py::make_tuple(1234);
|
||||||
|
py::dict kwargs = py::dict("to"_a=some_instance);
|
||||||
|
f(*args, "say"_a="hello", **kwargs);
|
||||||
|
|
||||||
|
Generalized unpacking according to PEP448_ is also supported:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::dict kwargs1 = py::dict("number"_a=1234);
|
||||||
|
py::dict kwargs2 = py::dict("to"_a=some_instance);
|
||||||
|
f(**kwargs1, "say"_a="hello", **kwargs2);
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_pytypes.cpp` contains a complete
|
||||||
|
example that demonstrates passing native Python types in more detail. The
|
||||||
|
file :file:`tests/test_callbacks.cpp` presents a few examples of calling
|
||||||
|
Python functions from C++, including keywords arguments and unpacking.
|
||||||
|
|
||||||
|
.. _PEP448: https://www.python.org/dev/peps/pep-0448/
|
||||||
|
|
@ -0,0 +1,144 @@
|
||||||
|
Utilities
|
||||||
|
#########
|
||||||
|
|
||||||
|
Using Python's print function in C++
|
||||||
|
====================================
|
||||||
|
|
||||||
|
The usual way to write output in C++ is using ``std::cout`` while in Python one
|
||||||
|
would use ``print``. Since these methods use different buffers, mixing them can
|
||||||
|
lead to output order issues. To resolve this, pybind11 modules can use the
|
||||||
|
:func:`py::print` function which writes to Python's ``sys.stdout`` for consistency.
|
||||||
|
|
||||||
|
Python's ``print`` function is replicated in the C++ API including optional
|
||||||
|
keyword arguments ``sep``, ``end``, ``file``, ``flush``. Everything works as
|
||||||
|
expected in Python:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::print(1, 2.0, "three"); // 1 2.0 three
|
||||||
|
py::print(1, 2.0, "three", "sep"_a="-"); // 1-2.0-three
|
||||||
|
|
||||||
|
auto args = py::make_tuple("unpacked", true);
|
||||||
|
py::print("->", *args, "end"_a="<-"); // -> unpacked True <-
|
||||||
|
|
||||||
|
.. _ostream_redirect:
|
||||||
|
|
||||||
|
Capturing standard output from ostream
|
||||||
|
======================================
|
||||||
|
|
||||||
|
Often, a library will use the streams ``std::cout`` and ``std::cerr`` to print,
|
||||||
|
but this does not play well with Python's standard ``sys.stdout`` and ``sys.stderr``
|
||||||
|
redirection. Replacing a library's printing with `py::print <print>` may not
|
||||||
|
be feasible. This can be fixed using a guard around the library function that
|
||||||
|
redirects output to the corresponding Python streams:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/iostream.h>
|
||||||
|
|
||||||
|
...
|
||||||
|
|
||||||
|
// Add a scoped redirect for your noisy code
|
||||||
|
m.def("noisy_func", []() {
|
||||||
|
py::scoped_ostream_redirect stream(
|
||||||
|
std::cout, // std::ostream&
|
||||||
|
py::module::import("sys").attr("stdout") // Python output
|
||||||
|
);
|
||||||
|
call_noisy_func();
|
||||||
|
});
|
||||||
|
|
||||||
|
This method respects flushes on the output streams and will flush if needed
|
||||||
|
when the scoped guard is destroyed. This allows the output to be redirected in
|
||||||
|
real time, such as to a Jupyter notebook. The two arguments, the C++ stream and
|
||||||
|
the Python output, are optional, and default to standard output if not given. An
|
||||||
|
extra type, `py::scoped_estream_redirect <scoped_estream_redirect>`, is identical
|
||||||
|
except for defaulting to ``std::cerr`` and ``sys.stderr``; this can be useful with
|
||||||
|
`py::call_guard`, which allows multiple items, but uses the default constructor:
|
||||||
|
|
||||||
|
.. code-block:: py
|
||||||
|
|
||||||
|
// Alternative: Call single function using call guard
|
||||||
|
m.def("noisy_func", &call_noisy_function,
|
||||||
|
py::call_guard<py::scoped_ostream_redirect,
|
||||||
|
py::scoped_estream_redirect>());
|
||||||
|
|
||||||
|
The redirection can also be done in Python with the addition of a context
|
||||||
|
manager, using the `py::add_ostream_redirect() <add_ostream_redirect>` function:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::add_ostream_redirect(m, "ostream_redirect");
|
||||||
|
|
||||||
|
The name in Python defaults to ``ostream_redirect`` if no name is passed. This
|
||||||
|
creates the following context manager in Python:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
with ostream_redirect(stdout=True, stderr=True):
|
||||||
|
noisy_function()
|
||||||
|
|
||||||
|
It defaults to redirecting both streams, though you can use the keyword
|
||||||
|
arguments to disable one of the streams if needed.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
The above methods will not redirect C-level output to file descriptors, such
|
||||||
|
as ``fprintf``. For those cases, you'll need to redirect the file
|
||||||
|
descriptors either directly in C or with Python's ``os.dup2`` function
|
||||||
|
in an operating-system dependent way.
|
||||||
|
|
||||||
|
.. _eval:
|
||||||
|
|
||||||
|
Evaluating Python expressions from strings and files
|
||||||
|
====================================================
|
||||||
|
|
||||||
|
pybind11 provides the `eval`, `exec` and `eval_file` functions to evaluate
|
||||||
|
Python expressions and statements. The following example illustrates how they
|
||||||
|
can be used.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// At beginning of file
|
||||||
|
#include <pybind11/eval.h>
|
||||||
|
|
||||||
|
...
|
||||||
|
|
||||||
|
// Evaluate in scope of main module
|
||||||
|
py::object scope = py::module::import("__main__").attr("__dict__");
|
||||||
|
|
||||||
|
// Evaluate an isolated expression
|
||||||
|
int result = py::eval("my_variable + 10", scope).cast<int>();
|
||||||
|
|
||||||
|
// Evaluate a sequence of statements
|
||||||
|
py::exec(
|
||||||
|
"print('Hello')\n"
|
||||||
|
"print('world!');",
|
||||||
|
scope);
|
||||||
|
|
||||||
|
// Evaluate the statements in an separate Python file on disk
|
||||||
|
py::eval_file("script.py", scope);
|
||||||
|
|
||||||
|
C++11 raw string literals are also supported and quite handy for this purpose.
|
||||||
|
The only requirement is that the first statement must be on a new line following
|
||||||
|
the raw string delimiter ``R"(``, ensuring all lines have common leading indent:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::exec(R"(
|
||||||
|
x = get_answer()
|
||||||
|
if x == 42:
|
||||||
|
print('Hello World!')
|
||||||
|
else:
|
||||||
|
print('Bye!')
|
||||||
|
)", scope
|
||||||
|
);
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
`eval` and `eval_file` accept a template parameter that describes how the
|
||||||
|
string/file should be interpreted. Possible choices include ``eval_expr``
|
||||||
|
(isolated expression), ``eval_single_statement`` (a single statement, return
|
||||||
|
value is always ``none``), and ``eval_statements`` (sequence of statements,
|
||||||
|
return value is always ``none``). `eval` defaults to ``eval_expr``,
|
||||||
|
`eval_file` defaults to ``eval_statements`` and `exec` is just a shortcut
|
||||||
|
for ``eval<eval_statements>``.
|
||||||
Some files were not shown because too many files have changed in this diff Show More
Loading…
Reference in New Issue