Merge branch 'develop' into fix/serializationToFile
commit
890d631e60
|
@ -0,0 +1,14 @@
|
||||||
|
# This triggers Cython builds on `gtsam-manylinux-build`
|
||||||
|
name: Trigger Python Builds
|
||||||
|
on: push
|
||||||
|
jobs:
|
||||||
|
triggerCython:
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
steps:
|
||||||
|
- name: Repository Dispatch
|
||||||
|
uses: ProfFan/repository-dispatch@master
|
||||||
|
with:
|
||||||
|
token: ${{ secrets.PYTHON_CI_REPO_ACCESS_TOKEN }}
|
||||||
|
repository: borglab/gtsam-manylinux-build
|
||||||
|
event-type: cython-wrapper
|
||||||
|
client-payload: '{"ref": "${{ github.ref }}", "sha": "${{ github.sha }}"}'
|
|
@ -63,7 +63,7 @@ function configure()
|
||||||
-DGTSAM_BUILD_EXAMPLES_ALWAYS=${GTSAM_BUILD_EXAMPLES_ALWAYS:-ON} \
|
-DGTSAM_BUILD_EXAMPLES_ALWAYS=${GTSAM_BUILD_EXAMPLES_ALWAYS:-ON} \
|
||||||
-DGTSAM_ALLOW_DEPRECATED_SINCE_V4=${GTSAM_ALLOW_DEPRECATED_SINCE_V4:-OFF} \
|
-DGTSAM_ALLOW_DEPRECATED_SINCE_V4=${GTSAM_ALLOW_DEPRECATED_SINCE_V4:-OFF} \
|
||||||
-DGTSAM_BUILD_WITH_MARCH_NATIVE=OFF \
|
-DGTSAM_BUILD_WITH_MARCH_NATIVE=OFF \
|
||||||
-DCMAKE_VERBOSE_MAKEFILE=ON
|
-DCMAKE_VERBOSE_MAKEFILE=OFF
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
|
@ -14,7 +14,8 @@ addons:
|
||||||
- clang-9
|
- clang-9
|
||||||
- build-essential pkg-config
|
- build-essential pkg-config
|
||||||
- cmake
|
- cmake
|
||||||
- libpython-dev python-numpy
|
- python3-dev libpython-dev
|
||||||
|
- python3-numpy
|
||||||
- libboost-all-dev
|
- libboost-all-dev
|
||||||
|
|
||||||
# before_install:
|
# before_install:
|
||||||
|
|
|
@ -87,6 +87,15 @@ endfunction()
|
||||||
# - output_dir: The output directory
|
# - output_dir: The output directory
|
||||||
function(build_cythonized_cpp target cpp_file output_lib_we output_dir)
|
function(build_cythonized_cpp target cpp_file output_lib_we output_dir)
|
||||||
add_library(${target} MODULE ${cpp_file})
|
add_library(${target} MODULE ${cpp_file})
|
||||||
|
|
||||||
|
if(WIN32)
|
||||||
|
# Use .pyd extension instead of .dll on Windows
|
||||||
|
set_target_properties(${target} PROPERTIES SUFFIX ".pyd")
|
||||||
|
|
||||||
|
# Add full path to the Python library
|
||||||
|
target_link_libraries(${target} ${PYTHON_LIBRARIES})
|
||||||
|
endif()
|
||||||
|
|
||||||
if(APPLE)
|
if(APPLE)
|
||||||
set(link_flags "-undefined dynamic_lookup")
|
set(link_flags "-undefined dynamic_lookup")
|
||||||
endif()
|
endif()
|
||||||
|
|
|
@ -7,6 +7,11 @@ if (GTSAM_INSTALL_CYTHON_TOOLBOX)
|
||||||
add_subdirectory(gtsam_eigency)
|
add_subdirectory(gtsam_eigency)
|
||||||
include_directories(${PROJECT_BINARY_DIR}/cython/gtsam_eigency)
|
include_directories(${PROJECT_BINARY_DIR}/cython/gtsam_eigency)
|
||||||
|
|
||||||
|
# Fix for error "C1128: number of sections exceeded object file format limit"
|
||||||
|
if(MSVC)
|
||||||
|
add_compile_options(/bigobj)
|
||||||
|
endif()
|
||||||
|
|
||||||
# wrap gtsam
|
# wrap gtsam
|
||||||
add_custom_target(gtsam_header DEPENDS "../gtsam.h")
|
add_custom_target(gtsam_header DEPENDS "../gtsam.h")
|
||||||
wrap_and_install_library_cython("../gtsam.h" # interface_header
|
wrap_and_install_library_cython("../gtsam.h" # interface_header
|
||||||
|
|
|
@ -5,32 +5,27 @@ All Rights Reserved
|
||||||
|
|
||||||
See LICENSE for the license information
|
See LICENSE for the license information
|
||||||
|
|
||||||
A script validating the ImuFactor inference.
|
A script validating and demonstrating the ImuFactor inference.
|
||||||
|
|
||||||
|
Author: Frank Dellaert, Varun Agrawal
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from __future__ import print_function
|
from __future__ import print_function
|
||||||
|
|
||||||
import math
|
import math
|
||||||
|
|
||||||
|
import gtsam
|
||||||
import matplotlib.pyplot as plt
|
import matplotlib.pyplot as plt
|
||||||
import numpy as np
|
import numpy as np
|
||||||
|
from gtsam import symbol_shorthand_B as B
|
||||||
|
from gtsam import symbol_shorthand_V as V
|
||||||
|
from gtsam import symbol_shorthand_X as X
|
||||||
|
from gtsam.utils.plot import plot_pose3
|
||||||
from mpl_toolkits.mplot3d import Axes3D
|
from mpl_toolkits.mplot3d import Axes3D
|
||||||
|
|
||||||
import gtsam
|
|
||||||
from gtsam.utils.plot import plot_pose3
|
|
||||||
from PreintegrationExample import POSES_FIG, PreintegrationExample
|
from PreintegrationExample import POSES_FIG, PreintegrationExample
|
||||||
|
|
||||||
BIAS_KEY = int(gtsam.symbol(ord('b'), 0))
|
BIAS_KEY = B(0)
|
||||||
|
|
||||||
|
|
||||||
def X(key):
|
|
||||||
"""Create symbol for pose key."""
|
|
||||||
return gtsam.symbol(ord('x'), key)
|
|
||||||
|
|
||||||
|
|
||||||
def V(key):
|
|
||||||
"""Create symbol for velocity key."""
|
|
||||||
return gtsam.symbol(ord('v'), key)
|
|
||||||
|
|
||||||
|
|
||||||
np.set_printoptions(precision=3, suppress=True)
|
np.set_printoptions(precision=3, suppress=True)
|
||||||
|
@ -76,8 +71,14 @@ class ImuFactorExample(PreintegrationExample):
|
||||||
initial.insert(BIAS_KEY, self.actualBias)
|
initial.insert(BIAS_KEY, self.actualBias)
|
||||||
for i in range(num_poses):
|
for i in range(num_poses):
|
||||||
state_i = self.scenario.navState(float(i))
|
state_i = self.scenario.navState(float(i))
|
||||||
initial.insert(X(i), state_i.pose())
|
|
||||||
initial.insert(V(i), state_i.velocity())
|
poseNoise = gtsam.Pose3.Expmap(np.random.randn(3)*0.1)
|
||||||
|
pose = state_i.pose().compose(poseNoise)
|
||||||
|
|
||||||
|
velocity = state_i.velocity() + np.random.randn(3)*0.1
|
||||||
|
|
||||||
|
initial.insert(X(i), pose)
|
||||||
|
initial.insert(V(i), velocity)
|
||||||
|
|
||||||
# simulate the loop
|
# simulate the loop
|
||||||
i = 0 # state index
|
i = 0 # state index
|
||||||
|
@ -88,6 +89,12 @@ class ImuFactorExample(PreintegrationExample):
|
||||||
measuredAcc = self.runner.measuredSpecificForce(t)
|
measuredAcc = self.runner.measuredSpecificForce(t)
|
||||||
pim.integrateMeasurement(measuredAcc, measuredOmega, self.dt)
|
pim.integrateMeasurement(measuredAcc, measuredOmega, self.dt)
|
||||||
|
|
||||||
|
poseNoise = gtsam.Pose3.Expmap(np.random.randn(3)*0.1)
|
||||||
|
|
||||||
|
actual_state_i = gtsam.NavState(
|
||||||
|
actual_state_i.pose().compose(poseNoise),
|
||||||
|
actual_state_i.velocity() + np.random.randn(3)*0.1)
|
||||||
|
|
||||||
# Plot IMU many times
|
# Plot IMU many times
|
||||||
if k % 10 == 0:
|
if k % 10 == 0:
|
||||||
self.plotImu(t, measuredOmega, measuredAcc)
|
self.plotImu(t, measuredOmega, measuredAcc)
|
||||||
|
@ -133,6 +140,9 @@ class ImuFactorExample(PreintegrationExample):
|
||||||
pose_i = result.atPose3(X(i))
|
pose_i = result.atPose3(X(i))
|
||||||
plot_pose3(POSES_FIG, pose_i, 0.1)
|
plot_pose3(POSES_FIG, pose_i, 0.1)
|
||||||
i += 1
|
i += 1
|
||||||
|
|
||||||
|
gtsam.utils.plot.set_axes_equal(POSES_FIG)
|
||||||
|
|
||||||
print(result.atimuBias_ConstantBias(BIAS_KEY))
|
print(result.atimuBias_ConstantBias(BIAS_KEY))
|
||||||
|
|
||||||
plt.ioff()
|
plt.ioff()
|
||||||
|
|
|
@ -8,27 +8,19 @@ from __future__ import print_function
|
||||||
|
|
||||||
import math
|
import math
|
||||||
|
|
||||||
import matplotlib.pyplot as plt
|
|
||||||
import numpy as np
|
|
||||||
from mpl_toolkits.mplot3d import Axes3D # pylint: disable=W0611
|
|
||||||
|
|
||||||
import gtsam
|
import gtsam
|
||||||
import gtsam.utils.plot as gtsam_plot
|
import gtsam.utils.plot as gtsam_plot
|
||||||
|
import matplotlib.pyplot as plt
|
||||||
|
import numpy as np
|
||||||
from gtsam import (ISAM2, BetweenFactorConstantBias, Cal3_S2,
|
from gtsam import (ISAM2, BetweenFactorConstantBias, Cal3_S2,
|
||||||
ConstantTwistScenario, ImuFactor, NonlinearFactorGraph,
|
ConstantTwistScenario, ImuFactor, NonlinearFactorGraph,
|
||||||
PinholeCameraCal3_S2, Point3, Pose3,
|
PinholeCameraCal3_S2, Point3, Pose3,
|
||||||
PriorFactorConstantBias, PriorFactorPose3,
|
PriorFactorConstantBias, PriorFactorPose3,
|
||||||
PriorFactorVector, Rot3, Values)
|
PriorFactorVector, Rot3, Values)
|
||||||
|
from gtsam import symbol_shorthand_B as B
|
||||||
|
from gtsam import symbol_shorthand_V as V
|
||||||
def X(key):
|
from gtsam import symbol_shorthand_X as X
|
||||||
"""Create symbol for pose key."""
|
from mpl_toolkits.mplot3d import Axes3D # pylint: disable=W0611
|
||||||
return gtsam.symbol(ord('x'), key)
|
|
||||||
|
|
||||||
|
|
||||||
def V(key):
|
|
||||||
"""Create symbol for velocity key."""
|
|
||||||
return gtsam.symbol(ord('v'), key)
|
|
||||||
|
|
||||||
|
|
||||||
def vector3(x, y, z):
|
def vector3(x, y, z):
|
||||||
|
@ -115,7 +107,7 @@ def IMU_example():
|
||||||
newgraph.push_back(PriorFactorPose3(X(0), pose_0, noise))
|
newgraph.push_back(PriorFactorPose3(X(0), pose_0, noise))
|
||||||
|
|
||||||
# Add imu priors
|
# Add imu priors
|
||||||
biasKey = gtsam.symbol(ord('b'), 0)
|
biasKey = B(0)
|
||||||
biasnoise = gtsam.noiseModel_Isotropic.Sigma(6, 0.1)
|
biasnoise = gtsam.noiseModel_Isotropic.Sigma(6, 0.1)
|
||||||
biasprior = PriorFactorConstantBias(biasKey, gtsam.imuBias_ConstantBias(),
|
biasprior = PriorFactorConstantBias(biasKey, gtsam.imuBias_ConstantBias(),
|
||||||
biasnoise)
|
biasnoise)
|
||||||
|
|
|
@ -13,9 +13,10 @@ Author: Alex Cunningham (C++), Kevin Deng & Frank Dellaert (Python)
|
||||||
|
|
||||||
from __future__ import print_function
|
from __future__ import print_function
|
||||||
|
|
||||||
import numpy as np
|
|
||||||
|
|
||||||
import gtsam
|
import gtsam
|
||||||
|
import numpy as np
|
||||||
|
from gtsam import symbol_shorthand_L as L
|
||||||
|
from gtsam import symbol_shorthand_X as X
|
||||||
|
|
||||||
# Create noise models
|
# Create noise models
|
||||||
PRIOR_NOISE = gtsam.noiseModel_Diagonal.Sigmas(np.array([0.3, 0.3, 0.1]))
|
PRIOR_NOISE = gtsam.noiseModel_Diagonal.Sigmas(np.array([0.3, 0.3, 0.1]))
|
||||||
|
@ -26,11 +27,11 @@ MEASUREMENT_NOISE = gtsam.noiseModel_Diagonal.Sigmas(np.array([0.1, 0.2]))
|
||||||
graph = gtsam.NonlinearFactorGraph()
|
graph = gtsam.NonlinearFactorGraph()
|
||||||
|
|
||||||
# Create the keys corresponding to unknown variables in the factor graph
|
# Create the keys corresponding to unknown variables in the factor graph
|
||||||
X1 = gtsam.symbol(ord('x'), 1)
|
X1 = X(1)
|
||||||
X2 = gtsam.symbol(ord('x'), 2)
|
X2 = X(2)
|
||||||
X3 = gtsam.symbol(ord('x'), 3)
|
X3 = X(3)
|
||||||
L1 = gtsam.symbol(ord('l'), 4)
|
L1 = L(4)
|
||||||
L2 = gtsam.symbol(ord('l'), 5)
|
L2 = L(5)
|
||||||
|
|
||||||
# Add a prior on pose X1 at the origin. A prior factor consists of a mean and a noise model
|
# Add a prior on pose X1 at the origin. A prior factor consists of a mean and a noise model
|
||||||
graph.add(gtsam.PriorFactorPose2(X1, gtsam.Pose2(0.0, 0.0, 0.0), PRIOR_NOISE))
|
graph.add(gtsam.PriorFactorPose2(X1, gtsam.Pose2(0.0, 0.0, 0.0), PRIOR_NOISE))
|
||||||
|
|
|
@ -82,7 +82,7 @@ else:
|
||||||
print ("Done!")
|
print ("Done!")
|
||||||
|
|
||||||
if args.plot:
|
if args.plot:
|
||||||
resultPoses = gtsam.extractPose2(result)
|
resultPoses = gtsam.utilities_extractPose2(result)
|
||||||
for i in range(resultPoses.shape[0]):
|
for i in range(resultPoses.shape[0]):
|
||||||
plot.plot_pose2(1, gtsam.Pose2(resultPoses[i, :]))
|
plot.plot_pose2(1, gtsam.Pose2(resultPoses[i, :]))
|
||||||
plt.show()
|
plt.show()
|
||||||
|
|
|
@ -65,7 +65,7 @@ else:
|
||||||
print ("Done!")
|
print ("Done!")
|
||||||
|
|
||||||
if args.plot:
|
if args.plot:
|
||||||
resultPoses = gtsam.allPose3s(result)
|
resultPoses = gtsam.utilities_allPose3s(result)
|
||||||
for i in range(resultPoses.size()):
|
for i in range(resultPoses.size()):
|
||||||
plot.plot_pose3(1, resultPoses.atPose3(i))
|
plot.plot_pose3(1, resultPoses.atPose3(i))
|
||||||
plt.show()
|
plt.show()
|
||||||
|
|
|
@ -1,7 +1,7 @@
|
||||||
These examples are almost identical to the old handwritten python wrapper
|
These examples are almost identical to the old handwritten python wrapper
|
||||||
examples. However, there are just some slight name changes, for example
|
examples. However, there are just some slight name changes, for example
|
||||||
`noiseModel.Diagonal` becomes `noiseModel_Diagonal` etc...
|
`noiseModel.Diagonal` becomes `noiseModel_Diagonal` etc...
|
||||||
Also, annoyingly, instead of `gtsam.Symbol('b', 0)` we now need to say `gtsam.symbol(ord('b'), 0))`
|
Also, instead of `gtsam.Symbol('b', 0)` we can simply say `gtsam.symbol_shorthand_B(0)` or `B(0)` if we use python aliasing.
|
||||||
|
|
||||||
# Porting Progress
|
# Porting Progress
|
||||||
|
|
||||||
|
|
|
@ -10,24 +10,20 @@ A structure-from-motion problem on a simulated dataset
|
||||||
"""
|
"""
|
||||||
from __future__ import print_function
|
from __future__ import print_function
|
||||||
|
|
||||||
|
import gtsam
|
||||||
import matplotlib.pyplot as plt
|
import matplotlib.pyplot as plt
|
||||||
import numpy as np
|
import numpy as np
|
||||||
|
from gtsam import symbol_shorthand_L as L
|
||||||
import gtsam
|
from gtsam import symbol_shorthand_X as X
|
||||||
from gtsam.examples import SFMdata
|
from gtsam.examples import SFMdata
|
||||||
from gtsam.gtsam import (Cal3_S2, DoglegOptimizer,
|
from gtsam.gtsam import (Cal3_S2, DoglegOptimizer,
|
||||||
GenericProjectionFactorCal3_S2, Marginals,
|
GenericProjectionFactorCal3_S2, Marginals,
|
||||||
NonlinearFactorGraph, Point3, Pose3,
|
NonlinearFactorGraph, PinholeCameraCal3_S2, Point3,
|
||||||
PriorFactorPoint3, PriorFactorPose3, Rot3,
|
Pose3, PriorFactorPoint3, PriorFactorPose3, Rot3,
|
||||||
SimpleCamera, Values)
|
SimpleCamera, Values)
|
||||||
from gtsam.utils import plot
|
from gtsam.utils import plot
|
||||||
|
|
||||||
|
|
||||||
def symbol(name: str, index: int) -> int:
|
|
||||||
""" helper for creating a symbol without explicitly casting 'name' from str to int """
|
|
||||||
return gtsam.symbol(ord(name), index)
|
|
||||||
|
|
||||||
|
|
||||||
def main():
|
def main():
|
||||||
"""
|
"""
|
||||||
Camera observations of landmarks (i.e. pixel coordinates) will be stored as Point2 (x, y).
|
Camera observations of landmarks (i.e. pixel coordinates) will be stored as Point2 (x, y).
|
||||||
|
@ -74,7 +70,7 @@ def main():
|
||||||
# Add a prior on pose x1. This indirectly specifies where the origin is.
|
# Add a prior on pose x1. This indirectly specifies where the origin is.
|
||||||
# 0.3 rad std on roll,pitch,yaw and 0.1m on x,y,z
|
# 0.3 rad std on roll,pitch,yaw and 0.1m on x,y,z
|
||||||
pose_noise = gtsam.noiseModel_Diagonal.Sigmas(np.array([0.3, 0.3, 0.3, 0.1, 0.1, 0.1]))
|
pose_noise = gtsam.noiseModel_Diagonal.Sigmas(np.array([0.3, 0.3, 0.3, 0.1, 0.1, 0.1]))
|
||||||
factor = PriorFactorPose3(symbol('x', 0), poses[0], pose_noise)
|
factor = PriorFactorPose3(X(0), poses[0], pose_noise)
|
||||||
graph.push_back(factor)
|
graph.push_back(factor)
|
||||||
|
|
||||||
# Simulated measurements from each camera pose, adding them to the factor graph
|
# Simulated measurements from each camera pose, adding them to the factor graph
|
||||||
|
@ -83,14 +79,14 @@ def main():
|
||||||
for j, point in enumerate(points):
|
for j, point in enumerate(points):
|
||||||
measurement = camera.project(point)
|
measurement = camera.project(point)
|
||||||
factor = GenericProjectionFactorCal3_S2(
|
factor = GenericProjectionFactorCal3_S2(
|
||||||
measurement, measurement_noise, symbol('x', i), symbol('l', j), K)
|
measurement, measurement_noise, X(i), L(j), K)
|
||||||
graph.push_back(factor)
|
graph.push_back(factor)
|
||||||
|
|
||||||
# Because the structure-from-motion problem has a scale ambiguity, the problem is still under-constrained
|
# Because the structure-from-motion problem has a scale ambiguity, the problem is still under-constrained
|
||||||
# Here we add a prior on the position of the first landmark. This fixes the scale by indicating the distance
|
# Here we add a prior on the position of the first landmark. This fixes the scale by indicating the distance
|
||||||
# between the first camera and the first landmark. All other landmark positions are interpreted using this scale.
|
# between the first camera and the first landmark. All other landmark positions are interpreted using this scale.
|
||||||
point_noise = gtsam.noiseModel_Isotropic.Sigma(3, 0.1)
|
point_noise = gtsam.noiseModel_Isotropic.Sigma(3, 0.1)
|
||||||
factor = PriorFactorPoint3(symbol('l', 0), points[0], point_noise)
|
factor = PriorFactorPoint3(L(0), points[0], point_noise)
|
||||||
graph.push_back(factor)
|
graph.push_back(factor)
|
||||||
graph.print_('Factor Graph:\n')
|
graph.print_('Factor Graph:\n')
|
||||||
|
|
||||||
|
@ -99,10 +95,10 @@ def main():
|
||||||
initial_estimate = Values()
|
initial_estimate = Values()
|
||||||
for i, pose in enumerate(poses):
|
for i, pose in enumerate(poses):
|
||||||
transformed_pose = pose.retract(0.1*np.random.randn(6,1))
|
transformed_pose = pose.retract(0.1*np.random.randn(6,1))
|
||||||
initial_estimate.insert(symbol('x', i), transformed_pose)
|
initial_estimate.insert(X(i), transformed_pose)
|
||||||
for j, point in enumerate(points):
|
for j, point in enumerate(points):
|
||||||
transformed_point = Point3(point.vector() + 0.1*np.random.randn(3))
|
transformed_point = Point3(point.vector() + 0.1*np.random.randn(3))
|
||||||
initial_estimate.insert(symbol('l', j), transformed_point)
|
initial_estimate.insert(L(j), transformed_point)
|
||||||
initial_estimate.print_('Initial Estimates:\n')
|
initial_estimate.print_('Initial Estimates:\n')
|
||||||
|
|
||||||
# Optimize the graph and print results
|
# Optimize the graph and print results
|
||||||
|
|
|
@ -10,8 +10,9 @@ This example will perform a relatively trivial optimization on
|
||||||
a single variable with a single factor.
|
a single variable with a single factor.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
import numpy as np
|
|
||||||
import gtsam
|
import gtsam
|
||||||
|
import numpy as np
|
||||||
|
from gtsam import symbol_shorthand_X as X
|
||||||
|
|
||||||
|
|
||||||
def main():
|
def main():
|
||||||
|
@ -33,7 +34,7 @@ def main():
|
||||||
prior = gtsam.Rot2.fromAngle(np.deg2rad(30))
|
prior = gtsam.Rot2.fromAngle(np.deg2rad(30))
|
||||||
prior.print_('goal angle')
|
prior.print_('goal angle')
|
||||||
model = gtsam.noiseModel_Isotropic.Sigma(dim=1, sigma=np.deg2rad(1))
|
model = gtsam.noiseModel_Isotropic.Sigma(dim=1, sigma=np.deg2rad(1))
|
||||||
key = gtsam.symbol(ord('x'), 1)
|
key = X(1)
|
||||||
factor = gtsam.PriorFactorRot2(key, prior, model)
|
factor = gtsam.PriorFactorRot2(key, prior, model)
|
||||||
|
|
||||||
"""
|
"""
|
||||||
|
|
|
@ -13,23 +13,14 @@ Author: Duy-Nguyen Ta (C++), Frank Dellaert (Python)
|
||||||
|
|
||||||
from __future__ import print_function
|
from __future__ import print_function
|
||||||
|
|
||||||
import matplotlib.pyplot as plt
|
|
||||||
import numpy as np
|
|
||||||
from mpl_toolkits.mplot3d import Axes3D # pylint: disable=W0611
|
|
||||||
|
|
||||||
import gtsam
|
import gtsam
|
||||||
import gtsam.utils.plot as gtsam_plot
|
import gtsam.utils.plot as gtsam_plot
|
||||||
|
import matplotlib.pyplot as plt
|
||||||
|
import numpy as np
|
||||||
|
from gtsam import symbol_shorthand_L as L
|
||||||
|
from gtsam import symbol_shorthand_X as X
|
||||||
from gtsam.examples import SFMdata
|
from gtsam.examples import SFMdata
|
||||||
|
from mpl_toolkits.mplot3d import Axes3D # pylint: disable=W0611
|
||||||
|
|
||||||
def X(i):
|
|
||||||
"""Create key for pose i."""
|
|
||||||
return int(gtsam.symbol(ord('x'), i))
|
|
||||||
|
|
||||||
|
|
||||||
def L(j):
|
|
||||||
"""Create key for landmark j."""
|
|
||||||
return int(gtsam.symbol(ord('l'), j))
|
|
||||||
|
|
||||||
|
|
||||||
def visual_ISAM2_plot(result):
|
def visual_ISAM2_plot(result):
|
||||||
|
|
|
@ -19,11 +19,8 @@ from gtsam.gtsam import (Cal3_S2, GenericProjectionFactorCal3_S2,
|
||||||
NonlinearFactorGraph, NonlinearISAM, Point3, Pose3,
|
NonlinearFactorGraph, NonlinearISAM, Point3, Pose3,
|
||||||
PriorFactorPoint3, PriorFactorPose3, Rot3,
|
PriorFactorPoint3, PriorFactorPose3, Rot3,
|
||||||
PinholeCameraCal3_S2, Values)
|
PinholeCameraCal3_S2, Values)
|
||||||
|
from gtsam import symbol_shorthand_L as L
|
||||||
|
from gtsam import symbol_shorthand_X as X
|
||||||
def symbol(name: str, index: int) -> int:
|
|
||||||
""" helper for creating a symbol without explicitly casting 'name' from str to int """
|
|
||||||
return gtsam.symbol(ord(name), index)
|
|
||||||
|
|
||||||
|
|
||||||
def main():
|
def main():
|
||||||
|
@ -58,7 +55,7 @@ def main():
|
||||||
# Add factors for each landmark observation
|
# Add factors for each landmark observation
|
||||||
for j, point in enumerate(points):
|
for j, point in enumerate(points):
|
||||||
measurement = camera.project(point)
|
measurement = camera.project(point)
|
||||||
factor = GenericProjectionFactorCal3_S2(measurement, camera_noise, symbol('x', i), symbol('l', j), K)
|
factor = GenericProjectionFactorCal3_S2(measurement, camera_noise, X(i), L(j), K)
|
||||||
graph.push_back(factor)
|
graph.push_back(factor)
|
||||||
|
|
||||||
# Intentionally initialize the variables off from the ground truth
|
# Intentionally initialize the variables off from the ground truth
|
||||||
|
@ -66,7 +63,7 @@ def main():
|
||||||
initial_xi = pose.compose(noise)
|
initial_xi = pose.compose(noise)
|
||||||
|
|
||||||
# Add an initial guess for the current pose
|
# Add an initial guess for the current pose
|
||||||
initial_estimate.insert(symbol('x', i), initial_xi)
|
initial_estimate.insert(X(i), initial_xi)
|
||||||
|
|
||||||
# If this is the first iteration, add a prior on the first pose to set the coordinate frame
|
# If this is the first iteration, add a prior on the first pose to set the coordinate frame
|
||||||
# and a prior on the first landmark to set the scale
|
# and a prior on the first landmark to set the scale
|
||||||
|
@ -75,12 +72,12 @@ def main():
|
||||||
if i == 0:
|
if i == 0:
|
||||||
# Add a prior on pose x0, with 0.3 rad std on roll,pitch,yaw and 0.1m x,y,z
|
# Add a prior on pose x0, with 0.3 rad std on roll,pitch,yaw and 0.1m x,y,z
|
||||||
pose_noise = gtsam.noiseModel_Diagonal.Sigmas(np.array([0.3, 0.3, 0.3, 0.1, 0.1, 0.1]))
|
pose_noise = gtsam.noiseModel_Diagonal.Sigmas(np.array([0.3, 0.3, 0.3, 0.1, 0.1, 0.1]))
|
||||||
factor = PriorFactorPose3(symbol('x', 0), poses[0], pose_noise)
|
factor = PriorFactorPose3(X(0), poses[0], pose_noise)
|
||||||
graph.push_back(factor)
|
graph.push_back(factor)
|
||||||
|
|
||||||
# Add a prior on landmark l0
|
# Add a prior on landmark l0
|
||||||
point_noise = gtsam.noiseModel_Isotropic.Sigma(3, 0.1)
|
point_noise = gtsam.noiseModel_Isotropic.Sigma(3, 0.1)
|
||||||
factor = PriorFactorPoint3(symbol('l', 0), points[0], point_noise)
|
factor = PriorFactorPoint3(L(0), points[0], point_noise)
|
||||||
graph.push_back(factor)
|
graph.push_back(factor)
|
||||||
|
|
||||||
# Add initial guesses to all observed landmarks
|
# Add initial guesses to all observed landmarks
|
||||||
|
@ -88,7 +85,7 @@ def main():
|
||||||
for j, point in enumerate(points):
|
for j, point in enumerate(points):
|
||||||
# Intentionally initialize the variables off from the ground truth
|
# Intentionally initialize the variables off from the ground truth
|
||||||
initial_lj = points[j].vector() + noise
|
initial_lj = points[j].vector() + noise
|
||||||
initial_estimate.insert(symbol('l', j), Point3(initial_lj))
|
initial_estimate.insert(L(j), Point3(initial_lj))
|
||||||
else:
|
else:
|
||||||
# Update iSAM with the new factors
|
# Update iSAM with the new factors
|
||||||
isam.update(graph, initial_estimate)
|
isam.update(graph, initial_estimate)
|
||||||
|
|
|
@ -15,17 +15,18 @@ from __future__ import print_function
|
||||||
import unittest
|
import unittest
|
||||||
|
|
||||||
import gtsam
|
import gtsam
|
||||||
|
import numpy as np
|
||||||
|
from gtsam import symbol_shorthand_X as X
|
||||||
from gtsam.utils.test_case import GtsamTestCase
|
from gtsam.utils.test_case import GtsamTestCase
|
||||||
|
|
||||||
import numpy as np
|
|
||||||
|
|
||||||
def create_graph():
|
def create_graph():
|
||||||
"""Create a basic linear factor graph for testing"""
|
"""Create a basic linear factor graph for testing"""
|
||||||
graph = gtsam.GaussianFactorGraph()
|
graph = gtsam.GaussianFactorGraph()
|
||||||
|
|
||||||
x0 = gtsam.symbol(ord('x'), 0)
|
x0 = X(0)
|
||||||
x1 = gtsam.symbol(ord('x'), 1)
|
x1 = X(1)
|
||||||
x2 = gtsam.symbol(ord('x'), 2)
|
x2 = X(2)
|
||||||
|
|
||||||
BETWEEN_NOISE = gtsam.noiseModel_Diagonal.Sigmas(np.ones(1))
|
BETWEEN_NOISE = gtsam.noiseModel_Diagonal.Sigmas(np.ones(1))
|
||||||
PRIOR_NOISE = gtsam.noiseModel_Diagonal.Sigmas(np.ones(1))
|
PRIOR_NOISE = gtsam.noiseModel_Diagonal.Sigmas(np.ones(1))
|
||||||
|
|
|
@ -33,7 +33,7 @@ class TestDSFMap(GtsamTestCase):
|
||||||
|
|
||||||
# testing the merge feature of dsf
|
# testing the merge feature of dsf
|
||||||
dsf.merge(pair1, pair2)
|
dsf.merge(pair1, pair2)
|
||||||
self.assertEquals(key(dsf.find(pair1)), key(dsf.find(pair2)))
|
self.assertEqual(key(dsf.find(pair1)), key(dsf.find(pair2)))
|
||||||
|
|
||||||
|
|
||||||
if __name__ == '__main__':
|
if __name__ == '__main__':
|
||||||
|
|
|
@ -0,0 +1,79 @@
|
||||||
|
"""
|
||||||
|
Unit tests for optimization that logs to comet.ml.
|
||||||
|
Author: Jing Wu and Frank Dellaert
|
||||||
|
"""
|
||||||
|
# pylint: disable=invalid-name
|
||||||
|
|
||||||
|
import unittest
|
||||||
|
from datetime import datetime
|
||||||
|
|
||||||
|
import gtsam
|
||||||
|
import numpy as np
|
||||||
|
from gtsam import Rot3
|
||||||
|
from gtsam.utils.test_case import GtsamTestCase
|
||||||
|
|
||||||
|
from gtsam.utils.logging_optimizer import gtsam_optimize
|
||||||
|
|
||||||
|
KEY = 0
|
||||||
|
MODEL = gtsam.noiseModel_Unit.Create(3)
|
||||||
|
|
||||||
|
|
||||||
|
class TestOptimizeComet(GtsamTestCase):
|
||||||
|
"""Check correct logging to comet.ml."""
|
||||||
|
|
||||||
|
def setUp(self):
|
||||||
|
"""Set up a small Karcher mean optimization example."""
|
||||||
|
# Grabbed from KarcherMeanFactor unit tests.
|
||||||
|
R = Rot3.Expmap(np.array([0.1, 0, 0]))
|
||||||
|
rotations = {R, R.inverse()} # mean is the identity
|
||||||
|
self.expected = Rot3()
|
||||||
|
|
||||||
|
graph = gtsam.NonlinearFactorGraph()
|
||||||
|
for R in rotations:
|
||||||
|
graph.add(gtsam.PriorFactorRot3(KEY, R, MODEL))
|
||||||
|
initial = gtsam.Values()
|
||||||
|
initial.insert(KEY, R)
|
||||||
|
self.params = gtsam.GaussNewtonParams()
|
||||||
|
self.optimizer = gtsam.GaussNewtonOptimizer(
|
||||||
|
graph, initial, self.params)
|
||||||
|
|
||||||
|
def test_simple_printing(self):
|
||||||
|
"""Test with a simple hook."""
|
||||||
|
|
||||||
|
# Provide a hook that just prints
|
||||||
|
def hook(_, error: float):
|
||||||
|
print(error)
|
||||||
|
|
||||||
|
# Only thing we require from optimizer is an iterate method
|
||||||
|
gtsam_optimize(self.optimizer, self.params, hook)
|
||||||
|
|
||||||
|
# Check that optimizing yields the identity.
|
||||||
|
actual = self.optimizer.values()
|
||||||
|
self.gtsamAssertEquals(actual.atRot3(KEY), self.expected, tol=1e-6)
|
||||||
|
|
||||||
|
@unittest.skip("Not a test we want run every time, as needs comet.ml account")
|
||||||
|
def test_comet(self):
|
||||||
|
"""Test with a comet hook."""
|
||||||
|
from comet_ml import Experiment
|
||||||
|
comet = Experiment(project_name="Testing",
|
||||||
|
auto_output_logging="native")
|
||||||
|
comet.log_dataset_info(name="Karcher", path="shonan")
|
||||||
|
comet.add_tag("GaussNewton")
|
||||||
|
comet.log_parameter("method", "GaussNewton")
|
||||||
|
time = datetime.now()
|
||||||
|
comet.set_name("GaussNewton-" + str(time.month) + "/" + str(time.day) + " "
|
||||||
|
+ str(time.hour)+":"+str(time.minute)+":"+str(time.second))
|
||||||
|
|
||||||
|
# I want to do some comet thing here
|
||||||
|
def hook(optimizer, error: float):
|
||||||
|
comet.log_metric("Karcher error",
|
||||||
|
error, optimizer.iterations())
|
||||||
|
|
||||||
|
gtsam_optimize(self.optimizer, self.params, hook)
|
||||||
|
comet.end()
|
||||||
|
|
||||||
|
actual = self.optimizer.values()
|
||||||
|
self.gtsamAssertEquals(actual.atRot3(KEY), self.expected)
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
unittest.main()
|
|
@ -0,0 +1,54 @@
|
||||||
|
"""
|
||||||
|
Optimization with logging via a hook.
|
||||||
|
Author: Jing Wu and Frank Dellaert
|
||||||
|
"""
|
||||||
|
# pylint: disable=invalid-name
|
||||||
|
|
||||||
|
from typing import TypeVar
|
||||||
|
|
||||||
|
from gtsam import NonlinearOptimizer, NonlinearOptimizerParams
|
||||||
|
import gtsam
|
||||||
|
|
||||||
|
T = TypeVar('T')
|
||||||
|
|
||||||
|
|
||||||
|
def optimize(optimizer: T, check_convergence, hook):
|
||||||
|
""" Given an optimizer and a convergence check, iterate until convergence.
|
||||||
|
After each iteration, hook(optimizer, error) is called.
|
||||||
|
After the function, use values and errors to get the result.
|
||||||
|
Arguments:
|
||||||
|
optimizer (T): needs an iterate and an error function.
|
||||||
|
check_convergence: T * float * float -> bool
|
||||||
|
hook -- hook function to record the error
|
||||||
|
"""
|
||||||
|
# the optimizer is created with default values which incur the error below
|
||||||
|
current_error = optimizer.error()
|
||||||
|
hook(optimizer, current_error)
|
||||||
|
|
||||||
|
# Iterative loop
|
||||||
|
while True:
|
||||||
|
# Do next iteration
|
||||||
|
optimizer.iterate()
|
||||||
|
new_error = optimizer.error()
|
||||||
|
hook(optimizer, new_error)
|
||||||
|
if check_convergence(optimizer, current_error, new_error):
|
||||||
|
return
|
||||||
|
current_error = new_error
|
||||||
|
|
||||||
|
|
||||||
|
def gtsam_optimize(optimizer: NonlinearOptimizer,
|
||||||
|
params: NonlinearOptimizerParams,
|
||||||
|
hook):
|
||||||
|
""" Given an optimizer and params, iterate until convergence.
|
||||||
|
After each iteration, hook(optimizer) is called.
|
||||||
|
After the function, use values and errors to get the result.
|
||||||
|
Arguments:
|
||||||
|
optimizer {NonlinearOptimizer} -- Nonlinear optimizer
|
||||||
|
params {NonlinearOptimizarParams} -- Nonlinear optimizer parameters
|
||||||
|
hook -- hook function to record the error
|
||||||
|
"""
|
||||||
|
def check_convergence(optimizer, current_error, new_error):
|
||||||
|
return (optimizer.iterations() >= params.getMaxIterations()) or (
|
||||||
|
gtsam.checkConvergence(params.getRelativeErrorTol(), params.getAbsoluteErrorTol(), params.getErrorTol(),
|
||||||
|
current_error, new_error))
|
||||||
|
optimize(optimizer, check_convergence, hook)
|
|
@ -279,7 +279,7 @@ def plot_trajectory(fignum, values, scale=1, marginals=None):
|
||||||
marginals (gtsam.Marginals): Marginalized probability values of the estimation.
|
marginals (gtsam.Marginals): Marginalized probability values of the estimation.
|
||||||
Used to plot uncertainty bounds.
|
Used to plot uncertainty bounds.
|
||||||
"""
|
"""
|
||||||
pose3Values = gtsam.allPose3s(values)
|
pose3Values = gtsam.utilities_allPose3s(values)
|
||||||
keys = gtsam.KeyVector(pose3Values.keys())
|
keys = gtsam.KeyVector(pose3Values.keys())
|
||||||
lastIndex = None
|
lastIndex = None
|
||||||
|
|
||||||
|
|
|
@ -1,3 +1,3 @@
|
||||||
Cython>=0.25.2
|
Cython>=0.25.2
|
||||||
backports_abc>=0.5
|
backports_abc>=0.5
|
||||||
numpy>=1.12.0
|
numpy>=1.11.0
|
||||||
|
|
|
@ -35,7 +35,7 @@ setup(
|
||||||
|
|
||||||
packages=packages,
|
packages=packages,
|
||||||
package_data={package:
|
package_data={package:
|
||||||
[f for f in os.listdir(package.replace('.', os.path.sep)) if os.path.splitext(f)[1] in ('.so', '.dll')]
|
[f for f in os.listdir(package.replace('.', os.path.sep)) if os.path.splitext(f)[1] in ('.so', '.pyd')]
|
||||||
for package in packages
|
for package in packages
|
||||||
},
|
},
|
||||||
install_requires=[line.strip() for line in '''
|
install_requires=[line.strip() for line in '''
|
||||||
|
|
|
@ -1,12 +0,0 @@
|
||||||
# How to build a GTSAM debian package
|
|
||||||
|
|
||||||
To use the ``debuild`` command, install the ``devscripts`` package
|
|
||||||
|
|
||||||
sudo apt install devscripts
|
|
||||||
|
|
||||||
Change into the gtsam directory, then run:
|
|
||||||
|
|
||||||
debuild -us -uc -j4
|
|
||||||
|
|
||||||
Adjust the ``-j4`` depending on how many CPUs you want to build on in
|
|
||||||
parallel.
|
|
|
@ -1,5 +0,0 @@
|
||||||
gtsam (4.0.0-1berndpfrommer) bionic; urgency=medium
|
|
||||||
|
|
||||||
* initial release
|
|
||||||
|
|
||||||
-- Bernd Pfrommer <bernd.pfrommer@gmail.com> Wed, 18 Jul 2018 20:36:44 -0400
|
|
|
@ -1 +0,0 @@
|
||||||
9
|
|
|
@ -1,15 +0,0 @@
|
||||||
Source: gtsam
|
|
||||||
Section: libs
|
|
||||||
Priority: optional
|
|
||||||
Maintainer: Frank Dellaert <frank@cc.gatech.edu>
|
|
||||||
Uploaders: Jose Luis Blanco Claraco <joseluisblancoc@gmail.com>, Bernd Pfrommer <bernd.pfrommer@gmail.com>
|
|
||||||
Build-Depends: cmake, libboost-all-dev (>= 1.58), libeigen3-dev, libtbb-dev, debhelper (>=9)
|
|
||||||
Standards-Version: 3.9.7
|
|
||||||
Homepage: https://github.com/borglab/gtsam
|
|
||||||
Vcs-Browser: https://github.com/borglab/gtsam
|
|
||||||
|
|
||||||
Package: libgtsam-dev
|
|
||||||
Architecture: any
|
|
||||||
Depends: ${shlibs:Depends}, ${misc:Depends}, libboost-serialization-dev, libboost-system-dev, libboost-filesystem-dev, libboost-thread-dev, libboost-program-options-dev, libboost-date-time-dev, libboost-timer-dev, libboost-chrono-dev, libboost-regex-dev
|
|
||||||
Description: Georgia Tech Smoothing and Mapping Library
|
|
||||||
gtsam: Georgia Tech Smoothing and Mapping library for SLAM type applications
|
|
|
@ -1,15 +0,0 @@
|
||||||
Format: https://www.debian.org/doc/packaging-manuals/copyright-format/1.0/
|
|
||||||
Upstream-Name: gtsam
|
|
||||||
Source: https://bitbucket.org/gtborg/gtsam.git
|
|
||||||
|
|
||||||
Files: *
|
|
||||||
Copyright: 2017, Frank Dellaert
|
|
||||||
License: BSD
|
|
||||||
|
|
||||||
Files: gtsam/3rdparty/CCOLAMD/*
|
|
||||||
Copyright: 2005-2011, Univ. of Florida. Authors: Timothy A. Davis, Sivasankaran Rajamanickam, and Stefan Larimore. Closely based on COLAMD by Davis, Stefan Larimore, in collaboration with Esmond Ng, and John Gilbert. http://www.cise.ufl.edu/research/sparse
|
|
||||||
License: GNU LESSER GENERAL PUBLIC LICENSE
|
|
||||||
|
|
||||||
Files: gtsam/3rdparty/Eigen/*
|
|
||||||
Copyright: 2017, Multiple Authors
|
|
||||||
License: MPL2
|
|
|
@ -1,29 +0,0 @@
|
||||||
#!/usr/bin/make -f
|
|
||||||
# See debhelper(7) (uncomment to enable)
|
|
||||||
# output every command that modifies files on the build system.
|
|
||||||
export DH_VERBOSE = 1
|
|
||||||
|
|
||||||
# Makefile target name for running unit tests:
|
|
||||||
GTSAM_TEST_TARGET = check
|
|
||||||
|
|
||||||
# see FEATURE AREAS in dpkg-buildflags(1)
|
|
||||||
#export DEB_BUILD_MAINT_OPTIONS = hardening=+all
|
|
||||||
|
|
||||||
# see ENVIRONMENT in dpkg-buildflags(1)
|
|
||||||
# package maintainers to append CFLAGS
|
|
||||||
#export DEB_CFLAGS_MAINT_APPEND = -Wall -pedantic
|
|
||||||
# package maintainers to append LDFLAGS
|
|
||||||
#export DEB_LDFLAGS_MAINT_APPEND = -Wl,--as-needed
|
|
||||||
|
|
||||||
%:
|
|
||||||
dh $@ --parallel
|
|
||||||
|
|
||||||
# dh_make generated override targets
|
|
||||||
# This is example for Cmake (See https://bugs.debian.org/641051 )
|
|
||||||
override_dh_auto_configure:
|
|
||||||
dh_auto_configure -- -DCMAKE_BUILD_TYPE=RelWithDebInfo -DCMAKE_INSTALL_PREFIX=/usr -DGTSAM_BUILD_EXAMPLES_ALWAYS=OFF -DGTSAM_BUILD_TESTS=ON -DGTSAM_BUILD_WRAP=OFF -DGTSAM_BUILD_DOCS=OFF -DGTSAM_INSTALL_CPPUNITLITE=OFF -DGTSAM_INSTALL_GEOGRAPHICLIB=OFF -DGTSAM_BUILD_TYPE_POSTFIXES=OFF -DGTSAM_BUILD_WITH_MARCH_NATIVE=OFF
|
|
||||||
|
|
||||||
override_dh_auto_test-arch:
|
|
||||||
# Tests for arch-dependent :
|
|
||||||
echo "[override_dh_auto_test-arch]"
|
|
||||||
dh_auto_build -O--buildsystem=cmake -- $(GTSAM_TEST_TARGET)
|
|
|
@ -1 +0,0 @@
|
||||||
3.0 (quilt)
|
|
|
@ -2291,15 +2291,11 @@ uncalibration
|
||||||
used in the residual).
|
used in the residual).
|
||||||
\end_layout
|
\end_layout
|
||||||
|
|
||||||
\begin_layout Standard
|
|
||||||
\begin_inset Note Note
|
|
||||||
status collapsed
|
|
||||||
|
|
||||||
\begin_layout Section
|
\begin_layout Section
|
||||||
Noise models of prior factors
|
Noise models of prior factors
|
||||||
\end_layout
|
\end_layout
|
||||||
|
|
||||||
\begin_layout Plain Layout
|
\begin_layout Standard
|
||||||
The simplest way to describe noise models is by an example.
|
The simplest way to describe noise models is by an example.
|
||||||
Let's take a prior factor on a 3D pose
|
Let's take a prior factor on a 3D pose
|
||||||
\begin_inset Formula $x\in\SE 3$
|
\begin_inset Formula $x\in\SE 3$
|
||||||
|
@ -2353,7 +2349,7 @@ e\left(x\right)=\norm{h\left(x\right)}_{\Sigma}^{2}=h\left(x\right)^{\t}\Sigma^{
|
||||||
useful answer out quickly ]
|
useful answer out quickly ]
|
||||||
\end_layout
|
\end_layout
|
||||||
|
|
||||||
\begin_layout Plain Layout
|
\begin_layout Standard
|
||||||
The density induced by a noise model on the prior factor is Gaussian in
|
The density induced by a noise model on the prior factor is Gaussian in
|
||||||
the tangent space about the linearization point.
|
the tangent space about the linearization point.
|
||||||
Suppose that the pose is linearized at
|
Suppose that the pose is linearized at
|
||||||
|
@ -2431,7 +2427,7 @@ Here we see that the update
|
||||||
.
|
.
|
||||||
\end_layout
|
\end_layout
|
||||||
|
|
||||||
\begin_layout Plain Layout
|
\begin_layout Standard
|
||||||
This means that to draw random pose samples, we actually draw random samples
|
This means that to draw random pose samples, we actually draw random samples
|
||||||
of
|
of
|
||||||
\begin_inset Formula $\delta x$
|
\begin_inset Formula $\delta x$
|
||||||
|
@ -2456,7 +2452,7 @@ This means that to draw random pose samples, we actually draw random samples
|
||||||
Noise models of between factors
|
Noise models of between factors
|
||||||
\end_layout
|
\end_layout
|
||||||
|
|
||||||
\begin_layout Plain Layout
|
\begin_layout Standard
|
||||||
The noise model of a BetweenFactor is a bit more complicated.
|
The noise model of a BetweenFactor is a bit more complicated.
|
||||||
The unwhitened error is
|
The unwhitened error is
|
||||||
\begin_inset Formula
|
\begin_inset Formula
|
||||||
|
@ -2516,11 +2512,6 @@ e\left(\delta x_{1}\right) & \approx\norm{\log\left(z^{-1}\left(x_{1}\exp\delta
|
||||||
\end_inset
|
\end_inset
|
||||||
|
|
||||||
|
|
||||||
\end_layout
|
|
||||||
|
|
||||||
\end_inset
|
|
||||||
|
|
||||||
|
|
||||||
\end_layout
|
\end_layout
|
||||||
|
|
||||||
\end_body
|
\end_body
|
||||||
|
|
Binary file not shown.
45
gtsam.h
45
gtsam.h
|
@ -1977,6 +1977,35 @@ size_t symbol(char chr, size_t index);
|
||||||
char symbolChr(size_t key);
|
char symbolChr(size_t key);
|
||||||
size_t symbolIndex(size_t key);
|
size_t symbolIndex(size_t key);
|
||||||
|
|
||||||
|
namespace symbol_shorthand {
|
||||||
|
size_t A(size_t j);
|
||||||
|
size_t B(size_t j);
|
||||||
|
size_t C(size_t j);
|
||||||
|
size_t D(size_t j);
|
||||||
|
size_t E(size_t j);
|
||||||
|
size_t F(size_t j);
|
||||||
|
size_t G(size_t j);
|
||||||
|
size_t H(size_t j);
|
||||||
|
size_t I(size_t j);
|
||||||
|
size_t J(size_t j);
|
||||||
|
size_t K(size_t j);
|
||||||
|
size_t L(size_t j);
|
||||||
|
size_t M(size_t j);
|
||||||
|
size_t N(size_t j);
|
||||||
|
size_t O(size_t j);
|
||||||
|
size_t P(size_t j);
|
||||||
|
size_t Q(size_t j);
|
||||||
|
size_t R(size_t j);
|
||||||
|
size_t S(size_t j);
|
||||||
|
size_t T(size_t j);
|
||||||
|
size_t U(size_t j);
|
||||||
|
size_t V(size_t j);
|
||||||
|
size_t W(size_t j);
|
||||||
|
size_t X(size_t j);
|
||||||
|
size_t Y(size_t j);
|
||||||
|
size_t Z(size_t j);
|
||||||
|
}///\namespace symbol
|
||||||
|
|
||||||
// Default keyformatter
|
// Default keyformatter
|
||||||
void PrintKeyList (const gtsam::KeyList& keys);
|
void PrintKeyList (const gtsam::KeyList& keys);
|
||||||
void PrintKeyList (const gtsam::KeyList& keys, string s);
|
void PrintKeyList (const gtsam::KeyList& keys, string s);
|
||||||
|
@ -2141,6 +2170,7 @@ class Values {
|
||||||
void insert(size_t j, const gtsam::EssentialMatrix& essential_matrix);
|
void insert(size_t j, const gtsam::EssentialMatrix& essential_matrix);
|
||||||
void insert(size_t j, const gtsam::PinholeCameraCal3_S2& simple_camera);
|
void insert(size_t j, const gtsam::PinholeCameraCal3_S2& simple_camera);
|
||||||
void insert(size_t j, const gtsam::imuBias::ConstantBias& constant_bias);
|
void insert(size_t j, const gtsam::imuBias::ConstantBias& constant_bias);
|
||||||
|
void insert(size_t j, const gtsam::NavState& nav_state);
|
||||||
void insert(size_t j, Vector vector);
|
void insert(size_t j, Vector vector);
|
||||||
void insert(size_t j, Matrix matrix);
|
void insert(size_t j, Matrix matrix);
|
||||||
|
|
||||||
|
@ -2158,10 +2188,11 @@ class Values {
|
||||||
void update(size_t j, const gtsam::Cal3Bundler& cal3bundler);
|
void update(size_t j, const gtsam::Cal3Bundler& cal3bundler);
|
||||||
void update(size_t j, const gtsam::EssentialMatrix& essential_matrix);
|
void update(size_t j, const gtsam::EssentialMatrix& essential_matrix);
|
||||||
void update(size_t j, const gtsam::imuBias::ConstantBias& constant_bias);
|
void update(size_t j, const gtsam::imuBias::ConstantBias& constant_bias);
|
||||||
|
void update(size_t j, const gtsam::NavState& nav_state);
|
||||||
void update(size_t j, Vector vector);
|
void update(size_t j, Vector vector);
|
||||||
void update(size_t j, Matrix matrix);
|
void update(size_t j, Matrix matrix);
|
||||||
|
|
||||||
template<T = {gtsam::Point2, gtsam::Point3, gtsam::Rot2, gtsam::Pose2, gtsam::SO3, gtsam::SO4, gtsam::SOn, gtsam::Rot3, gtsam::Pose3, gtsam::Cal3_S2, gtsam::Cal3DS2, gtsam::Cal3Bundler, gtsam::EssentialMatrix, gtsam::imuBias::ConstantBias, Vector, Matrix}>
|
template<T = {gtsam::Point2, gtsam::Point3, gtsam::Rot2, gtsam::Pose2, gtsam::SO3, gtsam::SO4, gtsam::SOn, gtsam::Rot3, gtsam::Pose3, gtsam::Cal3_S2, gtsam::Cal3DS2, gtsam::Cal3Bundler, gtsam::EssentialMatrix, gtsam::imuBias::ConstantBias, gtsam::NavState, Vector, Matrix}>
|
||||||
T at(size_t j);
|
T at(size_t j);
|
||||||
|
|
||||||
/// version for double
|
/// version for double
|
||||||
|
@ -2263,6 +2294,8 @@ virtual class NonlinearOptimizerParams {
|
||||||
bool checkConvergence(double relativeErrorTreshold,
|
bool checkConvergence(double relativeErrorTreshold,
|
||||||
double absoluteErrorTreshold, double errorThreshold,
|
double absoluteErrorTreshold, double errorThreshold,
|
||||||
double currentError, double newError);
|
double currentError, double newError);
|
||||||
|
bool checkConvergence(const gtsam::NonlinearOptimizerParams& params,
|
||||||
|
double currentError, double newError);
|
||||||
|
|
||||||
#include <gtsam/nonlinear/GaussNewtonOptimizer.h>
|
#include <gtsam/nonlinear/GaussNewtonOptimizer.h>
|
||||||
virtual class GaussNewtonParams : gtsam::NonlinearOptimizerParams {
|
virtual class GaussNewtonParams : gtsam::NonlinearOptimizerParams {
|
||||||
|
@ -2498,7 +2531,7 @@ class NonlinearISAM {
|
||||||
#include <gtsam/geometry/StereoPoint2.h>
|
#include <gtsam/geometry/StereoPoint2.h>
|
||||||
|
|
||||||
#include <gtsam/nonlinear/PriorFactor.h>
|
#include <gtsam/nonlinear/PriorFactor.h>
|
||||||
template<T = {Vector, gtsam::Point2, gtsam::StereoPoint2, gtsam::Point3, gtsam::Rot2, gtsam::SO3, gtsam::SO4, gtsam::Rot3, gtsam::Pose2, gtsam::Pose3, gtsam::Cal3_S2,gtsam::CalibratedCamera, gtsam::SimpleCamera, gtsam::PinholeCameraCal3_S2, gtsam::imuBias::ConstantBias}>
|
template<T = {Vector, gtsam::Point2, gtsam::StereoPoint2, gtsam::Point3, gtsam::Rot2, gtsam::SO3, gtsam::SO4, gtsam::SOn, gtsam::Rot3, gtsam::Pose2, gtsam::Pose3, gtsam::Cal3_S2,gtsam::CalibratedCamera, gtsam::SimpleCamera, gtsam::PinholeCameraCal3_S2, gtsam::imuBias::ConstantBias}>
|
||||||
virtual class PriorFactor : gtsam::NoiseModelFactor {
|
virtual class PriorFactor : gtsam::NoiseModelFactor {
|
||||||
PriorFactor(size_t key, const T& prior, const gtsam::noiseModel::Base* noiseModel);
|
PriorFactor(size_t key, const T& prior, const gtsam::noiseModel::Base* noiseModel);
|
||||||
T prior() const;
|
T prior() const;
|
||||||
|
@ -2521,7 +2554,7 @@ virtual class BetweenFactor : gtsam::NoiseModelFactor {
|
||||||
|
|
||||||
|
|
||||||
#include <gtsam/nonlinear/NonlinearEquality.h>
|
#include <gtsam/nonlinear/NonlinearEquality.h>
|
||||||
template<T = {gtsam::Point2, gtsam::StereoPoint2, gtsam::Point3, gtsam::Rot2, gtsam::SO3, gtsam::SO4, gtsam::Rot3, gtsam::Pose2, gtsam::Pose3, gtsam::Cal3_S2, gtsam::CalibratedCamera, gtsam::SimpleCamera, gtsam::PinholeCameraCal3_S2, gtsam::imuBias::ConstantBias}>
|
template<T = {gtsam::Point2, gtsam::StereoPoint2, gtsam::Point3, gtsam::Rot2, gtsam::SO3, gtsam::SO4, gtsam::SOn, gtsam::Rot3, gtsam::Pose2, gtsam::Pose3, gtsam::Cal3_S2, gtsam::CalibratedCamera, gtsam::SimpleCamera, gtsam::PinholeCameraCal3_S2, gtsam::imuBias::ConstantBias}>
|
||||||
virtual class NonlinearEquality : gtsam::NoiseModelFactor {
|
virtual class NonlinearEquality : gtsam::NoiseModelFactor {
|
||||||
// Constructor - forces exact evaluation
|
// Constructor - forces exact evaluation
|
||||||
NonlinearEquality(size_t j, const T& feasible);
|
NonlinearEquality(size_t j, const T& feasible);
|
||||||
|
@ -2762,8 +2795,10 @@ void save2D(const gtsam::NonlinearFactorGraph& graph,
|
||||||
// std::vector<gtsam::BetweenFactor<Pose3>::shared_ptr>
|
// std::vector<gtsam::BetweenFactor<Pose3>::shared_ptr>
|
||||||
class BetweenFactorPose3s
|
class BetweenFactorPose3s
|
||||||
{
|
{
|
||||||
|
BetweenFactorPose3s();
|
||||||
size_t size() const;
|
size_t size() const;
|
||||||
gtsam::BetweenFactorPose3* at(size_t i) const;
|
gtsam::BetweenFactorPose3* at(size_t i) const;
|
||||||
|
void push_back(const gtsam::BetweenFactorPose3* factor);
|
||||||
};
|
};
|
||||||
|
|
||||||
#include <gtsam/slam/InitializePose3.h>
|
#include <gtsam/slam/InitializePose3.h>
|
||||||
|
@ -2913,6 +2948,8 @@ class PreintegratedImuMeasurements {
|
||||||
void integrateMeasurement(Vector measuredAcc, Vector measuredOmega,
|
void integrateMeasurement(Vector measuredAcc, Vector measuredOmega,
|
||||||
double deltaT);
|
double deltaT);
|
||||||
void resetIntegration();
|
void resetIntegration();
|
||||||
|
void resetIntegrationAndSetBias(const gtsam::imuBias::ConstantBias& biasHat);
|
||||||
|
|
||||||
Matrix preintMeasCov() const;
|
Matrix preintMeasCov() const;
|
||||||
double deltaTij() const;
|
double deltaTij() const;
|
||||||
gtsam::Rot3 deltaRij() const;
|
gtsam::Rot3 deltaRij() const;
|
||||||
|
@ -2972,6 +3009,8 @@ class PreintegratedCombinedMeasurements {
|
||||||
void integrateMeasurement(Vector measuredAcc, Vector measuredOmega,
|
void integrateMeasurement(Vector measuredAcc, Vector measuredOmega,
|
||||||
double deltaT);
|
double deltaT);
|
||||||
void resetIntegration();
|
void resetIntegration();
|
||||||
|
void resetIntegrationAndSetBias(const gtsam::imuBias::ConstantBias& biasHat);
|
||||||
|
|
||||||
Matrix preintMeasCov() const;
|
Matrix preintMeasCov() const;
|
||||||
double deltaTij() const;
|
double deltaTij() const;
|
||||||
gtsam::Rot3 deltaRij() const;
|
gtsam::Rot3 deltaRij() const;
|
||||||
|
|
|
@ -170,7 +170,7 @@ namespace internal {
|
||||||
/// Assumes existence of: identity, dimension, localCoordinates, retract,
|
/// Assumes existence of: identity, dimension, localCoordinates, retract,
|
||||||
/// and additionally Logmap, Expmap, compose, between, and inverse
|
/// and additionally Logmap, Expmap, compose, between, and inverse
|
||||||
template<class Class>
|
template<class Class>
|
||||||
struct LieGroupTraits {
|
struct LieGroupTraits: GetDimensionImpl<Class, Class::dimension> {
|
||||||
typedef lie_group_tag structure_category;
|
typedef lie_group_tag structure_category;
|
||||||
|
|
||||||
/// @name Group
|
/// @name Group
|
||||||
|
@ -186,8 +186,6 @@ struct LieGroupTraits {
|
||||||
typedef Eigen::Matrix<double, dimension, 1> TangentVector;
|
typedef Eigen::Matrix<double, dimension, 1> TangentVector;
|
||||||
typedef OptionalJacobian<dimension, dimension> ChartJacobian;
|
typedef OptionalJacobian<dimension, dimension> ChartJacobian;
|
||||||
|
|
||||||
static int GetDimension(const Class&) {return dimension;}
|
|
||||||
|
|
||||||
static TangentVector Local(const Class& origin, const Class& other,
|
static TangentVector Local(const Class& origin, const Class& other,
|
||||||
ChartJacobian Horigin = boost::none, ChartJacobian Hother = boost::none) {
|
ChartJacobian Horigin = boost::none, ChartJacobian Hother = boost::none) {
|
||||||
return origin.localCoordinates(other, Horigin, Hother);
|
return origin.localCoordinates(other, Horigin, Hother);
|
||||||
|
|
|
@ -72,7 +72,7 @@ struct HasManifoldPrereqs {
|
||||||
|
|
||||||
/// Extra manifold traits for fixed-dimension types
|
/// Extra manifold traits for fixed-dimension types
|
||||||
template<class Class, int N>
|
template<class Class, int N>
|
||||||
struct ManifoldImpl {
|
struct GetDimensionImpl {
|
||||||
// Compile-time dimensionality
|
// Compile-time dimensionality
|
||||||
static int GetDimension(const Class&) {
|
static int GetDimension(const Class&) {
|
||||||
return N;
|
return N;
|
||||||
|
@ -81,7 +81,7 @@ struct ManifoldImpl {
|
||||||
|
|
||||||
/// Extra manifold traits for variable-dimension types
|
/// Extra manifold traits for variable-dimension types
|
||||||
template<class Class>
|
template<class Class>
|
||||||
struct ManifoldImpl<Class, Eigen::Dynamic> {
|
struct GetDimensionImpl<Class, Eigen::Dynamic> {
|
||||||
// Run-time dimensionality
|
// Run-time dimensionality
|
||||||
static int GetDimension(const Class& m) {
|
static int GetDimension(const Class& m) {
|
||||||
return m.dim();
|
return m.dim();
|
||||||
|
@ -92,7 +92,7 @@ struct ManifoldImpl<Class, Eigen::Dynamic> {
|
||||||
/// To use this for your class type, define:
|
/// To use this for your class type, define:
|
||||||
/// template<> struct traits<Class> : public internal::ManifoldTraits<Class> { };
|
/// template<> struct traits<Class> : public internal::ManifoldTraits<Class> { };
|
||||||
template<class Class>
|
template<class Class>
|
||||||
struct ManifoldTraits: ManifoldImpl<Class, Class::dimension> {
|
struct ManifoldTraits: GetDimensionImpl<Class, Class::dimension> {
|
||||||
|
|
||||||
// Check that Class has the necessary machinery
|
// Check that Class has the necessary machinery
|
||||||
BOOST_CONCEPT_ASSERT((HasManifoldPrereqs<Class>));
|
BOOST_CONCEPT_ASSERT((HasManifoldPrereqs<Class>));
|
||||||
|
|
|
@ -76,7 +76,7 @@ namespace gtsam {
|
||||||
blockStart_(0)
|
blockStart_(0)
|
||||||
{
|
{
|
||||||
fillOffsets(dimensions.begin(), dimensions.end(), appendOneDimension);
|
fillOffsets(dimensions.begin(), dimensions.end(), appendOneDimension);
|
||||||
matrix_.setZero(variableColOffsets_.back(), variableColOffsets_.back());
|
matrix_.resize(variableColOffsets_.back(), variableColOffsets_.back());
|
||||||
assertInvariants();
|
assertInvariants();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -86,7 +86,7 @@ namespace gtsam {
|
||||||
blockStart_(0)
|
blockStart_(0)
|
||||||
{
|
{
|
||||||
fillOffsets(firstBlockDim, lastBlockDim, appendOneDimension);
|
fillOffsets(firstBlockDim, lastBlockDim, appendOneDimension);
|
||||||
matrix_.setZero(variableColOffsets_.back(), variableColOffsets_.back());
|
matrix_.resize(variableColOffsets_.back(), variableColOffsets_.back());
|
||||||
assertInvariants();
|
assertInvariants();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -95,7 +95,7 @@ namespace gtsam {
|
||||||
SymmetricBlockMatrix(const CONTAINER& dimensions, const Matrix& matrix, bool appendOneDimension = false) :
|
SymmetricBlockMatrix(const CONTAINER& dimensions, const Matrix& matrix, bool appendOneDimension = false) :
|
||||||
blockStart_(0)
|
blockStart_(0)
|
||||||
{
|
{
|
||||||
matrix_.setZero(matrix.rows(), matrix.cols());
|
matrix_.resize(matrix.rows(), matrix.cols());
|
||||||
matrix_.triangularView<Eigen::Upper>() = matrix.triangularView<Eigen::Upper>();
|
matrix_.triangularView<Eigen::Upper>() = matrix.triangularView<Eigen::Upper>();
|
||||||
fillOffsets(dimensions.begin(), dimensions.end(), appendOneDimension);
|
fillOffsets(dimensions.begin(), dimensions.end(), appendOneDimension);
|
||||||
if(matrix_.rows() != matrix_.cols())
|
if(matrix_.rows() != matrix_.cols())
|
||||||
|
@ -416,4 +416,3 @@ namespace gtsam {
|
||||||
class CholeskyFailed;
|
class CholeskyFailed;
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
|
@ -24,7 +24,7 @@
|
||||||
namespace gtsam {
|
namespace gtsam {
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
Cal3Fisheye::Cal3Fisheye(const Vector& v)
|
Cal3Fisheye::Cal3Fisheye(const Vector9& v)
|
||||||
: fx_(v[0]),
|
: fx_(v[0]),
|
||||||
fy_(v[1]),
|
fy_(v[1]),
|
||||||
s_(v[2]),
|
s_(v[2]),
|
||||||
|
@ -50,76 +50,73 @@ Matrix3 Cal3Fisheye::K() const {
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
static Matrix29 D2dcalibration(const double xd, const double yd,
|
double Cal3Fisheye::Scaling(double r) {
|
||||||
const double xi, const double yi,
|
static constexpr double threshold = 1e-8;
|
||||||
const double t3, const double t5,
|
if (r > threshold || r < -threshold) {
|
||||||
const double t7, const double t9, const double r,
|
return atan(r) / r;
|
||||||
Matrix2& DK) {
|
} else {
|
||||||
// order: fx, fy, s, u0, v0
|
// Taylor expansion close to 0
|
||||||
Matrix25 DR1;
|
double r2 = r * r, r4 = r2 * r2;
|
||||||
DR1 << xd, 0.0, yd, 1.0, 0.0, 0.0, yd, 0.0, 0.0, 1.0;
|
return 1.0 - r2 / 3 + r4 / 5;
|
||||||
|
}
|
||||||
// order: k1, k2, k3, k4
|
|
||||||
Matrix24 DR2;
|
|
||||||
DR2 << t3 * xi, t5 * xi, t7 * xi, t9 * xi, t3 * yi, t5 * yi, t7 * yi, t9 * yi;
|
|
||||||
DR2 /= r;
|
|
||||||
Matrix29 D;
|
|
||||||
D << DR1, DK * DR2;
|
|
||||||
return D;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* ************************************************************************* */
|
|
||||||
static Matrix2 D2dintrinsic(const double xi, const double yi, const double r,
|
|
||||||
const double td, const double t, const double tt,
|
|
||||||
const double t4, const double t6, const double t8,
|
|
||||||
const double k1, const double k2, const double k3,
|
|
||||||
const double k4, const Matrix2& DK) {
|
|
||||||
const double dr_dxi = xi / sqrt(xi * xi + yi * yi);
|
|
||||||
const double dr_dyi = yi / sqrt(xi * xi + yi * yi);
|
|
||||||
const double dt_dr = 1 / (1 + r * r);
|
|
||||||
const double dtd_dt =
|
|
||||||
1 + 3 * k1 * tt + 5 * k2 * t4 + 7 * k3 * t6 + 9 * k4 * t8;
|
|
||||||
const double dtd_dxi = dtd_dt * dt_dr * dr_dxi;
|
|
||||||
const double dtd_dyi = dtd_dt * dt_dr * dr_dyi;
|
|
||||||
|
|
||||||
const double rinv = 1 / r;
|
|
||||||
const double rrinv = 1 / (r * r);
|
|
||||||
const double dxd_dxi =
|
|
||||||
dtd_dxi * xi * rinv + td * rinv + td * xi * (-rrinv) * dr_dxi;
|
|
||||||
const double dxd_dyi = dtd_dyi * xi * rinv - td * xi * rrinv * dr_dyi;
|
|
||||||
const double dyd_dxi = dtd_dxi * yi * rinv - td * yi * rrinv * dr_dxi;
|
|
||||||
const double dyd_dyi =
|
|
||||||
dtd_dyi * yi * rinv + td * rinv + td * yi * (-rrinv) * dr_dyi;
|
|
||||||
|
|
||||||
Matrix2 DR;
|
|
||||||
DR << dxd_dxi, dxd_dyi, dyd_dxi, dyd_dyi;
|
|
||||||
|
|
||||||
return DK * DR;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
Point2 Cal3Fisheye::uncalibrate(const Point2& p, OptionalJacobian<2, 9> H1,
|
Point2 Cal3Fisheye::uncalibrate(const Point2& p, OptionalJacobian<2, 9> H1,
|
||||||
OptionalJacobian<2, 2> H2) const {
|
OptionalJacobian<2, 2> H2) const {
|
||||||
const double xi = p.x(), yi = p.y();
|
const double xi = p.x(), yi = p.y();
|
||||||
const double r = sqrt(xi * xi + yi * yi);
|
const double r2 = xi * xi + yi * yi, r = sqrt(r2);
|
||||||
const double t = atan(r);
|
const double t = atan(r);
|
||||||
const double tt = t * t, t4 = tt * tt, t6 = tt * t4, t8 = t4 * t4;
|
const double t2 = t * t, t4 = t2 * t2, t6 = t2 * t4, t8 = t4 * t4;
|
||||||
const double td = t * (1 + k1_ * tt + k2_ * t4 + k3_ * t6 + k4_ * t8);
|
Vector5 K, T;
|
||||||
const double td_o_r = r > 1e-8 ? td / r : 1;
|
K << 1, k1_, k2_, k3_, k4_;
|
||||||
const double xd = td_o_r * xi, yd = td_o_r * yi;
|
T << 1, t2, t4, t6, t8;
|
||||||
|
const double scaling = Scaling(r);
|
||||||
|
const double s = scaling * K.dot(T);
|
||||||
|
const double xd = s * xi, yd = s * yi;
|
||||||
Point2 uv(fx_ * xd + s_ * yd + u0_, fy_ * yd + v0_);
|
Point2 uv(fx_ * xd + s_ * yd + u0_, fy_ * yd + v0_);
|
||||||
|
|
||||||
Matrix2 DK;
|
Matrix2 DK;
|
||||||
if (H1 || H2) DK << fx_, s_, 0.0, fy_;
|
if (H1 || H2) DK << fx_, s_, 0.0, fy_;
|
||||||
|
|
||||||
// Derivative for calibration parameters (2 by 9)
|
// Derivative for calibration parameters (2 by 9)
|
||||||
if (H1)
|
if (H1) {
|
||||||
*H1 = D2dcalibration(xd, yd, xi, yi, t * tt, t * t4, t * t6, t * t8, r, DK);
|
Matrix25 DR1;
|
||||||
|
// order: fx, fy, s, u0, v0
|
||||||
|
DR1 << xd, 0.0, yd, 1.0, 0.0, 0.0, yd, 0.0, 0.0, 1.0;
|
||||||
|
|
||||||
|
// order: k1, k2, k3, k4
|
||||||
|
Matrix24 DR2;
|
||||||
|
auto T4 = T.tail<4>().transpose();
|
||||||
|
DR2 << xi * T4, yi * T4;
|
||||||
|
*H1 << DR1, DK * scaling * DR2;
|
||||||
|
}
|
||||||
|
|
||||||
// Derivative for points in intrinsic coords (2 by 2)
|
// Derivative for points in intrinsic coords (2 by 2)
|
||||||
if (H2)
|
if (H2) {
|
||||||
*H2 =
|
const double dtd_dt =
|
||||||
D2dintrinsic(xi, yi, r, td, t, tt, t4, t6, t8, k1_, k2_, k3_, k4_, DK);
|
1 + 3 * k1_ * t2 + 5 * k2_ * t4 + 7 * k3_ * t6 + 9 * k4_ * t8;
|
||||||
|
const double dt_dr = 1 / (1 + r2);
|
||||||
|
const double rinv = 1 / r;
|
||||||
|
const double dr_dxi = xi * rinv;
|
||||||
|
const double dr_dyi = yi * rinv;
|
||||||
|
const double dtd_dxi = dtd_dt * dt_dr * dr_dxi;
|
||||||
|
const double dtd_dyi = dtd_dt * dt_dr * dr_dyi;
|
||||||
|
|
||||||
|
const double td = t * K.dot(T);
|
||||||
|
const double rrinv = 1 / r2;
|
||||||
|
const double dxd_dxi =
|
||||||
|
dtd_dxi * dr_dxi + td * rinv - td * xi * rrinv * dr_dxi;
|
||||||
|
const double dxd_dyi = dtd_dyi * dr_dxi - td * xi * rrinv * dr_dyi;
|
||||||
|
const double dyd_dxi = dtd_dxi * dr_dyi - td * yi * rrinv * dr_dxi;
|
||||||
|
const double dyd_dyi =
|
||||||
|
dtd_dyi * dr_dyi + td * rinv - td * yi * rrinv * dr_dyi;
|
||||||
|
|
||||||
|
Matrix2 DR;
|
||||||
|
DR << dxd_dxi, dxd_dyi, dyd_dxi, dyd_dyi;
|
||||||
|
|
||||||
|
*H2 = DK * DR;
|
||||||
|
}
|
||||||
|
|
||||||
return uv;
|
return uv;
|
||||||
}
|
}
|
||||||
|
@ -157,39 +154,10 @@ Point2 Cal3Fisheye::calibrate(const Point2& uv, const double tol) const {
|
||||||
return pi;
|
return pi;
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
|
||||||
Matrix2 Cal3Fisheye::D2d_intrinsic(const Point2& p) const {
|
|
||||||
const double xi = p.x(), yi = p.y();
|
|
||||||
const double r = sqrt(xi * xi + yi * yi);
|
|
||||||
const double t = atan(r);
|
|
||||||
const double tt = t * t, t4 = tt * tt, t6 = t4 * tt, t8 = t4 * t4;
|
|
||||||
const double td = t * (1 + k1_ * tt + k2_ * t4 + k3_ * t6 + k4_ * t8);
|
|
||||||
|
|
||||||
Matrix2 DK;
|
|
||||||
DK << fx_, s_, 0.0, fy_;
|
|
||||||
|
|
||||||
return D2dintrinsic(xi, yi, r, td, t, tt, t4, t6, t8, k1_, k2_, k3_, k4_, DK);
|
|
||||||
}
|
|
||||||
|
|
||||||
/* ************************************************************************* */
|
|
||||||
Matrix29 Cal3Fisheye::D2d_calibration(const Point2& p) const {
|
|
||||||
const double xi = p.x(), yi = p.y();
|
|
||||||
const double r = sqrt(xi * xi + yi * yi);
|
|
||||||
const double t = atan(r);
|
|
||||||
const double tt = t * t, t4 = tt * tt, t6 = tt * t4, t8 = t4 * t4;
|
|
||||||
const double td = t * (1 + k1_ * tt + k2_ * t4 + k3_ * t6 + k4_ * t8);
|
|
||||||
const double xd = td / r * xi, yd = td / r * yi;
|
|
||||||
|
|
||||||
Matrix2 DK;
|
|
||||||
DK << fx_, s_, 0.0, fy_;
|
|
||||||
return D2dcalibration(xd, yd, xi, yi, t * tt, t * t4, t * t6, t * t8, r, DK);
|
|
||||||
}
|
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
void Cal3Fisheye::print(const std::string& s_) const {
|
void Cal3Fisheye::print(const std::string& s_) const {
|
||||||
gtsam::print((Matrix)K(), s_ + ".K");
|
gtsam::print((Matrix)K(), s_ + ".K");
|
||||||
gtsam::print(Vector(k()), s_ + ".k");
|
gtsam::print(Vector(k()), s_ + ".k");
|
||||||
;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
|
|
|
@ -20,6 +20,8 @@
|
||||||
|
|
||||||
#include <gtsam/geometry/Point2.h>
|
#include <gtsam/geometry/Point2.h>
|
||||||
|
|
||||||
|
#include <string>
|
||||||
|
|
||||||
namespace gtsam {
|
namespace gtsam {
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
@ -43,7 +45,7 @@ namespace gtsam {
|
||||||
* [u; v; 1] = K*[x_d; y_d; 1]
|
* [u; v; 1] = K*[x_d; y_d; 1]
|
||||||
*/
|
*/
|
||||||
class GTSAM_EXPORT Cal3Fisheye {
|
class GTSAM_EXPORT Cal3Fisheye {
|
||||||
protected:
|
private:
|
||||||
double fx_, fy_, s_, u0_, v0_; // focal length, skew and principal point
|
double fx_, fy_, s_, u0_, v0_; // focal length, skew and principal point
|
||||||
double k1_, k2_, k3_, k4_; // fisheye distortion coefficients
|
double k1_, k2_, k3_, k4_; // fisheye distortion coefficients
|
||||||
|
|
||||||
|
@ -78,7 +80,7 @@ class GTSAM_EXPORT Cal3Fisheye {
|
||||||
/// @name Advanced Constructors
|
/// @name Advanced Constructors
|
||||||
/// @{
|
/// @{
|
||||||
|
|
||||||
Cal3Fisheye(const Vector& v);
|
explicit Cal3Fisheye(const Vector9& v);
|
||||||
|
|
||||||
/// @}
|
/// @}
|
||||||
/// @name Standard Interface
|
/// @name Standard Interface
|
||||||
|
@ -120,6 +122,9 @@ class GTSAM_EXPORT Cal3Fisheye {
|
||||||
/// Return all parameters as a vector
|
/// Return all parameters as a vector
|
||||||
Vector9 vector() const;
|
Vector9 vector() const;
|
||||||
|
|
||||||
|
/// Helper function that calculates atan(r)/r
|
||||||
|
static double Scaling(double r);
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* @brief convert intrinsic coordinates [x_i; y_i] to (distorted) image
|
* @brief convert intrinsic coordinates [x_i; y_i] to (distorted) image
|
||||||
* coordinates [u; v]
|
* coordinates [u; v]
|
||||||
|
@ -136,13 +141,6 @@ class GTSAM_EXPORT Cal3Fisheye {
|
||||||
/// y_i]
|
/// y_i]
|
||||||
Point2 calibrate(const Point2& p, const double tol = 1e-5) const;
|
Point2 calibrate(const Point2& p, const double tol = 1e-5) const;
|
||||||
|
|
||||||
/// Derivative of uncalibrate wrpt intrinsic coordinates [x_i; y_i]
|
|
||||||
Matrix2 D2d_intrinsic(const Point2& p) const;
|
|
||||||
|
|
||||||
/// Derivative of uncalibrate wrpt the calibration parameters
|
|
||||||
/// [fx, fy, s, u0, v0, k1, k2, k3, k4]
|
|
||||||
Matrix29 D2d_calibration(const Point2& p) const;
|
|
||||||
|
|
||||||
/// @}
|
/// @}
|
||||||
/// @name Testable
|
/// @name Testable
|
||||||
/// @{
|
/// @{
|
||||||
|
|
|
@ -261,13 +261,13 @@ Vector3 SO3::Logmap(const SO3& Q, ChartJacobian H) {
|
||||||
|
|
||||||
// when trace == -1, i.e., when theta = +-pi, +-3pi, +-5pi, etc.
|
// when trace == -1, i.e., when theta = +-pi, +-3pi, +-5pi, etc.
|
||||||
// we do something special
|
// we do something special
|
||||||
if (std::abs(tr + 1.0) < 1e-10) {
|
if (tr + 1.0 < 1e-10) {
|
||||||
if (std::abs(R33 + 1.0) > 1e-10)
|
if (std::abs(R33 + 1.0) > 1e-5)
|
||||||
omega = (M_PI / sqrt(2.0 + 2.0 * R33)) * Vector3(R13, R23, 1.0 + R33);
|
omega = (M_PI / sqrt(2.0 + 2.0 * R33)) * Vector3(R13, R23, 1.0 + R33);
|
||||||
else if (std::abs(R22 + 1.0) > 1e-10)
|
else if (std::abs(R22 + 1.0) > 1e-5)
|
||||||
omega = (M_PI / sqrt(2.0 + 2.0 * R22)) * Vector3(R12, 1.0 + R22, R32);
|
omega = (M_PI / sqrt(2.0 + 2.0 * R22)) * Vector3(R12, 1.0 + R22, R32);
|
||||||
else
|
else
|
||||||
// if(std::abs(R.r1_.x()+1.0) > 1e-10) This is implicit
|
// if(std::abs(R.r1_.x()+1.0) > 1e-5) This is implicit
|
||||||
omega = (M_PI / sqrt(2.0 + 2.0 * R11)) * Vector3(1.0 + R11, R21, R31);
|
omega = (M_PI / sqrt(2.0 + 2.0 * R11)) * Vector3(1.0 + R11, R21, R31);
|
||||||
} else {
|
} else {
|
||||||
double magnitude;
|
double magnitude;
|
||||||
|
|
|
@ -33,9 +33,10 @@ using namespace std;
|
||||||
|
|
||||||
namespace gtsam {
|
namespace gtsam {
|
||||||
|
|
||||||
|
// TODO(frank): is this better than SOn::Random?
|
||||||
// /* *************************************************************************
|
// /* *************************************************************************
|
||||||
// */ static Vector3 randomOmega(boost::mt19937 &rng) {
|
// */ static Vector3 randomOmega(boost::mt19937 &rng) {
|
||||||
// static boost::uniform_real<double> randomAngle(-M_PI, M_PI);
|
// static std::uniform_real_distribution<double> randomAngle(-M_PI, M_PI);
|
||||||
// return Unit3::Random(rng).unitVector() * randomAngle(rng);
|
// return Unit3::Random(rng).unitVector() * randomAngle(rng);
|
||||||
// }
|
// }
|
||||||
|
|
||||||
|
@ -58,9 +59,9 @@ Matrix4 SO4::Hat(const Vector6& xi) {
|
||||||
Y(0, 1) = -xi(5);
|
Y(0, 1) = -xi(5);
|
||||||
Y(0, 2) = +xi(4);
|
Y(0, 2) = +xi(4);
|
||||||
Y(1, 2) = -xi(3);
|
Y(1, 2) = -xi(3);
|
||||||
Y(0, 3) = -xi(2);
|
Y(0, 3) = +xi(2);
|
||||||
Y(1, 3) = +xi(1);
|
Y(1, 3) = -xi(1);
|
||||||
Y(2, 3) = -xi(0);
|
Y(2, 3) = +xi(0);
|
||||||
return Y - Y.transpose();
|
return Y - Y.transpose();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -72,9 +73,9 @@ Vector6 SO4::Vee(const Matrix4& X) {
|
||||||
xi(5) = -X(0, 1);
|
xi(5) = -X(0, 1);
|
||||||
xi(4) = +X(0, 2);
|
xi(4) = +X(0, 2);
|
||||||
xi(3) = -X(1, 2);
|
xi(3) = -X(1, 2);
|
||||||
xi(2) = -X(0, 3);
|
xi(2) = +X(0, 3);
|
||||||
xi(1) = +X(1, 3);
|
xi(1) = -X(1, 3);
|
||||||
xi(0) = -X(2, 3);
|
xi(0) = +X(2, 3);
|
||||||
return xi;
|
return xi;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -208,9 +209,9 @@ GTSAM_EXPORT Matrix3 topLeft(const SO4& Q, OptionalJacobian<9, 6> H) {
|
||||||
if (H) {
|
if (H) {
|
||||||
const Vector3 m1 = M.col(0), m2 = M.col(1), m3 = M.col(2),
|
const Vector3 m1 = M.col(0), m2 = M.col(1), m3 = M.col(2),
|
||||||
q = R.topRightCorner<3, 1>();
|
q = R.topRightCorner<3, 1>();
|
||||||
*H << Z_3x1, Z_3x1, q, Z_3x1, -m3, m2, //
|
*H << Z_3x1, Z_3x1, -q, Z_3x1, -m3, m2, //
|
||||||
Z_3x1, -q, Z_3x1, m3, Z_3x1, -m1, //
|
Z_3x1, q, Z_3x1, m3, Z_3x1, -m1, //
|
||||||
q, Z_3x1, Z_3x1, -m2, m1, Z_3x1;
|
-q, Z_3x1, Z_3x1, -m2, m1, Z_3x1;
|
||||||
}
|
}
|
||||||
return M;
|
return M;
|
||||||
}
|
}
|
||||||
|
@ -221,9 +222,9 @@ GTSAM_EXPORT Matrix43 stiefel(const SO4& Q, OptionalJacobian<12, 6> H) {
|
||||||
const Matrix43 M = R.leftCols<3>();
|
const Matrix43 M = R.leftCols<3>();
|
||||||
if (H) {
|
if (H) {
|
||||||
const auto &m1 = R.col(0), m2 = R.col(1), m3 = R.col(2), q = R.col(3);
|
const auto &m1 = R.col(0), m2 = R.col(1), m3 = R.col(2), q = R.col(3);
|
||||||
*H << Z_4x1, Z_4x1, q, Z_4x1, -m3, m2, //
|
*H << Z_4x1, Z_4x1, -q, Z_4x1, -m3, m2, //
|
||||||
Z_4x1, -q, Z_4x1, m3, Z_4x1, -m1, //
|
Z_4x1, q, Z_4x1, m3, Z_4x1, -m1, //
|
||||||
q, Z_4x1, Z_4x1, -m2, m1, Z_4x1;
|
-q, Z_4x1, Z_4x1, -m2, m1, Z_4x1;
|
||||||
}
|
}
|
||||||
return M;
|
return M;
|
||||||
}
|
}
|
||||||
|
|
|
@ -38,11 +38,12 @@ Matrix SOn::Hat(const Vector& xi) {
|
||||||
const size_t dmin = (n - 1) * (n - 2) / 2;
|
const size_t dmin = (n - 1) * (n - 2) / 2;
|
||||||
X.topLeftCorner(n - 1, n - 1) = Hat(xi.tail(dmin));
|
X.topLeftCorner(n - 1, n - 1) = Hat(xi.tail(dmin));
|
||||||
|
|
||||||
|
// determine sign of last element (signs alternate)
|
||||||
|
double sign = pow(-1.0, xi.size());
|
||||||
// Now fill last row and column
|
// Now fill last row and column
|
||||||
double sign = 1.0;
|
|
||||||
for (size_t i = 0; i < n - 1; i++) {
|
for (size_t i = 0; i < n - 1; i++) {
|
||||||
const size_t j = n - 2 - i;
|
const size_t j = n - 2 - i;
|
||||||
X(n - 1, j) = sign * xi(i);
|
X(n - 1, j) = -sign * xi(i);
|
||||||
X(j, n - 1) = -X(n - 1, j);
|
X(j, n - 1) = -X(n - 1, j);
|
||||||
sign = -sign;
|
sign = -sign;
|
||||||
}
|
}
|
||||||
|
@ -67,10 +68,10 @@ Vector SOn::Vee(const Matrix& X) {
|
||||||
Vector xi(d);
|
Vector xi(d);
|
||||||
|
|
||||||
// Fill first n-1 spots from last row of X
|
// Fill first n-1 spots from last row of X
|
||||||
double sign = 1.0;
|
double sign = pow(-1.0, xi.size());
|
||||||
for (size_t i = 0; i < n - 1; i++) {
|
for (size_t i = 0; i < n - 1; i++) {
|
||||||
const size_t j = n - 2 - i;
|
const size_t j = n - 2 - i;
|
||||||
xi(i) = sign * X(n - 1, j);
|
xi(i) = -sign * X(n - 1, j);
|
||||||
sign = -sign;
|
sign = -sign;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
|
@ -24,10 +24,11 @@
|
||||||
|
|
||||||
#include <Eigen/Core>
|
#include <Eigen/Core>
|
||||||
|
|
||||||
#include <random>
|
#include <iostream> // TODO(frank): how to avoid?
|
||||||
#include <string>
|
#include <string>
|
||||||
#include <type_traits>
|
#include <type_traits>
|
||||||
#include <vector>
|
#include <vector>
|
||||||
|
#include <random>
|
||||||
|
|
||||||
namespace gtsam {
|
namespace gtsam {
|
||||||
|
|
||||||
|
@ -93,6 +94,16 @@ class SO : public LieGroup<SO<N>, internal::DimensionSO(N)> {
|
||||||
return SO(R);
|
return SO(R);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// Named constructor from lower dimensional matrix
|
||||||
|
template <typename Derived, int N_ = N, typename = IsDynamic<N_>>
|
||||||
|
static SO Lift(size_t n, const Eigen::MatrixBase<Derived> &R) {
|
||||||
|
Matrix Q = Matrix::Identity(n, n);
|
||||||
|
size_t p = R.rows();
|
||||||
|
assert(p < n && R.cols() == p);
|
||||||
|
Q.topLeftCorner(p, p) = R;
|
||||||
|
return SO(Q);
|
||||||
|
}
|
||||||
|
|
||||||
/// Construct dynamic SO(n) from Fixed SO<M>
|
/// Construct dynamic SO(n) from Fixed SO<M>
|
||||||
template <int M, int N_ = N, typename = IsDynamic<N_>>
|
template <int M, int N_ = N, typename = IsDynamic<N_>>
|
||||||
explicit SO(const SO<M>& R) : matrix_(R.matrix()) {}
|
explicit SO(const SO<M>& R) : matrix_(R.matrix()) {}
|
||||||
|
@ -207,11 +218,11 @@ class SO : public LieGroup<SO<N>, internal::DimensionSO(N)> {
|
||||||
* etc... For example, the vector-space isomorphic to so(5) is laid out as:
|
* etc... For example, the vector-space isomorphic to so(5) is laid out as:
|
||||||
* a b c d | u v w | x y | z
|
* a b c d | u v w | x y | z
|
||||||
* where the latter elements correspond to "telescoping" sub-algebras:
|
* where the latter elements correspond to "telescoping" sub-algebras:
|
||||||
* 0 -z y -w d
|
* 0 -z y w -d
|
||||||
* z 0 -x v -c
|
* z 0 -x -v c
|
||||||
* -y x 0 -u b
|
* -y x 0 u -b
|
||||||
* w -v u 0 -a
|
* -w v -u 0 a
|
||||||
* -d c -b a 0
|
* d -c b -a 0
|
||||||
* This scheme behaves exactly as expected for SO(2) and SO(3).
|
* This scheme behaves exactly as expected for SO(2) and SO(3).
|
||||||
*/
|
*/
|
||||||
static MatrixNN Hat(const TangentVector& xi);
|
static MatrixNN Hat(const TangentVector& xi);
|
||||||
|
|
|
@ -10,17 +10,18 @@
|
||||||
* -------------------------------------------------------------------------- */
|
* -------------------------------------------------------------------------- */
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* @file testCal3Fisheye.cpp
|
* @file testCal3DFisheye.cpp
|
||||||
* @brief Unit tests for fisheye calibration class
|
* @brief Unit tests for fisheye calibration class
|
||||||
* @author ghaggin
|
* @author ghaggin
|
||||||
*/
|
*/
|
||||||
|
|
||||||
#include <CppUnitLite/TestHarness.h>
|
|
||||||
#include <gtsam/base/Testable.h>
|
#include <gtsam/base/Testable.h>
|
||||||
#include <gtsam/base/numericalDerivative.h>
|
#include <gtsam/base/numericalDerivative.h>
|
||||||
#include <gtsam/geometry/Cal3Fisheye.h>
|
#include <gtsam/geometry/Cal3Fisheye.h>
|
||||||
#include <gtsam/geometry/Point3.h>
|
#include <gtsam/geometry/Point3.h>
|
||||||
|
|
||||||
|
#include <CppUnitLite/TestHarness.h>
|
||||||
|
|
||||||
using namespace gtsam;
|
using namespace gtsam;
|
||||||
|
|
||||||
GTSAM_CONCEPT_TESTABLE_INST(Cal3Fisheye)
|
GTSAM_CONCEPT_TESTABLE_INST(Cal3Fisheye)
|
||||||
|
@ -30,12 +31,27 @@ static const double fx = 250, fy = 260, s = 0.1, u0 = 320, v0 = 240;
|
||||||
static Cal3Fisheye K(fx, fy, s, u0, v0, -0.013721808247486035,
|
static Cal3Fisheye K(fx, fy, s, u0, v0, -0.013721808247486035,
|
||||||
0.020727425669427896, -0.012786476702685545,
|
0.020727425669427896, -0.012786476702685545,
|
||||||
0.0025242267320687625);
|
0.0025242267320687625);
|
||||||
static Point2 p(2, 3);
|
static Point2 kTestPoint2(2, 3);
|
||||||
|
|
||||||
|
/* ************************************************************************* */
|
||||||
|
TEST(Cal3Fisheye, assert_equal) { CHECK(assert_equal(K, K, 1e-5)); }
|
||||||
|
|
||||||
|
/* ************************************************************************* */
|
||||||
|
TEST(Cal3Fisheye, retract) {
|
||||||
|
Cal3Fisheye expected(K.fx() + 1, K.fy() + 2, K.skew() + 3, K.px() + 4,
|
||||||
|
K.py() + 5, K.k1() + 6, K.k2() + 7, K.k3() + 8,
|
||||||
|
K.k4() + 9);
|
||||||
|
Vector d(9);
|
||||||
|
d << 1, 2, 3, 4, 5, 6, 7, 8, 9;
|
||||||
|
Cal3Fisheye actual = K.retract(d);
|
||||||
|
CHECK(assert_equal(expected, actual, 1e-7));
|
||||||
|
CHECK(assert_equal(d, K.localCoordinates(actual), 1e-7));
|
||||||
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
TEST(Cal3Fisheye, uncalibrate1) {
|
TEST(Cal3Fisheye, uncalibrate1) {
|
||||||
// Calculate the solution
|
// Calculate the solution
|
||||||
const double xi = p.x(), yi = p.y();
|
const double xi = kTestPoint2.x(), yi = kTestPoint2.y();
|
||||||
const double r = sqrt(xi * xi + yi * yi);
|
const double r = sqrt(xi * xi + yi * yi);
|
||||||
const double t = atan(r);
|
const double t = atan(r);
|
||||||
const double tt = t * t, t4 = tt * tt, t6 = tt * t4, t8 = t4 * t4;
|
const double tt = t * t, t4 = tt * tt, t6 = tt * t4, t8 = t4 * t4;
|
||||||
|
@ -46,32 +62,42 @@ TEST(Cal3Fisheye, uncalibrate1) {
|
||||||
|
|
||||||
Point2 uv_sol(v[0] / v[2], v[1] / v[2]);
|
Point2 uv_sol(v[0] / v[2], v[1] / v[2]);
|
||||||
|
|
||||||
Point2 uv = K.uncalibrate(p);
|
Point2 uv = K.uncalibrate(kTestPoint2);
|
||||||
CHECK(assert_equal(uv, uv_sol));
|
CHECK(assert_equal(uv, uv_sol));
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
/**
|
// For numerical derivatives
|
||||||
* Check that a point at (0,0) projects to the
|
Point2 f(const Cal3Fisheye& k, const Point2& pt) { return k.uncalibrate(pt); }
|
||||||
* image center.
|
|
||||||
*/
|
/* ************************************************************************* */
|
||||||
TEST(Cal3Fisheye, uncalibrate2) {
|
TEST(Cal3Fisheye, Derivatives) {
|
||||||
Point2 pz(0, 0);
|
Matrix H1, H2;
|
||||||
auto uv = K.uncalibrate(pz);
|
K.uncalibrate(kTestPoint2, H1, H2);
|
||||||
CHECK(assert_equal(uv, Point2(u0, v0)));
|
CHECK(assert_equal(numericalDerivative21(f, K, kTestPoint2, 1e-7), H1, 1e-5));
|
||||||
|
CHECK(assert_equal(numericalDerivative22(f, K, kTestPoint2, 1e-7), H2, 1e-5));
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
/**
|
// Check that a point at (0,0) projects to the image center.
|
||||||
* This test uses cv2::fisheye::projectPoints to test that uncalibrate
|
TEST(Cal3Fisheye, uncalibrate2) {
|
||||||
* properly projects a point into the image plane. One notable difference
|
Point2 pz(0, 0);
|
||||||
* between opencv and the Cal3Fisheye::uncalibrate function is the skew
|
Matrix H1, H2;
|
||||||
* parameter. The equivalence is alpha = s/fx.
|
auto uv = K.uncalibrate(pz, H1, H2);
|
||||||
*
|
CHECK(assert_equal(uv, Point2(u0, v0)));
|
||||||
*
|
CHECK(assert_equal(numericalDerivative21(f, K, pz, 1e-7), H1, 1e-5));
|
||||||
* Python script to project points with fisheye model in OpenCv
|
// TODO(frank): the second jacobian is all NaN for the image center!
|
||||||
* (script run with OpenCv version 4.2.0 and Numpy version 1.18.2)
|
// CHECK(assert_equal(numericalDerivative22(f, K, pz, 1e-7), H2, 1e-5));
|
||||||
*/
|
}
|
||||||
|
|
||||||
|
/* ************************************************************************* */
|
||||||
|
// This test uses cv2::fisheye::projectPoints to test that uncalibrate
|
||||||
|
// properly projects a point into the image plane. One notable difference
|
||||||
|
// between opencv and the Cal3Fisheye::uncalibrate function is the skew
|
||||||
|
// parameter. The equivalence is alpha = s/fx.
|
||||||
|
//
|
||||||
|
// Python script to project points with fisheye model in OpenCv
|
||||||
|
// (script run with OpenCv version 4.2.0 and Numpy version 1.18.2)
|
||||||
// clang-format off
|
// clang-format off
|
||||||
/*
|
/*
|
||||||
===========================================================
|
===========================================================
|
||||||
|
@ -94,6 +120,7 @@ tvec = np.float64([[0.,0.,0.]]);
|
||||||
imagePoints, jacobian = cv2.fisheye.projectPoints(objpts, rvec, tvec, cameraMatrix, distCoeffs, alpha=alpha)
|
imagePoints, jacobian = cv2.fisheye.projectPoints(objpts, rvec, tvec, cameraMatrix, distCoeffs, alpha=alpha)
|
||||||
np.set_printoptions(precision=14)
|
np.set_printoptions(precision=14)
|
||||||
print(imagePoints)
|
print(imagePoints)
|
||||||
|
|
||||||
===========================================================
|
===========================================================
|
||||||
* Script output: [[[457.82638130304935 408.18905848512986]]]
|
* Script output: [[[457.82638130304935 408.18905848512986]]]
|
||||||
*/
|
*/
|
||||||
|
@ -134,21 +161,18 @@ TEST(Cal3Fisheye, calibrate1) {
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
/**
|
// Check that calibrate returns (0,0) for the image center
|
||||||
* Check that calibrate returns (0,0) for the image center
|
|
||||||
*/
|
|
||||||
TEST(Cal3Fisheye, calibrate2) {
|
TEST(Cal3Fisheye, calibrate2) {
|
||||||
Point2 uv(u0, v0);
|
Point2 uv(u0, v0);
|
||||||
auto xi_hat = K.calibrate(uv);
|
auto xi_hat = K.calibrate(uv);
|
||||||
CHECK(assert_equal(xi_hat, Point2(0, 0)))
|
CHECK(assert_equal(xi_hat, Point2(0, 0)))
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/* ************************************************************************* */
|
||||||
* Run calibrate on OpenCv test from uncalibrate3
|
// Run calibrate on OpenCv test from uncalibrate3
|
||||||
* (script shown above)
|
// (script shown above)
|
||||||
* 3d point: (23, 27, 31)
|
// 3d point: (23, 27, 31)
|
||||||
* 2d point in image plane: (457.82638130304935, 408.18905848512986)
|
// 2d point in image plane: (457.82638130304935, 408.18905848512986)
|
||||||
*/
|
|
||||||
TEST(Cal3Fisheye, calibrate3) {
|
TEST(Cal3Fisheye, calibrate3) {
|
||||||
Point3 p3(23, 27, 31);
|
Point3 p3(23, 27, 31);
|
||||||
Point2 xi(p3.x() / p3.z(), p3.y() / p3.z());
|
Point2 xi(p3.x() / p3.z(), p3.y() / p3.z());
|
||||||
|
@ -157,47 +181,6 @@ TEST(Cal3Fisheye, calibrate3) {
|
||||||
CHECK(assert_equal(xi_hat, xi));
|
CHECK(assert_equal(xi_hat, xi));
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
|
||||||
// For numerical derivatives
|
|
||||||
Point2 uncalibrate_(const Cal3Fisheye& k, const Point2& pt) {
|
|
||||||
return k.uncalibrate(pt);
|
|
||||||
}
|
|
||||||
|
|
||||||
/* ************************************************************************* */
|
|
||||||
TEST(Cal3Fisheye, Duncalibrate1) {
|
|
||||||
Matrix computed;
|
|
||||||
K.uncalibrate(p, computed, boost::none);
|
|
||||||
Matrix numerical = numericalDerivative21(uncalibrate_, K, p, 1e-7);
|
|
||||||
CHECK(assert_equal(numerical, computed, 1e-5));
|
|
||||||
Matrix separate = K.D2d_calibration(p);
|
|
||||||
CHECK(assert_equal(numerical, separate, 1e-5));
|
|
||||||
}
|
|
||||||
|
|
||||||
/* ************************************************************************* */
|
|
||||||
TEST(Cal3Fisheye, Duncalibrate2) {
|
|
||||||
Matrix computed;
|
|
||||||
K.uncalibrate(p, boost::none, computed);
|
|
||||||
Matrix numerical = numericalDerivative22(uncalibrate_, K, p, 1e-7);
|
|
||||||
CHECK(assert_equal(numerical, computed, 1e-5));
|
|
||||||
Matrix separate = K.D2d_intrinsic(p);
|
|
||||||
CHECK(assert_equal(numerical, separate, 1e-5));
|
|
||||||
}
|
|
||||||
|
|
||||||
/* ************************************************************************* */
|
|
||||||
TEST(Cal3Fisheye, assert_equal) { CHECK(assert_equal(K, K, 1e-5)); }
|
|
||||||
|
|
||||||
/* ************************************************************************* */
|
|
||||||
TEST(Cal3Fisheye, retract) {
|
|
||||||
Cal3Fisheye expected(K.fx() + 1, K.fy() + 2, K.skew() + 3, K.px() + 4,
|
|
||||||
K.py() + 5, K.k1() + 6, K.k2() + 7, K.k3() + 8,
|
|
||||||
K.k4() + 9);
|
|
||||||
Vector d(9);
|
|
||||||
d << 1, 2, 3, 4, 5, 6, 7, 8, 9;
|
|
||||||
Cal3Fisheye actual = K.retract(d);
|
|
||||||
CHECK(assert_equal(expected, actual, 1e-7));
|
|
||||||
CHECK(assert_equal(d, K.localCoordinates(actual), 1e-7));
|
|
||||||
}
|
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
int main() {
|
int main() {
|
||||||
TestResult tr;
|
TestResult tr;
|
||||||
|
|
|
@ -181,63 +181,81 @@ TEST( Rot3, retract)
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
TEST(Rot3, log)
|
TEST(Rot3, log) {
|
||||||
{
|
|
||||||
static const double PI = boost::math::constants::pi<double>();
|
static const double PI = boost::math::constants::pi<double>();
|
||||||
Vector w;
|
Vector w;
|
||||||
Rot3 R;
|
Rot3 R;
|
||||||
|
|
||||||
#define CHECK_OMEGA(X,Y,Z) \
|
#define CHECK_OMEGA(X, Y, Z) \
|
||||||
w = (Vector(3) << (double)X, (double)Y, double(Z)).finished(); \
|
w = (Vector(3) << X, Y, Z).finished(); \
|
||||||
R = Rot3::Rodrigues(w); \
|
R = Rot3::Rodrigues(w); \
|
||||||
EXPECT(assert_equal(w, Rot3::Logmap(R),1e-12));
|
EXPECT(assert_equal(w, Rot3::Logmap(R), 1e-12));
|
||||||
|
|
||||||
// Check zero
|
// Check zero
|
||||||
CHECK_OMEGA( 0, 0, 0)
|
CHECK_OMEGA(0, 0, 0)
|
||||||
|
|
||||||
// create a random direction:
|
// create a random direction:
|
||||||
double norm=sqrt(1.0+16.0+4.0);
|
double norm = sqrt(1.0 + 16.0 + 4.0);
|
||||||
double x=1.0/norm, y=4.0/norm, z=2.0/norm;
|
double x = 1.0 / norm, y = 4.0 / norm, z = 2.0 / norm;
|
||||||
|
|
||||||
// Check very small rotation for Taylor expansion
|
// Check very small rotation for Taylor expansion
|
||||||
// Note that tolerance above is 1e-12, so Taylor is pretty good !
|
// Note that tolerance above is 1e-12, so Taylor is pretty good !
|
||||||
double d = 0.0001;
|
double d = 0.0001;
|
||||||
CHECK_OMEGA( d, 0, 0)
|
CHECK_OMEGA(d, 0, 0)
|
||||||
CHECK_OMEGA( 0, d, 0)
|
CHECK_OMEGA(0, d, 0)
|
||||||
CHECK_OMEGA( 0, 0, d)
|
CHECK_OMEGA(0, 0, d)
|
||||||
CHECK_OMEGA(x*d, y*d, z*d)
|
CHECK_OMEGA(x * d, y * d, z * d)
|
||||||
|
|
||||||
// check normal rotation
|
// check normal rotation
|
||||||
d = 0.1;
|
d = 0.1;
|
||||||
CHECK_OMEGA( d, 0, 0)
|
CHECK_OMEGA(d, 0, 0)
|
||||||
CHECK_OMEGA( 0, d, 0)
|
CHECK_OMEGA(0, d, 0)
|
||||||
CHECK_OMEGA( 0, 0, d)
|
CHECK_OMEGA(0, 0, d)
|
||||||
CHECK_OMEGA(x*d, y*d, z*d)
|
CHECK_OMEGA(x * d, y * d, z * d)
|
||||||
|
|
||||||
// Check 180 degree rotations
|
// Check 180 degree rotations
|
||||||
CHECK_OMEGA( PI, 0, 0)
|
CHECK_OMEGA(PI, 0, 0)
|
||||||
CHECK_OMEGA( 0, PI, 0)
|
CHECK_OMEGA(0, PI, 0)
|
||||||
CHECK_OMEGA( 0, 0, PI)
|
CHECK_OMEGA(0, 0, PI)
|
||||||
|
|
||||||
// Windows and Linux have flipped sign in quaternion mode
|
// Windows and Linux have flipped sign in quaternion mode
|
||||||
#if !defined(__APPLE__) && defined (GTSAM_USE_QUATERNIONS)
|
#if !defined(__APPLE__) && defined(GTSAM_USE_QUATERNIONS)
|
||||||
w = (Vector(3) << x*PI, y*PI, z*PI).finished();
|
w = (Vector(3) << x * PI, y * PI, z * PI).finished();
|
||||||
R = Rot3::Rodrigues(w);
|
R = Rot3::Rodrigues(w);
|
||||||
EXPECT(assert_equal(Vector(-w), Rot3::Logmap(R),1e-12));
|
EXPECT(assert_equal(Vector(-w), Rot3::Logmap(R), 1e-12));
|
||||||
#else
|
#else
|
||||||
CHECK_OMEGA(x*PI,y*PI,z*PI)
|
CHECK_OMEGA(x * PI, y * PI, z * PI)
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
// Check 360 degree rotations
|
// Check 360 degree rotations
|
||||||
#define CHECK_OMEGA_ZERO(X,Y,Z) \
|
#define CHECK_OMEGA_ZERO(X, Y, Z) \
|
||||||
w = (Vector(3) << (double)X, (double)Y, double(Z)).finished(); \
|
w = (Vector(3) << X, Y, Z).finished(); \
|
||||||
R = Rot3::Rodrigues(w); \
|
R = Rot3::Rodrigues(w); \
|
||||||
EXPECT(assert_equal((Vector) Z_3x1, Rot3::Logmap(R)));
|
EXPECT(assert_equal((Vector)Z_3x1, Rot3::Logmap(R)));
|
||||||
|
|
||||||
CHECK_OMEGA_ZERO( 2.0*PI, 0, 0)
|
CHECK_OMEGA_ZERO(2.0 * PI, 0, 0)
|
||||||
CHECK_OMEGA_ZERO( 0, 2.0*PI, 0)
|
CHECK_OMEGA_ZERO(0, 2.0 * PI, 0)
|
||||||
CHECK_OMEGA_ZERO( 0, 0, 2.0*PI)
|
CHECK_OMEGA_ZERO(0, 0, 2.0 * PI)
|
||||||
CHECK_OMEGA_ZERO(x*2.*PI,y*2.*PI,z*2.*PI)
|
CHECK_OMEGA_ZERO(x * 2. * PI, y * 2. * PI, z * 2. * PI)
|
||||||
|
|
||||||
|
// Check problematic case from Lund dataset vercingetorix.g2o
|
||||||
|
// This is an almost rotation with determinant not *quite* 1.
|
||||||
|
Rot3 Rlund(-0.98582676, -0.03958746, -0.16303092, //
|
||||||
|
-0.03997006, -0.88835923, 0.45740671, //
|
||||||
|
-0.16293753, 0.45743998, 0.87418537);
|
||||||
|
|
||||||
|
// Rot3's Logmap returns different, but equivalent compacted
|
||||||
|
// axis-angle vectors depending on whether Rot3 is implemented
|
||||||
|
// by Quaternions or SO3.
|
||||||
|
#if defined(GTSAM_USE_QUATERNIONS)
|
||||||
|
// Quaternion bounds angle to [-pi, pi] resulting in ~179.9 degrees
|
||||||
|
EXPECT(assert_equal(Vector3(0.264451979, -0.742197651, -3.04098211),
|
||||||
|
(Vector)Rot3::Logmap(Rlund), 1e-8));
|
||||||
|
#else
|
||||||
|
// SO3 does not bound angle resulting in ~180.1 degrees
|
||||||
|
EXPECT(assert_equal(Vector3(-0.264544406, 0.742217405, 3.04117314),
|
||||||
|
(Vector)Rot3::Logmap(Rlund), 1e-8));
|
||||||
|
#endif
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
|
@ -536,16 +554,15 @@ TEST( Rot3, logmapStability ) {
|
||||||
TEST(Rot3, quaternion) {
|
TEST(Rot3, quaternion) {
|
||||||
// NOTE: This is also verifying the ability to convert Vector to Quaternion
|
// NOTE: This is also verifying the ability to convert Vector to Quaternion
|
||||||
Quaternion q1(0.710997408193224, 0.360544029310185, 0.594459869568306, 0.105395217842782);
|
Quaternion q1(0.710997408193224, 0.360544029310185, 0.594459869568306, 0.105395217842782);
|
||||||
Rot3 R1 = Rot3((Matrix)(Matrix(3, 3) <<
|
Rot3 R1(0.271018623057411, 0.278786459830371, 0.921318086098018,
|
||||||
0.271018623057411, 0.278786459830371, 0.921318086098018,
|
|
||||||
0.578529366719085, 0.717799701969298, -0.387385285854279,
|
0.578529366719085, 0.717799701969298, -0.387385285854279,
|
||||||
-0.769319620053772, 0.637998195662053, 0.033250932803219).finished());
|
-0.769319620053772, 0.637998195662053, 0.033250932803219);
|
||||||
|
|
||||||
Quaternion q2(0.263360579192421, 0.571813128030932, 0.494678363680335, 0.599136268678053);
|
Quaternion q2(0.263360579192421, 0.571813128030932, 0.494678363680335,
|
||||||
Rot3 R2 = Rot3((Matrix)(Matrix(3, 3) <<
|
0.599136268678053);
|
||||||
-0.207341903877828, 0.250149415542075, 0.945745528564780,
|
Rot3 R2(-0.207341903877828, 0.250149415542075, 0.945745528564780,
|
||||||
0.881304914479026, -0.371869043667957, 0.291573424846290,
|
0.881304914479026, -0.371869043667957, 0.291573424846290,
|
||||||
0.424630407073532, 0.893945571198514, -0.143353873763946).finished());
|
0.424630407073532, 0.893945571198514, -0.143353873763946);
|
||||||
|
|
||||||
// Check creating Rot3 from quaternion
|
// Check creating Rot3 from quaternion
|
||||||
EXPECT(assert_equal(R1, Rot3(q1)));
|
EXPECT(assert_equal(R1, Rot3(q1)));
|
||||||
|
|
|
@ -46,7 +46,7 @@ TEST(SOn, SO0) {
|
||||||
EXPECT_LONGS_EQUAL(Eigen::Dynamic, SOn::dimension);
|
EXPECT_LONGS_EQUAL(Eigen::Dynamic, SOn::dimension);
|
||||||
EXPECT_LONGS_EQUAL(Eigen::Dynamic, SOn::Dim());
|
EXPECT_LONGS_EQUAL(Eigen::Dynamic, SOn::Dim());
|
||||||
EXPECT_LONGS_EQUAL(0, R.dim());
|
EXPECT_LONGS_EQUAL(0, R.dim());
|
||||||
EXPECT_LONGS_EQUAL(-1, traits<SOn>::GetDimension(R));
|
EXPECT_LONGS_EQUAL(0, traits<SOn>::GetDimension(R));
|
||||||
}
|
}
|
||||||
|
|
||||||
//******************************************************************************
|
//******************************************************************************
|
||||||
|
@ -56,7 +56,7 @@ TEST(SOn, SO5) {
|
||||||
EXPECT_LONGS_EQUAL(Eigen::Dynamic, SOn::dimension);
|
EXPECT_LONGS_EQUAL(Eigen::Dynamic, SOn::dimension);
|
||||||
EXPECT_LONGS_EQUAL(Eigen::Dynamic, SOn::Dim());
|
EXPECT_LONGS_EQUAL(Eigen::Dynamic, SOn::Dim());
|
||||||
EXPECT_LONGS_EQUAL(10, R.dim());
|
EXPECT_LONGS_EQUAL(10, R.dim());
|
||||||
EXPECT_LONGS_EQUAL(-1, traits<SOn>::GetDimension(R));
|
EXPECT_LONGS_EQUAL(10, traits<SOn>::GetDimension(R));
|
||||||
}
|
}
|
||||||
|
|
||||||
//******************************************************************************
|
//******************************************************************************
|
||||||
|
@ -95,32 +95,42 @@ TEST(SOn, Random) {
|
||||||
|
|
||||||
//******************************************************************************
|
//******************************************************************************
|
||||||
TEST(SOn, HatVee) {
|
TEST(SOn, HatVee) {
|
||||||
Vector6 v;
|
Vector10 v;
|
||||||
v << 1, 2, 3, 4, 5, 6;
|
v << 1, 2, 3, 4, 5, 6, 7, 8, 9, 10;
|
||||||
|
|
||||||
Matrix expected2(2, 2);
|
Matrix expected2(2, 2);
|
||||||
expected2 << 0, -1, 1, 0;
|
expected2 << 0, -1, 1, 0;
|
||||||
const auto actual2 = SOn::Hat(v.head<1>());
|
const auto actual2 = SOn::Hat(v.head<1>());
|
||||||
CHECK(assert_equal(expected2, actual2));
|
EXPECT(assert_equal(expected2, actual2));
|
||||||
CHECK(assert_equal((Vector)v.head<1>(), SOn::Vee(actual2)));
|
EXPECT(assert_equal((Vector)v.head<1>(), SOn::Vee(actual2)));
|
||||||
|
|
||||||
Matrix expected3(3, 3);
|
Matrix expected3(3, 3);
|
||||||
expected3 << 0, -3, 2, //
|
expected3 << 0, -3, 2, //
|
||||||
3, 0, -1, //
|
3, 0, -1, //
|
||||||
-2, 1, 0;
|
-2, 1, 0;
|
||||||
const auto actual3 = SOn::Hat(v.head<3>());
|
const auto actual3 = SOn::Hat(v.head<3>());
|
||||||
CHECK(assert_equal(expected3, actual3));
|
EXPECT(assert_equal(expected3, actual3));
|
||||||
CHECK(assert_equal(skewSymmetric(1, 2, 3), actual3));
|
EXPECT(assert_equal(skewSymmetric(1, 2, 3), actual3));
|
||||||
CHECK(assert_equal((Vector)v.head<3>(), SOn::Vee(actual3)));
|
EXPECT(assert_equal((Vector)v.head<3>(), SOn::Vee(actual3)));
|
||||||
|
|
||||||
Matrix expected4(4, 4);
|
Matrix expected4(4, 4);
|
||||||
expected4 << 0, -6, 5, -3, //
|
expected4 << 0, -6, 5, 3, //
|
||||||
6, 0, -4, 2, //
|
6, 0, -4, -2, //
|
||||||
-5, 4, 0, -1, //
|
-5, 4, 0, 1, //
|
||||||
3, -2, 1, 0;
|
-3, 2, -1, 0;
|
||||||
const auto actual4 = SOn::Hat(v);
|
const auto actual4 = SOn::Hat(v.head<6>());
|
||||||
CHECK(assert_equal(expected4, actual4));
|
EXPECT(assert_equal(expected4, actual4));
|
||||||
CHECK(assert_equal((Vector)v, SOn::Vee(actual4)));
|
EXPECT(assert_equal((Vector)v.head<6>(), SOn::Vee(actual4)));
|
||||||
|
|
||||||
|
Matrix expected5(5, 5);
|
||||||
|
expected5 << 0,-10, 9, 7, -4, //
|
||||||
|
10, 0, -8, -6, 3, //
|
||||||
|
-9, 8, 0, 5, -2, //
|
||||||
|
-7, 6, -5, 0, 1, //
|
||||||
|
4, -3, 2, -1, 0;
|
||||||
|
const auto actual5 = SOn::Hat(v);
|
||||||
|
EXPECT(assert_equal(expected5, actual5));
|
||||||
|
EXPECT(assert_equal((Vector)v, SOn::Vee(actual5)));
|
||||||
}
|
}
|
||||||
|
|
||||||
//******************************************************************************
|
//******************************************************************************
|
||||||
|
|
|
@ -10,7 +10,11 @@
|
||||||
#include <gtsam/geometry/CameraSet.h>
|
#include <gtsam/geometry/CameraSet.h>
|
||||||
#include <gtsam/linear/JacobianFactor.h>
|
#include <gtsam/linear/JacobianFactor.h>
|
||||||
#include <gtsam/linear/VectorValues.h>
|
#include <gtsam/linear/VectorValues.h>
|
||||||
|
|
||||||
#include <iosfwd>
|
#include <iosfwd>
|
||||||
|
#include <map>
|
||||||
|
#include <string>
|
||||||
|
#include <vector>
|
||||||
|
|
||||||
namespace gtsam {
|
namespace gtsam {
|
||||||
|
|
||||||
|
@ -76,7 +80,7 @@ public:
|
||||||
|
|
||||||
/// print
|
/// print
|
||||||
void print(const std::string& s = "", const KeyFormatter& keyFormatter =
|
void print(const std::string& s = "", const KeyFormatter& keyFormatter =
|
||||||
DefaultKeyFormatter) const {
|
DefaultKeyFormatter) const override {
|
||||||
std::cout << " RegularImplicitSchurFactor " << std::endl;
|
std::cout << " RegularImplicitSchurFactor " << std::endl;
|
||||||
Factor::print(s);
|
Factor::print(s);
|
||||||
for (size_t pos = 0; pos < size(); ++pos) {
|
for (size_t pos = 0; pos < size(); ++pos) {
|
||||||
|
@ -88,7 +92,7 @@ public:
|
||||||
}
|
}
|
||||||
|
|
||||||
/// equals
|
/// equals
|
||||||
bool equals(const GaussianFactor& lf, double tol) const {
|
bool equals(const GaussianFactor& lf, double tol) const override {
|
||||||
const This* f = dynamic_cast<const This*>(&lf);
|
const This* f = dynamic_cast<const This*>(&lf);
|
||||||
if (!f)
|
if (!f)
|
||||||
return false;
|
return false;
|
||||||
|
@ -104,37 +108,36 @@ public:
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Degrees of freedom of camera
|
/// Degrees of freedom of camera
|
||||||
virtual DenseIndex getDim(const_iterator variable) const {
|
DenseIndex getDim(const_iterator variable) const override {
|
||||||
return D;
|
return D;
|
||||||
}
|
}
|
||||||
|
|
||||||
virtual void updateHessian(const KeyVector& keys,
|
void updateHessian(const KeyVector& keys,
|
||||||
SymmetricBlockMatrix* info) const {
|
SymmetricBlockMatrix* info) const override {
|
||||||
throw std::runtime_error(
|
throw std::runtime_error(
|
||||||
"RegularImplicitSchurFactor::updateHessian non implemented");
|
"RegularImplicitSchurFactor::updateHessian non implemented");
|
||||||
}
|
}
|
||||||
virtual Matrix augmentedJacobian() const {
|
Matrix augmentedJacobian() const override {
|
||||||
throw std::runtime_error(
|
throw std::runtime_error(
|
||||||
"RegularImplicitSchurFactor::augmentedJacobian non implemented");
|
"RegularImplicitSchurFactor::augmentedJacobian non implemented");
|
||||||
return Matrix();
|
return Matrix();
|
||||||
}
|
}
|
||||||
virtual std::pair<Matrix, Vector> jacobian() const {
|
std::pair<Matrix, Vector> jacobian() const override {
|
||||||
throw std::runtime_error(
|
throw std::runtime_error(
|
||||||
"RegularImplicitSchurFactor::jacobian non implemented");
|
"RegularImplicitSchurFactor::jacobian non implemented");
|
||||||
return std::make_pair(Matrix(), Vector());
|
return std::make_pair(Matrix(), Vector());
|
||||||
}
|
}
|
||||||
|
|
||||||
/// *Compute* full augmented information matrix
|
/// *Compute* full augmented information matrix
|
||||||
virtual Matrix augmentedInformation() const {
|
Matrix augmentedInformation() const override {
|
||||||
|
|
||||||
// Do the Schur complement
|
// Do the Schur complement
|
||||||
SymmetricBlockMatrix augmentedHessian = //
|
SymmetricBlockMatrix augmentedHessian =
|
||||||
Set::SchurComplement(FBlocks_, E_, b_);
|
Set::SchurComplement(FBlocks_, E_, b_);
|
||||||
return augmentedHessian.selfadjointView();
|
return augmentedHessian.selfadjointView();
|
||||||
}
|
}
|
||||||
|
|
||||||
/// *Compute* full information matrix
|
/// *Compute* full information matrix
|
||||||
virtual Matrix information() const {
|
Matrix information() const override {
|
||||||
Matrix augmented = augmentedInformation();
|
Matrix augmented = augmentedInformation();
|
||||||
int m = this->keys_.size();
|
int m = this->keys_.size();
|
||||||
size_t M = D * m;
|
size_t M = D * m;
|
||||||
|
@ -145,7 +148,7 @@ public:
|
||||||
using GaussianFactor::hessianDiagonal;
|
using GaussianFactor::hessianDiagonal;
|
||||||
|
|
||||||
/// Add the diagonal of the Hessian for this factor to existing VectorValues
|
/// Add the diagonal of the Hessian for this factor to existing VectorValues
|
||||||
virtual void hessianDiagonalAdd(VectorValues &d) const override {
|
void hessianDiagonalAdd(VectorValues &d) const override {
|
||||||
// diag(Hessian) = diag(F' * (I - E * PointCov * E') * F);
|
// diag(Hessian) = diag(F' * (I - E * PointCov * E') * F);
|
||||||
for (size_t k = 0; k < size(); ++k) { // for each camera
|
for (size_t k = 0; k < size(); ++k) { // for each camera
|
||||||
Key j = keys_[k];
|
Key j = keys_[k];
|
||||||
|
@ -176,7 +179,7 @@ public:
|
||||||
* @brief add the contribution of this factor to the diagonal of the hessian
|
* @brief add the contribution of this factor to the diagonal of the hessian
|
||||||
* d(output) = d(input) + deltaHessianFactor
|
* d(output) = d(input) + deltaHessianFactor
|
||||||
*/
|
*/
|
||||||
virtual void hessianDiagonal(double* d) const {
|
void hessianDiagonal(double* d) const override {
|
||||||
// diag(Hessian) = diag(F' * (I - E * PointCov * E') * F);
|
// diag(Hessian) = diag(F' * (I - E * PointCov * E') * F);
|
||||||
// Use eigen magic to access raw memory
|
// Use eigen magic to access raw memory
|
||||||
typedef Eigen::Matrix<double, D, 1> DVector;
|
typedef Eigen::Matrix<double, D, 1> DVector;
|
||||||
|
@ -202,7 +205,7 @@ public:
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Return the block diagonal of the Hessian for this factor
|
/// Return the block diagonal of the Hessian for this factor
|
||||||
virtual std::map<Key, Matrix> hessianBlockDiagonal() const {
|
std::map<Key, Matrix> hessianBlockDiagonal() const override {
|
||||||
std::map<Key, Matrix> blocks;
|
std::map<Key, Matrix> blocks;
|
||||||
// F'*(I - E*P*E')*F
|
// F'*(I - E*P*E')*F
|
||||||
for (size_t pos = 0; pos < size(); ++pos) {
|
for (size_t pos = 0; pos < size(); ++pos) {
|
||||||
|
@ -227,17 +230,18 @@ public:
|
||||||
return blocks;
|
return blocks;
|
||||||
}
|
}
|
||||||
|
|
||||||
virtual GaussianFactor::shared_ptr clone() const {
|
GaussianFactor::shared_ptr clone() const override {
|
||||||
return boost::make_shared<RegularImplicitSchurFactor<CAMERA> >(keys_,
|
return boost::make_shared<RegularImplicitSchurFactor<CAMERA> >(keys_,
|
||||||
FBlocks_, PointCovariance_, E_, b_);
|
FBlocks_, PointCovariance_, E_, b_);
|
||||||
throw std::runtime_error(
|
throw std::runtime_error(
|
||||||
"RegularImplicitSchurFactor::clone non implemented");
|
"RegularImplicitSchurFactor::clone non implemented");
|
||||||
}
|
}
|
||||||
virtual bool empty() const {
|
|
||||||
|
bool empty() const override {
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
|
|
||||||
virtual GaussianFactor::shared_ptr negate() const {
|
GaussianFactor::shared_ptr negate() const override {
|
||||||
return boost::make_shared<RegularImplicitSchurFactor<CAMERA> >(keys_,
|
return boost::make_shared<RegularImplicitSchurFactor<CAMERA> >(keys_,
|
||||||
FBlocks_, PointCovariance_, E_, b_);
|
FBlocks_, PointCovariance_, E_, b_);
|
||||||
throw std::runtime_error(
|
throw std::runtime_error(
|
||||||
|
@ -288,7 +292,7 @@ public:
|
||||||
* f = nonlinear error
|
* f = nonlinear error
|
||||||
* (x'*H*x - 2*x'*eta + f) = x'*F'*Q*F*x - 2*x'*F'*Q *b + f = x'*F'*Q*(F*x - 2*b) + f
|
* (x'*H*x - 2*x'*eta + f) = x'*F'*Q*F*x - 2*x'*F'*Q *b + f = x'*F'*Q*(F*x - 2*b) + f
|
||||||
*/
|
*/
|
||||||
virtual double error(const VectorValues& x) const {
|
double error(const VectorValues& x) const override {
|
||||||
|
|
||||||
// resize does not do malloc if correct size
|
// resize does not do malloc if correct size
|
||||||
e1.resize(size());
|
e1.resize(size());
|
||||||
|
@ -383,13 +387,12 @@ public:
|
||||||
void multiplyHessianAdd(double alpha, const double* x, double* y,
|
void multiplyHessianAdd(double alpha, const double* x, double* y,
|
||||||
std::vector<size_t> keys) const {
|
std::vector<size_t> keys) const {
|
||||||
}
|
}
|
||||||
;
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* @brief Hessian-vector multiply, i.e. y += F'*alpha*(I - E*P*E')*F*x
|
* @brief Hessian-vector multiply, i.e. y += F'*alpha*(I - E*P*E')*F*x
|
||||||
*/
|
*/
|
||||||
void multiplyHessianAdd(double alpha, const VectorValues& x,
|
void multiplyHessianAdd(double alpha, const VectorValues& x,
|
||||||
VectorValues& y) const {
|
VectorValues& y) const override {
|
||||||
|
|
||||||
// resize does not do malloc if correct size
|
// resize does not do malloc if correct size
|
||||||
e1.resize(size());
|
e1.resize(size());
|
||||||
|
@ -432,7 +435,7 @@ public:
|
||||||
/**
|
/**
|
||||||
* Calculate gradient, which is -F'Q*b, see paper
|
* Calculate gradient, which is -F'Q*b, see paper
|
||||||
*/
|
*/
|
||||||
VectorValues gradientAtZero() const {
|
VectorValues gradientAtZero() const override {
|
||||||
// calculate Q*b
|
// calculate Q*b
|
||||||
e1.resize(size());
|
e1.resize(size());
|
||||||
e2.resize(size());
|
e2.resize(size());
|
||||||
|
@ -454,7 +457,7 @@ public:
|
||||||
/**
|
/**
|
||||||
* Calculate gradient, which is -F'Q*b, see paper - RAW MEMORY ACCESS
|
* Calculate gradient, which is -F'Q*b, see paper - RAW MEMORY ACCESS
|
||||||
*/
|
*/
|
||||||
virtual void gradientAtZero(double* d) const {
|
void gradientAtZero(double* d) const override {
|
||||||
|
|
||||||
// Use eigen magic to access raw memory
|
// Use eigen magic to access raw memory
|
||||||
typedef Eigen::Matrix<double, D, 1> DVector;
|
typedef Eigen::Matrix<double, D, 1> DVector;
|
||||||
|
@ -474,7 +477,7 @@ public:
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Gradient wrt a key at any values
|
/// Gradient wrt a key at any values
|
||||||
Vector gradient(Key key, const VectorValues& x) const {
|
Vector gradient(Key key, const VectorValues& x) const override {
|
||||||
throw std::runtime_error(
|
throw std::runtime_error(
|
||||||
"gradient for RegularImplicitSchurFactor is not implemented yet");
|
"gradient for RegularImplicitSchurFactor is not implemented yet");
|
||||||
}
|
}
|
||||||
|
|
|
@ -37,6 +37,7 @@
|
||||||
#include <boost/assign/list_inserter.hpp>
|
#include <boost/assign/list_inserter.hpp>
|
||||||
#include <boost/filesystem/operations.hpp>
|
#include <boost/filesystem/operations.hpp>
|
||||||
#include <boost/filesystem/path.hpp>
|
#include <boost/filesystem/path.hpp>
|
||||||
|
#include <boost/optional.hpp>
|
||||||
|
|
||||||
#include <cmath>
|
#include <cmath>
|
||||||
#include <fstream>
|
#include <fstream>
|
||||||
|
@ -541,10 +542,16 @@ std::map<Key, Pose3> parse3DPoses(const string& filename) {
|
||||||
}
|
}
|
||||||
|
|
||||||
/* ************************************************************************* */
|
/* ************************************************************************* */
|
||||||
BetweenFactorPose3s parse3DFactors(const string& filename) {
|
BetweenFactorPose3s parse3DFactors(const string& filename,
|
||||||
|
const noiseModel::Diagonal::shared_ptr& corruptingNoise) {
|
||||||
ifstream is(filename.c_str());
|
ifstream is(filename.c_str());
|
||||||
if (!is) throw invalid_argument("parse3DFactors: can not find file " + filename);
|
if (!is) throw invalid_argument("parse3DFactors: can not find file " + filename);
|
||||||
|
|
||||||
|
boost::optional<Sampler> sampler;
|
||||||
|
if (corruptingNoise) {
|
||||||
|
sampler = Sampler(corruptingNoise);
|
||||||
|
}
|
||||||
|
|
||||||
std::vector<BetweenFactor<Pose3>::shared_ptr> factors;
|
std::vector<BetweenFactor<Pose3>::shared_ptr> factors;
|
||||||
while (!is.eof()) {
|
while (!is.eof()) {
|
||||||
char buf[LINESIZE];
|
char buf[LINESIZE];
|
||||||
|
@ -585,8 +592,13 @@ BetweenFactorPose3s parse3DFactors(const string& filename) {
|
||||||
mgtsam.block<3, 3>(3, 0) = m.block<3, 3>(3, 0); // off diagonal
|
mgtsam.block<3, 3>(3, 0) = m.block<3, 3>(3, 0); // off diagonal
|
||||||
|
|
||||||
SharedNoiseModel model = noiseModel::Gaussian::Information(mgtsam);
|
SharedNoiseModel model = noiseModel::Gaussian::Information(mgtsam);
|
||||||
|
auto R12 = Rot3::Quaternion(qw, qx, qy, qz);
|
||||||
|
if (sampler) {
|
||||||
|
R12 = R12.retract(sampler->sample());
|
||||||
|
}
|
||||||
|
|
||||||
factors.emplace_back(new BetweenFactor<Pose3>(
|
factors.emplace_back(new BetweenFactor<Pose3>(
|
||||||
id1, id2, Pose3(Rot3::Quaternion(qw, qx, qy, qz), {x, y, z}), model));
|
id1, id2, Pose3(R12, {x, y, z}), model));
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return factors;
|
return factors;
|
||||||
|
|
|
@ -159,7 +159,8 @@ GTSAM_EXPORT void writeG2o(const NonlinearFactorGraph& graph,
|
||||||
|
|
||||||
/// Parse edges in 3D TORO graph file into a set of BetweenFactors.
|
/// Parse edges in 3D TORO graph file into a set of BetweenFactors.
|
||||||
using BetweenFactorPose3s = std::vector<gtsam::BetweenFactor<Pose3>::shared_ptr>;
|
using BetweenFactorPose3s = std::vector<gtsam::BetweenFactor<Pose3>::shared_ptr>;
|
||||||
GTSAM_EXPORT BetweenFactorPose3s parse3DFactors(const std::string& filename);
|
GTSAM_EXPORT BetweenFactorPose3s parse3DFactors(const std::string& filename,
|
||||||
|
const noiseModel::Diagonal::shared_ptr& corruptingNoise=nullptr);
|
||||||
|
|
||||||
/// Parse vertices in 3D TORO graph file into a map of Pose3s.
|
/// Parse vertices in 3D TORO graph file into a map of Pose3s.
|
||||||
GTSAM_EXPORT std::map<Key, Pose3> parse3DPoses(const std::string& filename);
|
GTSAM_EXPORT std::map<Key, Pose3> parse3DPoses(const std::string& filename);
|
||||||
|
|
|
@ -1,44 +0,0 @@
|
||||||
# How to build Debian and Ubuntu Packages
|
|
||||||
|
|
||||||
## Preparations
|
|
||||||
|
|
||||||
Packages must be signed with a GPG key. First have a look of the keys
|
|
||||||
you have available:
|
|
||||||
|
|
||||||
gpg --list-secret-keys
|
|
||||||
|
|
||||||
If you don't have one, create one, then list again.
|
|
||||||
|
|
||||||
Pick a secret key you like from the listed keys, for instance
|
|
||||||
"Your Name <your.email@yourprovider.com>". Then unlock that key by
|
|
||||||
signing a dummy file. The following line should pop up a window to
|
|
||||||
enter the passphrase:
|
|
||||||
|
|
||||||
echo | gpg --local-user "Your Name <your.email@yourprovider.com>" -s >/dev/null
|
|
||||||
|
|
||||||
Now you can run the below scripts. Without this step they will fail
|
|
||||||
with "No secret key" or similar messages.
|
|
||||||
|
|
||||||
## How to generate a Debian package
|
|
||||||
|
|
||||||
Run the package script, providing a name/email that matches your PGP key.
|
|
||||||
|
|
||||||
cd [GTSAM_SOURCE_ROOT]
|
|
||||||
bash package_scripts/prepare_debian.sh -e "Your Name <your.email@yourprovider.com>"
|
|
||||||
|
|
||||||
|
|
||||||
## How to generate Ubuntu packages for a PPA
|
|
||||||
|
|
||||||
Run the packaging script, passing the name of the gpg key
|
|
||||||
(see above) with the "-e" option:
|
|
||||||
|
|
||||||
cd [GTSAM_SOURCE_ROOT]
|
|
||||||
bash package_scripts/prepare_ubuntu_pkgs_for_ppa.sh -e "Your Name <your.email@yourprovider.com>"
|
|
||||||
|
|
||||||
Check that you have uploaded this key to the ubuntu key server, and
|
|
||||||
have added the key to your account.
|
|
||||||
|
|
||||||
Upload the package to your ppa:
|
|
||||||
|
|
||||||
cd ~/gtsam_ubuntu
|
|
||||||
bash [GTSAM_SOURCE_ROOT]/package_scripts/upload_all_gtsam_ppa.sh -p "ppa:your-name/ppa-name"
|
|
|
@ -1,8 +0,0 @@
|
||||||
#!/bin/sh
|
|
||||||
|
|
||||||
# Compile boost statically, with -fPIC to allow linking it into the mex
|
|
||||||
# module (which is a dynamic library). --disable-icu prevents depending
|
|
||||||
# on libicu, which is unneeded and would require then linking the mex
|
|
||||||
# module with it as well. We just stage instead of install, then the
|
|
||||||
# toolbox_package_unix.sh script uses the staged boost.
|
|
||||||
./b2 link=static threading=multi cxxflags=-fPIC cflags=-fPIC --disable-icu -a -j4 stage
|
|
|
@ -1,187 +0,0 @@
|
||||||
#!/bin/bash
|
|
||||||
# Prepare to build a Debian package.
|
|
||||||
# Jose Luis Blanco Claraco, 2019 (for GTSAM)
|
|
||||||
# Jose Luis Blanco Claraco, 2008-2018 (for MRPT)
|
|
||||||
|
|
||||||
set -e # end on error
|
|
||||||
#set -x # for debugging
|
|
||||||
|
|
||||||
APPEND_SNAPSHOT_NUM=0
|
|
||||||
IS_FOR_UBUNTU=0
|
|
||||||
APPEND_LINUX_DISTRO=""
|
|
||||||
VALUE_EXTRA_CMAKE_PARAMS=""
|
|
||||||
while getopts "sud:c:e:" OPTION
|
|
||||||
do
|
|
||||||
case $OPTION in
|
|
||||||
s)
|
|
||||||
APPEND_SNAPSHOT_NUM=1
|
|
||||||
;;
|
|
||||||
u)
|
|
||||||
IS_FOR_UBUNTU=1
|
|
||||||
;;
|
|
||||||
d)
|
|
||||||
APPEND_LINUX_DISTRO=$OPTARG
|
|
||||||
;;
|
|
||||||
c)
|
|
||||||
VALUE_EXTRA_CMAKE_PARAMS=$OPTARG
|
|
||||||
;;
|
|
||||||
e)
|
|
||||||
PACKAGER_EMAIL=$OPTARG
|
|
||||||
;;
|
|
||||||
?)
|
|
||||||
echo "Unknown command line argument!"
|
|
||||||
exit 1
|
|
||||||
;;
|
|
||||||
esac
|
|
||||||
done
|
|
||||||
|
|
||||||
if [ -z ${PACKAGER_EMAIL+x} ]; then
|
|
||||||
echo "must specify packager email via -e option!"
|
|
||||||
exit -1
|
|
||||||
fi
|
|
||||||
|
|
||||||
if [ -f CMakeLists.txt ];
|
|
||||||
then
|
|
||||||
source package_scripts/prepare_debian_gen_snapshot_version.sh
|
|
||||||
else
|
|
||||||
echo "Error: cannot find CMakeList.txt. This script is intended to be run from the root of the source tree."
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Append snapshot?
|
|
||||||
if [ $APPEND_SNAPSHOT_NUM == "1" ];
|
|
||||||
then
|
|
||||||
CUR_SCRIPT_DIR="$( cd "$( dirname "${BASH_SOURCE[0]}" )" && pwd )"
|
|
||||||
source $CUR_SCRIPT_DIR/prepare_debian_gen_snapshot_version.sh # populate GTSAM_SNAPSHOT_VERSION
|
|
||||||
|
|
||||||
GTSAM_VERSION_STR="${GTSAM_VERSION_STR}~snapshot${GTSAM_SNAPSHOT_VERSION}${APPEND_LINUX_DISTRO}"
|
|
||||||
else
|
|
||||||
GTSAM_VERSION_STR="${GTSAM_VERSION_STR}${APPEND_LINUX_DISTRO}"
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Call prepare_release
|
|
||||||
GTSAMSRC=`pwd`
|
|
||||||
|
|
||||||
if [ -f $HOME/gtsam_release/gtsam*.tar.gz ];
|
|
||||||
then
|
|
||||||
echo "## release file already exists. Reusing it."
|
|
||||||
else
|
|
||||||
source package_scripts/prepare_release.sh
|
|
||||||
echo
|
|
||||||
echo "## Done prepare_release.sh"
|
|
||||||
fi
|
|
||||||
|
|
||||||
echo "=========== Generating GTSAM ${GTSAM_VER_MMP} Debian package =============="
|
|
||||||
cd $GTSAMSRC
|
|
||||||
|
|
||||||
set -x
|
|
||||||
if [ -z "$GTSAM_DEB_DIR" ]; then
|
|
||||||
GTSAM_DEB_DIR="$HOME/gtsam_debian"
|
|
||||||
fi
|
|
||||||
GTSAM_EXTERN_DEBIAN_DIR="$GTSAMSRC/debian/"
|
|
||||||
GTSAM_EXTERN_UBUNTU_PPA_DIR="$GTSAMSRC/debian/"
|
|
||||||
|
|
||||||
if [ -f ${GTSAM_EXTERN_DEBIAN_DIR}/control ];
|
|
||||||
then
|
|
||||||
echo "Using debian dir: ${GTSAM_EXTERN_DEBIAN_DIR}"
|
|
||||||
else
|
|
||||||
echo "ERROR: Cannot find ${GTSAM_EXTERN_DEBIAN_DIR}"
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
GTSAM_DEBSRC_DIR=$GTSAM_DEB_DIR/gtsam-${GTSAM_VERSION_STR}
|
|
||||||
|
|
||||||
echo "GTSAM_VERSION_STR: ${GTSAM_VERSION_STR}"
|
|
||||||
echo "GTSAM_DEBSRC_DIR: ${GTSAM_DEBSRC_DIR}"
|
|
||||||
|
|
||||||
# Prepare a directory for building the debian package:
|
|
||||||
#
|
|
||||||
rm -fR $GTSAM_DEB_DIR || true
|
|
||||||
mkdir -p $GTSAM_DEB_DIR || true
|
|
||||||
|
|
||||||
# Orig tarball:
|
|
||||||
echo "Copying orig tarball: gtsam_${GTSAM_VERSION_STR}.orig.tar.gz"
|
|
||||||
cp $HOME/gtsam_release/gtsam*.tar.gz $GTSAM_DEB_DIR/gtsam_${GTSAM_VERSION_STR}.orig.tar.gz
|
|
||||||
cd ${GTSAM_DEB_DIR}
|
|
||||||
tar -xf gtsam_${GTSAM_VERSION_STR}.orig.tar.gz
|
|
||||||
|
|
||||||
if [ ! -d "${GTSAM_DEBSRC_DIR}" ];
|
|
||||||
then
|
|
||||||
mv gtsam-* ${GTSAM_DEBSRC_DIR} # fix different dir names for Ubuntu PPA packages
|
|
||||||
fi
|
|
||||||
|
|
||||||
if [ ! -f "${GTSAM_DEBSRC_DIR}/CMakeLists.txt" ];
|
|
||||||
then
|
|
||||||
echo "*ERROR*: Seems there was a problem copying sources to ${GTSAM_DEBSRC_DIR}... aborting script."
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
cd ${GTSAM_DEBSRC_DIR}
|
|
||||||
|
|
||||||
# Copy debian directory:
|
|
||||||
#mkdir debian
|
|
||||||
cp -r ${GTSAM_EXTERN_DEBIAN_DIR}/* debian
|
|
||||||
|
|
||||||
# Use modified control & rules files for Ubuntu PPA packages:
|
|
||||||
#if [ $IS_FOR_UBUNTU == "1" ];
|
|
||||||
#then
|
|
||||||
# already done: cp ${GTSAM_EXTERN_UBUNTU_PPA_DIR}/control.in debian/
|
|
||||||
# Ubuntu: force use of gcc-7:
|
|
||||||
#sed -i '9i\export CXX=/usr/bin/g++-7\' debian/rules
|
|
||||||
#sed -i '9i\export CC=/usr/bin/gcc-7\' debian/rules7
|
|
||||||
#fi
|
|
||||||
|
|
||||||
# Export signing pub key:
|
|
||||||
mkdir debian/upstream/
|
|
||||||
gpg --export --export-options export-minimal --armor > debian/upstream/signing-key.asc
|
|
||||||
|
|
||||||
# Parse debian/ control.in --> control
|
|
||||||
#mv debian/control.in debian/control
|
|
||||||
#sed -i "s/@GTSAM_VER_MM@/${GTSAM_VER_MM}/g" debian/control
|
|
||||||
|
|
||||||
# Replace the text "REPLACE_HERE_EXTRA_CMAKE_PARAMS" in the "debian/rules" file
|
|
||||||
# with: ${${VALUE_EXTRA_CMAKE_PARAMS}}
|
|
||||||
RULES_FILE=debian/rules
|
|
||||||
sed -i -e "s/REPLACE_HERE_EXTRA_CMAKE_PARAMS/${VALUE_EXTRA_CMAKE_PARAMS}/g" $RULES_FILE
|
|
||||||
echo "Using these extra parameters for CMake: '${VALUE_EXTRA_CMAKE_PARAMS}'"
|
|
||||||
|
|
||||||
# Strip my custom files...
|
|
||||||
rm debian/*.new || true
|
|
||||||
|
|
||||||
|
|
||||||
# Figure out the next Debian version number:
|
|
||||||
echo "Detecting next Debian version number..."
|
|
||||||
|
|
||||||
CHANGELOG_UPSTREAM_VER=$( dpkg-parsechangelog | sed -n 's/Version:.*\([0-9]\.[0-9]*\.[0-9]*.*snapshot.*\)-.*/\1/p' )
|
|
||||||
CHANGELOG_LAST_DEBIAN_VER=$( dpkg-parsechangelog | sed -n 's/Version:.*\([0-9]\.[0-9]*\.[0-9]*\).*-\([0-9]*\).*/\2/p' )
|
|
||||||
|
|
||||||
echo " -> PREVIOUS UPSTREAM: $CHANGELOG_UPSTREAM_VER -> New: ${GTSAM_VERSION_STR}"
|
|
||||||
echo " -> PREVIOUS DEBIAN VERSION: $CHANGELOG_LAST_DEBIAN_VER"
|
|
||||||
|
|
||||||
# If we have the same upstream versions, increase the Debian version, otherwise create a new entry:
|
|
||||||
if [ "$CHANGELOG_UPSTREAM_VER" = "$GTSAM_VERSION_STR" ];
|
|
||||||
then
|
|
||||||
NEW_DEBIAN_VER=$[$CHANGELOG_LAST_DEBIAN_VER + 1]
|
|
||||||
echo "Changing to a new Debian version: ${GTSAM_VERSION_STR}-${NEW_DEBIAN_VER}"
|
|
||||||
DEBCHANGE_CMD="--newversion ${GTSAM_VERSION_STR}-${NEW_DEBIAN_VER}"
|
|
||||||
else
|
|
||||||
DEBCHANGE_CMD="--newversion ${GTSAM_VERSION_STR}-1"
|
|
||||||
fi
|
|
||||||
|
|
||||||
echo "Adding a new entry to debian/changelog..."
|
|
||||||
|
|
||||||
DEBEMAIL=${PACKAGER_EMAIL} debchange $DEBCHANGE_CMD -b --distribution unstable --force-distribution New version of upstream sources.
|
|
||||||
|
|
||||||
echo "Copying back the new changelog to a temporary file in: ${GTSAM_EXTERN_DEBIAN_DIR}changelog.new"
|
|
||||||
cp debian/changelog ${GTSAM_EXTERN_DEBIAN_DIR}changelog.new
|
|
||||||
|
|
||||||
set +x
|
|
||||||
|
|
||||||
echo "=============================================================="
|
|
||||||
echo "Now, you can build the source Deb package with 'debuild -S -sa'"
|
|
||||||
echo "=============================================================="
|
|
||||||
|
|
||||||
cd ..
|
|
||||||
ls -lh
|
|
||||||
|
|
||||||
exit 0
|
|
|
@ -1,25 +0,0 @@
|
||||||
#!/bin/bash
|
|
||||||
|
|
||||||
# See https://reproducible-builds.org/specs/source-date-epoch/
|
|
||||||
# get SOURCE_DATE_EPOCH with UNIX time_t
|
|
||||||
if [ -d ".git" ];
|
|
||||||
then
|
|
||||||
SOURCE_DATE_EPOCH=$(git log -1 --pretty=%ct)
|
|
||||||
else
|
|
||||||
echo "Error: intended for use from within a git repository"
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
GTSAM_SNAPSHOT_VERSION=$(date -d @$SOURCE_DATE_EPOCH +%Y%m%d-%H%M)
|
|
||||||
|
|
||||||
GTSAM_SNAPSHOT_VERSION+="-git-"
|
|
||||||
GTSAM_SNAPSHOT_VERSION+=`git rev-parse --short=8 HEAD`
|
|
||||||
GTSAM_SNAPSHOT_VERSION+="-"
|
|
||||||
|
|
||||||
# x.y.z version components:
|
|
||||||
GTSAM_VERSION_MAJOR=$(grep "(GTSAM_VERSION_MAJOR" CMakeLists.txt | sed -r 's/^.*GTSAM_VERSION_MAJOR\s*([0-9])*.*$/\1/g')
|
|
||||||
GTSAM_VERSION_MINOR=$(grep "(GTSAM_VERSION_MINOR" CMakeLists.txt | sed -r 's/^.*GTSAM_VERSION_MINOR\s*([0-9])*.*$/\1/g')
|
|
||||||
GTSAM_VERSION_PATCH=$(grep "(GTSAM_VERSION_PATCH" CMakeLists.txt | sed -r 's/^.*GTSAM_VERSION_PATCH\s*([0-9])*.*$/\1/g')
|
|
||||||
|
|
||||||
GTSAM_VER_MM="${GTSAM_VERSION_MAJOR}.${GTSAM_VERSION_MINOR}"
|
|
||||||
GTSAM_VER_MMP="${GTSAM_VERSION_MAJOR}.${GTSAM_VERSION_MINOR}.${GTSAM_VERSION_PATCH}"
|
|
||||||
GTSAM_VERSION_STR=$GTSAM_VER_MMP
|
|
|
@ -1,71 +0,0 @@
|
||||||
#!/bin/bash
|
|
||||||
# Export sources from a git tree and prepare it for a public release.
|
|
||||||
# Jose Luis Blanco Claraco, 2019 (for GTSAM)
|
|
||||||
# Jose Luis Blanco Claraco, 2008-2018 (for MRPT)
|
|
||||||
|
|
||||||
set -e # exit on error
|
|
||||||
#set -x # for debugging
|
|
||||||
|
|
||||||
# Checks
|
|
||||||
# --------------------------------
|
|
||||||
if [ -f version_prefix.txt ];
|
|
||||||
then
|
|
||||||
if [ -z ${GTSAM_VERSION_STR+x} ];
|
|
||||||
then
|
|
||||||
source package_scripts/prepare_debian_gen_snapshot_version.sh
|
|
||||||
fi
|
|
||||||
echo "ERROR: Run this script from the GTSAM source tree root directory."
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
GTSAM_SRC=`pwd`
|
|
||||||
OUT_RELEASES_DIR="$HOME/gtsam_release"
|
|
||||||
|
|
||||||
OUT_DIR=$OUT_RELEASES_DIR/gtsam-${GTSAM_VERSION_STR}
|
|
||||||
|
|
||||||
echo "=========== Generating GTSAM release ${GTSAM_VER_MMP} =================="
|
|
||||||
echo "GTSAM_VERSION_STR : ${GTSAM_VERSION_STR}"
|
|
||||||
echo "OUT_DIR : ${OUT_DIR}"
|
|
||||||
echo "============================================================"
|
|
||||||
echo
|
|
||||||
|
|
||||||
# Prepare output directory:
|
|
||||||
rm -fR $OUT_RELEASES_DIR || true
|
|
||||||
mkdir -p ${OUT_DIR}
|
|
||||||
|
|
||||||
# Export / copy sources to target dir:
|
|
||||||
if [ -d "$GTSAM_SRC/.git" ];
|
|
||||||
then
|
|
||||||
echo "# Exporting git source tree to ${OUT_DIR}"
|
|
||||||
git archive --format=tar HEAD | tar -x -C ${OUT_DIR}
|
|
||||||
|
|
||||||
# Remove VCS control files:
|
|
||||||
find ${OUT_DIR} -name '.gitignore' | xargs rm
|
|
||||||
|
|
||||||
# Generate ./SOURCE_DATE_EPOCH with UNIX time_t
|
|
||||||
SOURCE_DATE_EPOCH=$(git log -1 --pretty=%ct)
|
|
||||||
else
|
|
||||||
echo "# Copying sources to ${OUT_DIR}"
|
|
||||||
cp -R . ${OUT_DIR}
|
|
||||||
|
|
||||||
# Generate ./SOURCE_DATE_EPOCH with UNIX time_t
|
|
||||||
SOURCE_DATE_EPOCH=$(date +%s)
|
|
||||||
fi
|
|
||||||
|
|
||||||
# See https://reproducible-builds.org/specs/source-date-epoch/
|
|
||||||
echo $SOURCE_DATE_EPOCH > ${OUT_DIR}/SOURCE_DATE_EPOCH
|
|
||||||
|
|
||||||
cd ${OUT_DIR}
|
|
||||||
|
|
||||||
# Dont include Debian files in releases:
|
|
||||||
rm -fR package_scripts
|
|
||||||
|
|
||||||
# Orig tarball:
|
|
||||||
cd ..
|
|
||||||
echo "# Creating orig tarball: gtsam-${GTSAM_VERSION_STR}.tar.gz"
|
|
||||||
tar czf gtsam-${GTSAM_VERSION_STR}.tar.gz gtsam-${GTSAM_VERSION_STR}
|
|
||||||
|
|
||||||
rm -fr gtsam-${GTSAM_VERSION_STR}
|
|
||||||
|
|
||||||
# GPG signature:
|
|
||||||
gpg --armor --detach-sign gtsam-${GTSAM_VERSION_STR}.tar.gz
|
|
|
@ -1,123 +0,0 @@
|
||||||
#!/bin/bash
|
|
||||||
# Creates a set of packages for each different Ubuntu distribution, with the
|
|
||||||
# intention of uploading them to a PPA on launchpad
|
|
||||||
#
|
|
||||||
# JLBC, 2010
|
|
||||||
# [Addition 2012:]
|
|
||||||
#
|
|
||||||
# You can declare a variable (in the caller shell) with extra flags for the
|
|
||||||
# CMake in the final ./configure like:
|
|
||||||
#
|
|
||||||
# GTSAM_PKG_CUSTOM_CMAKE_PARAMS="\"-DDISABLE_SSE3=ON\""
|
|
||||||
#
|
|
||||||
|
|
||||||
|
|
||||||
function show_help {
|
|
||||||
echo "USAGE:"
|
|
||||||
echo ""
|
|
||||||
echo "- to display this help: "
|
|
||||||
echo "prepare_ubuntu_packages_for_ppa.sh -h or -?"
|
|
||||||
echo ""
|
|
||||||
echo "- to package to your PPA: "
|
|
||||||
echo "prepare_ubuntu_packages_for_ppa.sh -e email_of_your_gpg_key"
|
|
||||||
echo ""
|
|
||||||
echo "to pass custom config for GTSAM, set the following"
|
|
||||||
echo "environment variable beforehand: "
|
|
||||||
echo ""
|
|
||||||
echo "GTSAM_PKG_CUSTOM_CMAKE_PARAMS=\"\"-DDISABLE_SSE3=ON\"\""
|
|
||||||
echo ""
|
|
||||||
}
|
|
||||||
|
|
||||||
while getopts "h?e:" opt; do
|
|
||||||
case "$opt" in
|
|
||||||
h|\?)
|
|
||||||
show_help
|
|
||||||
exit 0
|
|
||||||
;;
|
|
||||||
e) PACKAGER_EMAIL=$OPTARG
|
|
||||||
;;
|
|
||||||
esac
|
|
||||||
done
|
|
||||||
|
|
||||||
if [ -z ${PACKAGER_EMAIL+x} ]; then
|
|
||||||
show_help
|
|
||||||
exit -1
|
|
||||||
fi
|
|
||||||
|
|
||||||
|
|
||||||
set -e
|
|
||||||
|
|
||||||
# List of distributions to create PPA packages for:
|
|
||||||
LST_DISTROS=(xenial bionic eoan focal)
|
|
||||||
|
|
||||||
# Checks
|
|
||||||
# --------------------------------
|
|
||||||
if [ -f CMakeLists.txt ];
|
|
||||||
then
|
|
||||||
source package_scripts/prepare_debian_gen_snapshot_version.sh
|
|
||||||
echo "GTSAM version: ${GTSAM_VER_MMP}"
|
|
||||||
else
|
|
||||||
echo "ERROR: Run this script from the GTSAM root directory."
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
if [ -z "${gtsam_ubuntu_OUT_DIR}" ]; then
|
|
||||||
export gtsam_ubuntu_OUT_DIR="$HOME/gtsam_ubuntu"
|
|
||||||
fi
|
|
||||||
GTSAMSRC=`pwd`
|
|
||||||
if [ -z "${GTSAM_DEB_DIR}" ]; then
|
|
||||||
export GTSAM_DEB_DIR="$HOME/gtsam_debian"
|
|
||||||
fi
|
|
||||||
GTSAM_EXTERN_DEBIAN_DIR="$GTSAMSRC/debian/"
|
|
||||||
|
|
||||||
# Clean out dirs:
|
|
||||||
rm -fr $gtsam_ubuntu_OUT_DIR/
|
|
||||||
|
|
||||||
# -------------------------------------------------------------------
|
|
||||||
# And now create the custom packages for each Ubuntu distribution:
|
|
||||||
# -------------------------------------------------------------------
|
|
||||||
count=${#LST_DISTROS[@]}
|
|
||||||
IDXS=$(seq 0 $(expr $count - 1))
|
|
||||||
|
|
||||||
cp ${GTSAM_EXTERN_DEBIAN_DIR}/changelog /tmp/my_changelog
|
|
||||||
|
|
||||||
for IDX in ${IDXS};
|
|
||||||
do
|
|
||||||
DEBIAN_DIST=${LST_DISTROS[$IDX]}
|
|
||||||
|
|
||||||
# -------------------------------------------------------------------
|
|
||||||
# Call the standard "prepare_debian.sh" script:
|
|
||||||
# -------------------------------------------------------------------
|
|
||||||
cd ${GTSAMSRC}
|
|
||||||
bash package_scripts/prepare_debian.sh -e "$PACKAGER_EMAIL" -s -u -d ${DEBIAN_DIST} -c "${GTSAM_PKG_CUSTOM_CMAKE_PARAMS}"
|
|
||||||
|
|
||||||
CUR_SCRIPT_DIR="$( cd "$( dirname "${BASH_SOURCE[0]}" )" && pwd )"
|
|
||||||
source $CUR_SCRIPT_DIR/prepare_debian_gen_snapshot_version.sh # populate GTSAM_SNAPSHOT_VERSION
|
|
||||||
|
|
||||||
echo "===== Distribution: ${DEBIAN_DIST} ========="
|
|
||||||
cd ${GTSAM_DEB_DIR}/gtsam-${GTSAM_VER_MMP}~snapshot${GTSAM_SNAPSHOT_VERSION}${DEBIAN_DIST}/debian
|
|
||||||
#cp ${GTSAM_EXTERN_DEBIAN_DIR}/changelog changelog
|
|
||||||
cp /tmp/my_changelog changelog
|
|
||||||
DEBCHANGE_CMD="--newversion ${GTSAM_VERSION_STR}~snapshot${GTSAM_SNAPSHOT_VERSION}${DEBIAN_DIST}-1"
|
|
||||||
echo "Changing to a new Debian version: ${DEBCHANGE_CMD}"
|
|
||||||
echo "Adding a new entry to debian/changelog for distribution ${DEBIAN_DIST}"
|
|
||||||
DEBEMAIL="${PACKAGER_EMAIL}" debchange $DEBCHANGE_CMD -b --distribution ${DEBIAN_DIST} --force-distribution New version of upstream sources.
|
|
||||||
|
|
||||||
cp changelog /tmp/my_changelog
|
|
||||||
|
|
||||||
echo "Now, let's build the source Deb package with 'debuild -S -sa':"
|
|
||||||
cd ..
|
|
||||||
# -S: source package
|
|
||||||
# -sa: force inclusion of sources
|
|
||||||
# -d: don't check dependencies in this system
|
|
||||||
debuild -S -sa -d
|
|
||||||
|
|
||||||
# Make a copy of all these packages:
|
|
||||||
cd ..
|
|
||||||
mkdir -p $gtsam_ubuntu_OUT_DIR/$DEBIAN_DIST
|
|
||||||
cp gtsam_* $gtsam_ubuntu_OUT_DIR/${DEBIAN_DIST}/
|
|
||||||
echo ">>>>>> Saving packages to: $gtsam_ubuntu_OUT_DIR/$DEBIAN_DIST/"
|
|
||||||
done
|
|
||||||
|
|
||||||
|
|
||||||
exit 0
|
|
|
@ -1,64 +0,0 @@
|
||||||
#!/bin/sh
|
|
||||||
|
|
||||||
# Script to build a tarball with the matlab toolbox
|
|
||||||
|
|
||||||
# Detect platform
|
|
||||||
os=`uname -s`
|
|
||||||
arch=`uname -m`
|
|
||||||
if [ "$os" = "Linux" -a "$arch" = "x86_64" ]; then
|
|
||||||
platform=lin64
|
|
||||||
elif [ "$os" = "Linux" -a "$arch" = "i686" ]; then
|
|
||||||
platform=lin32
|
|
||||||
elif [ "$os" = "Darwin" -a "$arch" = "x86_64" ]; then
|
|
||||||
platform=mac64
|
|
||||||
else
|
|
||||||
echo "Unrecognized platform"
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
echo "Platform is ${platform}"
|
|
||||||
|
|
||||||
# Check for empty diectory
|
|
||||||
if [ ! -z "`ls`" ]; then
|
|
||||||
echo "Please run this script from an empty build directory"
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Check for boost
|
|
||||||
if [ -z "$1" ]; then
|
|
||||||
echo "Usage: $0 BOOSTTREE"
|
|
||||||
echo "BOOSTTREE should be a boost source tree compiled with toolbox_build_boost."
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Run cmake
|
|
||||||
cmake -DCMAKE_BUILD_TYPE=Release \
|
|
||||||
-DGTSAM_INSTALL_MATLAB_TOOLBOX:BOOL=ON \
|
|
||||||
-DCMAKE_INSTALL_PREFIX="$PWD/stage" \
|
|
||||||
-DBoost_NO_SYSTEM_PATHS:BOOL=ON \
|
|
||||||
-DBoost_USE_STATIC_LIBS:BOOL=ON \
|
|
||||||
-DBOOST_ROOT="$1" \
|
|
||||||
-DGTSAM_BUILD_TESTS:BOOL=OFF \
|
|
||||||
-DGTSAM_BUILD_TIMING:BOOL=OFF \
|
|
||||||
-DGTSAM_BUILD_EXAMPLES_ALWAYS:BOOL=OFF \
|
|
||||||
-DGTSAM_WITH_TBB:BOOL=OFF \
|
|
||||||
-DGTSAM_SUPPORT_NESTED_DISSECTION:BOOL=OFF \
|
|
||||||
-DGTSAM_INSTALL_GEOGRAPHICLIB:BOOL=OFF \
|
|
||||||
-DGTSAM_BUILD_UNSTABLE:BOOL=OFF \
|
|
||||||
-DGTSAM_MEX_BUILD_STATIC_MODULE:BOOL=ON ..
|
|
||||||
|
|
||||||
if [ $? -ne 0 ]; then
|
|
||||||
echo "CMake failed"
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Compile
|
|
||||||
make -j8 install
|
|
||||||
|
|
||||||
if [ $? -ne 0 ]; then
|
|
||||||
echo "Compile failed"
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Create package
|
|
||||||
tar czf gtsam-toolbox-3.2.0-$platform.tgz -C stage/gtsam_toolbox toolbox
|
|
|
@ -1,31 +0,0 @@
|
||||||
#!/bin/bash
|
|
||||||
|
|
||||||
function show_help {
|
|
||||||
echo "USAGE:"
|
|
||||||
echo ""
|
|
||||||
echo "- to display this help: "
|
|
||||||
echo "upload_all_gtsam_ppa.sh -h or -?"
|
|
||||||
echo ""
|
|
||||||
echo "- to upload to your PPA: "
|
|
||||||
echo "upload_all_gtsam_ppa.sh -p ppa:your_name/name_of_ppa"
|
|
||||||
echo ""
|
|
||||||
}
|
|
||||||
|
|
||||||
while getopts "h?p:" opt; do
|
|
||||||
case "$opt" in
|
|
||||||
h|\?)
|
|
||||||
show_help
|
|
||||||
exit 0
|
|
||||||
;;
|
|
||||||
p) ppa_name=$OPTARG
|
|
||||||
;;
|
|
||||||
esac
|
|
||||||
done
|
|
||||||
|
|
||||||
if [ -z ${ppa_name+x} ]; then
|
|
||||||
show_help
|
|
||||||
exit -1
|
|
||||||
fi
|
|
||||||
|
|
||||||
|
|
||||||
find . -name '*.changes' | xargs -I FIL dput ${ppa_name} FIL
|
|
|
@ -54,7 +54,16 @@ struct GlobalFunction: public FullyOverloadedFunction {
|
||||||
// function name in Cython pxd
|
// function name in Cython pxd
|
||||||
std::string pxdName() const { return "pxd_" + pyRename(name_); }
|
std::string pxdName() const { return "pxd_" + pyRename(name_); }
|
||||||
// function name in Python pyx
|
// function name in Python pyx
|
||||||
std::string pyxName() const { return pyRename(name_); }
|
std::string pyxName() const {
|
||||||
|
std::string result = "";
|
||||||
|
for(size_t i=0; i<overloads[0].namespaces_.size(); i++){
|
||||||
|
if (i >= 1) {
|
||||||
|
result += (overloads[0].namespaces_[i] + "_");
|
||||||
|
}
|
||||||
|
}
|
||||||
|
result += pyRename(name_);
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
|
||||||
// emit cython wrapper
|
// emit cython wrapper
|
||||||
void emit_cython_pxd(FileWriter& pxdFile) const;
|
void emit_cython_pxd(FileWriter& pxdFile) const;
|
||||||
|
|
|
@ -1 +0,0 @@
|
||||||
Subproject commit b3bf248eec9cad8260753c982e1ae6cb72fff470
|
|
|
@ -0,0 +1,70 @@
|
||||||
|
version: 1.0.{build}
|
||||||
|
image:
|
||||||
|
- Visual Studio 2017
|
||||||
|
- Visual Studio 2015
|
||||||
|
test: off
|
||||||
|
skip_branch_with_pr: true
|
||||||
|
build:
|
||||||
|
parallel: true
|
||||||
|
platform:
|
||||||
|
- x64
|
||||||
|
- x86
|
||||||
|
environment:
|
||||||
|
matrix:
|
||||||
|
- PYTHON: 36
|
||||||
|
CPP: 14
|
||||||
|
CONFIG: Debug
|
||||||
|
- PYTHON: 27
|
||||||
|
CPP: 14
|
||||||
|
CONFIG: Debug
|
||||||
|
- CONDA: 36
|
||||||
|
CPP: latest
|
||||||
|
CONFIG: Release
|
||||||
|
matrix:
|
||||||
|
exclude:
|
||||||
|
- image: Visual Studio 2015
|
||||||
|
platform: x86
|
||||||
|
- image: Visual Studio 2015
|
||||||
|
CPP: latest
|
||||||
|
- image: Visual Studio 2017
|
||||||
|
CPP: latest
|
||||||
|
platform: x86
|
||||||
|
install:
|
||||||
|
- ps: |
|
||||||
|
if ($env:PLATFORM -eq "x64") { $env:CMAKE_ARCH = "x64" }
|
||||||
|
if ($env:APPVEYOR_JOB_NAME -like "*Visual Studio 2017*") {
|
||||||
|
$env:CMAKE_GENERATOR = "Visual Studio 15 2017"
|
||||||
|
$env:CMAKE_INCLUDE_PATH = "C:\Libraries\boost_1_64_0"
|
||||||
|
$env:CXXFLAGS = "-permissive-"
|
||||||
|
} else {
|
||||||
|
$env:CMAKE_GENERATOR = "Visual Studio 14 2015"
|
||||||
|
}
|
||||||
|
if ($env:PYTHON) {
|
||||||
|
if ($env:PLATFORM -eq "x64") { $env:PYTHON = "$env:PYTHON-x64" }
|
||||||
|
$env:PATH = "C:\Python$env:PYTHON\;C:\Python$env:PYTHON\Scripts\;$env:PATH"
|
||||||
|
python -W ignore -m pip install --upgrade pip wheel
|
||||||
|
python -W ignore -m pip install pytest numpy --no-warn-script-location
|
||||||
|
} elseif ($env:CONDA) {
|
||||||
|
if ($env:CONDA -eq "27") { $env:CONDA = "" }
|
||||||
|
if ($env:PLATFORM -eq "x64") { $env:CONDA = "$env:CONDA-x64" }
|
||||||
|
$env:PATH = "C:\Miniconda$env:CONDA\;C:\Miniconda$env:CONDA\Scripts\;$env:PATH"
|
||||||
|
$env:PYTHONHOME = "C:\Miniconda$env:CONDA"
|
||||||
|
conda --version
|
||||||
|
conda install -y -q pytest numpy scipy
|
||||||
|
}
|
||||||
|
- ps: |
|
||||||
|
Start-FileDownload 'http://bitbucket.org/eigen/eigen/get/3.3.3.zip'
|
||||||
|
7z x 3.3.3.zip -y > $null
|
||||||
|
$env:CMAKE_INCLUDE_PATH = "eigen-eigen-67e894c6cd8f;$env:CMAKE_INCLUDE_PATH"
|
||||||
|
build_script:
|
||||||
|
- cmake -G "%CMAKE_GENERATOR%" -A "%CMAKE_ARCH%"
|
||||||
|
-DPYBIND11_CPP_STANDARD=/std:c++%CPP%
|
||||||
|
-DPYBIND11_WERROR=ON
|
||||||
|
-DDOWNLOAD_CATCH=ON
|
||||||
|
-DCMAKE_SUPPRESS_REGENERATION=1
|
||||||
|
.
|
||||||
|
- set MSBuildLogger="C:\Program Files\AppVeyor\BuildAgent\Appveyor.MSBuildLogger.dll"
|
||||||
|
- cmake --build . --config %CONFIG% --target pytest -- /m /v:m /logger:%MSBuildLogger%
|
||||||
|
- cmake --build . --config %CONFIG% --target cpptest -- /m /v:m /logger:%MSBuildLogger%
|
||||||
|
- if "%CPP%"=="latest" (cmake --build . --config %CONFIG% --target test_cmake_build -- /m /v:m /logger:%MSBuildLogger%)
|
||||||
|
on_failure: if exist "tests\test_cmake_build" type tests\test_cmake_build\*.log*
|
|
@ -0,0 +1,38 @@
|
||||||
|
CMakeCache.txt
|
||||||
|
CMakeFiles
|
||||||
|
Makefile
|
||||||
|
cmake_install.cmake
|
||||||
|
.DS_Store
|
||||||
|
*.so
|
||||||
|
*.pyd
|
||||||
|
*.dll
|
||||||
|
*.sln
|
||||||
|
*.sdf
|
||||||
|
*.opensdf
|
||||||
|
*.vcxproj
|
||||||
|
*.filters
|
||||||
|
example.dir
|
||||||
|
Win32
|
||||||
|
x64
|
||||||
|
Release
|
||||||
|
Debug
|
||||||
|
.vs
|
||||||
|
CTestTestfile.cmake
|
||||||
|
Testing
|
||||||
|
autogen
|
||||||
|
MANIFEST
|
||||||
|
/.ninja_*
|
||||||
|
/*.ninja
|
||||||
|
/docs/.build
|
||||||
|
*.py[co]
|
||||||
|
*.egg-info
|
||||||
|
*~
|
||||||
|
.*.swp
|
||||||
|
.DS_Store
|
||||||
|
/dist
|
||||||
|
/build
|
||||||
|
/cmake/
|
||||||
|
.cache/
|
||||||
|
sosize-*.txt
|
||||||
|
pybind11Config*.cmake
|
||||||
|
pybind11Targets.cmake
|
|
@ -0,0 +1,3 @@
|
||||||
|
[submodule "tools/clang"]
|
||||||
|
path = tools/clang
|
||||||
|
url = ../../wjakob/clang-cindex-python3
|
|
@ -0,0 +1,3 @@
|
||||||
|
python:
|
||||||
|
version: 3
|
||||||
|
requirements_file: docs/requirements.txt
|
|
@ -0,0 +1,280 @@
|
||||||
|
language: cpp
|
||||||
|
matrix:
|
||||||
|
include:
|
||||||
|
# This config does a few things:
|
||||||
|
# - Checks C++ and Python code styles (check-style.sh and flake8).
|
||||||
|
# - Makes sure sphinx can build the docs without any errors or warnings.
|
||||||
|
# - Tests setup.py sdist and install (all header files should be present).
|
||||||
|
# - Makes sure that everything still works without optional deps (numpy/scipy/eigen) and
|
||||||
|
# also tests the automatic discovery functions in CMake (Python version, C++ standard).
|
||||||
|
- os: linux
|
||||||
|
dist: xenial # Necessary to run doxygen 1.8.15
|
||||||
|
name: Style, docs, and pip
|
||||||
|
cache: false
|
||||||
|
before_install:
|
||||||
|
- pyenv global $(pyenv whence 2to3) # activate all python versions
|
||||||
|
- PY_CMD=python3
|
||||||
|
- $PY_CMD -m pip install --user --upgrade pip wheel setuptools
|
||||||
|
install:
|
||||||
|
- $PY_CMD -m pip install --user --upgrade sphinx sphinx_rtd_theme breathe flake8 pep8-naming pytest
|
||||||
|
- curl -fsSL https://sourceforge.net/projects/doxygen/files/rel-1.8.15/doxygen-1.8.15.linux.bin.tar.gz/download | tar xz
|
||||||
|
- export PATH="$PWD/doxygen-1.8.15/bin:$PATH"
|
||||||
|
script:
|
||||||
|
- tools/check-style.sh
|
||||||
|
- flake8
|
||||||
|
- $PY_CMD -m sphinx -W -b html docs docs/.build
|
||||||
|
- |
|
||||||
|
# Make sure setup.py distributes and installs all the headers
|
||||||
|
$PY_CMD setup.py sdist
|
||||||
|
$PY_CMD -m pip install --user -U ./dist/*
|
||||||
|
installed=$($PY_CMD -c "import pybind11; print(pybind11.get_include(True) + '/pybind11')")
|
||||||
|
diff -rq $installed ./include/pybind11
|
||||||
|
- |
|
||||||
|
# Barebones build
|
||||||
|
cmake -DCMAKE_BUILD_TYPE=Debug -DPYBIND11_WERROR=ON -DDOWNLOAD_CATCH=ON -DPYTHON_EXECUTABLE=$(which $PY_CMD) .
|
||||||
|
make pytest -j 2
|
||||||
|
make cpptest -j 2
|
||||||
|
# The following are regular test configurations, including optional dependencies.
|
||||||
|
# With regard to each other they differ in Python version, C++ standard and compiler.
|
||||||
|
- os: linux
|
||||||
|
dist: trusty
|
||||||
|
name: Python 2.7, c++11, gcc 4.8
|
||||||
|
env: PYTHON=2.7 CPP=11 GCC=4.8
|
||||||
|
addons:
|
||||||
|
apt:
|
||||||
|
packages:
|
||||||
|
- cmake=2.\*
|
||||||
|
- cmake-data=2.\*
|
||||||
|
- os: linux
|
||||||
|
dist: trusty
|
||||||
|
name: Python 3.6, c++11, gcc 4.8
|
||||||
|
env: PYTHON=3.6 CPP=11 GCC=4.8
|
||||||
|
addons:
|
||||||
|
apt:
|
||||||
|
sources:
|
||||||
|
- deadsnakes
|
||||||
|
packages:
|
||||||
|
- python3.6-dev
|
||||||
|
- python3.6-venv
|
||||||
|
- cmake=2.\*
|
||||||
|
- cmake-data=2.\*
|
||||||
|
- os: linux
|
||||||
|
dist: trusty
|
||||||
|
env: PYTHON=2.7 CPP=14 GCC=6 CMAKE=1
|
||||||
|
name: Python 2.7, c++14, gcc 4.8, CMake test
|
||||||
|
addons:
|
||||||
|
apt:
|
||||||
|
sources:
|
||||||
|
- ubuntu-toolchain-r-test
|
||||||
|
packages:
|
||||||
|
- g++-6
|
||||||
|
- os: linux
|
||||||
|
dist: trusty
|
||||||
|
name: Python 3.5, c++14, gcc 6, Debug build
|
||||||
|
# N.B. `ensurepip` could be installed transitively by `python3.5-venv`, but
|
||||||
|
# seems to have apt conflicts (at least for Trusty). Use Docker instead.
|
||||||
|
services: docker
|
||||||
|
env: DOCKER=debian:stretch PYTHON=3.5 CPP=14 GCC=6 DEBUG=1
|
||||||
|
- os: linux
|
||||||
|
dist: xenial
|
||||||
|
env: PYTHON=3.6 CPP=17 GCC=7
|
||||||
|
name: Python 3.6, c++17, gcc 7
|
||||||
|
addons:
|
||||||
|
apt:
|
||||||
|
sources:
|
||||||
|
- deadsnakes
|
||||||
|
- ubuntu-toolchain-r-test
|
||||||
|
packages:
|
||||||
|
- g++-7
|
||||||
|
- python3.6-dev
|
||||||
|
- python3.6-venv
|
||||||
|
- os: linux
|
||||||
|
dist: xenial
|
||||||
|
env: PYTHON=3.6 CPP=17 CLANG=7
|
||||||
|
name: Python 3.6, c++17, Clang 7
|
||||||
|
addons:
|
||||||
|
apt:
|
||||||
|
sources:
|
||||||
|
- deadsnakes
|
||||||
|
- llvm-toolchain-xenial-7
|
||||||
|
packages:
|
||||||
|
- python3.6-dev
|
||||||
|
- python3.6-venv
|
||||||
|
- clang-7
|
||||||
|
- libclang-7-dev
|
||||||
|
- llvm-7-dev
|
||||||
|
- lld-7
|
||||||
|
- libc++-7-dev
|
||||||
|
- libc++abi-7-dev # Why is this necessary???
|
||||||
|
- os: osx
|
||||||
|
name: Python 2.7, c++14, AppleClang 7.3, CMake test
|
||||||
|
osx_image: xcode7.3
|
||||||
|
env: PYTHON=2.7 CPP=14 CLANG CMAKE=1
|
||||||
|
- os: osx
|
||||||
|
name: Python 3.7, c++14, AppleClang 9, Debug build
|
||||||
|
osx_image: xcode9
|
||||||
|
env: PYTHON=3.7 CPP=14 CLANG DEBUG=1
|
||||||
|
# Test a PyPy 2.7 build
|
||||||
|
- os: linux
|
||||||
|
dist: trusty
|
||||||
|
env: PYPY=5.8 PYTHON=2.7 CPP=11 GCC=4.8
|
||||||
|
name: PyPy 5.8, Python 2.7, c++11, gcc 4.8
|
||||||
|
addons:
|
||||||
|
apt:
|
||||||
|
packages:
|
||||||
|
- libblas-dev
|
||||||
|
- liblapack-dev
|
||||||
|
- gfortran
|
||||||
|
# Build in 32-bit mode and tests against the CMake-installed version
|
||||||
|
- os: linux
|
||||||
|
dist: trusty
|
||||||
|
services: docker
|
||||||
|
env: DOCKER=i386/debian:stretch PYTHON=3.5 CPP=14 GCC=6 INSTALL=1
|
||||||
|
name: Python 3.4, c++14, gcc 6, 32-bit
|
||||||
|
script:
|
||||||
|
- |
|
||||||
|
# Consolidated 32-bit Docker Build + Install
|
||||||
|
set -ex
|
||||||
|
$SCRIPT_RUN_PREFIX sh -c "
|
||||||
|
set -ex
|
||||||
|
cmake ${CMAKE_EXTRA_ARGS} -DPYBIND11_INSTALL=1 -DPYBIND11_TEST=0 .
|
||||||
|
make install
|
||||||
|
cp -a tests /pybind11-tests
|
||||||
|
mkdir /build-tests && cd /build-tests
|
||||||
|
cmake ../pybind11-tests ${CMAKE_EXTRA_ARGS} -DPYBIND11_WERROR=ON
|
||||||
|
make pytest -j 2"
|
||||||
|
set +ex
|
||||||
|
cache:
|
||||||
|
directories:
|
||||||
|
- $HOME/.local/bin
|
||||||
|
- $HOME/.local/lib
|
||||||
|
- $HOME/.local/include
|
||||||
|
- $HOME/Library/Python
|
||||||
|
before_install:
|
||||||
|
- |
|
||||||
|
# Configure build variables
|
||||||
|
set -ex
|
||||||
|
if [ "$TRAVIS_OS_NAME" = "linux" ]; then
|
||||||
|
if [ -n "$CLANG" ]; then
|
||||||
|
export CXX=clang++-$CLANG CC=clang-$CLANG
|
||||||
|
EXTRA_PACKAGES+=" clang-$CLANG llvm-$CLANG-dev"
|
||||||
|
else
|
||||||
|
if [ -z "$GCC" ]; then GCC=4.8
|
||||||
|
else EXTRA_PACKAGES+=" g++-$GCC"
|
||||||
|
fi
|
||||||
|
export CXX=g++-$GCC CC=gcc-$GCC
|
||||||
|
fi
|
||||||
|
elif [ "$TRAVIS_OS_NAME" = "osx" ]; then
|
||||||
|
export CXX=clang++ CC=clang;
|
||||||
|
fi
|
||||||
|
if [ -n "$CPP" ]; then CPP=-std=c++$CPP; fi
|
||||||
|
if [ "${PYTHON:0:1}" = "3" ]; then PY=3; fi
|
||||||
|
if [ -n "$DEBUG" ]; then CMAKE_EXTRA_ARGS+=" -DCMAKE_BUILD_TYPE=Debug"; fi
|
||||||
|
set +ex
|
||||||
|
- |
|
||||||
|
# Initialize environment
|
||||||
|
set -ex
|
||||||
|
if [ -n "$DOCKER" ]; then
|
||||||
|
docker pull $DOCKER
|
||||||
|
|
||||||
|
containerid=$(docker run --detach --tty \
|
||||||
|
--volume="$PWD":/pybind11 --workdir=/pybind11 \
|
||||||
|
--env="CC=$CC" --env="CXX=$CXX" --env="DEBIAN_FRONTEND=$DEBIAN_FRONTEND" \
|
||||||
|
--env=GCC_COLORS=\ \
|
||||||
|
$DOCKER)
|
||||||
|
SCRIPT_RUN_PREFIX="docker exec --tty $containerid"
|
||||||
|
$SCRIPT_RUN_PREFIX sh -c 'for s in 0 15; do sleep $s; apt-get update && apt-get -qy dist-upgrade && break; done'
|
||||||
|
else
|
||||||
|
if [ "$PYPY" = "5.8" ]; then
|
||||||
|
curl -fSL https://bitbucket.org/pypy/pypy/downloads/pypy2-v5.8.0-linux64.tar.bz2 | tar xj
|
||||||
|
PY_CMD=$(echo `pwd`/pypy2-v5.8.0-linux64/bin/pypy)
|
||||||
|
CMAKE_EXTRA_ARGS+=" -DPYTHON_EXECUTABLE:FILEPATH=$PY_CMD"
|
||||||
|
else
|
||||||
|
PY_CMD=python$PYTHON
|
||||||
|
if [ "$TRAVIS_OS_NAME" = "osx" ]; then
|
||||||
|
if [ "$PY" = "3" ]; then
|
||||||
|
brew update && brew upgrade python
|
||||||
|
else
|
||||||
|
curl -fsSL https://bootstrap.pypa.io/get-pip.py | $PY_CMD - --user
|
||||||
|
fi
|
||||||
|
fi
|
||||||
|
fi
|
||||||
|
if [ "$PY" = 3 ] || [ -n "$PYPY" ]; then
|
||||||
|
$PY_CMD -m ensurepip --user
|
||||||
|
fi
|
||||||
|
$PY_CMD --version
|
||||||
|
$PY_CMD -m pip install --user --upgrade pip wheel
|
||||||
|
fi
|
||||||
|
set +ex
|
||||||
|
install:
|
||||||
|
- |
|
||||||
|
# Install dependencies
|
||||||
|
set -ex
|
||||||
|
cmake --version
|
||||||
|
if [ -n "$DOCKER" ]; then
|
||||||
|
if [ -n "$DEBUG" ]; then
|
||||||
|
PY_DEBUG="python$PYTHON-dbg python$PY-scipy-dbg"
|
||||||
|
CMAKE_EXTRA_ARGS+=" -DPYTHON_EXECUTABLE=/usr/bin/python${PYTHON}dm"
|
||||||
|
fi
|
||||||
|
$SCRIPT_RUN_PREFIX sh -c "for s in 0 15; do sleep \$s; \
|
||||||
|
apt-get -qy --no-install-recommends install \
|
||||||
|
$PY_DEBUG python$PYTHON-dev python$PY-pytest python$PY-scipy \
|
||||||
|
libeigen3-dev libboost-dev cmake make ${EXTRA_PACKAGES} && break; done"
|
||||||
|
else
|
||||||
|
|
||||||
|
if [ "$CLANG" = "7" ]; then
|
||||||
|
export CXXFLAGS="-stdlib=libc++"
|
||||||
|
fi
|
||||||
|
|
||||||
|
export NPY_NUM_BUILD_JOBS=2
|
||||||
|
echo "Installing pytest, numpy, scipy..."
|
||||||
|
local PIP_CMD=""
|
||||||
|
if [ -n $PYPY ]; then
|
||||||
|
# For expediency, install only versions that are available on the extra index.
|
||||||
|
travis_wait 30 \
|
||||||
|
$PY_CMD -m pip install --user --upgrade --extra-index-url https://imaginary.ca/trusty-pypi \
|
||||||
|
pytest numpy==1.15.4 scipy==1.2.0
|
||||||
|
else
|
||||||
|
$PY_CMD -m pip install --user --upgrade pytest numpy scipy
|
||||||
|
fi
|
||||||
|
echo "done."
|
||||||
|
|
||||||
|
mkdir eigen
|
||||||
|
curl -fsSL https://bitbucket.org/eigen/eigen/get/3.3.4.tar.bz2 | \
|
||||||
|
tar --extract -j --directory=eigen --strip-components=1
|
||||||
|
export CMAKE_INCLUDE_PATH="${CMAKE_INCLUDE_PATH:+$CMAKE_INCLUDE_PATH:}$PWD/eigen"
|
||||||
|
fi
|
||||||
|
set +ex
|
||||||
|
script:
|
||||||
|
- |
|
||||||
|
# CMake Configuration
|
||||||
|
set -ex
|
||||||
|
$SCRIPT_RUN_PREFIX cmake ${CMAKE_EXTRA_ARGS} \
|
||||||
|
-DPYBIND11_PYTHON_VERSION=$PYTHON \
|
||||||
|
-DPYBIND11_CPP_STANDARD=$CPP \
|
||||||
|
-DPYBIND11_WERROR=${WERROR:-ON} \
|
||||||
|
-DDOWNLOAD_CATCH=${DOWNLOAD_CATCH:-ON} \
|
||||||
|
.
|
||||||
|
set +ex
|
||||||
|
- |
|
||||||
|
# pytest
|
||||||
|
set -ex
|
||||||
|
$SCRIPT_RUN_PREFIX make pytest -j 2 VERBOSE=1
|
||||||
|
set +ex
|
||||||
|
- |
|
||||||
|
# cpptest
|
||||||
|
set -ex
|
||||||
|
$SCRIPT_RUN_PREFIX make cpptest -j 2
|
||||||
|
set +ex
|
||||||
|
- |
|
||||||
|
# CMake Build Interface
|
||||||
|
set -ex
|
||||||
|
if [ -n "$CMAKE" ]; then $SCRIPT_RUN_PREFIX make test_cmake_build; fi
|
||||||
|
set +ex
|
||||||
|
after_failure: cat tests/test_cmake_build/*.log*
|
||||||
|
after_script:
|
||||||
|
- |
|
||||||
|
# Cleanup (Docker)
|
||||||
|
set -ex
|
||||||
|
if [ -n "$DOCKER" ]; then docker stop "$containerid"; docker rm "$containerid"; fi
|
||||||
|
set +ex
|
|
@ -0,0 +1,157 @@
|
||||||
|
# CMakeLists.txt -- Build system for the pybind11 modules
|
||||||
|
#
|
||||||
|
# Copyright (c) 2015 Wenzel Jakob <wenzel@inf.ethz.ch>
|
||||||
|
#
|
||||||
|
# All rights reserved. Use of this source code is governed by a
|
||||||
|
# BSD-style license that can be found in the LICENSE file.
|
||||||
|
|
||||||
|
cmake_minimum_required(VERSION 2.8.12)
|
||||||
|
|
||||||
|
if (POLICY CMP0048)
|
||||||
|
# cmake warns if loaded from a min-3.0-required parent dir, so silence the warning:
|
||||||
|
cmake_policy(SET CMP0048 NEW)
|
||||||
|
endif()
|
||||||
|
|
||||||
|
# CMake versions < 3.4.0 do not support try_compile/pthread checks without C as active language.
|
||||||
|
if(CMAKE_VERSION VERSION_LESS 3.4.0)
|
||||||
|
project(pybind11)
|
||||||
|
else()
|
||||||
|
project(pybind11 CXX)
|
||||||
|
endif()
|
||||||
|
|
||||||
|
# Check if pybind11 is being used directly or via add_subdirectory
|
||||||
|
set(PYBIND11_MASTER_PROJECT OFF)
|
||||||
|
if (CMAKE_CURRENT_SOURCE_DIR STREQUAL CMAKE_SOURCE_DIR)
|
||||||
|
set(PYBIND11_MASTER_PROJECT ON)
|
||||||
|
endif()
|
||||||
|
|
||||||
|
option(PYBIND11_INSTALL "Install pybind11 header files?" ${PYBIND11_MASTER_PROJECT})
|
||||||
|
option(PYBIND11_TEST "Build pybind11 test suite?" ${PYBIND11_MASTER_PROJECT})
|
||||||
|
|
||||||
|
list(APPEND CMAKE_MODULE_PATH "${CMAKE_CURRENT_LIST_DIR}/tools")
|
||||||
|
|
||||||
|
include(pybind11Tools)
|
||||||
|
|
||||||
|
# Cache variables so pybind11_add_module can be used in parent projects
|
||||||
|
set(PYBIND11_INCLUDE_DIR "${CMAKE_CURRENT_LIST_DIR}/include" CACHE INTERNAL "")
|
||||||
|
set(PYTHON_INCLUDE_DIRS ${PYTHON_INCLUDE_DIRS} CACHE INTERNAL "")
|
||||||
|
set(PYTHON_LIBRARIES ${PYTHON_LIBRARIES} CACHE INTERNAL "")
|
||||||
|
set(PYTHON_MODULE_PREFIX ${PYTHON_MODULE_PREFIX} CACHE INTERNAL "")
|
||||||
|
set(PYTHON_MODULE_EXTENSION ${PYTHON_MODULE_EXTENSION} CACHE INTERNAL "")
|
||||||
|
set(PYTHON_VERSION_MAJOR ${PYTHON_VERSION_MAJOR} CACHE INTERNAL "")
|
||||||
|
set(PYTHON_VERSION_MINOR ${PYTHON_VERSION_MINOR} CACHE INTERNAL "")
|
||||||
|
|
||||||
|
# NB: when adding a header don't forget to also add it to setup.py
|
||||||
|
set(PYBIND11_HEADERS
|
||||||
|
include/pybind11/detail/class.h
|
||||||
|
include/pybind11/detail/common.h
|
||||||
|
include/pybind11/detail/descr.h
|
||||||
|
include/pybind11/detail/init.h
|
||||||
|
include/pybind11/detail/internals.h
|
||||||
|
include/pybind11/detail/typeid.h
|
||||||
|
include/pybind11/attr.h
|
||||||
|
include/pybind11/buffer_info.h
|
||||||
|
include/pybind11/cast.h
|
||||||
|
include/pybind11/chrono.h
|
||||||
|
include/pybind11/common.h
|
||||||
|
include/pybind11/complex.h
|
||||||
|
include/pybind11/options.h
|
||||||
|
include/pybind11/eigen.h
|
||||||
|
include/pybind11/embed.h
|
||||||
|
include/pybind11/eval.h
|
||||||
|
include/pybind11/functional.h
|
||||||
|
include/pybind11/numpy.h
|
||||||
|
include/pybind11/operators.h
|
||||||
|
include/pybind11/pybind11.h
|
||||||
|
include/pybind11/pytypes.h
|
||||||
|
include/pybind11/stl.h
|
||||||
|
include/pybind11/stl_bind.h
|
||||||
|
)
|
||||||
|
string(REPLACE "include/" "${CMAKE_CURRENT_SOURCE_DIR}/include/"
|
||||||
|
PYBIND11_HEADERS "${PYBIND11_HEADERS}")
|
||||||
|
|
||||||
|
if (PYBIND11_TEST)
|
||||||
|
add_subdirectory(tests)
|
||||||
|
endif()
|
||||||
|
|
||||||
|
include(GNUInstallDirs)
|
||||||
|
include(CMakePackageConfigHelpers)
|
||||||
|
|
||||||
|
# extract project version from source
|
||||||
|
file(STRINGS "${PYBIND11_INCLUDE_DIR}/pybind11/detail/common.h" pybind11_version_defines
|
||||||
|
REGEX "#define PYBIND11_VERSION_(MAJOR|MINOR|PATCH) ")
|
||||||
|
foreach(ver ${pybind11_version_defines})
|
||||||
|
if (ver MATCHES "#define PYBIND11_VERSION_(MAJOR|MINOR|PATCH) +([^ ]+)$")
|
||||||
|
set(PYBIND11_VERSION_${CMAKE_MATCH_1} "${CMAKE_MATCH_2}" CACHE INTERNAL "")
|
||||||
|
endif()
|
||||||
|
endforeach()
|
||||||
|
set(${PROJECT_NAME}_VERSION ${PYBIND11_VERSION_MAJOR}.${PYBIND11_VERSION_MINOR}.${PYBIND11_VERSION_PATCH})
|
||||||
|
message(STATUS "pybind11 v${${PROJECT_NAME}_VERSION}")
|
||||||
|
|
||||||
|
option (USE_PYTHON_INCLUDE_DIR "Install pybind11 headers in Python include directory instead of default installation prefix" OFF)
|
||||||
|
if (USE_PYTHON_INCLUDE_DIR)
|
||||||
|
file(RELATIVE_PATH CMAKE_INSTALL_INCLUDEDIR ${CMAKE_INSTALL_PREFIX} ${PYTHON_INCLUDE_DIRS})
|
||||||
|
endif()
|
||||||
|
|
||||||
|
if(NOT (CMAKE_VERSION VERSION_LESS 3.0)) # CMake >= 3.0
|
||||||
|
# Build an interface library target:
|
||||||
|
add_library(pybind11 INTERFACE)
|
||||||
|
add_library(pybind11::pybind11 ALIAS pybind11) # to match exported target
|
||||||
|
target_include_directories(pybind11 INTERFACE $<BUILD_INTERFACE:${PYBIND11_INCLUDE_DIR}>
|
||||||
|
$<BUILD_INTERFACE:${PYTHON_INCLUDE_DIRS}>
|
||||||
|
$<INSTALL_INTERFACE:${CMAKE_INSTALL_INCLUDEDIR}>)
|
||||||
|
target_compile_options(pybind11 INTERFACE $<BUILD_INTERFACE:${PYBIND11_CPP_STANDARD}>)
|
||||||
|
|
||||||
|
add_library(module INTERFACE)
|
||||||
|
add_library(pybind11::module ALIAS module)
|
||||||
|
if(NOT MSVC)
|
||||||
|
target_compile_options(module INTERFACE -fvisibility=hidden)
|
||||||
|
endif()
|
||||||
|
target_link_libraries(module INTERFACE pybind11::pybind11)
|
||||||
|
if(WIN32 OR CYGWIN)
|
||||||
|
target_link_libraries(module INTERFACE $<BUILD_INTERFACE:${PYTHON_LIBRARIES}>)
|
||||||
|
elseif(APPLE)
|
||||||
|
target_link_libraries(module INTERFACE "-undefined dynamic_lookup")
|
||||||
|
endif()
|
||||||
|
|
||||||
|
add_library(embed INTERFACE)
|
||||||
|
add_library(pybind11::embed ALIAS embed)
|
||||||
|
target_link_libraries(embed INTERFACE pybind11::pybind11 $<BUILD_INTERFACE:${PYTHON_LIBRARIES}>)
|
||||||
|
endif()
|
||||||
|
|
||||||
|
if (PYBIND11_INSTALL)
|
||||||
|
install(DIRECTORY ${PYBIND11_INCLUDE_DIR}/pybind11 DESTINATION ${CMAKE_INSTALL_INCLUDEDIR})
|
||||||
|
# GNUInstallDirs "DATADIR" wrong here; CMake search path wants "share".
|
||||||
|
set(PYBIND11_CMAKECONFIG_INSTALL_DIR "share/cmake/${PROJECT_NAME}" CACHE STRING "install path for pybind11Config.cmake")
|
||||||
|
|
||||||
|
configure_package_config_file(tools/${PROJECT_NAME}Config.cmake.in
|
||||||
|
"${CMAKE_CURRENT_BINARY_DIR}/${PROJECT_NAME}Config.cmake"
|
||||||
|
INSTALL_DESTINATION ${PYBIND11_CMAKECONFIG_INSTALL_DIR})
|
||||||
|
# Remove CMAKE_SIZEOF_VOID_P from ConfigVersion.cmake since the library does
|
||||||
|
# not depend on architecture specific settings or libraries.
|
||||||
|
set(_PYBIND11_CMAKE_SIZEOF_VOID_P ${CMAKE_SIZEOF_VOID_P})
|
||||||
|
unset(CMAKE_SIZEOF_VOID_P)
|
||||||
|
write_basic_package_version_file(${CMAKE_CURRENT_BINARY_DIR}/${PROJECT_NAME}ConfigVersion.cmake
|
||||||
|
VERSION ${${PROJECT_NAME}_VERSION}
|
||||||
|
COMPATIBILITY AnyNewerVersion)
|
||||||
|
set(CMAKE_SIZEOF_VOID_P ${_PYBIND11_CMAKE_SIZEOF_VOID_P})
|
||||||
|
install(FILES ${CMAKE_CURRENT_BINARY_DIR}/${PROJECT_NAME}Config.cmake
|
||||||
|
${CMAKE_CURRENT_BINARY_DIR}/${PROJECT_NAME}ConfigVersion.cmake
|
||||||
|
tools/FindPythonLibsNew.cmake
|
||||||
|
tools/pybind11Tools.cmake
|
||||||
|
DESTINATION ${PYBIND11_CMAKECONFIG_INSTALL_DIR})
|
||||||
|
|
||||||
|
if(NOT (CMAKE_VERSION VERSION_LESS 3.0))
|
||||||
|
if(NOT PYBIND11_EXPORT_NAME)
|
||||||
|
set(PYBIND11_EXPORT_NAME "${PROJECT_NAME}Targets")
|
||||||
|
endif()
|
||||||
|
|
||||||
|
install(TARGETS pybind11 module embed
|
||||||
|
EXPORT "${PYBIND11_EXPORT_NAME}")
|
||||||
|
if(PYBIND11_MASTER_PROJECT)
|
||||||
|
install(EXPORT "${PYBIND11_EXPORT_NAME}"
|
||||||
|
NAMESPACE "${PROJECT_NAME}::"
|
||||||
|
DESTINATION ${PYBIND11_CMAKECONFIG_INSTALL_DIR})
|
||||||
|
endif()
|
||||||
|
endif()
|
||||||
|
endif()
|
|
@ -0,0 +1,49 @@
|
||||||
|
Thank you for your interest in this project! Please refer to the following
|
||||||
|
sections on how to contribute code and bug reports.
|
||||||
|
|
||||||
|
### Reporting bugs
|
||||||
|
|
||||||
|
At the moment, this project is run in the spare time of a single person
|
||||||
|
([Wenzel Jakob](http://rgl.epfl.ch/people/wjakob)) with very limited resources
|
||||||
|
for issue tracker tickets. Thus, before submitting a question or bug report,
|
||||||
|
please take a moment of your time and ensure that your issue isn't already
|
||||||
|
discussed in the project documentation provided at
|
||||||
|
[http://pybind11.readthedocs.org/en/latest](http://pybind11.readthedocs.org/en/latest).
|
||||||
|
|
||||||
|
Assuming that you have identified a previously unknown problem or an important
|
||||||
|
question, it's essential that you submit a self-contained and minimal piece of
|
||||||
|
code that reproduces the problem. In other words: no external dependencies,
|
||||||
|
isolate the function(s) that cause breakage, submit matched and complete C++
|
||||||
|
and Python snippets that can be easily compiled and run on my end.
|
||||||
|
|
||||||
|
## Pull requests
|
||||||
|
Contributions are submitted, reviewed, and accepted using Github pull requests.
|
||||||
|
Please refer to [this
|
||||||
|
article](https://help.github.com/articles/using-pull-requests) for details and
|
||||||
|
adhere to the following rules to make the process as smooth as possible:
|
||||||
|
|
||||||
|
* Make a new branch for every feature you're working on.
|
||||||
|
* Make small and clean pull requests that are easy to review but make sure they
|
||||||
|
do add value by themselves.
|
||||||
|
* Add tests for any new functionality and run the test suite (``make pytest``)
|
||||||
|
to ensure that no existing features break.
|
||||||
|
* Please run ``flake8`` and ``tools/check-style.sh`` to check your code matches
|
||||||
|
the project style. (Note that ``check-style.sh`` requires ``gawk``.)
|
||||||
|
* This project has a strong focus on providing general solutions using a
|
||||||
|
minimal amount of code, thus small pull requests are greatly preferred.
|
||||||
|
|
||||||
|
### Licensing of contributions
|
||||||
|
|
||||||
|
pybind11 is provided under a BSD-style license that can be found in the
|
||||||
|
``LICENSE`` file. By using, distributing, or contributing to this project, you
|
||||||
|
agree to the terms and conditions of this license.
|
||||||
|
|
||||||
|
You are under no obligation whatsoever to provide any bug fixes, patches, or
|
||||||
|
upgrades to the features, functionality or performance of the source code
|
||||||
|
("Enhancements") to anyone; however, if you choose to make your Enhancements
|
||||||
|
available either publicly, or directly to the author of this software, without
|
||||||
|
imposing a separate written license agreement for such Enhancements, then you
|
||||||
|
hereby grant the following license: a non-exclusive, royalty-free perpetual
|
||||||
|
license to install, use, modify, prepare derivative works, incorporate into
|
||||||
|
other computer software, distribute, and sublicense such enhancements or
|
||||||
|
derivative works thereof, in binary and source code form.
|
|
@ -0,0 +1,17 @@
|
||||||
|
Make sure you've completed the following steps before submitting your issue -- thank you!
|
||||||
|
|
||||||
|
1. Check if your question has already been answered in the [FAQ](http://pybind11.readthedocs.io/en/latest/faq.html) section.
|
||||||
|
2. Make sure you've read the [documentation](http://pybind11.readthedocs.io/en/latest/). Your issue may be addressed there.
|
||||||
|
3. If those resources didn't help and you only have a short question (not a bug report), consider asking in the [Gitter chat room](https://gitter.im/pybind/Lobby).
|
||||||
|
4. If you have a genuine bug report or a more complex question which is not answered in the previous items (or not suitable for chat), please fill in the details below.
|
||||||
|
5. Include a self-contained and minimal piece of code that reproduces the problem. If that's not possible, try to make the description as clear as possible.
|
||||||
|
|
||||||
|
*After reading, remove this checklist and the template text in parentheses below.*
|
||||||
|
|
||||||
|
## Issue description
|
||||||
|
|
||||||
|
(Provide a short description, state the expected behavior and what actually happens.)
|
||||||
|
|
||||||
|
## Reproducible example code
|
||||||
|
|
||||||
|
(The code should be minimal, have no external dependencies, isolate the function(s) that cause breakage. Submit matched and complete C++ and Python snippets that can be easily compiled and run to diagnose the issue.)
|
|
@ -0,0 +1,29 @@
|
||||||
|
Copyright (c) 2016 Wenzel Jakob <wenzel.jakob@epfl.ch>, All rights reserved.
|
||||||
|
|
||||||
|
Redistribution and use in source and binary forms, with or without
|
||||||
|
modification, are permitted provided that the following conditions are met:
|
||||||
|
|
||||||
|
1. Redistributions of source code must retain the above copyright notice, this
|
||||||
|
list of conditions and the following disclaimer.
|
||||||
|
|
||||||
|
2. Redistributions in binary form must reproduce the above copyright notice,
|
||||||
|
this list of conditions and the following disclaimer in the documentation
|
||||||
|
and/or other materials provided with the distribution.
|
||||||
|
|
||||||
|
3. Neither the name of the copyright holder nor the names of its contributors
|
||||||
|
may be used to endorse or promote products derived from this software
|
||||||
|
without specific prior written permission.
|
||||||
|
|
||||||
|
THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
|
||||||
|
ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
|
||||||
|
WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
|
||||||
|
DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE
|
||||||
|
FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
|
||||||
|
DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
|
||||||
|
SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
|
||||||
|
CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
|
||||||
|
OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
|
||||||
|
OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
|
||||||
|
|
||||||
|
Please also refer to the file CONTRIBUTING.md, which clarifies licensing of
|
||||||
|
external contributions to this project including patches, pull requests, etc.
|
|
@ -0,0 +1,2 @@
|
||||||
|
recursive-include include/pybind11 *.h
|
||||||
|
include LICENSE README.md CONTRIBUTING.md
|
|
@ -0,0 +1,129 @@
|
||||||
|

|
||||||
|
|
||||||
|
# pybind11 — Seamless operability between C++11 and Python
|
||||||
|
|
||||||
|
[](http://pybind11.readthedocs.org/en/master/?badge=master)
|
||||||
|
[](http://pybind11.readthedocs.org/en/stable/?badge=stable)
|
||||||
|
[](https://gitter.im/pybind/Lobby)
|
||||||
|
[](https://travis-ci.org/pybind/pybind11)
|
||||||
|
[](https://ci.appveyor.com/project/wjakob/pybind11)
|
||||||
|
|
||||||
|
**pybind11** is a lightweight header-only library that exposes C++ types in Python
|
||||||
|
and vice versa, mainly to create Python bindings of existing C++ code. Its
|
||||||
|
goals and syntax are similar to the excellent
|
||||||
|
[Boost.Python](http://www.boost.org/doc/libs/1_58_0/libs/python/doc/) library
|
||||||
|
by David Abrahams: to minimize boilerplate code in traditional extension
|
||||||
|
modules by inferring type information using compile-time introspection.
|
||||||
|
|
||||||
|
The main issue with Boost.Python—and the reason for creating such a similar
|
||||||
|
project—is Boost. Boost is an enormously large and complex suite of utility
|
||||||
|
libraries that works with almost every C++ compiler in existence. This
|
||||||
|
compatibility has its cost: arcane template tricks and workarounds are
|
||||||
|
necessary to support the oldest and buggiest of compiler specimens. Now that
|
||||||
|
C++11-compatible compilers are widely available, this heavy machinery has
|
||||||
|
become an excessively large and unnecessary dependency.
|
||||||
|
|
||||||
|
Think of this library as a tiny self-contained version of Boost.Python with
|
||||||
|
everything stripped away that isn't relevant for binding generation. Without
|
||||||
|
comments, the core header files only require ~4K lines of code and depend on
|
||||||
|
Python (2.7 or 3.x, or PyPy2.7 >= 5.7) and the C++ standard library. This
|
||||||
|
compact implementation was possible thanks to some of the new C++11 language
|
||||||
|
features (specifically: tuples, lambda functions and variadic templates). Since
|
||||||
|
its creation, this library has grown beyond Boost.Python in many ways, leading
|
||||||
|
to dramatically simpler binding code in many common situations.
|
||||||
|
|
||||||
|
Tutorial and reference documentation is provided at
|
||||||
|
[http://pybind11.readthedocs.org/en/master](http://pybind11.readthedocs.org/en/master).
|
||||||
|
A PDF version of the manual is available
|
||||||
|
[here](https://media.readthedocs.org/pdf/pybind11/master/pybind11.pdf).
|
||||||
|
|
||||||
|
## Core features
|
||||||
|
pybind11 can map the following core C++ features to Python
|
||||||
|
|
||||||
|
- Functions accepting and returning custom data structures per value, reference, or pointer
|
||||||
|
- Instance methods and static methods
|
||||||
|
- Overloaded functions
|
||||||
|
- Instance attributes and static attributes
|
||||||
|
- Arbitrary exception types
|
||||||
|
- Enumerations
|
||||||
|
- Callbacks
|
||||||
|
- Iterators and ranges
|
||||||
|
- Custom operators
|
||||||
|
- Single and multiple inheritance
|
||||||
|
- STL data structures
|
||||||
|
- Smart pointers with reference counting like ``std::shared_ptr``
|
||||||
|
- Internal references with correct reference counting
|
||||||
|
- C++ classes with virtual (and pure virtual) methods can be extended in Python
|
||||||
|
|
||||||
|
## Goodies
|
||||||
|
In addition to the core functionality, pybind11 provides some extra goodies:
|
||||||
|
|
||||||
|
- Python 2.7, 3.x, and PyPy (PyPy2.7 >= 5.7) are supported with an
|
||||||
|
implementation-agnostic interface.
|
||||||
|
|
||||||
|
- It is possible to bind C++11 lambda functions with captured variables. The
|
||||||
|
lambda capture data is stored inside the resulting Python function object.
|
||||||
|
|
||||||
|
- pybind11 uses C++11 move constructors and move assignment operators whenever
|
||||||
|
possible to efficiently transfer custom data types.
|
||||||
|
|
||||||
|
- It's easy to expose the internal storage of custom data types through
|
||||||
|
Pythons' buffer protocols. This is handy e.g. for fast conversion between
|
||||||
|
C++ matrix classes like Eigen and NumPy without expensive copy operations.
|
||||||
|
|
||||||
|
- pybind11 can automatically vectorize functions so that they are transparently
|
||||||
|
applied to all entries of one or more NumPy array arguments.
|
||||||
|
|
||||||
|
- Python's slice-based access and assignment operations can be supported with
|
||||||
|
just a few lines of code.
|
||||||
|
|
||||||
|
- Everything is contained in just a few header files; there is no need to link
|
||||||
|
against any additional libraries.
|
||||||
|
|
||||||
|
- Binaries are generally smaller by a factor of at least 2 compared to
|
||||||
|
equivalent bindings generated by Boost.Python. A recent pybind11 conversion
|
||||||
|
of PyRosetta, an enormous Boost.Python binding project,
|
||||||
|
[reported](http://graylab.jhu.edu/RosettaCon2016/PyRosetta-4.pdf) a binary
|
||||||
|
size reduction of **5.4x** and compile time reduction by **5.8x**.
|
||||||
|
|
||||||
|
- Function signatures are precomputed at compile time (using ``constexpr``),
|
||||||
|
leading to smaller binaries.
|
||||||
|
|
||||||
|
- With little extra effort, C++ types can be pickled and unpickled similar to
|
||||||
|
regular Python objects.
|
||||||
|
|
||||||
|
## Supported compilers
|
||||||
|
|
||||||
|
1. Clang/LLVM 3.3 or newer (for Apple Xcode's clang, this is 5.0.0 or newer)
|
||||||
|
2. GCC 4.8 or newer
|
||||||
|
3. Microsoft Visual Studio 2015 Update 3 or newer
|
||||||
|
4. Intel C++ compiler 17 or newer (16 with pybind11 v2.0 and 15 with pybind11 v2.0 and a [workaround](https://github.com/pybind/pybind11/issues/276))
|
||||||
|
5. Cygwin/GCC (tested on 2.5.1)
|
||||||
|
|
||||||
|
## About
|
||||||
|
|
||||||
|
This project was created by [Wenzel Jakob](http://rgl.epfl.ch/people/wjakob).
|
||||||
|
Significant features and/or improvements to the code were contributed by
|
||||||
|
Jonas Adler,
|
||||||
|
Lori A. Burns,
|
||||||
|
Sylvain Corlay,
|
||||||
|
Trent Houliston,
|
||||||
|
Axel Huebl,
|
||||||
|
@hulucc,
|
||||||
|
Sergey Lyskov
|
||||||
|
Johan Mabille,
|
||||||
|
Tomasz Miąsko,
|
||||||
|
Dean Moldovan,
|
||||||
|
Ben Pritchard,
|
||||||
|
Jason Rhinelander,
|
||||||
|
Boris Schäling,
|
||||||
|
Pim Schellart,
|
||||||
|
Henry Schreiner,
|
||||||
|
Ivan Smirnov, and
|
||||||
|
Patrick Stewart.
|
||||||
|
|
||||||
|
### License
|
||||||
|
|
||||||
|
pybind11 is provided under a BSD-style license that can be found in the
|
||||||
|
``LICENSE`` file. By using, distributing, or contributing to this project,
|
||||||
|
you agree to the terms and conditions of this license.
|
|
@ -0,0 +1,20 @@
|
||||||
|
PROJECT_NAME = pybind11
|
||||||
|
INPUT = ../include/pybind11/
|
||||||
|
RECURSIVE = YES
|
||||||
|
|
||||||
|
GENERATE_HTML = NO
|
||||||
|
GENERATE_LATEX = NO
|
||||||
|
GENERATE_XML = YES
|
||||||
|
XML_OUTPUT = .build/doxygenxml
|
||||||
|
XML_PROGRAMLISTING = YES
|
||||||
|
|
||||||
|
MACRO_EXPANSION = YES
|
||||||
|
EXPAND_ONLY_PREDEF = YES
|
||||||
|
EXPAND_AS_DEFINED = PYBIND11_RUNTIME_EXCEPTION
|
||||||
|
|
||||||
|
ALIASES = "rst=\verbatim embed:rst"
|
||||||
|
ALIASES += "endrst=\endverbatim"
|
||||||
|
|
||||||
|
QUIET = YES
|
||||||
|
WARNINGS = YES
|
||||||
|
WARN_IF_UNDOCUMENTED = NO
|
|
@ -0,0 +1,11 @@
|
||||||
|
.wy-table-responsive table td,
|
||||||
|
.wy-table-responsive table th {
|
||||||
|
white-space: initial !important;
|
||||||
|
}
|
||||||
|
.rst-content table.docutils td {
|
||||||
|
vertical-align: top !important;
|
||||||
|
}
|
||||||
|
div[class^='highlight'] pre {
|
||||||
|
white-space: pre;
|
||||||
|
white-space: pre-wrap;
|
||||||
|
}
|
|
@ -0,0 +1,81 @@
|
||||||
|
Chrono
|
||||||
|
======
|
||||||
|
|
||||||
|
When including the additional header file :file:`pybind11/chrono.h` conversions
|
||||||
|
from C++11 chrono datatypes to python datetime objects are automatically enabled.
|
||||||
|
This header also enables conversions of python floats (often from sources such
|
||||||
|
as ``time.monotonic()``, ``time.perf_counter()`` and ``time.process_time()``)
|
||||||
|
into durations.
|
||||||
|
|
||||||
|
An overview of clocks in C++11
|
||||||
|
------------------------------
|
||||||
|
|
||||||
|
A point of confusion when using these conversions is the differences between
|
||||||
|
clocks provided in C++11. There are three clock types defined by the C++11
|
||||||
|
standard and users can define their own if needed. Each of these clocks have
|
||||||
|
different properties and when converting to and from python will give different
|
||||||
|
results.
|
||||||
|
|
||||||
|
The first clock defined by the standard is ``std::chrono::system_clock``. This
|
||||||
|
clock measures the current date and time. However, this clock changes with to
|
||||||
|
updates to the operating system time. For example, if your time is synchronised
|
||||||
|
with a time server this clock will change. This makes this clock a poor choice
|
||||||
|
for timing purposes but good for measuring the wall time.
|
||||||
|
|
||||||
|
The second clock defined in the standard is ``std::chrono::steady_clock``.
|
||||||
|
This clock ticks at a steady rate and is never adjusted. This makes it excellent
|
||||||
|
for timing purposes, however the value in this clock does not correspond to the
|
||||||
|
current date and time. Often this clock will be the amount of time your system
|
||||||
|
has been on, although it does not have to be. This clock will never be the same
|
||||||
|
clock as the system clock as the system clock can change but steady clocks
|
||||||
|
cannot.
|
||||||
|
|
||||||
|
The third clock defined in the standard is ``std::chrono::high_resolution_clock``.
|
||||||
|
This clock is the clock that has the highest resolution out of the clocks in the
|
||||||
|
system. It is normally a typedef to either the system clock or the steady clock
|
||||||
|
but can be its own independent clock. This is important as when using these
|
||||||
|
conversions as the types you get in python for this clock might be different
|
||||||
|
depending on the system.
|
||||||
|
If it is a typedef of the system clock, python will get datetime objects, but if
|
||||||
|
it is a different clock they will be timedelta objects.
|
||||||
|
|
||||||
|
Provided conversions
|
||||||
|
--------------------
|
||||||
|
|
||||||
|
.. rubric:: C++ to Python
|
||||||
|
|
||||||
|
- ``std::chrono::system_clock::time_point`` → ``datetime.datetime``
|
||||||
|
System clock times are converted to python datetime instances. They are
|
||||||
|
in the local timezone, but do not have any timezone information attached
|
||||||
|
to them (they are naive datetime objects).
|
||||||
|
|
||||||
|
- ``std::chrono::duration`` → ``datetime.timedelta``
|
||||||
|
Durations are converted to timedeltas, any precision in the duration
|
||||||
|
greater than microseconds is lost by rounding towards zero.
|
||||||
|
|
||||||
|
- ``std::chrono::[other_clocks]::time_point`` → ``datetime.timedelta``
|
||||||
|
Any clock time that is not the system clock is converted to a time delta.
|
||||||
|
This timedelta measures the time from the clocks epoch to now.
|
||||||
|
|
||||||
|
.. rubric:: Python to C++
|
||||||
|
|
||||||
|
- ``datetime.datetime`` → ``std::chrono::system_clock::time_point``
|
||||||
|
Date/time objects are converted into system clock timepoints. Any
|
||||||
|
timezone information is ignored and the type is treated as a naive
|
||||||
|
object.
|
||||||
|
|
||||||
|
- ``datetime.timedelta`` → ``std::chrono::duration``
|
||||||
|
Time delta are converted into durations with microsecond precision.
|
||||||
|
|
||||||
|
- ``datetime.timedelta`` → ``std::chrono::[other_clocks]::time_point``
|
||||||
|
Time deltas that are converted into clock timepoints are treated as
|
||||||
|
the amount of time from the start of the clocks epoch.
|
||||||
|
|
||||||
|
- ``float`` → ``std::chrono::duration``
|
||||||
|
Floats that are passed to C++ as durations be interpreted as a number of
|
||||||
|
seconds. These will be converted to the duration using ``duration_cast``
|
||||||
|
from the float.
|
||||||
|
|
||||||
|
- ``float`` → ``std::chrono::[other_clocks]::time_point``
|
||||||
|
Floats that are passed to C++ as time points will be interpreted as the
|
||||||
|
number of seconds from the start of the clocks epoch.
|
|
@ -0,0 +1,91 @@
|
||||||
|
Custom type casters
|
||||||
|
===================
|
||||||
|
|
||||||
|
In very rare cases, applications may require custom type casters that cannot be
|
||||||
|
expressed using the abstractions provided by pybind11, thus requiring raw
|
||||||
|
Python C API calls. This is fairly advanced usage and should only be pursued by
|
||||||
|
experts who are familiar with the intricacies of Python reference counting.
|
||||||
|
|
||||||
|
The following snippets demonstrate how this works for a very simple ``inty``
|
||||||
|
type that that should be convertible from Python types that provide a
|
||||||
|
``__int__(self)`` method.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
struct inty { long long_value; };
|
||||||
|
|
||||||
|
void print(inty s) {
|
||||||
|
std::cout << s.long_value << std::endl;
|
||||||
|
}
|
||||||
|
|
||||||
|
The following Python snippet demonstrates the intended usage from the Python side:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
class A:
|
||||||
|
def __int__(self):
|
||||||
|
return 123
|
||||||
|
|
||||||
|
from example import print
|
||||||
|
print(A())
|
||||||
|
|
||||||
|
To register the necessary conversion routines, it is necessary to add
|
||||||
|
a partial overload to the ``pybind11::detail::type_caster<T>`` template.
|
||||||
|
Although this is an implementation detail, adding partial overloads to this
|
||||||
|
type is explicitly allowed.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
namespace pybind11 { namespace detail {
|
||||||
|
template <> struct type_caster<inty> {
|
||||||
|
public:
|
||||||
|
/**
|
||||||
|
* This macro establishes the name 'inty' in
|
||||||
|
* function signatures and declares a local variable
|
||||||
|
* 'value' of type inty
|
||||||
|
*/
|
||||||
|
PYBIND11_TYPE_CASTER(inty, _("inty"));
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Conversion part 1 (Python->C++): convert a PyObject into a inty
|
||||||
|
* instance or return false upon failure. The second argument
|
||||||
|
* indicates whether implicit conversions should be applied.
|
||||||
|
*/
|
||||||
|
bool load(handle src, bool) {
|
||||||
|
/* Extract PyObject from handle */
|
||||||
|
PyObject *source = src.ptr();
|
||||||
|
/* Try converting into a Python integer value */
|
||||||
|
PyObject *tmp = PyNumber_Long(source);
|
||||||
|
if (!tmp)
|
||||||
|
return false;
|
||||||
|
/* Now try to convert into a C++ int */
|
||||||
|
value.long_value = PyLong_AsLong(tmp);
|
||||||
|
Py_DECREF(tmp);
|
||||||
|
/* Ensure return code was OK (to avoid out-of-range errors etc) */
|
||||||
|
return !(value.long_value == -1 && !PyErr_Occurred());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Conversion part 2 (C++ -> Python): convert an inty instance into
|
||||||
|
* a Python object. The second and third arguments are used to
|
||||||
|
* indicate the return value policy and parent object (for
|
||||||
|
* ``return_value_policy::reference_internal``) and are generally
|
||||||
|
* ignored by implicit casters.
|
||||||
|
*/
|
||||||
|
static handle cast(inty src, return_value_policy /* policy */, handle /* parent */) {
|
||||||
|
return PyLong_FromLong(src.long_value);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}} // namespace pybind11::detail
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
A ``type_caster<T>`` defined with ``PYBIND11_TYPE_CASTER(T, ...)`` requires
|
||||||
|
that ``T`` is default-constructible (``value`` is first default constructed
|
||||||
|
and then ``load()`` assigns to it).
|
||||||
|
|
||||||
|
.. warning::
|
||||||
|
|
||||||
|
When using custom type casters, it's important to declare them consistently
|
||||||
|
in every compilation unit of the Python extension module. Otherwise,
|
||||||
|
undefined behavior can ensue.
|
|
@ -0,0 +1,310 @@
|
||||||
|
Eigen
|
||||||
|
#####
|
||||||
|
|
||||||
|
`Eigen <http://eigen.tuxfamily.org>`_ is C++ header-based library for dense and
|
||||||
|
sparse linear algebra. Due to its popularity and widespread adoption, pybind11
|
||||||
|
provides transparent conversion and limited mapping support between Eigen and
|
||||||
|
Scientific Python linear algebra data types.
|
||||||
|
|
||||||
|
To enable the built-in Eigen support you must include the optional header file
|
||||||
|
:file:`pybind11/eigen.h`.
|
||||||
|
|
||||||
|
Pass-by-value
|
||||||
|
=============
|
||||||
|
|
||||||
|
When binding a function with ordinary Eigen dense object arguments (for
|
||||||
|
example, ``Eigen::MatrixXd``), pybind11 will accept any input value that is
|
||||||
|
already (or convertible to) a ``numpy.ndarray`` with dimensions compatible with
|
||||||
|
the Eigen type, copy its values into a temporary Eigen variable of the
|
||||||
|
appropriate type, then call the function with this temporary variable.
|
||||||
|
|
||||||
|
Sparse matrices are similarly copied to or from
|
||||||
|
``scipy.sparse.csr_matrix``/``scipy.sparse.csc_matrix`` objects.
|
||||||
|
|
||||||
|
Pass-by-reference
|
||||||
|
=================
|
||||||
|
|
||||||
|
One major limitation of the above is that every data conversion implicitly
|
||||||
|
involves a copy, which can be both expensive (for large matrices) and disallows
|
||||||
|
binding functions that change their (Matrix) arguments. Pybind11 allows you to
|
||||||
|
work around this by using Eigen's ``Eigen::Ref<MatrixType>`` class much as you
|
||||||
|
would when writing a function taking a generic type in Eigen itself (subject to
|
||||||
|
some limitations discussed below).
|
||||||
|
|
||||||
|
When calling a bound function accepting a ``Eigen::Ref<const MatrixType>``
|
||||||
|
type, pybind11 will attempt to avoid copying by using an ``Eigen::Map`` object
|
||||||
|
that maps into the source ``numpy.ndarray`` data: this requires both that the
|
||||||
|
data types are the same (e.g. ``dtype='float64'`` and ``MatrixType::Scalar`` is
|
||||||
|
``double``); and that the storage is layout compatible. The latter limitation
|
||||||
|
is discussed in detail in the section below, and requires careful
|
||||||
|
consideration: by default, numpy matrices and Eigen matrices are *not* storage
|
||||||
|
compatible.
|
||||||
|
|
||||||
|
If the numpy matrix cannot be used as is (either because its types differ, e.g.
|
||||||
|
passing an array of integers to an Eigen parameter requiring doubles, or
|
||||||
|
because the storage is incompatible), pybind11 makes a temporary copy and
|
||||||
|
passes the copy instead.
|
||||||
|
|
||||||
|
When a bound function parameter is instead ``Eigen::Ref<MatrixType>`` (note the
|
||||||
|
lack of ``const``), pybind11 will only allow the function to be called if it
|
||||||
|
can be mapped *and* if the numpy array is writeable (that is
|
||||||
|
``a.flags.writeable`` is true). Any access (including modification) made to
|
||||||
|
the passed variable will be transparently carried out directly on the
|
||||||
|
``numpy.ndarray``.
|
||||||
|
|
||||||
|
This means you can can write code such as the following and have it work as
|
||||||
|
expected:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void scale_by_2(Eigen::Ref<Eigen::VectorXd> v) {
|
||||||
|
v *= 2;
|
||||||
|
}
|
||||||
|
|
||||||
|
Note, however, that you will likely run into limitations due to numpy and
|
||||||
|
Eigen's difference default storage order for data; see the below section on
|
||||||
|
:ref:`storage_orders` for details on how to bind code that won't run into such
|
||||||
|
limitations.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
Passing by reference is not supported for sparse types.
|
||||||
|
|
||||||
|
Returning values to Python
|
||||||
|
==========================
|
||||||
|
|
||||||
|
When returning an ordinary dense Eigen matrix type to numpy (e.g.
|
||||||
|
``Eigen::MatrixXd`` or ``Eigen::RowVectorXf``) pybind11 keeps the matrix and
|
||||||
|
returns a numpy array that directly references the Eigen matrix: no copy of the
|
||||||
|
data is performed. The numpy array will have ``array.flags.owndata`` set to
|
||||||
|
``False`` to indicate that it does not own the data, and the lifetime of the
|
||||||
|
stored Eigen matrix will be tied to the returned ``array``.
|
||||||
|
|
||||||
|
If you bind a function with a non-reference, ``const`` return type (e.g.
|
||||||
|
``const Eigen::MatrixXd``), the same thing happens except that pybind11 also
|
||||||
|
sets the numpy array's ``writeable`` flag to false.
|
||||||
|
|
||||||
|
If you return an lvalue reference or pointer, the usual pybind11 rules apply,
|
||||||
|
as dictated by the binding function's return value policy (see the
|
||||||
|
documentation on :ref:`return_value_policies` for full details). That means,
|
||||||
|
without an explicit return value policy, lvalue references will be copied and
|
||||||
|
pointers will be managed by pybind11. In order to avoid copying, you should
|
||||||
|
explicitly specify an appropriate return value policy, as in the following
|
||||||
|
example:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
class MyClass {
|
||||||
|
Eigen::MatrixXd big_mat = Eigen::MatrixXd::Zero(10000, 10000);
|
||||||
|
public:
|
||||||
|
Eigen::MatrixXd &getMatrix() { return big_mat; }
|
||||||
|
const Eigen::MatrixXd &viewMatrix() { return big_mat; }
|
||||||
|
};
|
||||||
|
|
||||||
|
// Later, in binding code:
|
||||||
|
py::class_<MyClass>(m, "MyClass")
|
||||||
|
.def(py::init<>())
|
||||||
|
.def("copy_matrix", &MyClass::getMatrix) // Makes a copy!
|
||||||
|
.def("get_matrix", &MyClass::getMatrix, py::return_value_policy::reference_internal)
|
||||||
|
.def("view_matrix", &MyClass::viewMatrix, py::return_value_policy::reference_internal)
|
||||||
|
;
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
a = MyClass()
|
||||||
|
m = a.get_matrix() # flags.writeable = True, flags.owndata = False
|
||||||
|
v = a.view_matrix() # flags.writeable = False, flags.owndata = False
|
||||||
|
c = a.copy_matrix() # flags.writeable = True, flags.owndata = True
|
||||||
|
# m[5,6] and v[5,6] refer to the same element, c[5,6] does not.
|
||||||
|
|
||||||
|
Note in this example that ``py::return_value_policy::reference_internal`` is
|
||||||
|
used to tie the life of the MyClass object to the life of the returned arrays.
|
||||||
|
|
||||||
|
You may also return an ``Eigen::Ref``, ``Eigen::Map`` or other map-like Eigen
|
||||||
|
object (for example, the return value of ``matrix.block()`` and related
|
||||||
|
methods) that map into a dense Eigen type. When doing so, the default
|
||||||
|
behaviour of pybind11 is to simply reference the returned data: you must take
|
||||||
|
care to ensure that this data remains valid! You may ask pybind11 to
|
||||||
|
explicitly *copy* such a return value by using the
|
||||||
|
``py::return_value_policy::copy`` policy when binding the function. You may
|
||||||
|
also use ``py::return_value_policy::reference_internal`` or a
|
||||||
|
``py::keep_alive`` to ensure the data stays valid as long as the returned numpy
|
||||||
|
array does.
|
||||||
|
|
||||||
|
When returning such a reference of map, pybind11 additionally respects the
|
||||||
|
readonly-status of the returned value, marking the numpy array as non-writeable
|
||||||
|
if the reference or map was itself read-only.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
Sparse types are always copied when returned.
|
||||||
|
|
||||||
|
.. _storage_orders:
|
||||||
|
|
||||||
|
Storage orders
|
||||||
|
==============
|
||||||
|
|
||||||
|
Passing arguments via ``Eigen::Ref`` has some limitations that you must be
|
||||||
|
aware of in order to effectively pass matrices by reference. First and
|
||||||
|
foremost is that the default ``Eigen::Ref<MatrixType>`` class requires
|
||||||
|
contiguous storage along columns (for column-major types, the default in Eigen)
|
||||||
|
or rows if ``MatrixType`` is specifically an ``Eigen::RowMajor`` storage type.
|
||||||
|
The former, Eigen's default, is incompatible with ``numpy``'s default row-major
|
||||||
|
storage, and so you will not be able to pass numpy arrays to Eigen by reference
|
||||||
|
without making one of two changes.
|
||||||
|
|
||||||
|
(Note that this does not apply to vectors (or column or row matrices): for such
|
||||||
|
types the "row-major" and "column-major" distinction is meaningless).
|
||||||
|
|
||||||
|
The first approach is to change the use of ``Eigen::Ref<MatrixType>`` to the
|
||||||
|
more general ``Eigen::Ref<MatrixType, 0, Eigen::Stride<Eigen::Dynamic,
|
||||||
|
Eigen::Dynamic>>`` (or similar type with a fully dynamic stride type in the
|
||||||
|
third template argument). Since this is a rather cumbersome type, pybind11
|
||||||
|
provides a ``py::EigenDRef<MatrixType>`` type alias for your convenience (along
|
||||||
|
with EigenDMap for the equivalent Map, and EigenDStride for just the stride
|
||||||
|
type).
|
||||||
|
|
||||||
|
This type allows Eigen to map into any arbitrary storage order. This is not
|
||||||
|
the default in Eigen for performance reasons: contiguous storage allows
|
||||||
|
vectorization that cannot be done when storage is not known to be contiguous at
|
||||||
|
compile time. The default ``Eigen::Ref`` stride type allows non-contiguous
|
||||||
|
storage along the outer dimension (that is, the rows of a column-major matrix
|
||||||
|
or columns of a row-major matrix), but not along the inner dimension.
|
||||||
|
|
||||||
|
This type, however, has the added benefit of also being able to map numpy array
|
||||||
|
slices. For example, the following (contrived) example uses Eigen with a numpy
|
||||||
|
slice to multiply by 2 all coefficients that are both on even rows (0, 2, 4,
|
||||||
|
...) and in columns 2, 5, or 8:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("scale", [](py::EigenDRef<Eigen::MatrixXd> m, double c) { m *= c; });
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
# a = np.array(...)
|
||||||
|
scale_by_2(myarray[0::2, 2:9:3])
|
||||||
|
|
||||||
|
The second approach to avoid copying is more intrusive: rearranging the
|
||||||
|
underlying data types to not run into the non-contiguous storage problem in the
|
||||||
|
first place. In particular, that means using matrices with ``Eigen::RowMajor``
|
||||||
|
storage, where appropriate, such as:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
using RowMatrixXd = Eigen::Matrix<double, Eigen::Dynamic, Eigen::Dynamic, Eigen::RowMajor>;
|
||||||
|
// Use RowMatrixXd instead of MatrixXd
|
||||||
|
|
||||||
|
Now bound functions accepting ``Eigen::Ref<RowMatrixXd>`` arguments will be
|
||||||
|
callable with numpy's (default) arrays without involving a copying.
|
||||||
|
|
||||||
|
You can, alternatively, change the storage order that numpy arrays use by
|
||||||
|
adding the ``order='F'`` option when creating an array:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
myarray = np.array(source, order='F')
|
||||||
|
|
||||||
|
Such an object will be passable to a bound function accepting an
|
||||||
|
``Eigen::Ref<MatrixXd>`` (or similar column-major Eigen type).
|
||||||
|
|
||||||
|
One major caveat with this approach, however, is that it is not entirely as
|
||||||
|
easy as simply flipping all Eigen or numpy usage from one to the other: some
|
||||||
|
operations may alter the storage order of a numpy array. For example, ``a2 =
|
||||||
|
array.transpose()`` results in ``a2`` being a view of ``array`` that references
|
||||||
|
the same data, but in the opposite storage order!
|
||||||
|
|
||||||
|
While this approach allows fully optimized vectorized calculations in Eigen, it
|
||||||
|
cannot be used with array slices, unlike the first approach.
|
||||||
|
|
||||||
|
When *returning* a matrix to Python (either a regular matrix, a reference via
|
||||||
|
``Eigen::Ref<>``, or a map/block into a matrix), no special storage
|
||||||
|
consideration is required: the created numpy array will have the required
|
||||||
|
stride that allows numpy to properly interpret the array, whatever its storage
|
||||||
|
order.
|
||||||
|
|
||||||
|
Failing rather than copying
|
||||||
|
===========================
|
||||||
|
|
||||||
|
The default behaviour when binding ``Eigen::Ref<const MatrixType>`` Eigen
|
||||||
|
references is to copy matrix values when passed a numpy array that does not
|
||||||
|
conform to the element type of ``MatrixType`` or does not have a compatible
|
||||||
|
stride layout. If you want to explicitly avoid copying in such a case, you
|
||||||
|
should bind arguments using the ``py::arg().noconvert()`` annotation (as
|
||||||
|
described in the :ref:`nonconverting_arguments` documentation).
|
||||||
|
|
||||||
|
The following example shows an example of arguments that don't allow data
|
||||||
|
copying to take place:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// The method and function to be bound:
|
||||||
|
class MyClass {
|
||||||
|
// ...
|
||||||
|
double some_method(const Eigen::Ref<const MatrixXd> &matrix) { /* ... */ }
|
||||||
|
};
|
||||||
|
float some_function(const Eigen::Ref<const MatrixXf> &big,
|
||||||
|
const Eigen::Ref<const MatrixXf> &small) {
|
||||||
|
// ...
|
||||||
|
}
|
||||||
|
|
||||||
|
// The associated binding code:
|
||||||
|
using namespace pybind11::literals; // for "arg"_a
|
||||||
|
py::class_<MyClass>(m, "MyClass")
|
||||||
|
// ... other class definitions
|
||||||
|
.def("some_method", &MyClass::some_method, py::arg().noconvert());
|
||||||
|
|
||||||
|
m.def("some_function", &some_function,
|
||||||
|
"big"_a.noconvert(), // <- Don't allow copying for this arg
|
||||||
|
"small"_a // <- This one can be copied if needed
|
||||||
|
);
|
||||||
|
|
||||||
|
With the above binding code, attempting to call the the ``some_method(m)``
|
||||||
|
method on a ``MyClass`` object, or attempting to call ``some_function(m, m2)``
|
||||||
|
will raise a ``RuntimeError`` rather than making a temporary copy of the array.
|
||||||
|
It will, however, allow the ``m2`` argument to be copied into a temporary if
|
||||||
|
necessary.
|
||||||
|
|
||||||
|
Note that explicitly specifying ``.noconvert()`` is not required for *mutable*
|
||||||
|
Eigen references (e.g. ``Eigen::Ref<MatrixXd>`` without ``const`` on the
|
||||||
|
``MatrixXd``): mutable references will never be called with a temporary copy.
|
||||||
|
|
||||||
|
Vectors versus column/row matrices
|
||||||
|
==================================
|
||||||
|
|
||||||
|
Eigen and numpy have fundamentally different notions of a vector. In Eigen, a
|
||||||
|
vector is simply a matrix with the number of columns or rows set to 1 at
|
||||||
|
compile time (for a column vector or row vector, respectively). Numpy, in
|
||||||
|
contrast, has comparable 2-dimensional 1xN and Nx1 arrays, but *also* has
|
||||||
|
1-dimensional arrays of size N.
|
||||||
|
|
||||||
|
When passing a 2-dimensional 1xN or Nx1 array to Eigen, the Eigen type must
|
||||||
|
have matching dimensions: That is, you cannot pass a 2-dimensional Nx1 numpy
|
||||||
|
array to an Eigen value expecting a row vector, or a 1xN numpy array as a
|
||||||
|
column vector argument.
|
||||||
|
|
||||||
|
On the other hand, pybind11 allows you to pass 1-dimensional arrays of length N
|
||||||
|
as Eigen parameters. If the Eigen type can hold a column vector of length N it
|
||||||
|
will be passed as such a column vector. If not, but the Eigen type constraints
|
||||||
|
will accept a row vector, it will be passed as a row vector. (The column
|
||||||
|
vector takes precedence when both are supported, for example, when passing a
|
||||||
|
1D numpy array to a MatrixXd argument). Note that the type need not be
|
||||||
|
explicitly a vector: it is permitted to pass a 1D numpy array of size 5 to an
|
||||||
|
Eigen ``Matrix<double, Dynamic, 5>``: you would end up with a 1x5 Eigen matrix.
|
||||||
|
Passing the same to an ``Eigen::MatrixXd`` would result in a 5x1 Eigen matrix.
|
||||||
|
|
||||||
|
When returning an Eigen vector to numpy, the conversion is ambiguous: a row
|
||||||
|
vector of length 4 could be returned as either a 1D array of length 4, or as a
|
||||||
|
2D array of size 1x4. When encountering such a situation, pybind11 compromises
|
||||||
|
by considering the returned Eigen type: if it is a compile-time vector--that
|
||||||
|
is, the type has either the number of rows or columns set to 1 at compile
|
||||||
|
time--pybind11 converts to a 1D numpy array when returning the value. For
|
||||||
|
instances that are a vector only at run-time (e.g. ``MatrixXd``,
|
||||||
|
``Matrix<float, Dynamic, 4>``), pybind11 returns the vector as a 2D array to
|
||||||
|
numpy. If this isn't want you want, you can use ``array.reshape(...)`` to get
|
||||||
|
a view of the same data in the desired dimensions.
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_eigen.cpp` contains a complete example that
|
||||||
|
shows how to pass Eigen sparse and dense data types in more detail.
|
|
@ -0,0 +1,109 @@
|
||||||
|
Functional
|
||||||
|
##########
|
||||||
|
|
||||||
|
The following features must be enabled by including :file:`pybind11/functional.h`.
|
||||||
|
|
||||||
|
|
||||||
|
Callbacks and passing anonymous functions
|
||||||
|
=========================================
|
||||||
|
|
||||||
|
The C++11 standard brought lambda functions and the generic polymorphic
|
||||||
|
function wrapper ``std::function<>`` to the C++ programming language, which
|
||||||
|
enable powerful new ways of working with functions. Lambda functions come in
|
||||||
|
two flavors: stateless lambda function resemble classic function pointers that
|
||||||
|
link to an anonymous piece of code, while stateful lambda functions
|
||||||
|
additionally depend on captured variables that are stored in an anonymous
|
||||||
|
*lambda closure object*.
|
||||||
|
|
||||||
|
Here is a simple example of a C++ function that takes an arbitrary function
|
||||||
|
(stateful or stateless) with signature ``int -> int`` as an argument and runs
|
||||||
|
it with the value 10.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
int func_arg(const std::function<int(int)> &f) {
|
||||||
|
return f(10);
|
||||||
|
}
|
||||||
|
|
||||||
|
The example below is more involved: it takes a function of signature ``int -> int``
|
||||||
|
and returns another function of the same kind. The return value is a stateful
|
||||||
|
lambda function, which stores the value ``f`` in the capture object and adds 1 to
|
||||||
|
its return value upon execution.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
std::function<int(int)> func_ret(const std::function<int(int)> &f) {
|
||||||
|
return [f](int i) {
|
||||||
|
return f(i) + 1;
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
This example demonstrates using python named parameters in C++ callbacks which
|
||||||
|
requires using ``py::cpp_function`` as a wrapper. Usage is similar to defining
|
||||||
|
methods of classes:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::cpp_function func_cpp() {
|
||||||
|
return py::cpp_function([](int i) { return i+1; },
|
||||||
|
py::arg("number"));
|
||||||
|
}
|
||||||
|
|
||||||
|
After including the extra header file :file:`pybind11/functional.h`, it is almost
|
||||||
|
trivial to generate binding code for all of these functions.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/functional.h>
|
||||||
|
|
||||||
|
PYBIND11_MODULE(example, m) {
|
||||||
|
m.def("func_arg", &func_arg);
|
||||||
|
m.def("func_ret", &func_ret);
|
||||||
|
m.def("func_cpp", &func_cpp);
|
||||||
|
}
|
||||||
|
|
||||||
|
The following interactive session shows how to call them from Python.
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
$ python
|
||||||
|
>>> import example
|
||||||
|
>>> def square(i):
|
||||||
|
... return i * i
|
||||||
|
...
|
||||||
|
>>> example.func_arg(square)
|
||||||
|
100L
|
||||||
|
>>> square_plus_1 = example.func_ret(square)
|
||||||
|
>>> square_plus_1(4)
|
||||||
|
17L
|
||||||
|
>>> plus_1 = func_cpp()
|
||||||
|
>>> plus_1(number=43)
|
||||||
|
44L
|
||||||
|
|
||||||
|
.. warning::
|
||||||
|
|
||||||
|
Keep in mind that passing a function from C++ to Python (or vice versa)
|
||||||
|
will instantiate a piece of wrapper code that translates function
|
||||||
|
invocations between the two languages. Naturally, this translation
|
||||||
|
increases the computational cost of each function call somewhat. A
|
||||||
|
problematic situation can arise when a function is copied back and forth
|
||||||
|
between Python and C++ many times in a row, in which case the underlying
|
||||||
|
wrappers will accumulate correspondingly. The resulting long sequence of
|
||||||
|
C++ -> Python -> C++ -> ... roundtrips can significantly decrease
|
||||||
|
performance.
|
||||||
|
|
||||||
|
There is one exception: pybind11 detects case where a stateless function
|
||||||
|
(i.e. a function pointer or a lambda function without captured variables)
|
||||||
|
is passed as an argument to another C++ function exposed in Python. In this
|
||||||
|
case, there is no overhead. Pybind11 will extract the underlying C++
|
||||||
|
function pointer from the wrapped function to sidestep a potential C++ ->
|
||||||
|
Python -> C++ roundtrip. This is demonstrated in :file:`tests/test_callbacks.cpp`.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
This functionality is very useful when generating bindings for callbacks in
|
||||||
|
C++ libraries (e.g. GUI libraries, asynchronous networking libraries, etc.).
|
||||||
|
|
||||||
|
The file :file:`tests/test_callbacks.cpp` contains a complete example
|
||||||
|
that demonstrates how to work with callbacks and anonymous functions in
|
||||||
|
more detail.
|
|
@ -0,0 +1,42 @@
|
||||||
|
Type conversions
|
||||||
|
################
|
||||||
|
|
||||||
|
Apart from enabling cross-language function calls, a fundamental problem
|
||||||
|
that a binding tool like pybind11 must address is to provide access to
|
||||||
|
native Python types in C++ and vice versa. There are three fundamentally
|
||||||
|
different ways to do this—which approach is preferable for a particular type
|
||||||
|
depends on the situation at hand.
|
||||||
|
|
||||||
|
1. Use a native C++ type everywhere. In this case, the type must be wrapped
|
||||||
|
using pybind11-generated bindings so that Python can interact with it.
|
||||||
|
|
||||||
|
2. Use a native Python type everywhere. It will need to be wrapped so that
|
||||||
|
C++ functions can interact with it.
|
||||||
|
|
||||||
|
3. Use a native C++ type on the C++ side and a native Python type on the
|
||||||
|
Python side. pybind11 refers to this as a *type conversion*.
|
||||||
|
|
||||||
|
Type conversions are the most "natural" option in the sense that native
|
||||||
|
(non-wrapped) types are used everywhere. The main downside is that a copy
|
||||||
|
of the data must be made on every Python ↔ C++ transition: this is
|
||||||
|
needed since the C++ and Python versions of the same type generally won't
|
||||||
|
have the same memory layout.
|
||||||
|
|
||||||
|
pybind11 can perform many kinds of conversions automatically. An overview
|
||||||
|
is provided in the table ":ref:`conversion_table`".
|
||||||
|
|
||||||
|
The following subsections discuss the differences between these options in more
|
||||||
|
detail. The main focus in this section is on type conversions, which represent
|
||||||
|
the last case of the above list.
|
||||||
|
|
||||||
|
.. toctree::
|
||||||
|
:maxdepth: 1
|
||||||
|
|
||||||
|
overview
|
||||||
|
strings
|
||||||
|
stl
|
||||||
|
functional
|
||||||
|
chrono
|
||||||
|
eigen
|
||||||
|
custom
|
||||||
|
|
|
@ -0,0 +1,165 @@
|
||||||
|
Overview
|
||||||
|
########
|
||||||
|
|
||||||
|
.. rubric:: 1. Native type in C++, wrapper in Python
|
||||||
|
|
||||||
|
Exposing a custom C++ type using :class:`py::class_` was covered in detail
|
||||||
|
in the :doc:`/classes` section. There, the underlying data structure is
|
||||||
|
always the original C++ class while the :class:`py::class_` wrapper provides
|
||||||
|
a Python interface. Internally, when an object like this is sent from C++ to
|
||||||
|
Python, pybind11 will just add the outer wrapper layer over the native C++
|
||||||
|
object. Getting it back from Python is just a matter of peeling off the
|
||||||
|
wrapper.
|
||||||
|
|
||||||
|
.. rubric:: 2. Wrapper in C++, native type in Python
|
||||||
|
|
||||||
|
This is the exact opposite situation. Now, we have a type which is native to
|
||||||
|
Python, like a ``tuple`` or a ``list``. One way to get this data into C++ is
|
||||||
|
with the :class:`py::object` family of wrappers. These are explained in more
|
||||||
|
detail in the :doc:`/advanced/pycpp/object` section. We'll just give a quick
|
||||||
|
example here:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void print_list(py::list my_list) {
|
||||||
|
for (auto item : my_list)
|
||||||
|
std::cout << item << " ";
|
||||||
|
}
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> print_list([1, 2, 3])
|
||||||
|
1 2 3
|
||||||
|
|
||||||
|
The Python ``list`` is not converted in any way -- it's just wrapped in a C++
|
||||||
|
:class:`py::list` class. At its core it's still a Python object. Copying a
|
||||||
|
:class:`py::list` will do the usual reference-counting like in Python.
|
||||||
|
Returning the object to Python will just remove the thin wrapper.
|
||||||
|
|
||||||
|
.. rubric:: 3. Converting between native C++ and Python types
|
||||||
|
|
||||||
|
In the previous two cases we had a native type in one language and a wrapper in
|
||||||
|
the other. Now, we have native types on both sides and we convert between them.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void print_vector(const std::vector<int> &v) {
|
||||||
|
for (auto item : v)
|
||||||
|
std::cout << item << "\n";
|
||||||
|
}
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> print_vector([1, 2, 3])
|
||||||
|
1 2 3
|
||||||
|
|
||||||
|
In this case, pybind11 will construct a new ``std::vector<int>`` and copy each
|
||||||
|
element from the Python ``list``. The newly constructed object will be passed
|
||||||
|
to ``print_vector``. The same thing happens in the other direction: a new
|
||||||
|
``list`` is made to match the value returned from C++.
|
||||||
|
|
||||||
|
Lots of these conversions are supported out of the box, as shown in the table
|
||||||
|
below. They are very convenient, but keep in mind that these conversions are
|
||||||
|
fundamentally based on copying data. This is perfectly fine for small immutable
|
||||||
|
types but it may become quite expensive for large data structures. This can be
|
||||||
|
avoided by overriding the automatic conversion with a custom wrapper (i.e. the
|
||||||
|
above-mentioned approach 1). This requires some manual effort and more details
|
||||||
|
are available in the :ref:`opaque` section.
|
||||||
|
|
||||||
|
.. _conversion_table:
|
||||||
|
|
||||||
|
List of all builtin conversions
|
||||||
|
-------------------------------
|
||||||
|
|
||||||
|
The following basic data types are supported out of the box (some may require
|
||||||
|
an additional extension header to be included). To pass other data structures
|
||||||
|
as arguments and return values, refer to the section on binding :ref:`classes`.
|
||||||
|
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| Data type | Description | Header file |
|
||||||
|
+====================================+===========================+===============================+
|
||||||
|
| ``int8_t``, ``uint8_t`` | 8-bit integers | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``int16_t``, ``uint16_t`` | 16-bit integers | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``int32_t``, ``uint32_t`` | 32-bit integers | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``int64_t``, ``uint64_t`` | 64-bit integers | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``ssize_t``, ``size_t`` | Platform-dependent size | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``float``, ``double`` | Floating point types | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``bool`` | Two-state Boolean type | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``char`` | Character literal | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``char16_t`` | UTF-16 character literal | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``char32_t`` | UTF-32 character literal | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``wchar_t`` | Wide character literal | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``const char *`` | UTF-8 string literal | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``const char16_t *`` | UTF-16 string literal | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``const char32_t *`` | UTF-32 string literal | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``const wchar_t *`` | Wide string literal | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::string`` | STL dynamic UTF-8 string | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::u16string`` | STL dynamic UTF-16 string | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::u32string`` | STL dynamic UTF-32 string | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::wstring`` | STL dynamic wide string | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::string_view``, | STL C++17 string views | :file:`pybind11/pybind11.h` |
|
||||||
|
| ``std::u16string_view``, etc. | | |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::pair<T1, T2>`` | Pair of two custom types | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::tuple<...>`` | Arbitrary tuple of types | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::reference_wrapper<...>`` | Reference type wrapper | :file:`pybind11/pybind11.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::complex<T>`` | Complex numbers | :file:`pybind11/complex.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::array<T, Size>`` | STL static array | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::vector<T>`` | STL dynamic array | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::deque<T>`` | STL double-ended queue | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::valarray<T>`` | STL value array | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::list<T>`` | STL linked list | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::map<T1, T2>`` | STL ordered map | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::unordered_map<T1, T2>`` | STL unordered map | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::set<T>`` | STL ordered set | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::unordered_set<T>`` | STL unordered set | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::optional<T>`` | STL optional type (C++17) | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::experimental::optional<T>`` | STL optional type (exp.) | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::variant<...>`` | Type-safe union (C++17) | :file:`pybind11/stl.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::function<...>`` | STL polymorphic function | :file:`pybind11/functional.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::chrono::duration<...>`` | STL time duration | :file:`pybind11/chrono.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``std::chrono::time_point<...>`` | STL date/time | :file:`pybind11/chrono.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``Eigen::Matrix<...>`` | Eigen: dense matrix | :file:`pybind11/eigen.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``Eigen::Map<...>`` | Eigen: mapped memory | :file:`pybind11/eigen.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
||||||
|
| ``Eigen::SparseMatrix<...>`` | Eigen: sparse matrix | :file:`pybind11/eigen.h` |
|
||||||
|
+------------------------------------+---------------------------+-------------------------------+
|
|
@ -0,0 +1,240 @@
|
||||||
|
STL containers
|
||||||
|
##############
|
||||||
|
|
||||||
|
Automatic conversion
|
||||||
|
====================
|
||||||
|
|
||||||
|
When including the additional header file :file:`pybind11/stl.h`, conversions
|
||||||
|
between ``std::vector<>``/``std::deque<>``/``std::list<>``/``std::array<>``,
|
||||||
|
``std::set<>``/``std::unordered_set<>``, and
|
||||||
|
``std::map<>``/``std::unordered_map<>`` and the Python ``list``, ``set`` and
|
||||||
|
``dict`` data structures are automatically enabled. The types ``std::pair<>``
|
||||||
|
and ``std::tuple<>`` are already supported out of the box with just the core
|
||||||
|
:file:`pybind11/pybind11.h` header.
|
||||||
|
|
||||||
|
The major downside of these implicit conversions is that containers must be
|
||||||
|
converted (i.e. copied) on every Python->C++ and C++->Python transition, which
|
||||||
|
can have implications on the program semantics and performance. Please read the
|
||||||
|
next sections for more details and alternative approaches that avoid this.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
Arbitrary nesting of any of these types is possible.
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_stl.cpp` contains a complete
|
||||||
|
example that demonstrates how to pass STL data types in more detail.
|
||||||
|
|
||||||
|
.. _cpp17_container_casters:
|
||||||
|
|
||||||
|
C++17 library containers
|
||||||
|
========================
|
||||||
|
|
||||||
|
The :file:`pybind11/stl.h` header also includes support for ``std::optional<>``
|
||||||
|
and ``std::variant<>``. These require a C++17 compiler and standard library.
|
||||||
|
In C++14 mode, ``std::experimental::optional<>`` is supported if available.
|
||||||
|
|
||||||
|
Various versions of these containers also exist for C++11 (e.g. in Boost).
|
||||||
|
pybind11 provides an easy way to specialize the ``type_caster`` for such
|
||||||
|
types:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// `boost::optional` as an example -- can be any `std::optional`-like container
|
||||||
|
namespace pybind11 { namespace detail {
|
||||||
|
template <typename T>
|
||||||
|
struct type_caster<boost::optional<T>> : optional_caster<boost::optional<T>> {};
|
||||||
|
}}
|
||||||
|
|
||||||
|
The above should be placed in a header file and included in all translation units
|
||||||
|
where automatic conversion is needed. Similarly, a specialization can be provided
|
||||||
|
for custom variant types:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// `boost::variant` as an example -- can be any `std::variant`-like container
|
||||||
|
namespace pybind11 { namespace detail {
|
||||||
|
template <typename... Ts>
|
||||||
|
struct type_caster<boost::variant<Ts...>> : variant_caster<boost::variant<Ts...>> {};
|
||||||
|
|
||||||
|
// Specifies the function used to visit the variant -- `apply_visitor` instead of `visit`
|
||||||
|
template <>
|
||||||
|
struct visit_helper<boost::variant> {
|
||||||
|
template <typename... Args>
|
||||||
|
static auto call(Args &&...args) -> decltype(boost::apply_visitor(args...)) {
|
||||||
|
return boost::apply_visitor(args...);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}} // namespace pybind11::detail
|
||||||
|
|
||||||
|
The ``visit_helper`` specialization is not required if your ``name::variant`` provides
|
||||||
|
a ``name::visit()`` function. For any other function name, the specialization must be
|
||||||
|
included to tell pybind11 how to visit the variant.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
pybind11 only supports the modern implementation of ``boost::variant``
|
||||||
|
which makes use of variadic templates. This requires Boost 1.56 or newer.
|
||||||
|
Additionally, on Windows, MSVC 2017 is required because ``boost::variant``
|
||||||
|
falls back to the old non-variadic implementation on MSVC 2015.
|
||||||
|
|
||||||
|
.. _opaque:
|
||||||
|
|
||||||
|
Making opaque types
|
||||||
|
===================
|
||||||
|
|
||||||
|
pybind11 heavily relies on a template matching mechanism to convert parameters
|
||||||
|
and return values that are constructed from STL data types such as vectors,
|
||||||
|
linked lists, hash tables, etc. This even works in a recursive manner, for
|
||||||
|
instance to deal with lists of hash maps of pairs of elementary and custom
|
||||||
|
types, etc.
|
||||||
|
|
||||||
|
However, a fundamental limitation of this approach is that internal conversions
|
||||||
|
between Python and C++ types involve a copy operation that prevents
|
||||||
|
pass-by-reference semantics. What does this mean?
|
||||||
|
|
||||||
|
Suppose we bind the following function
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void append_1(std::vector<int> &v) {
|
||||||
|
v.push_back(1);
|
||||||
|
}
|
||||||
|
|
||||||
|
and call it from Python, the following happens:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> v = [5, 6]
|
||||||
|
>>> append_1(v)
|
||||||
|
>>> print(v)
|
||||||
|
[5, 6]
|
||||||
|
|
||||||
|
As you can see, when passing STL data structures by reference, modifications
|
||||||
|
are not propagated back the Python side. A similar situation arises when
|
||||||
|
exposing STL data structures using the ``def_readwrite`` or ``def_readonly``
|
||||||
|
functions:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
/* ... definition ... */
|
||||||
|
|
||||||
|
class MyClass {
|
||||||
|
std::vector<int> contents;
|
||||||
|
};
|
||||||
|
|
||||||
|
/* ... binding code ... */
|
||||||
|
|
||||||
|
py::class_<MyClass>(m, "MyClass")
|
||||||
|
.def(py::init<>())
|
||||||
|
.def_readwrite("contents", &MyClass::contents);
|
||||||
|
|
||||||
|
In this case, properties can be read and written in their entirety. However, an
|
||||||
|
``append`` operation involving such a list type has no effect:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> m = MyClass()
|
||||||
|
>>> m.contents = [5, 6]
|
||||||
|
>>> print(m.contents)
|
||||||
|
[5, 6]
|
||||||
|
>>> m.contents.append(7)
|
||||||
|
>>> print(m.contents)
|
||||||
|
[5, 6]
|
||||||
|
|
||||||
|
Finally, the involved copy operations can be costly when dealing with very
|
||||||
|
large lists. To deal with all of the above situations, pybind11 provides a
|
||||||
|
macro named ``PYBIND11_MAKE_OPAQUE(T)`` that disables the template-based
|
||||||
|
conversion machinery of types, thus rendering them *opaque*. The contents of
|
||||||
|
opaque objects are never inspected or extracted, hence they *can* be passed by
|
||||||
|
reference. For instance, to turn ``std::vector<int>`` into an opaque type, add
|
||||||
|
the declaration
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
PYBIND11_MAKE_OPAQUE(std::vector<int>);
|
||||||
|
|
||||||
|
before any binding code (e.g. invocations to ``class_::def()``, etc.). This
|
||||||
|
macro must be specified at the top level (and outside of any namespaces), since
|
||||||
|
it instantiates a partial template overload. If your binding code consists of
|
||||||
|
multiple compilation units, it must be present in every file (typically via a
|
||||||
|
common header) preceding any usage of ``std::vector<int>``. Opaque types must
|
||||||
|
also have a corresponding ``class_`` declaration to associate them with a name
|
||||||
|
in Python, and to define a set of available operations, e.g.:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<std::vector<int>>(m, "IntVector")
|
||||||
|
.def(py::init<>())
|
||||||
|
.def("clear", &std::vector<int>::clear)
|
||||||
|
.def("pop_back", &std::vector<int>::pop_back)
|
||||||
|
.def("__len__", [](const std::vector<int> &v) { return v.size(); })
|
||||||
|
.def("__iter__", [](std::vector<int> &v) {
|
||||||
|
return py::make_iterator(v.begin(), v.end());
|
||||||
|
}, py::keep_alive<0, 1>()) /* Keep vector alive while iterator is used */
|
||||||
|
// ....
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_opaque_types.cpp` contains a complete
|
||||||
|
example that demonstrates how to create and expose opaque types using
|
||||||
|
pybind11 in more detail.
|
||||||
|
|
||||||
|
.. _stl_bind:
|
||||||
|
|
||||||
|
Binding STL containers
|
||||||
|
======================
|
||||||
|
|
||||||
|
The ability to expose STL containers as native Python objects is a fairly
|
||||||
|
common request, hence pybind11 also provides an optional header file named
|
||||||
|
:file:`pybind11/stl_bind.h` that does exactly this. The mapped containers try
|
||||||
|
to match the behavior of their native Python counterparts as much as possible.
|
||||||
|
|
||||||
|
The following example showcases usage of :file:`pybind11/stl_bind.h`:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// Don't forget this
|
||||||
|
#include <pybind11/stl_bind.h>
|
||||||
|
|
||||||
|
PYBIND11_MAKE_OPAQUE(std::vector<int>);
|
||||||
|
PYBIND11_MAKE_OPAQUE(std::map<std::string, double>);
|
||||||
|
|
||||||
|
// ...
|
||||||
|
|
||||||
|
// later in binding code:
|
||||||
|
py::bind_vector<std::vector<int>>(m, "VectorInt");
|
||||||
|
py::bind_map<std::map<std::string, double>>(m, "MapStringDouble");
|
||||||
|
|
||||||
|
When binding STL containers pybind11 considers the types of the container's
|
||||||
|
elements to decide whether the container should be confined to the local module
|
||||||
|
(via the :ref:`module_local` feature). If the container element types are
|
||||||
|
anything other than already-bound custom types bound without
|
||||||
|
``py::module_local()`` the container binding will have ``py::module_local()``
|
||||||
|
applied. This includes converting types such as numeric types, strings, Eigen
|
||||||
|
types; and types that have not yet been bound at the time of the stl container
|
||||||
|
binding. This module-local binding is designed to avoid potential conflicts
|
||||||
|
between module bindings (for example, from two separate modules each attempting
|
||||||
|
to bind ``std::vector<int>`` as a python type).
|
||||||
|
|
||||||
|
It is possible to override this behavior to force a definition to be either
|
||||||
|
module-local or global. To do so, you can pass the attributes
|
||||||
|
``py::module_local()`` (to make the binding module-local) or
|
||||||
|
``py::module_local(false)`` (to make the binding global) into the
|
||||||
|
``py::bind_vector`` or ``py::bind_map`` arguments:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::bind_vector<std::vector<int>>(m, "VectorInt", py::module_local(false));
|
||||||
|
|
||||||
|
Note, however, that such a global binding would make it impossible to load this
|
||||||
|
module at the same time as any other pybind module that also attempts to bind
|
||||||
|
the same container type (``std::vector<int>`` in the above example).
|
||||||
|
|
||||||
|
See :ref:`module_local` for more details on module-local bindings.
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_stl_binders.cpp` shows how to use the
|
||||||
|
convenience STL container wrappers.
|
|
@ -0,0 +1,305 @@
|
||||||
|
Strings, bytes and Unicode conversions
|
||||||
|
######################################
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
This section discusses string handling in terms of Python 3 strings. For
|
||||||
|
Python 2.7, replace all occurrences of ``str`` with ``unicode`` and
|
||||||
|
``bytes`` with ``str``. Python 2.7 users may find it best to use ``from
|
||||||
|
__future__ import unicode_literals`` to avoid unintentionally using ``str``
|
||||||
|
instead of ``unicode``.
|
||||||
|
|
||||||
|
Passing Python strings to C++
|
||||||
|
=============================
|
||||||
|
|
||||||
|
When a Python ``str`` is passed from Python to a C++ function that accepts
|
||||||
|
``std::string`` or ``char *`` as arguments, pybind11 will encode the Python
|
||||||
|
string to UTF-8. All Python ``str`` can be encoded in UTF-8, so this operation
|
||||||
|
does not fail.
|
||||||
|
|
||||||
|
The C++ language is encoding agnostic. It is the responsibility of the
|
||||||
|
programmer to track encodings. It's often easiest to simply `use UTF-8
|
||||||
|
everywhere <http://utf8everywhere.org/>`_.
|
||||||
|
|
||||||
|
.. code-block:: c++
|
||||||
|
|
||||||
|
m.def("utf8_test",
|
||||||
|
[](const std::string &s) {
|
||||||
|
cout << "utf-8 is icing on the cake.\n";
|
||||||
|
cout << s;
|
||||||
|
}
|
||||||
|
);
|
||||||
|
m.def("utf8_charptr",
|
||||||
|
[](const char *s) {
|
||||||
|
cout << "My favorite food is\n";
|
||||||
|
cout << s;
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
>>> utf8_test('🎂')
|
||||||
|
utf-8 is icing on the cake.
|
||||||
|
🎂
|
||||||
|
|
||||||
|
>>> utf8_charptr('🍕')
|
||||||
|
My favorite food is
|
||||||
|
🍕
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
Some terminal emulators do not support UTF-8 or emoji fonts and may not
|
||||||
|
display the example above correctly.
|
||||||
|
|
||||||
|
The results are the same whether the C++ function accepts arguments by value or
|
||||||
|
reference, and whether or not ``const`` is used.
|
||||||
|
|
||||||
|
Passing bytes to C++
|
||||||
|
--------------------
|
||||||
|
|
||||||
|
A Python ``bytes`` object will be passed to C++ functions that accept
|
||||||
|
``std::string`` or ``char*`` *without* conversion. On Python 3, in order to
|
||||||
|
make a function *only* accept ``bytes`` (and not ``str``), declare it as taking
|
||||||
|
a ``py::bytes`` argument.
|
||||||
|
|
||||||
|
|
||||||
|
Returning C++ strings to Python
|
||||||
|
===============================
|
||||||
|
|
||||||
|
When a C++ function returns a ``std::string`` or ``char*`` to a Python caller,
|
||||||
|
**pybind11 will assume that the string is valid UTF-8** and will decode it to a
|
||||||
|
native Python ``str``, using the same API as Python uses to perform
|
||||||
|
``bytes.decode('utf-8')``. If this implicit conversion fails, pybind11 will
|
||||||
|
raise a ``UnicodeDecodeError``.
|
||||||
|
|
||||||
|
.. code-block:: c++
|
||||||
|
|
||||||
|
m.def("std_string_return",
|
||||||
|
[]() {
|
||||||
|
return std::string("This string needs to be UTF-8 encoded");
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
>>> isinstance(example.std_string_return(), str)
|
||||||
|
True
|
||||||
|
|
||||||
|
|
||||||
|
Because UTF-8 is inclusive of pure ASCII, there is never any issue with
|
||||||
|
returning a pure ASCII string to Python. If there is any possibility that the
|
||||||
|
string is not pure ASCII, it is necessary to ensure the encoding is valid
|
||||||
|
UTF-8.
|
||||||
|
|
||||||
|
.. warning::
|
||||||
|
|
||||||
|
Implicit conversion assumes that a returned ``char *`` is null-terminated.
|
||||||
|
If there is no null terminator a buffer overrun will occur.
|
||||||
|
|
||||||
|
Explicit conversions
|
||||||
|
--------------------
|
||||||
|
|
||||||
|
If some C++ code constructs a ``std::string`` that is not a UTF-8 string, one
|
||||||
|
can perform a explicit conversion and return a ``py::str`` object. Explicit
|
||||||
|
conversion has the same overhead as implicit conversion.
|
||||||
|
|
||||||
|
.. code-block:: c++
|
||||||
|
|
||||||
|
// This uses the Python C API to convert Latin-1 to Unicode
|
||||||
|
m.def("str_output",
|
||||||
|
[]() {
|
||||||
|
std::string s = "Send your r\xe9sum\xe9 to Alice in HR"; // Latin-1
|
||||||
|
py::str py_s = PyUnicode_DecodeLatin1(s.data(), s.length());
|
||||||
|
return py_s;
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
>>> str_output()
|
||||||
|
'Send your résumé to Alice in HR'
|
||||||
|
|
||||||
|
The `Python C API
|
||||||
|
<https://docs.python.org/3/c-api/unicode.html#built-in-codecs>`_ provides
|
||||||
|
several built-in codecs.
|
||||||
|
|
||||||
|
|
||||||
|
One could also use a third party encoding library such as libiconv to transcode
|
||||||
|
to UTF-8.
|
||||||
|
|
||||||
|
Return C++ strings without conversion
|
||||||
|
-------------------------------------
|
||||||
|
|
||||||
|
If the data in a C++ ``std::string`` does not represent text and should be
|
||||||
|
returned to Python as ``bytes``, then one can return the data as a
|
||||||
|
``py::bytes`` object.
|
||||||
|
|
||||||
|
.. code-block:: c++
|
||||||
|
|
||||||
|
m.def("return_bytes",
|
||||||
|
[]() {
|
||||||
|
std::string s("\xba\xd0\xba\xd0"); // Not valid UTF-8
|
||||||
|
return py::bytes(s); // Return the data without transcoding
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
>>> example.return_bytes()
|
||||||
|
b'\xba\xd0\xba\xd0'
|
||||||
|
|
||||||
|
|
||||||
|
Note the asymmetry: pybind11 will convert ``bytes`` to ``std::string`` without
|
||||||
|
encoding, but cannot convert ``std::string`` back to ``bytes`` implicitly.
|
||||||
|
|
||||||
|
.. code-block:: c++
|
||||||
|
|
||||||
|
m.def("asymmetry",
|
||||||
|
[](std::string s) { // Accepts str or bytes from Python
|
||||||
|
return s; // Looks harmless, but implicitly converts to str
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
>>> isinstance(example.asymmetry(b"have some bytes"), str)
|
||||||
|
True
|
||||||
|
|
||||||
|
>>> example.asymmetry(b"\xba\xd0\xba\xd0") # invalid utf-8 as bytes
|
||||||
|
UnicodeDecodeError: 'utf-8' codec can't decode byte 0xba in position 0: invalid start byte
|
||||||
|
|
||||||
|
|
||||||
|
Wide character strings
|
||||||
|
======================
|
||||||
|
|
||||||
|
When a Python ``str`` is passed to a C++ function expecting ``std::wstring``,
|
||||||
|
``wchar_t*``, ``std::u16string`` or ``std::u32string``, the ``str`` will be
|
||||||
|
encoded to UTF-16 or UTF-32 depending on how the C++ compiler implements each
|
||||||
|
type, in the platform's native endianness. When strings of these types are
|
||||||
|
returned, they are assumed to contain valid UTF-16 or UTF-32, and will be
|
||||||
|
decoded to Python ``str``.
|
||||||
|
|
||||||
|
.. code-block:: c++
|
||||||
|
|
||||||
|
#define UNICODE
|
||||||
|
#include <windows.h>
|
||||||
|
|
||||||
|
m.def("set_window_text",
|
||||||
|
[](HWND hwnd, std::wstring s) {
|
||||||
|
// Call SetWindowText with null-terminated UTF-16 string
|
||||||
|
::SetWindowText(hwnd, s.c_str());
|
||||||
|
}
|
||||||
|
);
|
||||||
|
m.def("get_window_text",
|
||||||
|
[](HWND hwnd) {
|
||||||
|
const int buffer_size = ::GetWindowTextLength(hwnd) + 1;
|
||||||
|
auto buffer = std::make_unique< wchar_t[] >(buffer_size);
|
||||||
|
|
||||||
|
::GetWindowText(hwnd, buffer.data(), buffer_size);
|
||||||
|
|
||||||
|
std::wstring text(buffer.get());
|
||||||
|
|
||||||
|
// wstring will be converted to Python str
|
||||||
|
return text;
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
.. warning::
|
||||||
|
|
||||||
|
Wide character strings may not work as described on Python 2.7 or Python
|
||||||
|
3.3 compiled with ``--enable-unicode=ucs2``.
|
||||||
|
|
||||||
|
Strings in multibyte encodings such as Shift-JIS must transcoded to a
|
||||||
|
UTF-8/16/32 before being returned to Python.
|
||||||
|
|
||||||
|
|
||||||
|
Character literals
|
||||||
|
==================
|
||||||
|
|
||||||
|
C++ functions that accept character literals as input will receive the first
|
||||||
|
character of a Python ``str`` as their input. If the string is longer than one
|
||||||
|
Unicode character, trailing characters will be ignored.
|
||||||
|
|
||||||
|
When a character literal is returned from C++ (such as a ``char`` or a
|
||||||
|
``wchar_t``), it will be converted to a ``str`` that represents the single
|
||||||
|
character.
|
||||||
|
|
||||||
|
.. code-block:: c++
|
||||||
|
|
||||||
|
m.def("pass_char", [](char c) { return c; });
|
||||||
|
m.def("pass_wchar", [](wchar_t w) { return w; });
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
>>> example.pass_char('A')
|
||||||
|
'A'
|
||||||
|
|
||||||
|
While C++ will cast integers to character types (``char c = 0x65;``), pybind11
|
||||||
|
does not convert Python integers to characters implicitly. The Python function
|
||||||
|
``chr()`` can be used to convert integers to characters.
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
>>> example.pass_char(0x65)
|
||||||
|
TypeError
|
||||||
|
|
||||||
|
>>> example.pass_char(chr(0x65))
|
||||||
|
'A'
|
||||||
|
|
||||||
|
If the desire is to work with an 8-bit integer, use ``int8_t`` or ``uint8_t``
|
||||||
|
as the argument type.
|
||||||
|
|
||||||
|
Grapheme clusters
|
||||||
|
-----------------
|
||||||
|
|
||||||
|
A single grapheme may be represented by two or more Unicode characters. For
|
||||||
|
example 'é' is usually represented as U+00E9 but can also be expressed as the
|
||||||
|
combining character sequence U+0065 U+0301 (that is, the letter 'e' followed by
|
||||||
|
a combining acute accent). The combining character will be lost if the
|
||||||
|
two-character sequence is passed as an argument, even though it renders as a
|
||||||
|
single grapheme.
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
>>> example.pass_wchar('é')
|
||||||
|
'é'
|
||||||
|
|
||||||
|
>>> combining_e_acute = 'e' + '\u0301'
|
||||||
|
|
||||||
|
>>> combining_e_acute
|
||||||
|
'é'
|
||||||
|
|
||||||
|
>>> combining_e_acute == 'é'
|
||||||
|
False
|
||||||
|
|
||||||
|
>>> example.pass_wchar(combining_e_acute)
|
||||||
|
'e'
|
||||||
|
|
||||||
|
Normalizing combining characters before passing the character literal to C++
|
||||||
|
may resolve *some* of these issues:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
>>> example.pass_wchar(unicodedata.normalize('NFC', combining_e_acute))
|
||||||
|
'é'
|
||||||
|
|
||||||
|
In some languages (Thai for example), there are `graphemes that cannot be
|
||||||
|
expressed as a single Unicode code point
|
||||||
|
<http://unicode.org/reports/tr29/#Grapheme_Cluster_Boundaries>`_, so there is
|
||||||
|
no way to capture them in a C++ character type.
|
||||||
|
|
||||||
|
|
||||||
|
C++17 string views
|
||||||
|
==================
|
||||||
|
|
||||||
|
C++17 string views are automatically supported when compiling in C++17 mode.
|
||||||
|
They follow the same rules for encoding and decoding as the corresponding STL
|
||||||
|
string type (for example, a ``std::u16string_view`` argument will be passed
|
||||||
|
UTF-16-encoded data, and a returned ``std::string_view`` will be decoded as
|
||||||
|
UTF-8).
|
||||||
|
|
||||||
|
References
|
||||||
|
==========
|
||||||
|
|
||||||
|
* `The Absolute Minimum Every Software Developer Absolutely, Positively Must Know About Unicode and Character Sets (No Excuses!) <https://www.joelonsoftware.com/2003/10/08/the-absolute-minimum-every-software-developer-absolutely-positively-must-know-about-unicode-and-character-sets-no-excuses/>`_
|
||||||
|
* `C++ - Using STL Strings at Win32 API Boundaries <https://msdn.microsoft.com/en-ca/magazine/mt238407.aspx>`_
|
File diff suppressed because it is too large
Load Diff
|
@ -0,0 +1,261 @@
|
||||||
|
.. _embedding:
|
||||||
|
|
||||||
|
Embedding the interpreter
|
||||||
|
#########################
|
||||||
|
|
||||||
|
While pybind11 is mainly focused on extending Python using C++, it's also
|
||||||
|
possible to do the reverse: embed the Python interpreter into a C++ program.
|
||||||
|
All of the other documentation pages still apply here, so refer to them for
|
||||||
|
general pybind11 usage. This section will cover a few extra things required
|
||||||
|
for embedding.
|
||||||
|
|
||||||
|
Getting started
|
||||||
|
===============
|
||||||
|
|
||||||
|
A basic executable with an embedded interpreter can be created with just a few
|
||||||
|
lines of CMake and the ``pybind11::embed`` target, as shown below. For more
|
||||||
|
information, see :doc:`/compiling`.
|
||||||
|
|
||||||
|
.. code-block:: cmake
|
||||||
|
|
||||||
|
cmake_minimum_required(VERSION 3.0)
|
||||||
|
project(example)
|
||||||
|
|
||||||
|
find_package(pybind11 REQUIRED) # or `add_subdirectory(pybind11)`
|
||||||
|
|
||||||
|
add_executable(example main.cpp)
|
||||||
|
target_link_libraries(example PRIVATE pybind11::embed)
|
||||||
|
|
||||||
|
The essential structure of the ``main.cpp`` file looks like this:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/embed.h> // everything needed for embedding
|
||||||
|
namespace py = pybind11;
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
py::scoped_interpreter guard{}; // start the interpreter and keep it alive
|
||||||
|
|
||||||
|
py::print("Hello, World!"); // use the Python API
|
||||||
|
}
|
||||||
|
|
||||||
|
The interpreter must be initialized before using any Python API, which includes
|
||||||
|
all the functions and classes in pybind11. The RAII guard class `scoped_interpreter`
|
||||||
|
takes care of the interpreter lifetime. After the guard is destroyed, the interpreter
|
||||||
|
shuts down and clears its memory. No Python functions can be called after this.
|
||||||
|
|
||||||
|
Executing Python code
|
||||||
|
=====================
|
||||||
|
|
||||||
|
There are a few different ways to run Python code. One option is to use `eval`,
|
||||||
|
`exec` or `eval_file`, as explained in :ref:`eval`. Here is a quick example in
|
||||||
|
the context of an executable with an embedded interpreter:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/embed.h>
|
||||||
|
namespace py = pybind11;
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
py::scoped_interpreter guard{};
|
||||||
|
|
||||||
|
py::exec(R"(
|
||||||
|
kwargs = dict(name="World", number=42)
|
||||||
|
message = "Hello, {name}! The answer is {number}".format(**kwargs)
|
||||||
|
print(message)
|
||||||
|
)");
|
||||||
|
}
|
||||||
|
|
||||||
|
Alternatively, similar results can be achieved using pybind11's API (see
|
||||||
|
:doc:`/advanced/pycpp/index` for more details).
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/embed.h>
|
||||||
|
namespace py = pybind11;
|
||||||
|
using namespace py::literals;
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
py::scoped_interpreter guard{};
|
||||||
|
|
||||||
|
auto kwargs = py::dict("name"_a="World", "number"_a=42);
|
||||||
|
auto message = "Hello, {name}! The answer is {number}"_s.format(**kwargs);
|
||||||
|
py::print(message);
|
||||||
|
}
|
||||||
|
|
||||||
|
The two approaches can also be combined:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/embed.h>
|
||||||
|
#include <iostream>
|
||||||
|
|
||||||
|
namespace py = pybind11;
|
||||||
|
using namespace py::literals;
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
py::scoped_interpreter guard{};
|
||||||
|
|
||||||
|
auto locals = py::dict("name"_a="World", "number"_a=42);
|
||||||
|
py::exec(R"(
|
||||||
|
message = "Hello, {name}! The answer is {number}".format(**locals())
|
||||||
|
)", py::globals(), locals);
|
||||||
|
|
||||||
|
auto message = locals["message"].cast<std::string>();
|
||||||
|
std::cout << message;
|
||||||
|
}
|
||||||
|
|
||||||
|
Importing modules
|
||||||
|
=================
|
||||||
|
|
||||||
|
Python modules can be imported using `module::import()`:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::module sys = py::module::import("sys");
|
||||||
|
py::print(sys.attr("path"));
|
||||||
|
|
||||||
|
For convenience, the current working directory is included in ``sys.path`` when
|
||||||
|
embedding the interpreter. This makes it easy to import local Python files:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
"""calc.py located in the working directory"""
|
||||||
|
|
||||||
|
def add(i, j):
|
||||||
|
return i + j
|
||||||
|
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::module calc = py::module::import("calc");
|
||||||
|
py::object result = calc.attr("add")(1, 2);
|
||||||
|
int n = result.cast<int>();
|
||||||
|
assert(n == 3);
|
||||||
|
|
||||||
|
Modules can be reloaded using `module::reload()` if the source is modified e.g.
|
||||||
|
by an external process. This can be useful in scenarios where the application
|
||||||
|
imports a user defined data processing script which needs to be updated after
|
||||||
|
changes by the user. Note that this function does not reload modules recursively.
|
||||||
|
|
||||||
|
.. _embedding_modules:
|
||||||
|
|
||||||
|
Adding embedded modules
|
||||||
|
=======================
|
||||||
|
|
||||||
|
Embedded binary modules can be added using the `PYBIND11_EMBEDDED_MODULE` macro.
|
||||||
|
Note that the definition must be placed at global scope. They can be imported
|
||||||
|
like any other module.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/embed.h>
|
||||||
|
namespace py = pybind11;
|
||||||
|
|
||||||
|
PYBIND11_EMBEDDED_MODULE(fast_calc, m) {
|
||||||
|
// `m` is a `py::module` which is used to bind functions and classes
|
||||||
|
m.def("add", [](int i, int j) {
|
||||||
|
return i + j;
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
py::scoped_interpreter guard{};
|
||||||
|
|
||||||
|
auto fast_calc = py::module::import("fast_calc");
|
||||||
|
auto result = fast_calc.attr("add")(1, 2).cast<int>();
|
||||||
|
assert(result == 3);
|
||||||
|
}
|
||||||
|
|
||||||
|
Unlike extension modules where only a single binary module can be created, on
|
||||||
|
the embedded side an unlimited number of modules can be added using multiple
|
||||||
|
`PYBIND11_EMBEDDED_MODULE` definitions (as long as they have unique names).
|
||||||
|
|
||||||
|
These modules are added to Python's list of builtins, so they can also be
|
||||||
|
imported in pure Python files loaded by the interpreter. Everything interacts
|
||||||
|
naturally:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
"""py_module.py located in the working directory"""
|
||||||
|
import cpp_module
|
||||||
|
|
||||||
|
a = cpp_module.a
|
||||||
|
b = a + 1
|
||||||
|
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/embed.h>
|
||||||
|
namespace py = pybind11;
|
||||||
|
|
||||||
|
PYBIND11_EMBEDDED_MODULE(cpp_module, m) {
|
||||||
|
m.attr("a") = 1;
|
||||||
|
}
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
py::scoped_interpreter guard{};
|
||||||
|
|
||||||
|
auto py_module = py::module::import("py_module");
|
||||||
|
|
||||||
|
auto locals = py::dict("fmt"_a="{} + {} = {}", **py_module.attr("__dict__"));
|
||||||
|
assert(locals["a"].cast<int>() == 1);
|
||||||
|
assert(locals["b"].cast<int>() == 2);
|
||||||
|
|
||||||
|
py::exec(R"(
|
||||||
|
c = a + b
|
||||||
|
message = fmt.format(a, b, c)
|
||||||
|
)", py::globals(), locals);
|
||||||
|
|
||||||
|
assert(locals["c"].cast<int>() == 3);
|
||||||
|
assert(locals["message"].cast<std::string>() == "1 + 2 = 3");
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
Interpreter lifetime
|
||||||
|
====================
|
||||||
|
|
||||||
|
The Python interpreter shuts down when `scoped_interpreter` is destroyed. After
|
||||||
|
this, creating a new instance will restart the interpreter. Alternatively, the
|
||||||
|
`initialize_interpreter` / `finalize_interpreter` pair of functions can be used
|
||||||
|
to directly set the state at any time.
|
||||||
|
|
||||||
|
Modules created with pybind11 can be safely re-initialized after the interpreter
|
||||||
|
has been restarted. However, this may not apply to third-party extension modules.
|
||||||
|
The issue is that Python itself cannot completely unload extension modules and
|
||||||
|
there are several caveats with regard to interpreter restarting. In short, not
|
||||||
|
all memory may be freed, either due to Python reference cycles or user-created
|
||||||
|
global data. All the details can be found in the CPython documentation.
|
||||||
|
|
||||||
|
.. warning::
|
||||||
|
|
||||||
|
Creating two concurrent `scoped_interpreter` guards is a fatal error. So is
|
||||||
|
calling `initialize_interpreter` for a second time after the interpreter
|
||||||
|
has already been initialized.
|
||||||
|
|
||||||
|
Do not use the raw CPython API functions ``Py_Initialize`` and
|
||||||
|
``Py_Finalize`` as these do not properly handle the lifetime of
|
||||||
|
pybind11's internal data.
|
||||||
|
|
||||||
|
|
||||||
|
Sub-interpreter support
|
||||||
|
=======================
|
||||||
|
|
||||||
|
Creating multiple copies of `scoped_interpreter` is not possible because it
|
||||||
|
represents the main Python interpreter. Sub-interpreters are something different
|
||||||
|
and they do permit the existence of multiple interpreters. This is an advanced
|
||||||
|
feature of the CPython API and should be handled with care. pybind11 does not
|
||||||
|
currently offer a C++ interface for sub-interpreters, so refer to the CPython
|
||||||
|
documentation for all the details regarding this feature.
|
||||||
|
|
||||||
|
We'll just mention a couple of caveats the sub-interpreters support in pybind11:
|
||||||
|
|
||||||
|
1. Sub-interpreters will not receive independent copies of embedded modules.
|
||||||
|
Instead, these are shared and modifications in one interpreter may be
|
||||||
|
reflected in another.
|
||||||
|
|
||||||
|
2. Managing multiple threads, multiple interpreters and the GIL can be
|
||||||
|
challenging and there are several caveats here, even within the pure
|
||||||
|
CPython API (please refer to the Python docs for details). As for
|
||||||
|
pybind11, keep in mind that `gil_scoped_release` and `gil_scoped_acquire`
|
||||||
|
do not take sub-interpreters into account.
|
|
@ -0,0 +1,142 @@
|
||||||
|
Exceptions
|
||||||
|
##########
|
||||||
|
|
||||||
|
Built-in exception translation
|
||||||
|
==============================
|
||||||
|
|
||||||
|
When C++ code invoked from Python throws an ``std::exception``, it is
|
||||||
|
automatically converted into a Python ``Exception``. pybind11 defines multiple
|
||||||
|
special exception classes that will map to different types of Python
|
||||||
|
exceptions:
|
||||||
|
|
||||||
|
.. tabularcolumns:: |p{0.5\textwidth}|p{0.45\textwidth}|
|
||||||
|
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| C++ exception type | Python exception type |
|
||||||
|
+======================================+======================================+
|
||||||
|
| :class:`std::exception` | ``RuntimeError`` |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`std::bad_alloc` | ``MemoryError`` |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`std::domain_error` | ``ValueError`` |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`std::invalid_argument` | ``ValueError`` |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`std::length_error` | ``ValueError`` |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`std::out_of_range` | ``IndexError`` |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`std::range_error` | ``ValueError`` |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`pybind11::stop_iteration` | ``StopIteration`` (used to implement |
|
||||||
|
| | custom iterators) |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`pybind11::index_error` | ``IndexError`` (used to indicate out |
|
||||||
|
| | of bounds access in ``__getitem__``, |
|
||||||
|
| | ``__setitem__``, etc.) |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`pybind11::value_error` | ``ValueError`` (used to indicate |
|
||||||
|
| | wrong value passed in |
|
||||||
|
| | ``container.remove(...)``) |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`pybind11::key_error` | ``KeyError`` (used to indicate out |
|
||||||
|
| | of bounds access in ``__getitem__``, |
|
||||||
|
| | ``__setitem__`` in dict-like |
|
||||||
|
| | objects, etc.) |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
| :class:`pybind11::error_already_set` | Indicates that the Python exception |
|
||||||
|
| | flag has already been set via Python |
|
||||||
|
| | API calls from C++ code; this C++ |
|
||||||
|
| | exception is used to propagate such |
|
||||||
|
| | a Python exception back to Python. |
|
||||||
|
+--------------------------------------+--------------------------------------+
|
||||||
|
|
||||||
|
When a Python function invoked from C++ throws an exception, it is converted
|
||||||
|
into a C++ exception of type :class:`error_already_set` whose string payload
|
||||||
|
contains a textual summary.
|
||||||
|
|
||||||
|
There is also a special exception :class:`cast_error` that is thrown by
|
||||||
|
:func:`handle::call` when the input arguments cannot be converted to Python
|
||||||
|
objects.
|
||||||
|
|
||||||
|
Registering custom translators
|
||||||
|
==============================
|
||||||
|
|
||||||
|
If the default exception conversion policy described above is insufficient,
|
||||||
|
pybind11 also provides support for registering custom exception translators.
|
||||||
|
To register a simple exception conversion that translates a C++ exception into
|
||||||
|
a new Python exception using the C++ exception's ``what()`` method, a helper
|
||||||
|
function is available:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::register_exception<CppExp>(module, "PyExp");
|
||||||
|
|
||||||
|
This call creates a Python exception class with the name ``PyExp`` in the given
|
||||||
|
module and automatically converts any encountered exceptions of type ``CppExp``
|
||||||
|
into Python exceptions of type ``PyExp``.
|
||||||
|
|
||||||
|
When more advanced exception translation is needed, the function
|
||||||
|
``py::register_exception_translator(translator)`` can be used to register
|
||||||
|
functions that can translate arbitrary exception types (and which may include
|
||||||
|
additional logic to do so). The function takes a stateless callable (e.g. a
|
||||||
|
function pointer or a lambda function without captured variables) with the call
|
||||||
|
signature ``void(std::exception_ptr)``.
|
||||||
|
|
||||||
|
When a C++ exception is thrown, the registered exception translators are tried
|
||||||
|
in reverse order of registration (i.e. the last registered translator gets the
|
||||||
|
first shot at handling the exception).
|
||||||
|
|
||||||
|
Inside the translator, ``std::rethrow_exception`` should be used within
|
||||||
|
a try block to re-throw the exception. One or more catch clauses to catch
|
||||||
|
the appropriate exceptions should then be used with each clause using
|
||||||
|
``PyErr_SetString`` to set a Python exception or ``ex(string)`` to set
|
||||||
|
the python exception to a custom exception type (see below).
|
||||||
|
|
||||||
|
To declare a custom Python exception type, declare a ``py::exception`` variable
|
||||||
|
and use this in the associated exception translator (note: it is often useful
|
||||||
|
to make this a static declaration when using it inside a lambda expression
|
||||||
|
without requiring capturing).
|
||||||
|
|
||||||
|
|
||||||
|
The following example demonstrates this for a hypothetical exception classes
|
||||||
|
``MyCustomException`` and ``OtherException``: the first is translated to a
|
||||||
|
custom python exception ``MyCustomError``, while the second is translated to a
|
||||||
|
standard python RuntimeError:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
static py::exception<MyCustomException> exc(m, "MyCustomError");
|
||||||
|
py::register_exception_translator([](std::exception_ptr p) {
|
||||||
|
try {
|
||||||
|
if (p) std::rethrow_exception(p);
|
||||||
|
} catch (const MyCustomException &e) {
|
||||||
|
exc(e.what());
|
||||||
|
} catch (const OtherException &e) {
|
||||||
|
PyErr_SetString(PyExc_RuntimeError, e.what());
|
||||||
|
}
|
||||||
|
});
|
||||||
|
|
||||||
|
Multiple exceptions can be handled by a single translator, as shown in the
|
||||||
|
example above. If the exception is not caught by the current translator, the
|
||||||
|
previously registered one gets a chance.
|
||||||
|
|
||||||
|
If none of the registered exception translators is able to handle the
|
||||||
|
exception, it is handled by the default converter as described in the previous
|
||||||
|
section.
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_exceptions.cpp` contains examples
|
||||||
|
of various custom exception translators and custom exception types.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
You must call either ``PyErr_SetString`` or a custom exception's call
|
||||||
|
operator (``exc(string)``) for every exception caught in a custom exception
|
||||||
|
translator. Failure to do so will cause Python to crash with ``SystemError:
|
||||||
|
error return without exception set``.
|
||||||
|
|
||||||
|
Exceptions that you do not plan to handle should simply not be caught, or
|
||||||
|
may be explicitly (re-)thrown to delegate it to the other,
|
||||||
|
previously-declared existing exception translators.
|
|
@ -0,0 +1,507 @@
|
||||||
|
Functions
|
||||||
|
#########
|
||||||
|
|
||||||
|
Before proceeding with this section, make sure that you are already familiar
|
||||||
|
with the basics of binding functions and classes, as explained in :doc:`/basics`
|
||||||
|
and :doc:`/classes`. The following guide is applicable to both free and member
|
||||||
|
functions, i.e. *methods* in Python.
|
||||||
|
|
||||||
|
.. _return_value_policies:
|
||||||
|
|
||||||
|
Return value policies
|
||||||
|
=====================
|
||||||
|
|
||||||
|
Python and C++ use fundamentally different ways of managing the memory and
|
||||||
|
lifetime of objects managed by them. This can lead to issues when creating
|
||||||
|
bindings for functions that return a non-trivial type. Just by looking at the
|
||||||
|
type information, it is not clear whether Python should take charge of the
|
||||||
|
returned value and eventually free its resources, or if this is handled on the
|
||||||
|
C++ side. For this reason, pybind11 provides a several *return value policy*
|
||||||
|
annotations that can be passed to the :func:`module::def` and
|
||||||
|
:func:`class_::def` functions. The default policy is
|
||||||
|
:enum:`return_value_policy::automatic`.
|
||||||
|
|
||||||
|
Return value policies are tricky, and it's very important to get them right.
|
||||||
|
Just to illustrate what can go wrong, consider the following simple example:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
/* Function declaration */
|
||||||
|
Data *get_data() { return _data; /* (pointer to a static data structure) */ }
|
||||||
|
...
|
||||||
|
|
||||||
|
/* Binding code */
|
||||||
|
m.def("get_data", &get_data); // <-- KABOOM, will cause crash when called from Python
|
||||||
|
|
||||||
|
What's going on here? When ``get_data()`` is called from Python, the return
|
||||||
|
value (a native C++ type) must be wrapped to turn it into a usable Python type.
|
||||||
|
In this case, the default return value policy (:enum:`return_value_policy::automatic`)
|
||||||
|
causes pybind11 to assume ownership of the static ``_data`` instance.
|
||||||
|
|
||||||
|
When Python's garbage collector eventually deletes the Python
|
||||||
|
wrapper, pybind11 will also attempt to delete the C++ instance (via ``operator
|
||||||
|
delete()``) due to the implied ownership. At this point, the entire application
|
||||||
|
will come crashing down, though errors could also be more subtle and involve
|
||||||
|
silent data corruption.
|
||||||
|
|
||||||
|
In the above example, the policy :enum:`return_value_policy::reference` should have
|
||||||
|
been specified so that the global data instance is only *referenced* without any
|
||||||
|
implied transfer of ownership, i.e.:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("get_data", &get_data, return_value_policy::reference);
|
||||||
|
|
||||||
|
On the other hand, this is not the right policy for many other situations,
|
||||||
|
where ignoring ownership could lead to resource leaks.
|
||||||
|
As a developer using pybind11, it's important to be familiar with the different
|
||||||
|
return value policies, including which situation calls for which one of them.
|
||||||
|
The following table provides an overview of available policies:
|
||||||
|
|
||||||
|
.. tabularcolumns:: |p{0.5\textwidth}|p{0.45\textwidth}|
|
||||||
|
|
||||||
|
+--------------------------------------------------+----------------------------------------------------------------------------+
|
||||||
|
| Return value policy | Description |
|
||||||
|
+==================================================+============================================================================+
|
||||||
|
| :enum:`return_value_policy::take_ownership` | Reference an existing object (i.e. do not create a new copy) and take |
|
||||||
|
| | ownership. Python will call the destructor and delete operator when the |
|
||||||
|
| | object's reference count reaches zero. Undefined behavior ensues when the |
|
||||||
|
| | C++ side does the same, or when the data was not dynamically allocated. |
|
||||||
|
+--------------------------------------------------+----------------------------------------------------------------------------+
|
||||||
|
| :enum:`return_value_policy::copy` | Create a new copy of the returned object, which will be owned by Python. |
|
||||||
|
| | This policy is comparably safe because the lifetimes of the two instances |
|
||||||
|
| | are decoupled. |
|
||||||
|
+--------------------------------------------------+----------------------------------------------------------------------------+
|
||||||
|
| :enum:`return_value_policy::move` | Use ``std::move`` to move the return value contents into a new instance |
|
||||||
|
| | that will be owned by Python. This policy is comparably safe because the |
|
||||||
|
| | lifetimes of the two instances (move source and destination) are decoupled.|
|
||||||
|
+--------------------------------------------------+----------------------------------------------------------------------------+
|
||||||
|
| :enum:`return_value_policy::reference` | Reference an existing object, but do not take ownership. The C++ side is |
|
||||||
|
| | responsible for managing the object's lifetime and deallocating it when |
|
||||||
|
| | it is no longer used. Warning: undefined behavior will ensue when the C++ |
|
||||||
|
| | side deletes an object that is still referenced and used by Python. |
|
||||||
|
+--------------------------------------------------+----------------------------------------------------------------------------+
|
||||||
|
| :enum:`return_value_policy::reference_internal` | Indicates that the lifetime of the return value is tied to the lifetime |
|
||||||
|
| | of a parent object, namely the implicit ``this``, or ``self`` argument of |
|
||||||
|
| | the called method or property. Internally, this policy works just like |
|
||||||
|
| | :enum:`return_value_policy::reference` but additionally applies a |
|
||||||
|
| | ``keep_alive<0, 1>`` *call policy* (described in the next section) that |
|
||||||
|
| | prevents the parent object from being garbage collected as long as the |
|
||||||
|
| | return value is referenced by Python. This is the default policy for |
|
||||||
|
| | property getters created via ``def_property``, ``def_readwrite``, etc. |
|
||||||
|
+--------------------------------------------------+----------------------------------------------------------------------------+
|
||||||
|
| :enum:`return_value_policy::automatic` | **Default policy.** This policy falls back to the policy |
|
||||||
|
| | :enum:`return_value_policy::take_ownership` when the return value is a |
|
||||||
|
| | pointer. Otherwise, it uses :enum:`return_value_policy::move` or |
|
||||||
|
| | :enum:`return_value_policy::copy` for rvalue and lvalue references, |
|
||||||
|
| | respectively. See above for a description of what all of these different |
|
||||||
|
| | policies do. |
|
||||||
|
+--------------------------------------------------+----------------------------------------------------------------------------+
|
||||||
|
| :enum:`return_value_policy::automatic_reference` | As above, but use policy :enum:`return_value_policy::reference` when the |
|
||||||
|
| | return value is a pointer. This is the default conversion policy for |
|
||||||
|
| | function arguments when calling Python functions manually from C++ code |
|
||||||
|
| | (i.e. via handle::operator()). You probably won't need to use this. |
|
||||||
|
+--------------------------------------------------+----------------------------------------------------------------------------+
|
||||||
|
|
||||||
|
Return value policies can also be applied to properties:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
class_<MyClass>(m, "MyClass")
|
||||||
|
.def_property("data", &MyClass::getData, &MyClass::setData,
|
||||||
|
py::return_value_policy::copy);
|
||||||
|
|
||||||
|
Technically, the code above applies the policy to both the getter and the
|
||||||
|
setter function, however, the setter doesn't really care about *return*
|
||||||
|
value policies which makes this a convenient terse syntax. Alternatively,
|
||||||
|
targeted arguments can be passed through the :class:`cpp_function` constructor:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
class_<MyClass>(m, "MyClass")
|
||||||
|
.def_property("data"
|
||||||
|
py::cpp_function(&MyClass::getData, py::return_value_policy::copy),
|
||||||
|
py::cpp_function(&MyClass::setData)
|
||||||
|
);
|
||||||
|
|
||||||
|
.. warning::
|
||||||
|
|
||||||
|
Code with invalid return value policies might access uninitialized memory or
|
||||||
|
free data structures multiple times, which can lead to hard-to-debug
|
||||||
|
non-determinism and segmentation faults, hence it is worth spending the
|
||||||
|
time to understand all the different options in the table above.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
One important aspect of the above policies is that they only apply to
|
||||||
|
instances which pybind11 has *not* seen before, in which case the policy
|
||||||
|
clarifies essential questions about the return value's lifetime and
|
||||||
|
ownership. When pybind11 knows the instance already (as identified by its
|
||||||
|
type and address in memory), it will return the existing Python object
|
||||||
|
wrapper rather than creating a new copy.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
The next section on :ref:`call_policies` discusses *call policies* that can be
|
||||||
|
specified *in addition* to a return value policy from the list above. Call
|
||||||
|
policies indicate reference relationships that can involve both return values
|
||||||
|
and parameters of functions.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
As an alternative to elaborate call policies and lifetime management logic,
|
||||||
|
consider using smart pointers (see the section on :ref:`smart_pointers` for
|
||||||
|
details). Smart pointers can tell whether an object is still referenced from
|
||||||
|
C++ or Python, which generally eliminates the kinds of inconsistencies that
|
||||||
|
can lead to crashes or undefined behavior. For functions returning smart
|
||||||
|
pointers, it is not necessary to specify a return value policy.
|
||||||
|
|
||||||
|
.. _call_policies:
|
||||||
|
|
||||||
|
Additional call policies
|
||||||
|
========================
|
||||||
|
|
||||||
|
In addition to the above return value policies, further *call policies* can be
|
||||||
|
specified to indicate dependencies between parameters or ensure a certain state
|
||||||
|
for the function call.
|
||||||
|
|
||||||
|
Keep alive
|
||||||
|
----------
|
||||||
|
|
||||||
|
In general, this policy is required when the C++ object is any kind of container
|
||||||
|
and another object is being added to the container. ``keep_alive<Nurse, Patient>``
|
||||||
|
indicates that the argument with index ``Patient`` should be kept alive at least
|
||||||
|
until the argument with index ``Nurse`` is freed by the garbage collector. Argument
|
||||||
|
indices start at one, while zero refers to the return value. For methods, index
|
||||||
|
``1`` refers to the implicit ``this`` pointer, while regular arguments begin at
|
||||||
|
index ``2``. Arbitrarily many call policies can be specified. When a ``Nurse``
|
||||||
|
with value ``None`` is detected at runtime, the call policy does nothing.
|
||||||
|
|
||||||
|
When the nurse is not a pybind11-registered type, the implementation internally
|
||||||
|
relies on the ability to create a *weak reference* to the nurse object. When
|
||||||
|
the nurse object is not a pybind11-registered type and does not support weak
|
||||||
|
references, an exception will be thrown.
|
||||||
|
|
||||||
|
Consider the following example: here, the binding code for a list append
|
||||||
|
operation ties the lifetime of the newly added element to the underlying
|
||||||
|
container:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<List>(m, "List")
|
||||||
|
.def("append", &List::append, py::keep_alive<1, 2>());
|
||||||
|
|
||||||
|
For consistency, the argument indexing is identical for constructors. Index
|
||||||
|
``1`` still refers to the implicit ``this`` pointer, i.e. the object which is
|
||||||
|
being constructed. Index ``0`` refers to the return type which is presumed to
|
||||||
|
be ``void`` when a constructor is viewed like a function. The following example
|
||||||
|
ties the lifetime of the constructor element to the constructed object:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Nurse>(m, "Nurse")
|
||||||
|
.def(py::init<Patient &>(), py::keep_alive<1, 2>());
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
``keep_alive`` is analogous to the ``with_custodian_and_ward`` (if Nurse,
|
||||||
|
Patient != 0) and ``with_custodian_and_ward_postcall`` (if Nurse/Patient ==
|
||||||
|
0) policies from Boost.Python.
|
||||||
|
|
||||||
|
Call guard
|
||||||
|
----------
|
||||||
|
|
||||||
|
The ``call_guard<T>`` policy allows any scope guard type ``T`` to be placed
|
||||||
|
around the function call. For example, this definition:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("foo", foo, py::call_guard<T>());
|
||||||
|
|
||||||
|
is equivalent to the following pseudocode:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("foo", [](args...) {
|
||||||
|
T scope_guard;
|
||||||
|
return foo(args...); // forwarded arguments
|
||||||
|
});
|
||||||
|
|
||||||
|
The only requirement is that ``T`` is default-constructible, but otherwise any
|
||||||
|
scope guard will work. This is very useful in combination with `gil_scoped_release`.
|
||||||
|
See :ref:`gil`.
|
||||||
|
|
||||||
|
Multiple guards can also be specified as ``py::call_guard<T1, T2, T3...>``. The
|
||||||
|
constructor order is left to right and destruction happens in reverse.
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_call_policies.cpp` contains a complete example
|
||||||
|
that demonstrates using `keep_alive` and `call_guard` in more detail.
|
||||||
|
|
||||||
|
.. _python_objects_as_args:
|
||||||
|
|
||||||
|
Python objects as arguments
|
||||||
|
===========================
|
||||||
|
|
||||||
|
pybind11 exposes all major Python types using thin C++ wrapper classes. These
|
||||||
|
wrapper classes can also be used as parameters of functions in bindings, which
|
||||||
|
makes it possible to directly work with native Python types on the C++ side.
|
||||||
|
For instance, the following statement iterates over a Python ``dict``:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void print_dict(py::dict dict) {
|
||||||
|
/* Easily interact with Python types */
|
||||||
|
for (auto item : dict)
|
||||||
|
std::cout << "key=" << std::string(py::str(item.first)) << ", "
|
||||||
|
<< "value=" << std::string(py::str(item.second)) << std::endl;
|
||||||
|
}
|
||||||
|
|
||||||
|
It can be exported:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("print_dict", &print_dict);
|
||||||
|
|
||||||
|
And used in Python as usual:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> print_dict({'foo': 123, 'bar': 'hello'})
|
||||||
|
key=foo, value=123
|
||||||
|
key=bar, value=hello
|
||||||
|
|
||||||
|
For more information on using Python objects in C++, see :doc:`/advanced/pycpp/index`.
|
||||||
|
|
||||||
|
Accepting \*args and \*\*kwargs
|
||||||
|
===============================
|
||||||
|
|
||||||
|
Python provides a useful mechanism to define functions that accept arbitrary
|
||||||
|
numbers of arguments and keyword arguments:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
def generic(*args, **kwargs):
|
||||||
|
... # do something with args and kwargs
|
||||||
|
|
||||||
|
Such functions can also be created using pybind11:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void generic(py::args args, py::kwargs kwargs) {
|
||||||
|
/// .. do something with args
|
||||||
|
if (kwargs)
|
||||||
|
/// .. do something with kwargs
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Binding code
|
||||||
|
m.def("generic", &generic);
|
||||||
|
|
||||||
|
The class ``py::args`` derives from ``py::tuple`` and ``py::kwargs`` derives
|
||||||
|
from ``py::dict``.
|
||||||
|
|
||||||
|
You may also use just one or the other, and may combine these with other
|
||||||
|
arguments as long as the ``py::args`` and ``py::kwargs`` arguments are the last
|
||||||
|
arguments accepted by the function.
|
||||||
|
|
||||||
|
Please refer to the other examples for details on how to iterate over these,
|
||||||
|
and on how to cast their entries into C++ objects. A demonstration is also
|
||||||
|
available in ``tests/test_kwargs_and_defaults.cpp``.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
When combining \*args or \*\*kwargs with :ref:`keyword_args` you should
|
||||||
|
*not* include ``py::arg`` tags for the ``py::args`` and ``py::kwargs``
|
||||||
|
arguments.
|
||||||
|
|
||||||
|
Default arguments revisited
|
||||||
|
===========================
|
||||||
|
|
||||||
|
The section on :ref:`default_args` previously discussed basic usage of default
|
||||||
|
arguments using pybind11. One noteworthy aspect of their implementation is that
|
||||||
|
default arguments are converted to Python objects right at declaration time.
|
||||||
|
Consider the following example:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<MyClass>("MyClass")
|
||||||
|
.def("myFunction", py::arg("arg") = SomeType(123));
|
||||||
|
|
||||||
|
In this case, pybind11 must already be set up to deal with values of the type
|
||||||
|
``SomeType`` (via a prior instantiation of ``py::class_<SomeType>``), or an
|
||||||
|
exception will be thrown.
|
||||||
|
|
||||||
|
Another aspect worth highlighting is that the "preview" of the default argument
|
||||||
|
in the function signature is generated using the object's ``__repr__`` method.
|
||||||
|
If not available, the signature may not be very helpful, e.g.:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
FUNCTIONS
|
||||||
|
...
|
||||||
|
| myFunction(...)
|
||||||
|
| Signature : (MyClass, arg : SomeType = <SomeType object at 0x101b7b080>) -> NoneType
|
||||||
|
...
|
||||||
|
|
||||||
|
The first way of addressing this is by defining ``SomeType.__repr__``.
|
||||||
|
Alternatively, it is possible to specify the human-readable preview of the
|
||||||
|
default argument manually using the ``arg_v`` notation:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<MyClass>("MyClass")
|
||||||
|
.def("myFunction", py::arg_v("arg", SomeType(123), "SomeType(123)"));
|
||||||
|
|
||||||
|
Sometimes it may be necessary to pass a null pointer value as a default
|
||||||
|
argument. In this case, remember to cast it to the underlying type in question,
|
||||||
|
like so:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<MyClass>("MyClass")
|
||||||
|
.def("myFunction", py::arg("arg") = (SomeType *) nullptr);
|
||||||
|
|
||||||
|
.. _nonconverting_arguments:
|
||||||
|
|
||||||
|
Non-converting arguments
|
||||||
|
========================
|
||||||
|
|
||||||
|
Certain argument types may support conversion from one type to another. Some
|
||||||
|
examples of conversions are:
|
||||||
|
|
||||||
|
* :ref:`implicit_conversions` declared using ``py::implicitly_convertible<A,B>()``
|
||||||
|
* Calling a method accepting a double with an integer argument
|
||||||
|
* Calling a ``std::complex<float>`` argument with a non-complex python type
|
||||||
|
(for example, with a float). (Requires the optional ``pybind11/complex.h``
|
||||||
|
header).
|
||||||
|
* Calling a function taking an Eigen matrix reference with a numpy array of the
|
||||||
|
wrong type or of an incompatible data layout. (Requires the optional
|
||||||
|
``pybind11/eigen.h`` header).
|
||||||
|
|
||||||
|
This behaviour is sometimes undesirable: the binding code may prefer to raise
|
||||||
|
an error rather than convert the argument. This behaviour can be obtained
|
||||||
|
through ``py::arg`` by calling the ``.noconvert()`` method of the ``py::arg``
|
||||||
|
object, such as:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("floats_only", [](double f) { return 0.5 * f; }, py::arg("f").noconvert());
|
||||||
|
m.def("floats_preferred", [](double f) { return 0.5 * f; }, py::arg("f"));
|
||||||
|
|
||||||
|
Attempting the call the second function (the one without ``.noconvert()``) with
|
||||||
|
an integer will succeed, but attempting to call the ``.noconvert()`` version
|
||||||
|
will fail with a ``TypeError``:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> floats_preferred(4)
|
||||||
|
2.0
|
||||||
|
>>> floats_only(4)
|
||||||
|
Traceback (most recent call last):
|
||||||
|
File "<stdin>", line 1, in <module>
|
||||||
|
TypeError: floats_only(): incompatible function arguments. The following argument types are supported:
|
||||||
|
1. (f: float) -> float
|
||||||
|
|
||||||
|
Invoked with: 4
|
||||||
|
|
||||||
|
You may, of course, combine this with the :var:`_a` shorthand notation (see
|
||||||
|
:ref:`keyword_args`) and/or :ref:`default_args`. It is also permitted to omit
|
||||||
|
the argument name by using the ``py::arg()`` constructor without an argument
|
||||||
|
name, i.e. by specifying ``py::arg().noconvert()``.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
When specifying ``py::arg`` options it is necessary to provide the same
|
||||||
|
number of options as the bound function has arguments. Thus if you want to
|
||||||
|
enable no-convert behaviour for just one of several arguments, you will
|
||||||
|
need to specify a ``py::arg()`` annotation for each argument with the
|
||||||
|
no-convert argument modified to ``py::arg().noconvert()``.
|
||||||
|
|
||||||
|
.. _none_arguments:
|
||||||
|
|
||||||
|
Allow/Prohibiting None arguments
|
||||||
|
================================
|
||||||
|
|
||||||
|
When a C++ type registered with :class:`py::class_` is passed as an argument to
|
||||||
|
a function taking the instance as pointer or shared holder (e.g. ``shared_ptr``
|
||||||
|
or a custom, copyable holder as described in :ref:`smart_pointers`), pybind
|
||||||
|
allows ``None`` to be passed from Python which results in calling the C++
|
||||||
|
function with ``nullptr`` (or an empty holder) for the argument.
|
||||||
|
|
||||||
|
To explicitly enable or disable this behaviour, using the
|
||||||
|
``.none`` method of the :class:`py::arg` object:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Dog>(m, "Dog").def(py::init<>());
|
||||||
|
py::class_<Cat>(m, "Cat").def(py::init<>());
|
||||||
|
m.def("bark", [](Dog *dog) -> std::string {
|
||||||
|
if (dog) return "woof!"; /* Called with a Dog instance */
|
||||||
|
else return "(no dog)"; /* Called with None, dog == nullptr */
|
||||||
|
}, py::arg("dog").none(true));
|
||||||
|
m.def("meow", [](Cat *cat) -> std::string {
|
||||||
|
// Can't be called with None argument
|
||||||
|
return "meow";
|
||||||
|
}, py::arg("cat").none(false));
|
||||||
|
|
||||||
|
With the above, the Python call ``bark(None)`` will return the string ``"(no
|
||||||
|
dog)"``, while attempting to call ``meow(None)`` will raise a ``TypeError``:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> from animals import Dog, Cat, bark, meow
|
||||||
|
>>> bark(Dog())
|
||||||
|
'woof!'
|
||||||
|
>>> meow(Cat())
|
||||||
|
'meow'
|
||||||
|
>>> bark(None)
|
||||||
|
'(no dog)'
|
||||||
|
>>> meow(None)
|
||||||
|
Traceback (most recent call last):
|
||||||
|
File "<stdin>", line 1, in <module>
|
||||||
|
TypeError: meow(): incompatible function arguments. The following argument types are supported:
|
||||||
|
1. (cat: animals.Cat) -> str
|
||||||
|
|
||||||
|
Invoked with: None
|
||||||
|
|
||||||
|
The default behaviour when the tag is unspecified is to allow ``None``.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
Even when ``.none(true)`` is specified for an argument, ``None`` will be converted to a
|
||||||
|
``nullptr`` *only* for custom and :ref:`opaque <opaque>` types. Pointers to built-in types
|
||||||
|
(``double *``, ``int *``, ...) and STL types (``std::vector<T> *``, ...; if ``pybind11/stl.h``
|
||||||
|
is included) are copied when converted to C++ (see :doc:`/advanced/cast/overview`) and will
|
||||||
|
not allow ``None`` as argument. To pass optional argument of these copied types consider
|
||||||
|
using ``std::optional<T>``
|
||||||
|
|
||||||
|
Overload resolution order
|
||||||
|
=========================
|
||||||
|
|
||||||
|
When a function or method with multiple overloads is called from Python,
|
||||||
|
pybind11 determines which overload to call in two passes. The first pass
|
||||||
|
attempts to call each overload without allowing argument conversion (as if
|
||||||
|
every argument had been specified as ``py::arg().noconvert()`` as described
|
||||||
|
above).
|
||||||
|
|
||||||
|
If no overload succeeds in the no-conversion first pass, a second pass is
|
||||||
|
attempted in which argument conversion is allowed (except where prohibited via
|
||||||
|
an explicit ``py::arg().noconvert()`` attribute in the function definition).
|
||||||
|
|
||||||
|
If the second pass also fails a ``TypeError`` is raised.
|
||||||
|
|
||||||
|
Within each pass, overloads are tried in the order they were registered with
|
||||||
|
pybind11.
|
||||||
|
|
||||||
|
What this means in practice is that pybind11 will prefer any overload that does
|
||||||
|
not require conversion of arguments to an overload that does, but otherwise prefers
|
||||||
|
earlier-defined overloads to later-defined ones.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
pybind11 does *not* further prioritize based on the number/pattern of
|
||||||
|
overloaded arguments. That is, pybind11 does not prioritize a function
|
||||||
|
requiring one conversion over one requiring three, but only prioritizes
|
||||||
|
overloads requiring no conversion at all to overloads that require
|
||||||
|
conversion of at least one argument.
|
|
@ -0,0 +1,306 @@
|
||||||
|
Miscellaneous
|
||||||
|
#############
|
||||||
|
|
||||||
|
.. _macro_notes:
|
||||||
|
|
||||||
|
General notes regarding convenience macros
|
||||||
|
==========================================
|
||||||
|
|
||||||
|
pybind11 provides a few convenience macros such as
|
||||||
|
:func:`PYBIND11_DECLARE_HOLDER_TYPE` and ``PYBIND11_OVERLOAD_*``. Since these
|
||||||
|
are "just" macros that are evaluated in the preprocessor (which has no concept
|
||||||
|
of types), they *will* get confused by commas in a template argument; for
|
||||||
|
example, consider:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
PYBIND11_OVERLOAD(MyReturnType<T1, T2>, Class<T3, T4>, func)
|
||||||
|
|
||||||
|
The limitation of the C preprocessor interprets this as five arguments (with new
|
||||||
|
arguments beginning after each comma) rather than three. To get around this,
|
||||||
|
there are two alternatives: you can use a type alias, or you can wrap the type
|
||||||
|
using the ``PYBIND11_TYPE`` macro:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// Version 1: using a type alias
|
||||||
|
using ReturnType = MyReturnType<T1, T2>;
|
||||||
|
using ClassType = Class<T3, T4>;
|
||||||
|
PYBIND11_OVERLOAD(ReturnType, ClassType, func);
|
||||||
|
|
||||||
|
// Version 2: using the PYBIND11_TYPE macro:
|
||||||
|
PYBIND11_OVERLOAD(PYBIND11_TYPE(MyReturnType<T1, T2>),
|
||||||
|
PYBIND11_TYPE(Class<T3, T4>), func)
|
||||||
|
|
||||||
|
The ``PYBIND11_MAKE_OPAQUE`` macro does *not* require the above workarounds.
|
||||||
|
|
||||||
|
.. _gil:
|
||||||
|
|
||||||
|
Global Interpreter Lock (GIL)
|
||||||
|
=============================
|
||||||
|
|
||||||
|
When calling a C++ function from Python, the GIL is always held.
|
||||||
|
The classes :class:`gil_scoped_release` and :class:`gil_scoped_acquire` can be
|
||||||
|
used to acquire and release the global interpreter lock in the body of a C++
|
||||||
|
function call. In this way, long-running C++ code can be parallelized using
|
||||||
|
multiple Python threads. Taking :ref:`overriding_virtuals` as an example, this
|
||||||
|
could be realized as follows (important changes highlighted):
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
:emphasize-lines: 8,9,31,32
|
||||||
|
|
||||||
|
class PyAnimal : public Animal {
|
||||||
|
public:
|
||||||
|
/* Inherit the constructors */
|
||||||
|
using Animal::Animal;
|
||||||
|
|
||||||
|
/* Trampoline (need one for each virtual function) */
|
||||||
|
std::string go(int n_times) {
|
||||||
|
/* Acquire GIL before calling Python code */
|
||||||
|
py::gil_scoped_acquire acquire;
|
||||||
|
|
||||||
|
PYBIND11_OVERLOAD_PURE(
|
||||||
|
std::string, /* Return type */
|
||||||
|
Animal, /* Parent class */
|
||||||
|
go, /* Name of function */
|
||||||
|
n_times /* Argument(s) */
|
||||||
|
);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
PYBIND11_MODULE(example, m) {
|
||||||
|
py::class_<Animal, PyAnimal> animal(m, "Animal");
|
||||||
|
animal
|
||||||
|
.def(py::init<>())
|
||||||
|
.def("go", &Animal::go);
|
||||||
|
|
||||||
|
py::class_<Dog>(m, "Dog", animal)
|
||||||
|
.def(py::init<>());
|
||||||
|
|
||||||
|
m.def("call_go", [](Animal *animal) -> std::string {
|
||||||
|
/* Release GIL before calling into (potentially long-running) C++ code */
|
||||||
|
py::gil_scoped_release release;
|
||||||
|
return call_go(animal);
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
The ``call_go`` wrapper can also be simplified using the `call_guard` policy
|
||||||
|
(see :ref:`call_policies`) which yields the same result:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("call_go", &call_go, py::call_guard<py::gil_scoped_release>());
|
||||||
|
|
||||||
|
|
||||||
|
Binding sequence data types, iterators, the slicing protocol, etc.
|
||||||
|
==================================================================
|
||||||
|
|
||||||
|
Please refer to the supplemental example for details.
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_sequences_and_iterators.cpp` contains a
|
||||||
|
complete example that shows how to bind a sequence data type, including
|
||||||
|
length queries (``__len__``), iterators (``__iter__``), the slicing
|
||||||
|
protocol and other kinds of useful operations.
|
||||||
|
|
||||||
|
|
||||||
|
Partitioning code over multiple extension modules
|
||||||
|
=================================================
|
||||||
|
|
||||||
|
It's straightforward to split binding code over multiple extension modules,
|
||||||
|
while referencing types that are declared elsewhere. Everything "just" works
|
||||||
|
without any special precautions. One exception to this rule occurs when
|
||||||
|
extending a type declared in another extension module. Recall the basic example
|
||||||
|
from Section :ref:`inheritance`.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Pet> pet(m, "Pet");
|
||||||
|
pet.def(py::init<const std::string &>())
|
||||||
|
.def_readwrite("name", &Pet::name);
|
||||||
|
|
||||||
|
py::class_<Dog>(m, "Dog", pet /* <- specify parent */)
|
||||||
|
.def(py::init<const std::string &>())
|
||||||
|
.def("bark", &Dog::bark);
|
||||||
|
|
||||||
|
Suppose now that ``Pet`` bindings are defined in a module named ``basic``,
|
||||||
|
whereas the ``Dog`` bindings are defined somewhere else. The challenge is of
|
||||||
|
course that the variable ``pet`` is not available anymore though it is needed
|
||||||
|
to indicate the inheritance relationship to the constructor of ``class_<Dog>``.
|
||||||
|
However, it can be acquired as follows:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::object pet = (py::object) py::module::import("basic").attr("Pet");
|
||||||
|
|
||||||
|
py::class_<Dog>(m, "Dog", pet)
|
||||||
|
.def(py::init<const std::string &>())
|
||||||
|
.def("bark", &Dog::bark);
|
||||||
|
|
||||||
|
Alternatively, you can specify the base class as a template parameter option to
|
||||||
|
``class_``, which performs an automated lookup of the corresponding Python
|
||||||
|
type. Like the above code, however, this also requires invoking the ``import``
|
||||||
|
function once to ensure that the pybind11 binding code of the module ``basic``
|
||||||
|
has been executed:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::module::import("basic");
|
||||||
|
|
||||||
|
py::class_<Dog, Pet>(m, "Dog")
|
||||||
|
.def(py::init<const std::string &>())
|
||||||
|
.def("bark", &Dog::bark);
|
||||||
|
|
||||||
|
Naturally, both methods will fail when there are cyclic dependencies.
|
||||||
|
|
||||||
|
Note that pybind11 code compiled with hidden-by-default symbol visibility (e.g.
|
||||||
|
via the command line flag ``-fvisibility=hidden`` on GCC/Clang), which is
|
||||||
|
required for proper pybind11 functionality, can interfere with the ability to
|
||||||
|
access types defined in another extension module. Working around this requires
|
||||||
|
manually exporting types that are accessed by multiple extension modules;
|
||||||
|
pybind11 provides a macro to do just this:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
class PYBIND11_EXPORT Dog : public Animal {
|
||||||
|
...
|
||||||
|
};
|
||||||
|
|
||||||
|
Note also that it is possible (although would rarely be required) to share arbitrary
|
||||||
|
C++ objects between extension modules at runtime. Internal library data is shared
|
||||||
|
between modules using capsule machinery [#f6]_ which can be also utilized for
|
||||||
|
storing, modifying and accessing user-defined data. Note that an extension module
|
||||||
|
will "see" other extensions' data if and only if they were built with the same
|
||||||
|
pybind11 version. Consider the following example:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
auto data = (MyData *) py::get_shared_data("mydata");
|
||||||
|
if (!data)
|
||||||
|
data = (MyData *) py::set_shared_data("mydata", new MyData(42));
|
||||||
|
|
||||||
|
If the above snippet was used in several separately compiled extension modules,
|
||||||
|
the first one to be imported would create a ``MyData`` instance and associate
|
||||||
|
a ``"mydata"`` key with a pointer to it. Extensions that are imported later
|
||||||
|
would be then able to access the data behind the same pointer.
|
||||||
|
|
||||||
|
.. [#f6] https://docs.python.org/3/extending/extending.html#using-capsules
|
||||||
|
|
||||||
|
Module Destructors
|
||||||
|
==================
|
||||||
|
|
||||||
|
pybind11 does not provide an explicit mechanism to invoke cleanup code at
|
||||||
|
module destruction time. In rare cases where such functionality is required, it
|
||||||
|
is possible to emulate it using Python capsules or weak references with a
|
||||||
|
destruction callback.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
auto cleanup_callback = []() {
|
||||||
|
// perform cleanup here -- this function is called with the GIL held
|
||||||
|
};
|
||||||
|
|
||||||
|
m.add_object("_cleanup", py::capsule(cleanup_callback));
|
||||||
|
|
||||||
|
This approach has the potential downside that instances of classes exposed
|
||||||
|
within the module may still be alive when the cleanup callback is invoked
|
||||||
|
(whether this is acceptable will generally depend on the application).
|
||||||
|
|
||||||
|
Alternatively, the capsule may also be stashed within a type object, which
|
||||||
|
ensures that it not called before all instances of that type have been
|
||||||
|
collected:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
auto cleanup_callback = []() { /* ... */ };
|
||||||
|
m.attr("BaseClass").attr("_cleanup") = py::capsule(cleanup_callback);
|
||||||
|
|
||||||
|
Both approaches also expose a potentially dangerous ``_cleanup`` attribute in
|
||||||
|
Python, which may be undesirable from an API standpoint (a premature explicit
|
||||||
|
call from Python might lead to undefined behavior). Yet another approach that
|
||||||
|
avoids this issue involves weak reference with a cleanup callback:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// Register a callback function that is invoked when the BaseClass object is colelcted
|
||||||
|
py::cpp_function cleanup_callback(
|
||||||
|
[](py::handle weakref) {
|
||||||
|
// perform cleanup here -- this function is called with the GIL held
|
||||||
|
|
||||||
|
weakref.dec_ref(); // release weak reference
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
// Create a weak reference with a cleanup callback and initially leak it
|
||||||
|
(void) py::weakref(m.attr("BaseClass"), cleanup_callback).release();
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
PyPy (at least version 5.9) does not garbage collect objects when the
|
||||||
|
interpreter exits. An alternative approach (which also works on CPython) is to use
|
||||||
|
the :py:mod:`atexit` module [#f7]_, for example:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
auto atexit = py::module::import("atexit");
|
||||||
|
atexit.attr("register")(py::cpp_function([]() {
|
||||||
|
// perform cleanup here -- this function is called with the GIL held
|
||||||
|
}));
|
||||||
|
|
||||||
|
.. [#f7] https://docs.python.org/3/library/atexit.html
|
||||||
|
|
||||||
|
|
||||||
|
Generating documentation using Sphinx
|
||||||
|
=====================================
|
||||||
|
|
||||||
|
Sphinx [#f4]_ has the ability to inspect the signatures and documentation
|
||||||
|
strings in pybind11-based extension modules to automatically generate beautiful
|
||||||
|
documentation in a variety formats. The python_example repository [#f5]_ contains a
|
||||||
|
simple example repository which uses this approach.
|
||||||
|
|
||||||
|
There are two potential gotchas when using this approach: first, make sure that
|
||||||
|
the resulting strings do not contain any :kbd:`TAB` characters, which break the
|
||||||
|
docstring parsing routines. You may want to use C++11 raw string literals,
|
||||||
|
which are convenient for multi-line comments. Conveniently, any excess
|
||||||
|
indentation will be automatically be removed by Sphinx. However, for this to
|
||||||
|
work, it is important that all lines are indented consistently, i.e.:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// ok
|
||||||
|
m.def("foo", &foo, R"mydelimiter(
|
||||||
|
The foo function
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
)mydelimiter");
|
||||||
|
|
||||||
|
// *not ok*
|
||||||
|
m.def("foo", &foo, R"mydelimiter(The foo function
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
)mydelimiter");
|
||||||
|
|
||||||
|
By default, pybind11 automatically generates and prepends a signature to the docstring of a function
|
||||||
|
registered with ``module::def()`` and ``class_::def()``. Sometimes this
|
||||||
|
behavior is not desirable, because you want to provide your own signature or remove
|
||||||
|
the docstring completely to exclude the function from the Sphinx documentation.
|
||||||
|
The class ``options`` allows you to selectively suppress auto-generated signatures:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
PYBIND11_MODULE(example, m) {
|
||||||
|
py::options options;
|
||||||
|
options.disable_function_signatures();
|
||||||
|
|
||||||
|
m.def("add", [](int a, int b) { return a + b; }, "A function which adds two numbers");
|
||||||
|
}
|
||||||
|
|
||||||
|
Note that changes to the settings affect only function bindings created during the
|
||||||
|
lifetime of the ``options`` instance. When it goes out of scope at the end of the module's init function,
|
||||||
|
the default settings are restored to prevent unwanted side effects.
|
||||||
|
|
||||||
|
.. [#f4] http://www.sphinx-doc.org
|
||||||
|
.. [#f5] http://github.com/pybind/python_example
|
|
@ -0,0 +1,13 @@
|
||||||
|
Python C++ interface
|
||||||
|
####################
|
||||||
|
|
||||||
|
pybind11 exposes Python types and functions using thin C++ wrappers, which
|
||||||
|
makes it possible to conveniently call Python code from C++ without resorting
|
||||||
|
to Python's C API.
|
||||||
|
|
||||||
|
.. toctree::
|
||||||
|
:maxdepth: 2
|
||||||
|
|
||||||
|
object
|
||||||
|
numpy
|
||||||
|
utilities
|
|
@ -0,0 +1,386 @@
|
||||||
|
.. _numpy:
|
||||||
|
|
||||||
|
NumPy
|
||||||
|
#####
|
||||||
|
|
||||||
|
Buffer protocol
|
||||||
|
===============
|
||||||
|
|
||||||
|
Python supports an extremely general and convenient approach for exchanging
|
||||||
|
data between plugin libraries. Types can expose a buffer view [#f2]_, which
|
||||||
|
provides fast direct access to the raw internal data representation. Suppose we
|
||||||
|
want to bind the following simplistic Matrix class:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
class Matrix {
|
||||||
|
public:
|
||||||
|
Matrix(size_t rows, size_t cols) : m_rows(rows), m_cols(cols) {
|
||||||
|
m_data = new float[rows*cols];
|
||||||
|
}
|
||||||
|
float *data() { return m_data; }
|
||||||
|
size_t rows() const { return m_rows; }
|
||||||
|
size_t cols() const { return m_cols; }
|
||||||
|
private:
|
||||||
|
size_t m_rows, m_cols;
|
||||||
|
float *m_data;
|
||||||
|
};
|
||||||
|
|
||||||
|
The following binding code exposes the ``Matrix`` contents as a buffer object,
|
||||||
|
making it possible to cast Matrices into NumPy arrays. It is even possible to
|
||||||
|
completely avoid copy operations with Python expressions like
|
||||||
|
``np.array(matrix_instance, copy = False)``.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Matrix>(m, "Matrix", py::buffer_protocol())
|
||||||
|
.def_buffer([](Matrix &m) -> py::buffer_info {
|
||||||
|
return py::buffer_info(
|
||||||
|
m.data(), /* Pointer to buffer */
|
||||||
|
sizeof(float), /* Size of one scalar */
|
||||||
|
py::format_descriptor<float>::format(), /* Python struct-style format descriptor */
|
||||||
|
2, /* Number of dimensions */
|
||||||
|
{ m.rows(), m.cols() }, /* Buffer dimensions */
|
||||||
|
{ sizeof(float) * m.cols(), /* Strides (in bytes) for each index */
|
||||||
|
sizeof(float) }
|
||||||
|
);
|
||||||
|
});
|
||||||
|
|
||||||
|
Supporting the buffer protocol in a new type involves specifying the special
|
||||||
|
``py::buffer_protocol()`` tag in the ``py::class_`` constructor and calling the
|
||||||
|
``def_buffer()`` method with a lambda function that creates a
|
||||||
|
``py::buffer_info`` description record on demand describing a given matrix
|
||||||
|
instance. The contents of ``py::buffer_info`` mirror the Python buffer protocol
|
||||||
|
specification.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
struct buffer_info {
|
||||||
|
void *ptr;
|
||||||
|
ssize_t itemsize;
|
||||||
|
std::string format;
|
||||||
|
ssize_t ndim;
|
||||||
|
std::vector<ssize_t> shape;
|
||||||
|
std::vector<ssize_t> strides;
|
||||||
|
};
|
||||||
|
|
||||||
|
To create a C++ function that can take a Python buffer object as an argument,
|
||||||
|
simply use the type ``py::buffer`` as one of its arguments. Buffers can exist
|
||||||
|
in a great variety of configurations, hence some safety checks are usually
|
||||||
|
necessary in the function body. Below, you can see an basic example on how to
|
||||||
|
define a custom constructor for the Eigen double precision matrix
|
||||||
|
(``Eigen::MatrixXd``) type, which supports initialization from compatible
|
||||||
|
buffer objects (e.g. a NumPy matrix).
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
/* Bind MatrixXd (or some other Eigen type) to Python */
|
||||||
|
typedef Eigen::MatrixXd Matrix;
|
||||||
|
|
||||||
|
typedef Matrix::Scalar Scalar;
|
||||||
|
constexpr bool rowMajor = Matrix::Flags & Eigen::RowMajorBit;
|
||||||
|
|
||||||
|
py::class_<Matrix>(m, "Matrix", py::buffer_protocol())
|
||||||
|
.def("__init__", [](Matrix &m, py::buffer b) {
|
||||||
|
typedef Eigen::Stride<Eigen::Dynamic, Eigen::Dynamic> Strides;
|
||||||
|
|
||||||
|
/* Request a buffer descriptor from Python */
|
||||||
|
py::buffer_info info = b.request();
|
||||||
|
|
||||||
|
/* Some sanity checks ... */
|
||||||
|
if (info.format != py::format_descriptor<Scalar>::format())
|
||||||
|
throw std::runtime_error("Incompatible format: expected a double array!");
|
||||||
|
|
||||||
|
if (info.ndim != 2)
|
||||||
|
throw std::runtime_error("Incompatible buffer dimension!");
|
||||||
|
|
||||||
|
auto strides = Strides(
|
||||||
|
info.strides[rowMajor ? 0 : 1] / (py::ssize_t)sizeof(Scalar),
|
||||||
|
info.strides[rowMajor ? 1 : 0] / (py::ssize_t)sizeof(Scalar));
|
||||||
|
|
||||||
|
auto map = Eigen::Map<Matrix, 0, Strides>(
|
||||||
|
static_cast<Scalar *>(info.ptr), info.shape[0], info.shape[1], strides);
|
||||||
|
|
||||||
|
new (&m) Matrix(map);
|
||||||
|
});
|
||||||
|
|
||||||
|
For reference, the ``def_buffer()`` call for this Eigen data type should look
|
||||||
|
as follows:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
.def_buffer([](Matrix &m) -> py::buffer_info {
|
||||||
|
return py::buffer_info(
|
||||||
|
m.data(), /* Pointer to buffer */
|
||||||
|
sizeof(Scalar), /* Size of one scalar */
|
||||||
|
py::format_descriptor<Scalar>::format(), /* Python struct-style format descriptor */
|
||||||
|
2, /* Number of dimensions */
|
||||||
|
{ m.rows(), m.cols() }, /* Buffer dimensions */
|
||||||
|
{ sizeof(Scalar) * (rowMajor ? m.cols() : 1),
|
||||||
|
sizeof(Scalar) * (rowMajor ? 1 : m.rows()) }
|
||||||
|
/* Strides (in bytes) for each index */
|
||||||
|
);
|
||||||
|
})
|
||||||
|
|
||||||
|
For a much easier approach of binding Eigen types (although with some
|
||||||
|
limitations), refer to the section on :doc:`/advanced/cast/eigen`.
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_buffers.cpp` contains a complete example
|
||||||
|
that demonstrates using the buffer protocol with pybind11 in more detail.
|
||||||
|
|
||||||
|
.. [#f2] http://docs.python.org/3/c-api/buffer.html
|
||||||
|
|
||||||
|
Arrays
|
||||||
|
======
|
||||||
|
|
||||||
|
By exchanging ``py::buffer`` with ``py::array`` in the above snippet, we can
|
||||||
|
restrict the function so that it only accepts NumPy arrays (rather than any
|
||||||
|
type of Python object satisfying the buffer protocol).
|
||||||
|
|
||||||
|
In many situations, we want to define a function which only accepts a NumPy
|
||||||
|
array of a certain data type. This is possible via the ``py::array_t<T>``
|
||||||
|
template. For instance, the following function requires the argument to be a
|
||||||
|
NumPy array containing double precision values.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void f(py::array_t<double> array);
|
||||||
|
|
||||||
|
When it is invoked with a different type (e.g. an integer or a list of
|
||||||
|
integers), the binding code will attempt to cast the input into a NumPy array
|
||||||
|
of the requested type. Note that this feature requires the
|
||||||
|
:file:`pybind11/numpy.h` header to be included.
|
||||||
|
|
||||||
|
Data in NumPy arrays is not guaranteed to packed in a dense manner;
|
||||||
|
furthermore, entries can be separated by arbitrary column and row strides.
|
||||||
|
Sometimes, it can be useful to require a function to only accept dense arrays
|
||||||
|
using either the C (row-major) or Fortran (column-major) ordering. This can be
|
||||||
|
accomplished via a second template argument with values ``py::array::c_style``
|
||||||
|
or ``py::array::f_style``.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void f(py::array_t<double, py::array::c_style | py::array::forcecast> array);
|
||||||
|
|
||||||
|
The ``py::array::forcecast`` argument is the default value of the second
|
||||||
|
template parameter, and it ensures that non-conforming arguments are converted
|
||||||
|
into an array satisfying the specified requirements instead of trying the next
|
||||||
|
function overload.
|
||||||
|
|
||||||
|
Structured types
|
||||||
|
================
|
||||||
|
|
||||||
|
In order for ``py::array_t`` to work with structured (record) types, we first
|
||||||
|
need to register the memory layout of the type. This can be done via
|
||||||
|
``PYBIND11_NUMPY_DTYPE`` macro, called in the plugin definition code, which
|
||||||
|
expects the type followed by field names:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
struct A {
|
||||||
|
int x;
|
||||||
|
double y;
|
||||||
|
};
|
||||||
|
|
||||||
|
struct B {
|
||||||
|
int z;
|
||||||
|
A a;
|
||||||
|
};
|
||||||
|
|
||||||
|
// ...
|
||||||
|
PYBIND11_MODULE(test, m) {
|
||||||
|
// ...
|
||||||
|
|
||||||
|
PYBIND11_NUMPY_DTYPE(A, x, y);
|
||||||
|
PYBIND11_NUMPY_DTYPE(B, z, a);
|
||||||
|
/* now both A and B can be used as template arguments to py::array_t */
|
||||||
|
}
|
||||||
|
|
||||||
|
The structure should consist of fundamental arithmetic types, ``std::complex``,
|
||||||
|
previously registered substructures, and arrays of any of the above. Both C++
|
||||||
|
arrays and ``std::array`` are supported. While there is a static assertion to
|
||||||
|
prevent many types of unsupported structures, it is still the user's
|
||||||
|
responsibility to use only "plain" structures that can be safely manipulated as
|
||||||
|
raw memory without violating invariants.
|
||||||
|
|
||||||
|
Vectorizing functions
|
||||||
|
=====================
|
||||||
|
|
||||||
|
Suppose we want to bind a function with the following signature to Python so
|
||||||
|
that it can process arbitrary NumPy array arguments (vectors, matrices, general
|
||||||
|
N-D arrays) in addition to its normal arguments:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
double my_func(int x, float y, double z);
|
||||||
|
|
||||||
|
After including the ``pybind11/numpy.h`` header, this is extremely simple:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("vectorized_func", py::vectorize(my_func));
|
||||||
|
|
||||||
|
Invoking the function like below causes 4 calls to be made to ``my_func`` with
|
||||||
|
each of the array elements. The significant advantage of this compared to
|
||||||
|
solutions like ``numpy.vectorize()`` is that the loop over the elements runs
|
||||||
|
entirely on the C++ side and can be crunched down into a tight, optimized loop
|
||||||
|
by the compiler. The result is returned as a NumPy array of type
|
||||||
|
``numpy.dtype.float64``.
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> x = np.array([[1, 3],[5, 7]])
|
||||||
|
>>> y = np.array([[2, 4],[6, 8]])
|
||||||
|
>>> z = 3
|
||||||
|
>>> result = vectorized_func(x, y, z)
|
||||||
|
|
||||||
|
The scalar argument ``z`` is transparently replicated 4 times. The input
|
||||||
|
arrays ``x`` and ``y`` are automatically converted into the right types (they
|
||||||
|
are of type ``numpy.dtype.int64`` but need to be ``numpy.dtype.int32`` and
|
||||||
|
``numpy.dtype.float32``, respectively).
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
Only arithmetic, complex, and POD types passed by value or by ``const &``
|
||||||
|
reference are vectorized; all other arguments are passed through as-is.
|
||||||
|
Functions taking rvalue reference arguments cannot be vectorized.
|
||||||
|
|
||||||
|
In cases where the computation is too complicated to be reduced to
|
||||||
|
``vectorize``, it will be necessary to create and access the buffer contents
|
||||||
|
manually. The following snippet contains a complete example that shows how this
|
||||||
|
works (the code is somewhat contrived, since it could have been done more
|
||||||
|
simply using ``vectorize``).
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/pybind11.h>
|
||||||
|
#include <pybind11/numpy.h>
|
||||||
|
|
||||||
|
namespace py = pybind11;
|
||||||
|
|
||||||
|
py::array_t<double> add_arrays(py::array_t<double> input1, py::array_t<double> input2) {
|
||||||
|
py::buffer_info buf1 = input1.request(), buf2 = input2.request();
|
||||||
|
|
||||||
|
if (buf1.ndim != 1 || buf2.ndim != 1)
|
||||||
|
throw std::runtime_error("Number of dimensions must be one");
|
||||||
|
|
||||||
|
if (buf1.size != buf2.size)
|
||||||
|
throw std::runtime_error("Input shapes must match");
|
||||||
|
|
||||||
|
/* No pointer is passed, so NumPy will allocate the buffer */
|
||||||
|
auto result = py::array_t<double>(buf1.size);
|
||||||
|
|
||||||
|
py::buffer_info buf3 = result.request();
|
||||||
|
|
||||||
|
double *ptr1 = (double *) buf1.ptr,
|
||||||
|
*ptr2 = (double *) buf2.ptr,
|
||||||
|
*ptr3 = (double *) buf3.ptr;
|
||||||
|
|
||||||
|
for (size_t idx = 0; idx < buf1.shape[0]; idx++)
|
||||||
|
ptr3[idx] = ptr1[idx] + ptr2[idx];
|
||||||
|
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
|
||||||
|
PYBIND11_MODULE(test, m) {
|
||||||
|
m.def("add_arrays", &add_arrays, "Add two NumPy arrays");
|
||||||
|
}
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_numpy_vectorize.cpp` contains a complete
|
||||||
|
example that demonstrates using :func:`vectorize` in more detail.
|
||||||
|
|
||||||
|
Direct access
|
||||||
|
=============
|
||||||
|
|
||||||
|
For performance reasons, particularly when dealing with very large arrays, it
|
||||||
|
is often desirable to directly access array elements without internal checking
|
||||||
|
of dimensions and bounds on every access when indices are known to be already
|
||||||
|
valid. To avoid such checks, the ``array`` class and ``array_t<T>`` template
|
||||||
|
class offer an unchecked proxy object that can be used for this unchecked
|
||||||
|
access through the ``unchecked<N>`` and ``mutable_unchecked<N>`` methods,
|
||||||
|
where ``N`` gives the required dimensionality of the array:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("sum_3d", [](py::array_t<double> x) {
|
||||||
|
auto r = x.unchecked<3>(); // x must have ndim = 3; can be non-writeable
|
||||||
|
double sum = 0;
|
||||||
|
for (ssize_t i = 0; i < r.shape(0); i++)
|
||||||
|
for (ssize_t j = 0; j < r.shape(1); j++)
|
||||||
|
for (ssize_t k = 0; k < r.shape(2); k++)
|
||||||
|
sum += r(i, j, k);
|
||||||
|
return sum;
|
||||||
|
});
|
||||||
|
m.def("increment_3d", [](py::array_t<double> x) {
|
||||||
|
auto r = x.mutable_unchecked<3>(); // Will throw if ndim != 3 or flags.writeable is false
|
||||||
|
for (ssize_t i = 0; i < r.shape(0); i++)
|
||||||
|
for (ssize_t j = 0; j < r.shape(1); j++)
|
||||||
|
for (ssize_t k = 0; k < r.shape(2); k++)
|
||||||
|
r(i, j, k) += 1.0;
|
||||||
|
}, py::arg().noconvert());
|
||||||
|
|
||||||
|
To obtain the proxy from an ``array`` object, you must specify both the data
|
||||||
|
type and number of dimensions as template arguments, such as ``auto r =
|
||||||
|
myarray.mutable_unchecked<float, 2>()``.
|
||||||
|
|
||||||
|
If the number of dimensions is not known at compile time, you can omit the
|
||||||
|
dimensions template parameter (i.e. calling ``arr_t.unchecked()`` or
|
||||||
|
``arr.unchecked<T>()``. This will give you a proxy object that works in the
|
||||||
|
same way, but results in less optimizable code and thus a small efficiency
|
||||||
|
loss in tight loops.
|
||||||
|
|
||||||
|
Note that the returned proxy object directly references the array's data, and
|
||||||
|
only reads its shape, strides, and writeable flag when constructed. You must
|
||||||
|
take care to ensure that the referenced array is not destroyed or reshaped for
|
||||||
|
the duration of the returned object, typically by limiting the scope of the
|
||||||
|
returned instance.
|
||||||
|
|
||||||
|
The returned proxy object supports some of the same methods as ``py::array`` so
|
||||||
|
that it can be used as a drop-in replacement for some existing, index-checked
|
||||||
|
uses of ``py::array``:
|
||||||
|
|
||||||
|
- ``r.ndim()`` returns the number of dimensions
|
||||||
|
|
||||||
|
- ``r.data(1, 2, ...)`` and ``r.mutable_data(1, 2, ...)``` returns a pointer to
|
||||||
|
the ``const T`` or ``T`` data, respectively, at the given indices. The
|
||||||
|
latter is only available to proxies obtained via ``a.mutable_unchecked()``.
|
||||||
|
|
||||||
|
- ``itemsize()`` returns the size of an item in bytes, i.e. ``sizeof(T)``.
|
||||||
|
|
||||||
|
- ``ndim()`` returns the number of dimensions.
|
||||||
|
|
||||||
|
- ``shape(n)`` returns the size of dimension ``n``
|
||||||
|
|
||||||
|
- ``size()`` returns the total number of elements (i.e. the product of the shapes).
|
||||||
|
|
||||||
|
- ``nbytes()`` returns the number of bytes used by the referenced elements
|
||||||
|
(i.e. ``itemsize()`` times ``size()``).
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_numpy_array.cpp` contains additional examples
|
||||||
|
demonstrating the use of this feature.
|
||||||
|
|
||||||
|
Ellipsis
|
||||||
|
========
|
||||||
|
|
||||||
|
Python 3 provides a convenient ``...`` ellipsis notation that is often used to
|
||||||
|
slice multidimensional arrays. For instance, the following snippet extracts the
|
||||||
|
middle dimensions of a tensor with the first and last index set to zero.
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
a = # a NumPy array
|
||||||
|
b = a[0, ..., 0]
|
||||||
|
|
||||||
|
The function ``py::ellipsis()`` function can be used to perform the same
|
||||||
|
operation on the C++ side:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::array a = /* A NumPy array */;
|
||||||
|
py::array b = a[py::make_tuple(0, py::ellipsis(), 0)];
|
|
@ -0,0 +1,170 @@
|
||||||
|
Python types
|
||||||
|
############
|
||||||
|
|
||||||
|
Available wrappers
|
||||||
|
==================
|
||||||
|
|
||||||
|
All major Python types are available as thin C++ wrapper classes. These
|
||||||
|
can also be used as function parameters -- see :ref:`python_objects_as_args`.
|
||||||
|
|
||||||
|
Available types include :class:`handle`, :class:`object`, :class:`bool_`,
|
||||||
|
:class:`int_`, :class:`float_`, :class:`str`, :class:`bytes`, :class:`tuple`,
|
||||||
|
:class:`list`, :class:`dict`, :class:`slice`, :class:`none`, :class:`capsule`,
|
||||||
|
:class:`iterable`, :class:`iterator`, :class:`function`, :class:`buffer`,
|
||||||
|
:class:`array`, and :class:`array_t`.
|
||||||
|
|
||||||
|
Casting back and forth
|
||||||
|
======================
|
||||||
|
|
||||||
|
In this kind of mixed code, it is often necessary to convert arbitrary C++
|
||||||
|
types to Python, which can be done using :func:`py::cast`:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
MyClass *cls = ..;
|
||||||
|
py::object obj = py::cast(cls);
|
||||||
|
|
||||||
|
The reverse direction uses the following syntax:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::object obj = ...;
|
||||||
|
MyClass *cls = obj.cast<MyClass *>();
|
||||||
|
|
||||||
|
When conversion fails, both directions throw the exception :class:`cast_error`.
|
||||||
|
|
||||||
|
.. _python_libs:
|
||||||
|
|
||||||
|
Accessing Python libraries from C++
|
||||||
|
===================================
|
||||||
|
|
||||||
|
It is also possible to import objects defined in the Python standard
|
||||||
|
library or available in the current Python environment (``sys.path``) and work
|
||||||
|
with these in C++.
|
||||||
|
|
||||||
|
This example obtains a reference to the Python ``Decimal`` class.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// Equivalent to "from decimal import Decimal"
|
||||||
|
py::object Decimal = py::module::import("decimal").attr("Decimal");
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// Try to import scipy
|
||||||
|
py::object scipy = py::module::import("scipy");
|
||||||
|
return scipy.attr("__version__");
|
||||||
|
|
||||||
|
.. _calling_python_functions:
|
||||||
|
|
||||||
|
Calling Python functions
|
||||||
|
========================
|
||||||
|
|
||||||
|
It is also possible to call Python classes, functions and methods
|
||||||
|
via ``operator()``.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// Construct a Python object of class Decimal
|
||||||
|
py::object pi = Decimal("3.14159");
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// Use Python to make our directories
|
||||||
|
py::object os = py::module::import("os");
|
||||||
|
py::object makedirs = os.attr("makedirs");
|
||||||
|
makedirs("/tmp/path/to/somewhere");
|
||||||
|
|
||||||
|
One can convert the result obtained from Python to a pure C++ version
|
||||||
|
if a ``py::class_`` or type conversion is defined.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::function f = <...>;
|
||||||
|
py::object result_py = f(1234, "hello", some_instance);
|
||||||
|
MyClass &result = result_py.cast<MyClass>();
|
||||||
|
|
||||||
|
.. _calling_python_methods:
|
||||||
|
|
||||||
|
Calling Python methods
|
||||||
|
========================
|
||||||
|
|
||||||
|
To call an object's method, one can again use ``.attr`` to obtain access to the
|
||||||
|
Python method.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// Calculate e^π in decimal
|
||||||
|
py::object exp_pi = pi.attr("exp")();
|
||||||
|
py::print(py::str(exp_pi));
|
||||||
|
|
||||||
|
In the example above ``pi.attr("exp")`` is a *bound method*: it will always call
|
||||||
|
the method for that same instance of the class. Alternately one can create an
|
||||||
|
*unbound method* via the Python class (instead of instance) and pass the ``self``
|
||||||
|
object explicitly, followed by other arguments.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::object decimal_exp = Decimal.attr("exp");
|
||||||
|
|
||||||
|
// Compute the e^n for n=0..4
|
||||||
|
for (int n = 0; n < 5; n++) {
|
||||||
|
py::print(decimal_exp(Decimal(n));
|
||||||
|
}
|
||||||
|
|
||||||
|
Keyword arguments
|
||||||
|
=================
|
||||||
|
|
||||||
|
Keyword arguments are also supported. In Python, there is the usual call syntax:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
def f(number, say, to):
|
||||||
|
... # function code
|
||||||
|
|
||||||
|
f(1234, say="hello", to=some_instance) # keyword call in Python
|
||||||
|
|
||||||
|
In C++, the same call can be made using:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
using namespace pybind11::literals; // to bring in the `_a` literal
|
||||||
|
f(1234, "say"_a="hello", "to"_a=some_instance); // keyword call in C++
|
||||||
|
|
||||||
|
Unpacking arguments
|
||||||
|
===================
|
||||||
|
|
||||||
|
Unpacking of ``*args`` and ``**kwargs`` is also possible and can be mixed with
|
||||||
|
other arguments:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// * unpacking
|
||||||
|
py::tuple args = py::make_tuple(1234, "hello", some_instance);
|
||||||
|
f(*args);
|
||||||
|
|
||||||
|
// ** unpacking
|
||||||
|
py::dict kwargs = py::dict("number"_a=1234, "say"_a="hello", "to"_a=some_instance);
|
||||||
|
f(**kwargs);
|
||||||
|
|
||||||
|
// mixed keywords, * and ** unpacking
|
||||||
|
py::tuple args = py::make_tuple(1234);
|
||||||
|
py::dict kwargs = py::dict("to"_a=some_instance);
|
||||||
|
f(*args, "say"_a="hello", **kwargs);
|
||||||
|
|
||||||
|
Generalized unpacking according to PEP448_ is also supported:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::dict kwargs1 = py::dict("number"_a=1234);
|
||||||
|
py::dict kwargs2 = py::dict("to"_a=some_instance);
|
||||||
|
f(**kwargs1, "say"_a="hello", **kwargs2);
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_pytypes.cpp` contains a complete
|
||||||
|
example that demonstrates passing native Python types in more detail. The
|
||||||
|
file :file:`tests/test_callbacks.cpp` presents a few examples of calling
|
||||||
|
Python functions from C++, including keywords arguments and unpacking.
|
||||||
|
|
||||||
|
.. _PEP448: https://www.python.org/dev/peps/pep-0448/
|
|
@ -0,0 +1,144 @@
|
||||||
|
Utilities
|
||||||
|
#########
|
||||||
|
|
||||||
|
Using Python's print function in C++
|
||||||
|
====================================
|
||||||
|
|
||||||
|
The usual way to write output in C++ is using ``std::cout`` while in Python one
|
||||||
|
would use ``print``. Since these methods use different buffers, mixing them can
|
||||||
|
lead to output order issues. To resolve this, pybind11 modules can use the
|
||||||
|
:func:`py::print` function which writes to Python's ``sys.stdout`` for consistency.
|
||||||
|
|
||||||
|
Python's ``print`` function is replicated in the C++ API including optional
|
||||||
|
keyword arguments ``sep``, ``end``, ``file``, ``flush``. Everything works as
|
||||||
|
expected in Python:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::print(1, 2.0, "three"); // 1 2.0 three
|
||||||
|
py::print(1, 2.0, "three", "sep"_a="-"); // 1-2.0-three
|
||||||
|
|
||||||
|
auto args = py::make_tuple("unpacked", true);
|
||||||
|
py::print("->", *args, "end"_a="<-"); // -> unpacked True <-
|
||||||
|
|
||||||
|
.. _ostream_redirect:
|
||||||
|
|
||||||
|
Capturing standard output from ostream
|
||||||
|
======================================
|
||||||
|
|
||||||
|
Often, a library will use the streams ``std::cout`` and ``std::cerr`` to print,
|
||||||
|
but this does not play well with Python's standard ``sys.stdout`` and ``sys.stderr``
|
||||||
|
redirection. Replacing a library's printing with `py::print <print>` may not
|
||||||
|
be feasible. This can be fixed using a guard around the library function that
|
||||||
|
redirects output to the corresponding Python streams:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/iostream.h>
|
||||||
|
|
||||||
|
...
|
||||||
|
|
||||||
|
// Add a scoped redirect for your noisy code
|
||||||
|
m.def("noisy_func", []() {
|
||||||
|
py::scoped_ostream_redirect stream(
|
||||||
|
std::cout, // std::ostream&
|
||||||
|
py::module::import("sys").attr("stdout") // Python output
|
||||||
|
);
|
||||||
|
call_noisy_func();
|
||||||
|
});
|
||||||
|
|
||||||
|
This method respects flushes on the output streams and will flush if needed
|
||||||
|
when the scoped guard is destroyed. This allows the output to be redirected in
|
||||||
|
real time, such as to a Jupyter notebook. The two arguments, the C++ stream and
|
||||||
|
the Python output, are optional, and default to standard output if not given. An
|
||||||
|
extra type, `py::scoped_estream_redirect <scoped_estream_redirect>`, is identical
|
||||||
|
except for defaulting to ``std::cerr`` and ``sys.stderr``; this can be useful with
|
||||||
|
`py::call_guard`, which allows multiple items, but uses the default constructor:
|
||||||
|
|
||||||
|
.. code-block:: py
|
||||||
|
|
||||||
|
// Alternative: Call single function using call guard
|
||||||
|
m.def("noisy_func", &call_noisy_function,
|
||||||
|
py::call_guard<py::scoped_ostream_redirect,
|
||||||
|
py::scoped_estream_redirect>());
|
||||||
|
|
||||||
|
The redirection can also be done in Python with the addition of a context
|
||||||
|
manager, using the `py::add_ostream_redirect() <add_ostream_redirect>` function:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::add_ostream_redirect(m, "ostream_redirect");
|
||||||
|
|
||||||
|
The name in Python defaults to ``ostream_redirect`` if no name is passed. This
|
||||||
|
creates the following context manager in Python:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
with ostream_redirect(stdout=True, stderr=True):
|
||||||
|
noisy_function()
|
||||||
|
|
||||||
|
It defaults to redirecting both streams, though you can use the keyword
|
||||||
|
arguments to disable one of the streams if needed.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
The above methods will not redirect C-level output to file descriptors, such
|
||||||
|
as ``fprintf``. For those cases, you'll need to redirect the file
|
||||||
|
descriptors either directly in C or with Python's ``os.dup2`` function
|
||||||
|
in an operating-system dependent way.
|
||||||
|
|
||||||
|
.. _eval:
|
||||||
|
|
||||||
|
Evaluating Python expressions from strings and files
|
||||||
|
====================================================
|
||||||
|
|
||||||
|
pybind11 provides the `eval`, `exec` and `eval_file` functions to evaluate
|
||||||
|
Python expressions and statements. The following example illustrates how they
|
||||||
|
can be used.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// At beginning of file
|
||||||
|
#include <pybind11/eval.h>
|
||||||
|
|
||||||
|
...
|
||||||
|
|
||||||
|
// Evaluate in scope of main module
|
||||||
|
py::object scope = py::module::import("__main__").attr("__dict__");
|
||||||
|
|
||||||
|
// Evaluate an isolated expression
|
||||||
|
int result = py::eval("my_variable + 10", scope).cast<int>();
|
||||||
|
|
||||||
|
// Evaluate a sequence of statements
|
||||||
|
py::exec(
|
||||||
|
"print('Hello')\n"
|
||||||
|
"print('world!');",
|
||||||
|
scope);
|
||||||
|
|
||||||
|
// Evaluate the statements in an separate Python file on disk
|
||||||
|
py::eval_file("script.py", scope);
|
||||||
|
|
||||||
|
C++11 raw string literals are also supported and quite handy for this purpose.
|
||||||
|
The only requirement is that the first statement must be on a new line following
|
||||||
|
the raw string delimiter ``R"(``, ensuring all lines have common leading indent:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::exec(R"(
|
||||||
|
x = get_answer()
|
||||||
|
if x == 42:
|
||||||
|
print('Hello World!')
|
||||||
|
else:
|
||||||
|
print('Bye!')
|
||||||
|
)", scope
|
||||||
|
);
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
`eval` and `eval_file` accept a template parameter that describes how the
|
||||||
|
string/file should be interpreted. Possible choices include ``eval_expr``
|
||||||
|
(isolated expression), ``eval_single_statement`` (a single statement, return
|
||||||
|
value is always ``none``), and ``eval_statements`` (sequence of statements,
|
||||||
|
return value is always ``none``). `eval` defaults to ``eval_expr``,
|
||||||
|
`eval_file` defaults to ``eval_statements`` and `exec` is just a shortcut
|
||||||
|
for ``eval<eval_statements>``.
|
|
@ -0,0 +1,173 @@
|
||||||
|
Smart pointers
|
||||||
|
##############
|
||||||
|
|
||||||
|
std::unique_ptr
|
||||||
|
===============
|
||||||
|
|
||||||
|
Given a class ``Example`` with Python bindings, it's possible to return
|
||||||
|
instances wrapped in C++11 unique pointers, like so
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
std::unique_ptr<Example> create_example() { return std::unique_ptr<Example>(new Example()); }
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("create_example", &create_example);
|
||||||
|
|
||||||
|
In other words, there is nothing special that needs to be done. While returning
|
||||||
|
unique pointers in this way is allowed, it is *illegal* to use them as function
|
||||||
|
arguments. For instance, the following function signature cannot be processed
|
||||||
|
by pybind11.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void do_something_with_example(std::unique_ptr<Example> ex) { ... }
|
||||||
|
|
||||||
|
The above signature would imply that Python needs to give up ownership of an
|
||||||
|
object that is passed to this function, which is generally not possible (for
|
||||||
|
instance, the object might be referenced elsewhere).
|
||||||
|
|
||||||
|
std::shared_ptr
|
||||||
|
===============
|
||||||
|
|
||||||
|
The binding generator for classes, :class:`class_`, can be passed a template
|
||||||
|
type that denotes a special *holder* type that is used to manage references to
|
||||||
|
the object. If no such holder type template argument is given, the default for
|
||||||
|
a type named ``Type`` is ``std::unique_ptr<Type>``, which means that the object
|
||||||
|
is deallocated when Python's reference count goes to zero.
|
||||||
|
|
||||||
|
It is possible to switch to other types of reference counting wrappers or smart
|
||||||
|
pointers, which is useful in codebases that rely on them. For instance, the
|
||||||
|
following snippet causes ``std::shared_ptr`` to be used instead.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Example, std::shared_ptr<Example> /* <- holder type */> obj(m, "Example");
|
||||||
|
|
||||||
|
Note that any particular class can only be associated with a single holder type.
|
||||||
|
|
||||||
|
One potential stumbling block when using holder types is that they need to be
|
||||||
|
applied consistently. Can you guess what's broken about the following binding
|
||||||
|
code?
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
class Child { };
|
||||||
|
|
||||||
|
class Parent {
|
||||||
|
public:
|
||||||
|
Parent() : child(std::make_shared<Child>()) { }
|
||||||
|
Child *get_child() { return child.get(); } /* Hint: ** DON'T DO THIS ** */
|
||||||
|
private:
|
||||||
|
std::shared_ptr<Child> child;
|
||||||
|
};
|
||||||
|
|
||||||
|
PYBIND11_MODULE(example, m) {
|
||||||
|
py::class_<Child, std::shared_ptr<Child>>(m, "Child");
|
||||||
|
|
||||||
|
py::class_<Parent, std::shared_ptr<Parent>>(m, "Parent")
|
||||||
|
.def(py::init<>())
|
||||||
|
.def("get_child", &Parent::get_child);
|
||||||
|
}
|
||||||
|
|
||||||
|
The following Python code will cause undefined behavior (and likely a
|
||||||
|
segmentation fault).
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
from example import Parent
|
||||||
|
print(Parent().get_child())
|
||||||
|
|
||||||
|
The problem is that ``Parent::get_child()`` returns a pointer to an instance of
|
||||||
|
``Child``, but the fact that this instance is already managed by
|
||||||
|
``std::shared_ptr<...>`` is lost when passing raw pointers. In this case,
|
||||||
|
pybind11 will create a second independent ``std::shared_ptr<...>`` that also
|
||||||
|
claims ownership of the pointer. In the end, the object will be freed **twice**
|
||||||
|
since these shared pointers have no way of knowing about each other.
|
||||||
|
|
||||||
|
There are two ways to resolve this issue:
|
||||||
|
|
||||||
|
1. For types that are managed by a smart pointer class, never use raw pointers
|
||||||
|
in function arguments or return values. In other words: always consistently
|
||||||
|
wrap pointers into their designated holder types (such as
|
||||||
|
``std::shared_ptr<...>``). In this case, the signature of ``get_child()``
|
||||||
|
should be modified as follows:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
std::shared_ptr<Child> get_child() { return child; }
|
||||||
|
|
||||||
|
2. Adjust the definition of ``Child`` by specifying
|
||||||
|
``std::enable_shared_from_this<T>`` (see cppreference_ for details) as a
|
||||||
|
base class. This adds a small bit of information to ``Child`` that allows
|
||||||
|
pybind11 to realize that there is already an existing
|
||||||
|
``std::shared_ptr<...>`` and communicate with it. In this case, the
|
||||||
|
declaration of ``Child`` should look as follows:
|
||||||
|
|
||||||
|
.. _cppreference: http://en.cppreference.com/w/cpp/memory/enable_shared_from_this
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
class Child : public std::enable_shared_from_this<Child> { };
|
||||||
|
|
||||||
|
.. _smart_pointers:
|
||||||
|
|
||||||
|
Custom smart pointers
|
||||||
|
=====================
|
||||||
|
|
||||||
|
pybind11 supports ``std::unique_ptr`` and ``std::shared_ptr`` right out of the
|
||||||
|
box. For any other custom smart pointer, transparent conversions can be enabled
|
||||||
|
using a macro invocation similar to the following. It must be declared at the
|
||||||
|
top namespace level before any binding code:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
PYBIND11_DECLARE_HOLDER_TYPE(T, SmartPtr<T>);
|
||||||
|
|
||||||
|
The first argument of :func:`PYBIND11_DECLARE_HOLDER_TYPE` should be a
|
||||||
|
placeholder name that is used as a template parameter of the second argument.
|
||||||
|
Thus, feel free to use any identifier, but use it consistently on both sides;
|
||||||
|
also, don't use the name of a type that already exists in your codebase.
|
||||||
|
|
||||||
|
The macro also accepts a third optional boolean parameter that is set to false
|
||||||
|
by default. Specify
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
PYBIND11_DECLARE_HOLDER_TYPE(T, SmartPtr<T>, true);
|
||||||
|
|
||||||
|
if ``SmartPtr<T>`` can always be initialized from a ``T*`` pointer without the
|
||||||
|
risk of inconsistencies (such as multiple independent ``SmartPtr`` instances
|
||||||
|
believing that they are the sole owner of the ``T*`` pointer). A common
|
||||||
|
situation where ``true`` should be passed is when the ``T`` instances use
|
||||||
|
*intrusive* reference counting.
|
||||||
|
|
||||||
|
Please take a look at the :ref:`macro_notes` before using this feature.
|
||||||
|
|
||||||
|
By default, pybind11 assumes that your custom smart pointer has a standard
|
||||||
|
interface, i.e. provides a ``.get()`` member function to access the underlying
|
||||||
|
raw pointer. If this is not the case, pybind11's ``holder_helper`` must be
|
||||||
|
specialized:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// Always needed for custom holder types
|
||||||
|
PYBIND11_DECLARE_HOLDER_TYPE(T, SmartPtr<T>);
|
||||||
|
|
||||||
|
// Only needed if the type's `.get()` goes by another name
|
||||||
|
namespace pybind11 { namespace detail {
|
||||||
|
template <typename T>
|
||||||
|
struct holder_helper<SmartPtr<T>> { // <-- specialization
|
||||||
|
static const T *get(const SmartPtr<T> &p) { return p.getPointer(); }
|
||||||
|
};
|
||||||
|
}}
|
||||||
|
|
||||||
|
The above specialization informs pybind11 that the custom ``SmartPtr`` class
|
||||||
|
provides ``.get()`` functionality via ``.getPointer()``.
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
The file :file:`tests/test_smart_ptr.cpp` contains a complete example
|
||||||
|
that demonstrates how to work with custom reference-counting holder types
|
||||||
|
in more detail.
|
|
@ -0,0 +1,293 @@
|
||||||
|
.. _basics:
|
||||||
|
|
||||||
|
First steps
|
||||||
|
###########
|
||||||
|
|
||||||
|
This sections demonstrates the basic features of pybind11. Before getting
|
||||||
|
started, make sure that development environment is set up to compile the
|
||||||
|
included set of test cases.
|
||||||
|
|
||||||
|
|
||||||
|
Compiling the test cases
|
||||||
|
========================
|
||||||
|
|
||||||
|
Linux/MacOS
|
||||||
|
-----------
|
||||||
|
|
||||||
|
On Linux you'll need to install the **python-dev** or **python3-dev** packages as
|
||||||
|
well as **cmake**. On Mac OS, the included python version works out of the box,
|
||||||
|
but **cmake** must still be installed.
|
||||||
|
|
||||||
|
After installing the prerequisites, run
|
||||||
|
|
||||||
|
.. code-block:: bash
|
||||||
|
|
||||||
|
mkdir build
|
||||||
|
cd build
|
||||||
|
cmake ..
|
||||||
|
make check -j 4
|
||||||
|
|
||||||
|
The last line will both compile and run the tests.
|
||||||
|
|
||||||
|
Windows
|
||||||
|
-------
|
||||||
|
|
||||||
|
On Windows, only **Visual Studio 2015** and newer are supported since pybind11 relies
|
||||||
|
on various C++11 language features that break older versions of Visual Studio.
|
||||||
|
|
||||||
|
To compile and run the tests:
|
||||||
|
|
||||||
|
.. code-block:: batch
|
||||||
|
|
||||||
|
mkdir build
|
||||||
|
cd build
|
||||||
|
cmake ..
|
||||||
|
cmake --build . --config Release --target check
|
||||||
|
|
||||||
|
This will create a Visual Studio project, compile and run the target, all from the
|
||||||
|
command line.
|
||||||
|
|
||||||
|
.. Note::
|
||||||
|
|
||||||
|
If all tests fail, make sure that the Python binary and the testcases are compiled
|
||||||
|
for the same processor type and bitness (i.e. either **i386** or **x86_64**). You
|
||||||
|
can specify **x86_64** as the target architecture for the generated Visual Studio
|
||||||
|
project using ``cmake -A x64 ..``.
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
Advanced users who are already familiar with Boost.Python may want to skip
|
||||||
|
the tutorial and look at the test cases in the :file:`tests` directory,
|
||||||
|
which exercise all features of pybind11.
|
||||||
|
|
||||||
|
Header and namespace conventions
|
||||||
|
================================
|
||||||
|
|
||||||
|
For brevity, all code examples assume that the following two lines are present:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/pybind11.h>
|
||||||
|
|
||||||
|
namespace py = pybind11;
|
||||||
|
|
||||||
|
Some features may require additional headers, but those will be specified as needed.
|
||||||
|
|
||||||
|
.. _simple_example:
|
||||||
|
|
||||||
|
Creating bindings for a simple function
|
||||||
|
=======================================
|
||||||
|
|
||||||
|
Let's start by creating Python bindings for an extremely simple function, which
|
||||||
|
adds two numbers and returns their result:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
int add(int i, int j) {
|
||||||
|
return i + j;
|
||||||
|
}
|
||||||
|
|
||||||
|
For simplicity [#f1]_, we'll put both this function and the binding code into
|
||||||
|
a file named :file:`example.cpp` with the following contents:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/pybind11.h>
|
||||||
|
|
||||||
|
int add(int i, int j) {
|
||||||
|
return i + j;
|
||||||
|
}
|
||||||
|
|
||||||
|
PYBIND11_MODULE(example, m) {
|
||||||
|
m.doc() = "pybind11 example plugin"; // optional module docstring
|
||||||
|
|
||||||
|
m.def("add", &add, "A function which adds two numbers");
|
||||||
|
}
|
||||||
|
|
||||||
|
.. [#f1] In practice, implementation and binding code will generally be located
|
||||||
|
in separate files.
|
||||||
|
|
||||||
|
The :func:`PYBIND11_MODULE` macro creates a function that will be called when an
|
||||||
|
``import`` statement is issued from within Python. The module name (``example``)
|
||||||
|
is given as the first macro argument (it should not be in quotes). The second
|
||||||
|
argument (``m``) defines a variable of type :class:`py::module <module>` which
|
||||||
|
is the main interface for creating bindings. The method :func:`module::def`
|
||||||
|
generates binding code that exposes the ``add()`` function to Python.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
Notice how little code was needed to expose our function to Python: all
|
||||||
|
details regarding the function's parameters and return value were
|
||||||
|
automatically inferred using template metaprogramming. This overall
|
||||||
|
approach and the used syntax are borrowed from Boost.Python, though the
|
||||||
|
underlying implementation is very different.
|
||||||
|
|
||||||
|
pybind11 is a header-only library, hence it is not necessary to link against
|
||||||
|
any special libraries and there are no intermediate (magic) translation steps.
|
||||||
|
On Linux, the above example can be compiled using the following command:
|
||||||
|
|
||||||
|
.. code-block:: bash
|
||||||
|
|
||||||
|
$ c++ -O3 -Wall -shared -std=c++11 -fPIC `python3 -m pybind11 --includes` example.cpp -o example`python3-config --extension-suffix`
|
||||||
|
|
||||||
|
For more details on the required compiler flags on Linux and MacOS, see
|
||||||
|
:ref:`building_manually`. For complete cross-platform compilation instructions,
|
||||||
|
refer to the :ref:`compiling` page.
|
||||||
|
|
||||||
|
The `python_example`_ and `cmake_example`_ repositories are also a good place
|
||||||
|
to start. They are both complete project examples with cross-platform build
|
||||||
|
systems. The only difference between the two is that `python_example`_ uses
|
||||||
|
Python's ``setuptools`` to build the module, while `cmake_example`_ uses CMake
|
||||||
|
(which may be preferable for existing C++ projects).
|
||||||
|
|
||||||
|
.. _python_example: https://github.com/pybind/python_example
|
||||||
|
.. _cmake_example: https://github.com/pybind/cmake_example
|
||||||
|
|
||||||
|
Building the above C++ code will produce a binary module file that can be
|
||||||
|
imported to Python. Assuming that the compiled module is located in the
|
||||||
|
current directory, the following interactive Python session shows how to
|
||||||
|
load and execute the example:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
$ python
|
||||||
|
Python 2.7.10 (default, Aug 22 2015, 20:33:39)
|
||||||
|
[GCC 4.2.1 Compatible Apple LLVM 7.0.0 (clang-700.0.59.1)] on darwin
|
||||||
|
Type "help", "copyright", "credits" or "license" for more information.
|
||||||
|
>>> import example
|
||||||
|
>>> example.add(1, 2)
|
||||||
|
3L
|
||||||
|
>>>
|
||||||
|
|
||||||
|
.. _keyword_args:
|
||||||
|
|
||||||
|
Keyword arguments
|
||||||
|
=================
|
||||||
|
|
||||||
|
With a simple modification code, it is possible to inform Python about the
|
||||||
|
names of the arguments ("i" and "j" in this case).
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("add", &add, "A function which adds two numbers",
|
||||||
|
py::arg("i"), py::arg("j"));
|
||||||
|
|
||||||
|
:class:`arg` is one of several special tag classes which can be used to pass
|
||||||
|
metadata into :func:`module::def`. With this modified binding code, we can now
|
||||||
|
call the function using keyword arguments, which is a more readable alternative
|
||||||
|
particularly for functions taking many parameters:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> import example
|
||||||
|
>>> example.add(i=1, j=2)
|
||||||
|
3L
|
||||||
|
|
||||||
|
The keyword names also appear in the function signatures within the documentation.
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> help(example)
|
||||||
|
|
||||||
|
....
|
||||||
|
|
||||||
|
FUNCTIONS
|
||||||
|
add(...)
|
||||||
|
Signature : (i: int, j: int) -> int
|
||||||
|
|
||||||
|
A function which adds two numbers
|
||||||
|
|
||||||
|
A shorter notation for named arguments is also available:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// regular notation
|
||||||
|
m.def("add1", &add, py::arg("i"), py::arg("j"));
|
||||||
|
// shorthand
|
||||||
|
using namespace pybind11::literals;
|
||||||
|
m.def("add2", &add, "i"_a, "j"_a);
|
||||||
|
|
||||||
|
The :var:`_a` suffix forms a C++11 literal which is equivalent to :class:`arg`.
|
||||||
|
Note that the literal operator must first be made visible with the directive
|
||||||
|
``using namespace pybind11::literals``. This does not bring in anything else
|
||||||
|
from the ``pybind11`` namespace except for literals.
|
||||||
|
|
||||||
|
.. _default_args:
|
||||||
|
|
||||||
|
Default arguments
|
||||||
|
=================
|
||||||
|
|
||||||
|
Suppose now that the function to be bound has default arguments, e.g.:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
int add(int i = 1, int j = 2) {
|
||||||
|
return i + j;
|
||||||
|
}
|
||||||
|
|
||||||
|
Unfortunately, pybind11 cannot automatically extract these parameters, since they
|
||||||
|
are not part of the function's type information. However, they are simple to specify
|
||||||
|
using an extension of :class:`arg`:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("add", &add, "A function which adds two numbers",
|
||||||
|
py::arg("i") = 1, py::arg("j") = 2);
|
||||||
|
|
||||||
|
The default values also appear within the documentation.
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> help(example)
|
||||||
|
|
||||||
|
....
|
||||||
|
|
||||||
|
FUNCTIONS
|
||||||
|
add(...)
|
||||||
|
Signature : (i: int = 1, j: int = 2) -> int
|
||||||
|
|
||||||
|
A function which adds two numbers
|
||||||
|
|
||||||
|
The shorthand notation is also available for default arguments:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// regular notation
|
||||||
|
m.def("add1", &add, py::arg("i") = 1, py::arg("j") = 2);
|
||||||
|
// shorthand
|
||||||
|
m.def("add2", &add, "i"_a=1, "j"_a=2);
|
||||||
|
|
||||||
|
Exporting variables
|
||||||
|
===================
|
||||||
|
|
||||||
|
To expose a value from C++, use the ``attr`` function to register it in a
|
||||||
|
module as shown below. Built-in types and general objects (more on that later)
|
||||||
|
are automatically converted when assigned as attributes, and can be explicitly
|
||||||
|
converted using the function ``py::cast``.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
PYBIND11_MODULE(example, m) {
|
||||||
|
m.attr("the_answer") = 42;
|
||||||
|
py::object world = py::cast("World");
|
||||||
|
m.attr("what") = world;
|
||||||
|
}
|
||||||
|
|
||||||
|
These are then accessible from Python:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> import example
|
||||||
|
>>> example.the_answer
|
||||||
|
42
|
||||||
|
>>> example.what
|
||||||
|
'World'
|
||||||
|
|
||||||
|
.. _supported_types:
|
||||||
|
|
||||||
|
Supported data types
|
||||||
|
====================
|
||||||
|
|
||||||
|
A large number of data types are supported out of the box and can be used
|
||||||
|
seamlessly as functions arguments, return values or with ``py::cast`` in general.
|
||||||
|
For a full overview, see the :doc:`advanced/cast/index` section.
|
|
@ -0,0 +1,88 @@
|
||||||
|
import random
|
||||||
|
import os
|
||||||
|
import time
|
||||||
|
import datetime as dt
|
||||||
|
|
||||||
|
nfns = 4 # Functions per class
|
||||||
|
nargs = 4 # Arguments per function
|
||||||
|
|
||||||
|
|
||||||
|
def generate_dummy_code_pybind11(nclasses=10):
|
||||||
|
decl = ""
|
||||||
|
bindings = ""
|
||||||
|
|
||||||
|
for cl in range(nclasses):
|
||||||
|
decl += "class cl%03i;\n" % cl
|
||||||
|
decl += '\n'
|
||||||
|
|
||||||
|
for cl in range(nclasses):
|
||||||
|
decl += "class cl%03i {\n" % cl
|
||||||
|
decl += "public:\n"
|
||||||
|
bindings += ' py::class_<cl%03i>(m, "cl%03i")\n' % (cl, cl)
|
||||||
|
for fn in range(nfns):
|
||||||
|
ret = random.randint(0, nclasses - 1)
|
||||||
|
params = [random.randint(0, nclasses - 1) for i in range(nargs)]
|
||||||
|
decl += " cl%03i *fn_%03i(" % (ret, fn)
|
||||||
|
decl += ", ".join("cl%03i *" % p for p in params)
|
||||||
|
decl += ");\n"
|
||||||
|
bindings += ' .def("fn_%03i", &cl%03i::fn_%03i)\n' % \
|
||||||
|
(fn, cl, fn)
|
||||||
|
decl += "};\n\n"
|
||||||
|
bindings += ' ;\n'
|
||||||
|
|
||||||
|
result = "#include <pybind11/pybind11.h>\n\n"
|
||||||
|
result += "namespace py = pybind11;\n\n"
|
||||||
|
result += decl + '\n'
|
||||||
|
result += "PYBIND11_MODULE(example, m) {\n"
|
||||||
|
result += bindings
|
||||||
|
result += "}"
|
||||||
|
return result
|
||||||
|
|
||||||
|
|
||||||
|
def generate_dummy_code_boost(nclasses=10):
|
||||||
|
decl = ""
|
||||||
|
bindings = ""
|
||||||
|
|
||||||
|
for cl in range(nclasses):
|
||||||
|
decl += "class cl%03i;\n" % cl
|
||||||
|
decl += '\n'
|
||||||
|
|
||||||
|
for cl in range(nclasses):
|
||||||
|
decl += "class cl%03i {\n" % cl
|
||||||
|
decl += "public:\n"
|
||||||
|
bindings += ' py::class_<cl%03i>("cl%03i")\n' % (cl, cl)
|
||||||
|
for fn in range(nfns):
|
||||||
|
ret = random.randint(0, nclasses - 1)
|
||||||
|
params = [random.randint(0, nclasses - 1) for i in range(nargs)]
|
||||||
|
decl += " cl%03i *fn_%03i(" % (ret, fn)
|
||||||
|
decl += ", ".join("cl%03i *" % p for p in params)
|
||||||
|
decl += ");\n"
|
||||||
|
bindings += ' .def("fn_%03i", &cl%03i::fn_%03i, py::return_value_policy<py::manage_new_object>())\n' % \
|
||||||
|
(fn, cl, fn)
|
||||||
|
decl += "};\n\n"
|
||||||
|
bindings += ' ;\n'
|
||||||
|
|
||||||
|
result = "#include <boost/python.hpp>\n\n"
|
||||||
|
result += "namespace py = boost::python;\n\n"
|
||||||
|
result += decl + '\n'
|
||||||
|
result += "BOOST_PYTHON_MODULE(example) {\n"
|
||||||
|
result += bindings
|
||||||
|
result += "}"
|
||||||
|
return result
|
||||||
|
|
||||||
|
|
||||||
|
for codegen in [generate_dummy_code_pybind11, generate_dummy_code_boost]:
|
||||||
|
print ("{")
|
||||||
|
for i in range(0, 10):
|
||||||
|
nclasses = 2 ** i
|
||||||
|
with open("test.cpp", "w") as f:
|
||||||
|
f.write(codegen(nclasses))
|
||||||
|
n1 = dt.datetime.now()
|
||||||
|
os.system("g++ -Os -shared -rdynamic -undefined dynamic_lookup "
|
||||||
|
"-fvisibility=hidden -std=c++14 test.cpp -I include "
|
||||||
|
"-I /System/Library/Frameworks/Python.framework/Headers -o test.so")
|
||||||
|
n2 = dt.datetime.now()
|
||||||
|
elapsed = (n2 - n1).total_seconds()
|
||||||
|
size = os.stat('test.so').st_size
|
||||||
|
print(" {%i, %f, %i}," % (nclasses * nfns, elapsed, size))
|
||||||
|
print ("}")
|
|
@ -0,0 +1,97 @@
|
||||||
|
Benchmark
|
||||||
|
=========
|
||||||
|
|
||||||
|
The following is the result of a synthetic benchmark comparing both compilation
|
||||||
|
time and module size of pybind11 against Boost.Python. A detailed report about a
|
||||||
|
Boost.Python to pybind11 conversion of a real project is available here: [#f1]_.
|
||||||
|
|
||||||
|
.. [#f1] http://graylab.jhu.edu/RosettaCon2016/PyRosetta-4.pdf
|
||||||
|
|
||||||
|
Setup
|
||||||
|
-----
|
||||||
|
|
||||||
|
A python script (see the ``docs/benchmark.py`` file) was used to generate a set
|
||||||
|
of files with dummy classes whose count increases for each successive benchmark
|
||||||
|
(between 1 and 2048 classes in powers of two). Each class has four methods with
|
||||||
|
a randomly generated signature with a return value and four arguments. (There
|
||||||
|
was no particular reason for this setup other than the desire to generate many
|
||||||
|
unique function signatures whose count could be controlled in a simple way.)
|
||||||
|
|
||||||
|
Here is an example of the binding code for one class:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
...
|
||||||
|
class cl034 {
|
||||||
|
public:
|
||||||
|
cl279 *fn_000(cl084 *, cl057 *, cl065 *, cl042 *);
|
||||||
|
cl025 *fn_001(cl098 *, cl262 *, cl414 *, cl121 *);
|
||||||
|
cl085 *fn_002(cl445 *, cl297 *, cl145 *, cl421 *);
|
||||||
|
cl470 *fn_003(cl200 *, cl323 *, cl332 *, cl492 *);
|
||||||
|
};
|
||||||
|
...
|
||||||
|
|
||||||
|
PYBIND11_MODULE(example, m) {
|
||||||
|
...
|
||||||
|
py::class_<cl034>(m, "cl034")
|
||||||
|
.def("fn_000", &cl034::fn_000)
|
||||||
|
.def("fn_001", &cl034::fn_001)
|
||||||
|
.def("fn_002", &cl034::fn_002)
|
||||||
|
.def("fn_003", &cl034::fn_003)
|
||||||
|
...
|
||||||
|
}
|
||||||
|
|
||||||
|
The Boost.Python version looks almost identical except that a return value
|
||||||
|
policy had to be specified as an argument to ``def()``. For both libraries,
|
||||||
|
compilation was done with
|
||||||
|
|
||||||
|
.. code-block:: bash
|
||||||
|
|
||||||
|
Apple LLVM version 7.0.2 (clang-700.1.81)
|
||||||
|
|
||||||
|
and the following compilation flags
|
||||||
|
|
||||||
|
.. code-block:: bash
|
||||||
|
|
||||||
|
g++ -Os -shared -rdynamic -undefined dynamic_lookup -fvisibility=hidden -std=c++14
|
||||||
|
|
||||||
|
Compilation time
|
||||||
|
----------------
|
||||||
|
|
||||||
|
The following log-log plot shows how the compilation time grows for an
|
||||||
|
increasing number of class and function declarations. pybind11 includes many
|
||||||
|
fewer headers, which initially leads to shorter compilation times, but the
|
||||||
|
performance is ultimately fairly similar (pybind11 is 19.8 seconds faster for
|
||||||
|
the largest largest file with 2048 classes and a total of 8192 methods -- a
|
||||||
|
modest **1.2x** speedup relative to Boost.Python, which required 116.35
|
||||||
|
seconds).
|
||||||
|
|
||||||
|
.. only:: not latex
|
||||||
|
|
||||||
|
.. image:: pybind11_vs_boost_python1.svg
|
||||||
|
|
||||||
|
.. only:: latex
|
||||||
|
|
||||||
|
.. image:: pybind11_vs_boost_python1.png
|
||||||
|
|
||||||
|
Module size
|
||||||
|
-----------
|
||||||
|
|
||||||
|
Differences between the two libraries become much more pronounced when
|
||||||
|
considering the file size of the generated Python plugin: for the largest file,
|
||||||
|
the binary generated by Boost.Python required 16.8 MiB, which was **2.17
|
||||||
|
times** / **9.1 megabytes** larger than the output generated by pybind11. For
|
||||||
|
very small inputs, Boost.Python has an edge in the plot below -- however, note
|
||||||
|
that it stores many definitions in an external library, whose size was not
|
||||||
|
included here, hence the comparison is slightly shifted in Boost.Python's
|
||||||
|
favor.
|
||||||
|
|
||||||
|
.. only:: not latex
|
||||||
|
|
||||||
|
.. image:: pybind11_vs_boost_python2.svg
|
||||||
|
|
||||||
|
.. only:: latex
|
||||||
|
|
||||||
|
.. image:: pybind11_vs_boost_python2.png
|
||||||
|
|
||||||
|
|
File diff suppressed because it is too large
Load Diff
|
@ -0,0 +1,521 @@
|
||||||
|
.. _classes:
|
||||||
|
|
||||||
|
Object-oriented code
|
||||||
|
####################
|
||||||
|
|
||||||
|
Creating bindings for a custom type
|
||||||
|
===================================
|
||||||
|
|
||||||
|
Let's now look at a more complex example where we'll create bindings for a
|
||||||
|
custom C++ data structure named ``Pet``. Its definition is given below:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
struct Pet {
|
||||||
|
Pet(const std::string &name) : name(name) { }
|
||||||
|
void setName(const std::string &name_) { name = name_; }
|
||||||
|
const std::string &getName() const { return name; }
|
||||||
|
|
||||||
|
std::string name;
|
||||||
|
};
|
||||||
|
|
||||||
|
The binding code for ``Pet`` looks as follows:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/pybind11.h>
|
||||||
|
|
||||||
|
namespace py = pybind11;
|
||||||
|
|
||||||
|
PYBIND11_MODULE(example, m) {
|
||||||
|
py::class_<Pet>(m, "Pet")
|
||||||
|
.def(py::init<const std::string &>())
|
||||||
|
.def("setName", &Pet::setName)
|
||||||
|
.def("getName", &Pet::getName);
|
||||||
|
}
|
||||||
|
|
||||||
|
:class:`class_` creates bindings for a C++ *class* or *struct*-style data
|
||||||
|
structure. :func:`init` is a convenience function that takes the types of a
|
||||||
|
constructor's parameters as template arguments and wraps the corresponding
|
||||||
|
constructor (see the :ref:`custom_constructors` section for details). An
|
||||||
|
interactive Python session demonstrating this example is shown below:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
% python
|
||||||
|
>>> import example
|
||||||
|
>>> p = example.Pet('Molly')
|
||||||
|
>>> print(p)
|
||||||
|
<example.Pet object at 0x10cd98060>
|
||||||
|
>>> p.getName()
|
||||||
|
u'Molly'
|
||||||
|
>>> p.setName('Charly')
|
||||||
|
>>> p.getName()
|
||||||
|
u'Charly'
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
Static member functions can be bound in the same way using
|
||||||
|
:func:`class_::def_static`.
|
||||||
|
|
||||||
|
Keyword and default arguments
|
||||||
|
=============================
|
||||||
|
It is possible to specify keyword and default arguments using the syntax
|
||||||
|
discussed in the previous chapter. Refer to the sections :ref:`keyword_args`
|
||||||
|
and :ref:`default_args` for details.
|
||||||
|
|
||||||
|
Binding lambda functions
|
||||||
|
========================
|
||||||
|
|
||||||
|
Note how ``print(p)`` produced a rather useless summary of our data structure in the example above:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> print(p)
|
||||||
|
<example.Pet object at 0x10cd98060>
|
||||||
|
|
||||||
|
To address this, we could bind an utility function that returns a human-readable
|
||||||
|
summary to the special method slot named ``__repr__``. Unfortunately, there is no
|
||||||
|
suitable functionality in the ``Pet`` data structure, and it would be nice if
|
||||||
|
we did not have to change it. This can easily be accomplished by binding a
|
||||||
|
Lambda function instead:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Pet>(m, "Pet")
|
||||||
|
.def(py::init<const std::string &>())
|
||||||
|
.def("setName", &Pet::setName)
|
||||||
|
.def("getName", &Pet::getName)
|
||||||
|
.def("__repr__",
|
||||||
|
[](const Pet &a) {
|
||||||
|
return "<example.Pet named '" + a.name + "'>";
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
Both stateless [#f1]_ and stateful lambda closures are supported by pybind11.
|
||||||
|
With the above change, the same Python code now produces the following output:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> print(p)
|
||||||
|
<example.Pet named 'Molly'>
|
||||||
|
|
||||||
|
.. [#f1] Stateless closures are those with an empty pair of brackets ``[]`` as the capture object.
|
||||||
|
|
||||||
|
.. _properties:
|
||||||
|
|
||||||
|
Instance and static fields
|
||||||
|
==========================
|
||||||
|
|
||||||
|
We can also directly expose the ``name`` field using the
|
||||||
|
:func:`class_::def_readwrite` method. A similar :func:`class_::def_readonly`
|
||||||
|
method also exists for ``const`` fields.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Pet>(m, "Pet")
|
||||||
|
.def(py::init<const std::string &>())
|
||||||
|
.def_readwrite("name", &Pet::name)
|
||||||
|
// ... remainder ...
|
||||||
|
|
||||||
|
This makes it possible to write
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> p = example.Pet('Molly')
|
||||||
|
>>> p.name
|
||||||
|
u'Molly'
|
||||||
|
>>> p.name = 'Charly'
|
||||||
|
>>> p.name
|
||||||
|
u'Charly'
|
||||||
|
|
||||||
|
Now suppose that ``Pet::name`` was a private internal variable
|
||||||
|
that can only be accessed via setters and getters.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
class Pet {
|
||||||
|
public:
|
||||||
|
Pet(const std::string &name) : name(name) { }
|
||||||
|
void setName(const std::string &name_) { name = name_; }
|
||||||
|
const std::string &getName() const { return name; }
|
||||||
|
private:
|
||||||
|
std::string name;
|
||||||
|
};
|
||||||
|
|
||||||
|
In this case, the method :func:`class_::def_property`
|
||||||
|
(:func:`class_::def_property_readonly` for read-only data) can be used to
|
||||||
|
provide a field-like interface within Python that will transparently call
|
||||||
|
the setter and getter functions:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Pet>(m, "Pet")
|
||||||
|
.def(py::init<const std::string &>())
|
||||||
|
.def_property("name", &Pet::getName, &Pet::setName)
|
||||||
|
// ... remainder ...
|
||||||
|
|
||||||
|
Write only properties can be defined by passing ``nullptr`` as the
|
||||||
|
input for the read function.
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
Similar functions :func:`class_::def_readwrite_static`,
|
||||||
|
:func:`class_::def_readonly_static` :func:`class_::def_property_static`,
|
||||||
|
and :func:`class_::def_property_readonly_static` are provided for binding
|
||||||
|
static variables and properties. Please also see the section on
|
||||||
|
:ref:`static_properties` in the advanced part of the documentation.
|
||||||
|
|
||||||
|
Dynamic attributes
|
||||||
|
==================
|
||||||
|
|
||||||
|
Native Python classes can pick up new attributes dynamically:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> class Pet:
|
||||||
|
... name = 'Molly'
|
||||||
|
...
|
||||||
|
>>> p = Pet()
|
||||||
|
>>> p.name = 'Charly' # overwrite existing
|
||||||
|
>>> p.age = 2 # dynamically add a new attribute
|
||||||
|
|
||||||
|
By default, classes exported from C++ do not support this and the only writable
|
||||||
|
attributes are the ones explicitly defined using :func:`class_::def_readwrite`
|
||||||
|
or :func:`class_::def_property`.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Pet>(m, "Pet")
|
||||||
|
.def(py::init<>())
|
||||||
|
.def_readwrite("name", &Pet::name);
|
||||||
|
|
||||||
|
Trying to set any other attribute results in an error:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> p = example.Pet()
|
||||||
|
>>> p.name = 'Charly' # OK, attribute defined in C++
|
||||||
|
>>> p.age = 2 # fail
|
||||||
|
AttributeError: 'Pet' object has no attribute 'age'
|
||||||
|
|
||||||
|
To enable dynamic attributes for C++ classes, the :class:`py::dynamic_attr` tag
|
||||||
|
must be added to the :class:`py::class_` constructor:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Pet>(m, "Pet", py::dynamic_attr())
|
||||||
|
.def(py::init<>())
|
||||||
|
.def_readwrite("name", &Pet::name);
|
||||||
|
|
||||||
|
Now everything works as expected:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> p = example.Pet()
|
||||||
|
>>> p.name = 'Charly' # OK, overwrite value in C++
|
||||||
|
>>> p.age = 2 # OK, dynamically add a new attribute
|
||||||
|
>>> p.__dict__ # just like a native Python class
|
||||||
|
{'age': 2}
|
||||||
|
|
||||||
|
Note that there is a small runtime cost for a class with dynamic attributes.
|
||||||
|
Not only because of the addition of a ``__dict__``, but also because of more
|
||||||
|
expensive garbage collection tracking which must be activated to resolve
|
||||||
|
possible circular references. Native Python classes incur this same cost by
|
||||||
|
default, so this is not anything to worry about. By default, pybind11 classes
|
||||||
|
are more efficient than native Python classes. Enabling dynamic attributes
|
||||||
|
just brings them on par.
|
||||||
|
|
||||||
|
.. _inheritance:
|
||||||
|
|
||||||
|
Inheritance and automatic downcasting
|
||||||
|
=====================================
|
||||||
|
|
||||||
|
Suppose now that the example consists of two data structures with an
|
||||||
|
inheritance relationship:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
struct Pet {
|
||||||
|
Pet(const std::string &name) : name(name) { }
|
||||||
|
std::string name;
|
||||||
|
};
|
||||||
|
|
||||||
|
struct Dog : Pet {
|
||||||
|
Dog(const std::string &name) : Pet(name) { }
|
||||||
|
std::string bark() const { return "woof!"; }
|
||||||
|
};
|
||||||
|
|
||||||
|
There are two different ways of indicating a hierarchical relationship to
|
||||||
|
pybind11: the first specifies the C++ base class as an extra template
|
||||||
|
parameter of the :class:`class_`:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Pet>(m, "Pet")
|
||||||
|
.def(py::init<const std::string &>())
|
||||||
|
.def_readwrite("name", &Pet::name);
|
||||||
|
|
||||||
|
// Method 1: template parameter:
|
||||||
|
py::class_<Dog, Pet /* <- specify C++ parent type */>(m, "Dog")
|
||||||
|
.def(py::init<const std::string &>())
|
||||||
|
.def("bark", &Dog::bark);
|
||||||
|
|
||||||
|
Alternatively, we can also assign a name to the previously bound ``Pet``
|
||||||
|
:class:`class_` object and reference it when binding the ``Dog`` class:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Pet> pet(m, "Pet");
|
||||||
|
pet.def(py::init<const std::string &>())
|
||||||
|
.def_readwrite("name", &Pet::name);
|
||||||
|
|
||||||
|
// Method 2: pass parent class_ object:
|
||||||
|
py::class_<Dog>(m, "Dog", pet /* <- specify Python parent type */)
|
||||||
|
.def(py::init<const std::string &>())
|
||||||
|
.def("bark", &Dog::bark);
|
||||||
|
|
||||||
|
Functionality-wise, both approaches are equivalent. Afterwards, instances will
|
||||||
|
expose fields and methods of both types:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> p = example.Dog('Molly')
|
||||||
|
>>> p.name
|
||||||
|
u'Molly'
|
||||||
|
>>> p.bark()
|
||||||
|
u'woof!'
|
||||||
|
|
||||||
|
The C++ classes defined above are regular non-polymorphic types with an
|
||||||
|
inheritance relationship. This is reflected in Python:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
// Return a base pointer to a derived instance
|
||||||
|
m.def("pet_store", []() { return std::unique_ptr<Pet>(new Dog("Molly")); });
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> p = example.pet_store()
|
||||||
|
>>> type(p) # `Dog` instance behind `Pet` pointer
|
||||||
|
Pet # no pointer downcasting for regular non-polymorphic types
|
||||||
|
>>> p.bark()
|
||||||
|
AttributeError: 'Pet' object has no attribute 'bark'
|
||||||
|
|
||||||
|
The function returned a ``Dog`` instance, but because it's a non-polymorphic
|
||||||
|
type behind a base pointer, Python only sees a ``Pet``. In C++, a type is only
|
||||||
|
considered polymorphic if it has at least one virtual function and pybind11
|
||||||
|
will automatically recognize this:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
struct PolymorphicPet {
|
||||||
|
virtual ~PolymorphicPet() = default;
|
||||||
|
};
|
||||||
|
|
||||||
|
struct PolymorphicDog : PolymorphicPet {
|
||||||
|
std::string bark() const { return "woof!"; }
|
||||||
|
};
|
||||||
|
|
||||||
|
// Same binding code
|
||||||
|
py::class_<PolymorphicPet>(m, "PolymorphicPet");
|
||||||
|
py::class_<PolymorphicDog, PolymorphicPet>(m, "PolymorphicDog")
|
||||||
|
.def(py::init<>())
|
||||||
|
.def("bark", &PolymorphicDog::bark);
|
||||||
|
|
||||||
|
// Again, return a base pointer to a derived instance
|
||||||
|
m.def("pet_store2", []() { return std::unique_ptr<PolymorphicPet>(new PolymorphicDog); });
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> p = example.pet_store2()
|
||||||
|
>>> type(p)
|
||||||
|
PolymorphicDog # automatically downcast
|
||||||
|
>>> p.bark()
|
||||||
|
u'woof!'
|
||||||
|
|
||||||
|
Given a pointer to a polymorphic base, pybind11 performs automatic downcasting
|
||||||
|
to the actual derived type. Note that this goes beyond the usual situation in
|
||||||
|
C++: we don't just get access to the virtual functions of the base, we get the
|
||||||
|
concrete derived type including functions and attributes that the base type may
|
||||||
|
not even be aware of.
|
||||||
|
|
||||||
|
.. seealso::
|
||||||
|
|
||||||
|
For more information about polymorphic behavior see :ref:`overriding_virtuals`.
|
||||||
|
|
||||||
|
|
||||||
|
Overloaded methods
|
||||||
|
==================
|
||||||
|
|
||||||
|
Sometimes there are several overloaded C++ methods with the same name taking
|
||||||
|
different kinds of input arguments:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
struct Pet {
|
||||||
|
Pet(const std::string &name, int age) : name(name), age(age) { }
|
||||||
|
|
||||||
|
void set(int age_) { age = age_; }
|
||||||
|
void set(const std::string &name_) { name = name_; }
|
||||||
|
|
||||||
|
std::string name;
|
||||||
|
int age;
|
||||||
|
};
|
||||||
|
|
||||||
|
Attempting to bind ``Pet::set`` will cause an error since the compiler does not
|
||||||
|
know which method the user intended to select. We can disambiguate by casting
|
||||||
|
them to function pointers. Binding multiple functions to the same Python name
|
||||||
|
automatically creates a chain of function overloads that will be tried in
|
||||||
|
sequence.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Pet>(m, "Pet")
|
||||||
|
.def(py::init<const std::string &, int>())
|
||||||
|
.def("set", (void (Pet::*)(int)) &Pet::set, "Set the pet's age")
|
||||||
|
.def("set", (void (Pet::*)(const std::string &)) &Pet::set, "Set the pet's name");
|
||||||
|
|
||||||
|
The overload signatures are also visible in the method's docstring:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> help(example.Pet)
|
||||||
|
|
||||||
|
class Pet(__builtin__.object)
|
||||||
|
| Methods defined here:
|
||||||
|
|
|
||||||
|
| __init__(...)
|
||||||
|
| Signature : (Pet, str, int) -> NoneType
|
||||||
|
|
|
||||||
|
| set(...)
|
||||||
|
| 1. Signature : (Pet, int) -> NoneType
|
||||||
|
|
|
||||||
|
| Set the pet's age
|
||||||
|
|
|
||||||
|
| 2. Signature : (Pet, str) -> NoneType
|
||||||
|
|
|
||||||
|
| Set the pet's name
|
||||||
|
|
||||||
|
If you have a C++14 compatible compiler [#cpp14]_, you can use an alternative
|
||||||
|
syntax to cast the overloaded function:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Pet>(m, "Pet")
|
||||||
|
.def("set", py::overload_cast<int>(&Pet::set), "Set the pet's age")
|
||||||
|
.def("set", py::overload_cast<const std::string &>(&Pet::set), "Set the pet's name");
|
||||||
|
|
||||||
|
Here, ``py::overload_cast`` only requires the parameter types to be specified.
|
||||||
|
The return type and class are deduced. This avoids the additional noise of
|
||||||
|
``void (Pet::*)()`` as seen in the raw cast. If a function is overloaded based
|
||||||
|
on constness, the ``py::const_`` tag should be used:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
struct Widget {
|
||||||
|
int foo(int x, float y);
|
||||||
|
int foo(int x, float y) const;
|
||||||
|
};
|
||||||
|
|
||||||
|
py::class_<Widget>(m, "Widget")
|
||||||
|
.def("foo_mutable", py::overload_cast<int, float>(&Widget::foo))
|
||||||
|
.def("foo_const", py::overload_cast<int, float>(&Widget::foo, py::const_));
|
||||||
|
|
||||||
|
|
||||||
|
.. [#cpp14] A compiler which supports the ``-std=c++14`` flag
|
||||||
|
or Visual Studio 2015 Update 2 and newer.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
To define multiple overloaded constructors, simply declare one after the
|
||||||
|
other using the ``.def(py::init<...>())`` syntax. The existing machinery
|
||||||
|
for specifying keyword and default arguments also works.
|
||||||
|
|
||||||
|
Enumerations and internal types
|
||||||
|
===============================
|
||||||
|
|
||||||
|
Let's now suppose that the example class contains an internal enumeration type,
|
||||||
|
e.g.:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
struct Pet {
|
||||||
|
enum Kind {
|
||||||
|
Dog = 0,
|
||||||
|
Cat
|
||||||
|
};
|
||||||
|
|
||||||
|
Pet(const std::string &name, Kind type) : name(name), type(type) { }
|
||||||
|
|
||||||
|
std::string name;
|
||||||
|
Kind type;
|
||||||
|
};
|
||||||
|
|
||||||
|
The binding code for this example looks as follows:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::class_<Pet> pet(m, "Pet");
|
||||||
|
|
||||||
|
pet.def(py::init<const std::string &, Pet::Kind>())
|
||||||
|
.def_readwrite("name", &Pet::name)
|
||||||
|
.def_readwrite("type", &Pet::type);
|
||||||
|
|
||||||
|
py::enum_<Pet::Kind>(pet, "Kind")
|
||||||
|
.value("Dog", Pet::Kind::Dog)
|
||||||
|
.value("Cat", Pet::Kind::Cat)
|
||||||
|
.export_values();
|
||||||
|
|
||||||
|
To ensure that the ``Kind`` type is created within the scope of ``Pet``, the
|
||||||
|
``pet`` :class:`class_` instance must be supplied to the :class:`enum_`.
|
||||||
|
constructor. The :func:`enum_::export_values` function exports the enum entries
|
||||||
|
into the parent scope, which should be skipped for newer C++11-style strongly
|
||||||
|
typed enums.
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> p = Pet('Lucy', Pet.Cat)
|
||||||
|
>>> p.type
|
||||||
|
Kind.Cat
|
||||||
|
>>> int(p.type)
|
||||||
|
1L
|
||||||
|
|
||||||
|
The entries defined by the enumeration type are exposed in the ``__members__`` property:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> Pet.Kind.__members__
|
||||||
|
{'Dog': Kind.Dog, 'Cat': Kind.Cat}
|
||||||
|
|
||||||
|
The ``name`` property returns the name of the enum value as a unicode string.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
It is also possible to use ``str(enum)``, however these accomplish different
|
||||||
|
goals. The following shows how these two approaches differ.
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> p = Pet( "Lucy", Pet.Cat )
|
||||||
|
>>> pet_type = p.type
|
||||||
|
>>> pet_type
|
||||||
|
Pet.Cat
|
||||||
|
>>> str(pet_type)
|
||||||
|
'Pet.Cat'
|
||||||
|
>>> pet_type.name
|
||||||
|
'Cat'
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
When the special tag ``py::arithmetic()`` is specified to the ``enum_``
|
||||||
|
constructor, pybind11 creates an enumeration that also supports rudimentary
|
||||||
|
arithmetic and bit-level operations like comparisons, and, or, xor, negation,
|
||||||
|
etc.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
py::enum_<Pet::Kind>(pet, "Kind", py::arithmetic())
|
||||||
|
...
|
||||||
|
|
||||||
|
By default, these are omitted to conserve space.
|
|
@ -0,0 +1,289 @@
|
||||||
|
.. _compiling:
|
||||||
|
|
||||||
|
Build systems
|
||||||
|
#############
|
||||||
|
|
||||||
|
Building with setuptools
|
||||||
|
========================
|
||||||
|
|
||||||
|
For projects on PyPI, building with setuptools is the way to go. Sylvain Corlay
|
||||||
|
has kindly provided an example project which shows how to set up everything,
|
||||||
|
including automatic generation of documentation using Sphinx. Please refer to
|
||||||
|
the [python_example]_ repository.
|
||||||
|
|
||||||
|
.. [python_example] https://github.com/pybind/python_example
|
||||||
|
|
||||||
|
Building with cppimport
|
||||||
|
========================
|
||||||
|
|
||||||
|
[cppimport]_ is a small Python import hook that determines whether there is a C++
|
||||||
|
source file whose name matches the requested module. If there is, the file is
|
||||||
|
compiled as a Python extension using pybind11 and placed in the same folder as
|
||||||
|
the C++ source file. Python is then able to find the module and load it.
|
||||||
|
|
||||||
|
.. [cppimport] https://github.com/tbenthompson/cppimport
|
||||||
|
|
||||||
|
.. _cmake:
|
||||||
|
|
||||||
|
Building with CMake
|
||||||
|
===================
|
||||||
|
|
||||||
|
For C++ codebases that have an existing CMake-based build system, a Python
|
||||||
|
extension module can be created with just a few lines of code:
|
||||||
|
|
||||||
|
.. code-block:: cmake
|
||||||
|
|
||||||
|
cmake_minimum_required(VERSION 2.8.12)
|
||||||
|
project(example)
|
||||||
|
|
||||||
|
add_subdirectory(pybind11)
|
||||||
|
pybind11_add_module(example example.cpp)
|
||||||
|
|
||||||
|
This assumes that the pybind11 repository is located in a subdirectory named
|
||||||
|
:file:`pybind11` and that the code is located in a file named :file:`example.cpp`.
|
||||||
|
The CMake command ``add_subdirectory`` will import the pybind11 project which
|
||||||
|
provides the ``pybind11_add_module`` function. It will take care of all the
|
||||||
|
details needed to build a Python extension module on any platform.
|
||||||
|
|
||||||
|
A working sample project, including a way to invoke CMake from :file:`setup.py` for
|
||||||
|
PyPI integration, can be found in the [cmake_example]_ repository.
|
||||||
|
|
||||||
|
.. [cmake_example] https://github.com/pybind/cmake_example
|
||||||
|
|
||||||
|
pybind11_add_module
|
||||||
|
-------------------
|
||||||
|
|
||||||
|
To ease the creation of Python extension modules, pybind11 provides a CMake
|
||||||
|
function with the following signature:
|
||||||
|
|
||||||
|
.. code-block:: cmake
|
||||||
|
|
||||||
|
pybind11_add_module(<name> [MODULE | SHARED] [EXCLUDE_FROM_ALL]
|
||||||
|
[NO_EXTRAS] [SYSTEM] [THIN_LTO] source1 [source2 ...])
|
||||||
|
|
||||||
|
This function behaves very much like CMake's builtin ``add_library`` (in fact,
|
||||||
|
it's a wrapper function around that command). It will add a library target
|
||||||
|
called ``<name>`` to be built from the listed source files. In addition, it
|
||||||
|
will take care of all the Python-specific compiler and linker flags as well
|
||||||
|
as the OS- and Python-version-specific file extension. The produced target
|
||||||
|
``<name>`` can be further manipulated with regular CMake commands.
|
||||||
|
|
||||||
|
``MODULE`` or ``SHARED`` may be given to specify the type of library. If no
|
||||||
|
type is given, ``MODULE`` is used by default which ensures the creation of a
|
||||||
|
Python-exclusive module. Specifying ``SHARED`` will create a more traditional
|
||||||
|
dynamic library which can also be linked from elsewhere. ``EXCLUDE_FROM_ALL``
|
||||||
|
removes this target from the default build (see CMake docs for details).
|
||||||
|
|
||||||
|
Since pybind11 is a template library, ``pybind11_add_module`` adds compiler
|
||||||
|
flags to ensure high quality code generation without bloat arising from long
|
||||||
|
symbol names and duplication of code in different translation units. It
|
||||||
|
sets default visibility to *hidden*, which is required for some pybind11
|
||||||
|
features and functionality when attempting to load multiple pybind11 modules
|
||||||
|
compiled under different pybind11 versions. It also adds additional flags
|
||||||
|
enabling LTO (Link Time Optimization) and strip unneeded symbols. See the
|
||||||
|
:ref:`FAQ entry <faq:symhidden>` for a more detailed explanation. These
|
||||||
|
latter optimizations are never applied in ``Debug`` mode. If ``NO_EXTRAS`` is
|
||||||
|
given, they will always be disabled, even in ``Release`` mode. However, this
|
||||||
|
will result in code bloat and is generally not recommended.
|
||||||
|
|
||||||
|
By default, pybind11 and Python headers will be included with ``-I``. In order
|
||||||
|
to include pybind11 as system library, e.g. to avoid warnings in downstream
|
||||||
|
code with warn-levels outside of pybind11's scope, set the option ``SYSTEM``.
|
||||||
|
|
||||||
|
As stated above, LTO is enabled by default. Some newer compilers also support
|
||||||
|
different flavors of LTO such as `ThinLTO`_. Setting ``THIN_LTO`` will cause
|
||||||
|
the function to prefer this flavor if available. The function falls back to
|
||||||
|
regular LTO if ``-flto=thin`` is not available.
|
||||||
|
|
||||||
|
.. _ThinLTO: http://clang.llvm.org/docs/ThinLTO.html
|
||||||
|
|
||||||
|
Configuration variables
|
||||||
|
-----------------------
|
||||||
|
|
||||||
|
By default, pybind11 will compile modules with the C++14 standard, if available
|
||||||
|
on the target compiler, falling back to C++11 if C++14 support is not
|
||||||
|
available. Note, however, that this default is subject to change: future
|
||||||
|
pybind11 releases are expected to migrate to newer C++ standards as they become
|
||||||
|
available. To override this, the standard flag can be given explicitly in
|
||||||
|
``PYBIND11_CPP_STANDARD``:
|
||||||
|
|
||||||
|
.. code-block:: cmake
|
||||||
|
|
||||||
|
# Use just one of these:
|
||||||
|
# GCC/clang:
|
||||||
|
set(PYBIND11_CPP_STANDARD -std=c++11)
|
||||||
|
set(PYBIND11_CPP_STANDARD -std=c++14)
|
||||||
|
set(PYBIND11_CPP_STANDARD -std=c++1z) # Experimental C++17 support
|
||||||
|
# MSVC:
|
||||||
|
set(PYBIND11_CPP_STANDARD /std:c++14)
|
||||||
|
set(PYBIND11_CPP_STANDARD /std:c++latest) # Enables some MSVC C++17 features
|
||||||
|
|
||||||
|
add_subdirectory(pybind11) # or find_package(pybind11)
|
||||||
|
|
||||||
|
Note that this and all other configuration variables must be set **before** the
|
||||||
|
call to ``add_subdirectory`` or ``find_package``. The variables can also be set
|
||||||
|
when calling CMake from the command line using the ``-D<variable>=<value>`` flag.
|
||||||
|
|
||||||
|
The target Python version can be selected by setting ``PYBIND11_PYTHON_VERSION``
|
||||||
|
or an exact Python installation can be specified with ``PYTHON_EXECUTABLE``.
|
||||||
|
For example:
|
||||||
|
|
||||||
|
.. code-block:: bash
|
||||||
|
|
||||||
|
cmake -DPYBIND11_PYTHON_VERSION=3.6 ..
|
||||||
|
# or
|
||||||
|
cmake -DPYTHON_EXECUTABLE=path/to/python ..
|
||||||
|
|
||||||
|
find_package vs. add_subdirectory
|
||||||
|
---------------------------------
|
||||||
|
|
||||||
|
For CMake-based projects that don't include the pybind11 repository internally,
|
||||||
|
an external installation can be detected through ``find_package(pybind11)``.
|
||||||
|
See the `Config file`_ docstring for details of relevant CMake variables.
|
||||||
|
|
||||||
|
.. code-block:: cmake
|
||||||
|
|
||||||
|
cmake_minimum_required(VERSION 2.8.12)
|
||||||
|
project(example)
|
||||||
|
|
||||||
|
find_package(pybind11 REQUIRED)
|
||||||
|
pybind11_add_module(example example.cpp)
|
||||||
|
|
||||||
|
Note that ``find_package(pybind11)`` will only work correctly if pybind11
|
||||||
|
has been correctly installed on the system, e. g. after downloading or cloning
|
||||||
|
the pybind11 repository :
|
||||||
|
|
||||||
|
.. code-block:: bash
|
||||||
|
|
||||||
|
cd pybind11
|
||||||
|
mkdir build
|
||||||
|
cd build
|
||||||
|
cmake ..
|
||||||
|
make install
|
||||||
|
|
||||||
|
Once detected, the aforementioned ``pybind11_add_module`` can be employed as
|
||||||
|
before. The function usage and configuration variables are identical no matter
|
||||||
|
if pybind11 is added as a subdirectory or found as an installed package. You
|
||||||
|
can refer to the same [cmake_example]_ repository for a full sample project
|
||||||
|
-- just swap out ``add_subdirectory`` for ``find_package``.
|
||||||
|
|
||||||
|
.. _Config file: https://github.com/pybind/pybind11/blob/master/tools/pybind11Config.cmake.in
|
||||||
|
|
||||||
|
Advanced: interface library target
|
||||||
|
----------------------------------
|
||||||
|
|
||||||
|
When using a version of CMake greater than 3.0, pybind11 can additionally
|
||||||
|
be used as a special *interface library* . The target ``pybind11::module``
|
||||||
|
is available with pybind11 headers, Python headers and libraries as needed,
|
||||||
|
and C++ compile definitions attached. This target is suitable for linking
|
||||||
|
to an independently constructed (through ``add_library``, not
|
||||||
|
``pybind11_add_module``) target in the consuming project.
|
||||||
|
|
||||||
|
.. code-block:: cmake
|
||||||
|
|
||||||
|
cmake_minimum_required(VERSION 3.0)
|
||||||
|
project(example)
|
||||||
|
|
||||||
|
find_package(pybind11 REQUIRED) # or add_subdirectory(pybind11)
|
||||||
|
|
||||||
|
add_library(example MODULE main.cpp)
|
||||||
|
target_link_libraries(example PRIVATE pybind11::module)
|
||||||
|
set_target_properties(example PROPERTIES PREFIX "${PYTHON_MODULE_PREFIX}"
|
||||||
|
SUFFIX "${PYTHON_MODULE_EXTENSION}")
|
||||||
|
|
||||||
|
.. warning::
|
||||||
|
|
||||||
|
Since pybind11 is a metatemplate library, it is crucial that certain
|
||||||
|
compiler flags are provided to ensure high quality code generation. In
|
||||||
|
contrast to the ``pybind11_add_module()`` command, the CMake interface
|
||||||
|
library only provides the *minimal* set of parameters to ensure that the
|
||||||
|
code using pybind11 compiles, but it does **not** pass these extra compiler
|
||||||
|
flags (i.e. this is up to you).
|
||||||
|
|
||||||
|
These include Link Time Optimization (``-flto`` on GCC/Clang/ICPC, ``/GL``
|
||||||
|
and ``/LTCG`` on Visual Studio) and .OBJ files with many sections on Visual
|
||||||
|
Studio (``/bigobj``). The :ref:`FAQ <faq:symhidden>` contains an
|
||||||
|
explanation on why these are needed.
|
||||||
|
|
||||||
|
Embedding the Python interpreter
|
||||||
|
--------------------------------
|
||||||
|
|
||||||
|
In addition to extension modules, pybind11 also supports embedding Python into
|
||||||
|
a C++ executable or library. In CMake, simply link with the ``pybind11::embed``
|
||||||
|
target. It provides everything needed to get the interpreter running. The Python
|
||||||
|
headers and libraries are attached to the target. Unlike ``pybind11::module``,
|
||||||
|
there is no need to manually set any additional properties here. For more
|
||||||
|
information about usage in C++, see :doc:`/advanced/embedding`.
|
||||||
|
|
||||||
|
.. code-block:: cmake
|
||||||
|
|
||||||
|
cmake_minimum_required(VERSION 3.0)
|
||||||
|
project(example)
|
||||||
|
|
||||||
|
find_package(pybind11 REQUIRED) # or add_subdirectory(pybind11)
|
||||||
|
|
||||||
|
add_executable(example main.cpp)
|
||||||
|
target_link_libraries(example PRIVATE pybind11::embed)
|
||||||
|
|
||||||
|
.. _building_manually:
|
||||||
|
|
||||||
|
Building manually
|
||||||
|
=================
|
||||||
|
|
||||||
|
pybind11 is a header-only library, hence it is not necessary to link against
|
||||||
|
any special libraries and there are no intermediate (magic) translation steps.
|
||||||
|
|
||||||
|
On Linux, you can compile an example such as the one given in
|
||||||
|
:ref:`simple_example` using the following command:
|
||||||
|
|
||||||
|
.. code-block:: bash
|
||||||
|
|
||||||
|
$ c++ -O3 -Wall -shared -std=c++11 -fPIC `python3 -m pybind11 --includes` example.cpp -o example`python3-config --extension-suffix`
|
||||||
|
|
||||||
|
The flags given here assume that you're using Python 3. For Python 2, just
|
||||||
|
change the executable appropriately (to ``python`` or ``python2``).
|
||||||
|
|
||||||
|
The ``python3 -m pybind11 --includes`` command fetches the include paths for
|
||||||
|
both pybind11 and Python headers. This assumes that pybind11 has been installed
|
||||||
|
using ``pip`` or ``conda``. If it hasn't, you can also manually specify
|
||||||
|
``-I <path-to-pybind11>/include`` together with the Python includes path
|
||||||
|
``python3-config --includes``.
|
||||||
|
|
||||||
|
Note that Python 2.7 modules don't use a special suffix, so you should simply
|
||||||
|
use ``example.so`` instead of ``example`python3-config --extension-suffix```.
|
||||||
|
Besides, the ``--extension-suffix`` option may or may not be available, depending
|
||||||
|
on the distribution; in the latter case, the module extension can be manually
|
||||||
|
set to ``.so``.
|
||||||
|
|
||||||
|
On Mac OS: the build command is almost the same but it also requires passing
|
||||||
|
the ``-undefined dynamic_lookup`` flag so as to ignore missing symbols when
|
||||||
|
building the module:
|
||||||
|
|
||||||
|
.. code-block:: bash
|
||||||
|
|
||||||
|
$ c++ -O3 -Wall -shared -std=c++11 -undefined dynamic_lookup `python3 -m pybind11 --includes` example.cpp -o example`python3-config --extension-suffix`
|
||||||
|
|
||||||
|
In general, it is advisable to include several additional build parameters
|
||||||
|
that can considerably reduce the size of the created binary. Refer to section
|
||||||
|
:ref:`cmake` for a detailed example of a suitable cross-platform CMake-based
|
||||||
|
build system that works on all platforms including Windows.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
On Linux and macOS, it's better to (intentionally) not link against
|
||||||
|
``libpython``. The symbols will be resolved when the extension library
|
||||||
|
is loaded into a Python binary. This is preferable because you might
|
||||||
|
have several different installations of a given Python version (e.g. the
|
||||||
|
system-provided Python, and one that ships with a piece of commercial
|
||||||
|
software). In this way, the plugin will work with both versions, instead
|
||||||
|
of possibly importing a second Python library into a process that already
|
||||||
|
contains one (which will lead to a segfault).
|
||||||
|
|
||||||
|
Generating binding code automatically
|
||||||
|
=====================================
|
||||||
|
|
||||||
|
The ``Binder`` project is a tool for automatic generation of pybind11 binding
|
||||||
|
code by introspecting existing C++ codebases using LLVM/Clang. See the
|
||||||
|
[binder]_ documentation for details.
|
||||||
|
|
||||||
|
.. [binder] http://cppbinder.readthedocs.io/en/latest/about.html
|
|
@ -0,0 +1,332 @@
|
||||||
|
#!/usr/bin/env python3
|
||||||
|
# -*- coding: utf-8 -*-
|
||||||
|
#
|
||||||
|
# pybind11 documentation build configuration file, created by
|
||||||
|
# sphinx-quickstart on Sun Oct 11 19:23:48 2015.
|
||||||
|
#
|
||||||
|
# This file is execfile()d with the current directory set to its
|
||||||
|
# containing dir.
|
||||||
|
#
|
||||||
|
# Note that not all possible configuration values are present in this
|
||||||
|
# autogenerated file.
|
||||||
|
#
|
||||||
|
# All configuration values have a default; values that are commented out
|
||||||
|
# serve to show the default.
|
||||||
|
|
||||||
|
import sys
|
||||||
|
import os
|
||||||
|
import shlex
|
||||||
|
import subprocess
|
||||||
|
|
||||||
|
# If extensions (or modules to document with autodoc) are in another directory,
|
||||||
|
# add these directories to sys.path here. If the directory is relative to the
|
||||||
|
# documentation root, use os.path.abspath to make it absolute, like shown here.
|
||||||
|
#sys.path.insert(0, os.path.abspath('.'))
|
||||||
|
|
||||||
|
# -- General configuration ------------------------------------------------
|
||||||
|
|
||||||
|
# If your documentation needs a minimal Sphinx version, state it here.
|
||||||
|
#needs_sphinx = '1.0'
|
||||||
|
|
||||||
|
# Add any Sphinx extension module names here, as strings. They can be
|
||||||
|
# extensions coming with Sphinx (named 'sphinx.ext.*') or your custom
|
||||||
|
# ones.
|
||||||
|
extensions = ['breathe']
|
||||||
|
|
||||||
|
breathe_projects = {'pybind11': '.build/doxygenxml/'}
|
||||||
|
breathe_default_project = 'pybind11'
|
||||||
|
breathe_domain_by_extension = {'h': 'cpp'}
|
||||||
|
|
||||||
|
# Add any paths that contain templates here, relative to this directory.
|
||||||
|
templates_path = ['.templates']
|
||||||
|
|
||||||
|
# The suffix(es) of source filenames.
|
||||||
|
# You can specify multiple suffix as a list of string:
|
||||||
|
# source_suffix = ['.rst', '.md']
|
||||||
|
source_suffix = '.rst'
|
||||||
|
|
||||||
|
# The encoding of source files.
|
||||||
|
#source_encoding = 'utf-8-sig'
|
||||||
|
|
||||||
|
# The master toctree document.
|
||||||
|
master_doc = 'index'
|
||||||
|
|
||||||
|
# General information about the project.
|
||||||
|
project = 'pybind11'
|
||||||
|
copyright = '2017, Wenzel Jakob'
|
||||||
|
author = 'Wenzel Jakob'
|
||||||
|
|
||||||
|
# The version info for the project you're documenting, acts as replacement for
|
||||||
|
# |version| and |release|, also used in various other places throughout the
|
||||||
|
# built documents.
|
||||||
|
#
|
||||||
|
# The short X.Y version.
|
||||||
|
version = '2.3'
|
||||||
|
# The full version, including alpha/beta/rc tags.
|
||||||
|
release = '2.3.dev1'
|
||||||
|
|
||||||
|
# The language for content autogenerated by Sphinx. Refer to documentation
|
||||||
|
# for a list of supported languages.
|
||||||
|
#
|
||||||
|
# This is also used if you do content translation via gettext catalogs.
|
||||||
|
# Usually you set "language" from the command line for these cases.
|
||||||
|
language = None
|
||||||
|
|
||||||
|
# There are two options for replacing |today|: either, you set today to some
|
||||||
|
# non-false value, then it is used:
|
||||||
|
#today = ''
|
||||||
|
# Else, today_fmt is used as the format for a strftime call.
|
||||||
|
#today_fmt = '%B %d, %Y'
|
||||||
|
|
||||||
|
# List of patterns, relative to source directory, that match files and
|
||||||
|
# directories to ignore when looking for source files.
|
||||||
|
exclude_patterns = ['.build', 'release.rst']
|
||||||
|
|
||||||
|
# The reST default role (used for this markup: `text`) to use for all
|
||||||
|
# documents.
|
||||||
|
default_role = 'any'
|
||||||
|
|
||||||
|
# If true, '()' will be appended to :func: etc. cross-reference text.
|
||||||
|
#add_function_parentheses = True
|
||||||
|
|
||||||
|
# If true, the current module name will be prepended to all description
|
||||||
|
# unit titles (such as .. function::).
|
||||||
|
#add_module_names = True
|
||||||
|
|
||||||
|
# If true, sectionauthor and moduleauthor directives will be shown in the
|
||||||
|
# output. They are ignored by default.
|
||||||
|
#show_authors = False
|
||||||
|
|
||||||
|
# The name of the Pygments (syntax highlighting) style to use.
|
||||||
|
#pygments_style = 'monokai'
|
||||||
|
|
||||||
|
# A list of ignored prefixes for module index sorting.
|
||||||
|
#modindex_common_prefix = []
|
||||||
|
|
||||||
|
# If true, keep warnings as "system message" paragraphs in the built documents.
|
||||||
|
#keep_warnings = False
|
||||||
|
|
||||||
|
# If true, `todo` and `todoList` produce output, else they produce nothing.
|
||||||
|
todo_include_todos = False
|
||||||
|
|
||||||
|
|
||||||
|
# -- Options for HTML output ----------------------------------------------
|
||||||
|
|
||||||
|
# The theme to use for HTML and HTML Help pages. See the documentation for
|
||||||
|
# a list of builtin themes.
|
||||||
|
|
||||||
|
on_rtd = os.environ.get('READTHEDOCS', None) == 'True'
|
||||||
|
|
||||||
|
if not on_rtd: # only import and set the theme if we're building docs locally
|
||||||
|
import sphinx_rtd_theme
|
||||||
|
html_theme = 'sphinx_rtd_theme'
|
||||||
|
html_theme_path = [sphinx_rtd_theme.get_html_theme_path()]
|
||||||
|
|
||||||
|
html_context = {
|
||||||
|
'css_files': [
|
||||||
|
'_static/theme_overrides.css'
|
||||||
|
]
|
||||||
|
}
|
||||||
|
else:
|
||||||
|
html_context = {
|
||||||
|
'css_files': [
|
||||||
|
'//media.readthedocs.org/css/sphinx_rtd_theme.css',
|
||||||
|
'//media.readthedocs.org/css/readthedocs-doc-embed.css',
|
||||||
|
'_static/theme_overrides.css'
|
||||||
|
]
|
||||||
|
}
|
||||||
|
|
||||||
|
# Theme options are theme-specific and customize the look and feel of a theme
|
||||||
|
# further. For a list of options available for each theme, see the
|
||||||
|
# documentation.
|
||||||
|
#html_theme_options = {}
|
||||||
|
|
||||||
|
# Add any paths that contain custom themes here, relative to this directory.
|
||||||
|
#html_theme_path = []
|
||||||
|
|
||||||
|
# The name for this set of Sphinx documents. If None, it defaults to
|
||||||
|
# "<project> v<release> documentation".
|
||||||
|
#html_title = None
|
||||||
|
|
||||||
|
# A shorter title for the navigation bar. Default is the same as html_title.
|
||||||
|
#html_short_title = None
|
||||||
|
|
||||||
|
# The name of an image file (relative to this directory) to place at the top
|
||||||
|
# of the sidebar.
|
||||||
|
#html_logo = None
|
||||||
|
|
||||||
|
# The name of an image file (within the static path) to use as favicon of the
|
||||||
|
# docs. This file should be a Windows icon file (.ico) being 16x16 or 32x32
|
||||||
|
# pixels large.
|
||||||
|
#html_favicon = None
|
||||||
|
|
||||||
|
# Add any paths that contain custom static files (such as style sheets) here,
|
||||||
|
# relative to this directory. They are copied after the builtin static files,
|
||||||
|
# so a file named "default.css" will overwrite the builtin "default.css".
|
||||||
|
html_static_path = ['_static']
|
||||||
|
|
||||||
|
# Add any extra paths that contain custom files (such as robots.txt or
|
||||||
|
# .htaccess) here, relative to this directory. These files are copied
|
||||||
|
# directly to the root of the documentation.
|
||||||
|
#html_extra_path = []
|
||||||
|
|
||||||
|
# If not '', a 'Last updated on:' timestamp is inserted at every page bottom,
|
||||||
|
# using the given strftime format.
|
||||||
|
#html_last_updated_fmt = '%b %d, %Y'
|
||||||
|
|
||||||
|
# If true, SmartyPants will be used to convert quotes and dashes to
|
||||||
|
# typographically correct entities.
|
||||||
|
#html_use_smartypants = True
|
||||||
|
|
||||||
|
# Custom sidebar templates, maps document names to template names.
|
||||||
|
#html_sidebars = {}
|
||||||
|
|
||||||
|
# Additional templates that should be rendered to pages, maps page names to
|
||||||
|
# template names.
|
||||||
|
#html_additional_pages = {}
|
||||||
|
|
||||||
|
# If false, no module index is generated.
|
||||||
|
#html_domain_indices = True
|
||||||
|
|
||||||
|
# If false, no index is generated.
|
||||||
|
#html_use_index = True
|
||||||
|
|
||||||
|
# If true, the index is split into individual pages for each letter.
|
||||||
|
#html_split_index = False
|
||||||
|
|
||||||
|
# If true, links to the reST sources are added to the pages.
|
||||||
|
#html_show_sourcelink = True
|
||||||
|
|
||||||
|
# If true, "Created using Sphinx" is shown in the HTML footer. Default is True.
|
||||||
|
#html_show_sphinx = True
|
||||||
|
|
||||||
|
# If true, "(C) Copyright ..." is shown in the HTML footer. Default is True.
|
||||||
|
#html_show_copyright = True
|
||||||
|
|
||||||
|
# If true, an OpenSearch description file will be output, and all pages will
|
||||||
|
# contain a <link> tag referring to it. The value of this option must be the
|
||||||
|
# base URL from which the finished HTML is served.
|
||||||
|
#html_use_opensearch = ''
|
||||||
|
|
||||||
|
# This is the file name suffix for HTML files (e.g. ".xhtml").
|
||||||
|
#html_file_suffix = None
|
||||||
|
|
||||||
|
# Language to be used for generating the HTML full-text search index.
|
||||||
|
# Sphinx supports the following languages:
|
||||||
|
# 'da', 'de', 'en', 'es', 'fi', 'fr', 'h', 'it', 'ja'
|
||||||
|
# 'nl', 'no', 'pt', 'ro', 'r', 'sv', 'tr'
|
||||||
|
#html_search_language = 'en'
|
||||||
|
|
||||||
|
# A dictionary with options for the search language support, empty by default.
|
||||||
|
# Now only 'ja' uses this config value
|
||||||
|
#html_search_options = {'type': 'default'}
|
||||||
|
|
||||||
|
# The name of a javascript file (relative to the configuration directory) that
|
||||||
|
# implements a search results scorer. If empty, the default will be used.
|
||||||
|
#html_search_scorer = 'scorer.js'
|
||||||
|
|
||||||
|
# Output file base name for HTML help builder.
|
||||||
|
htmlhelp_basename = 'pybind11doc'
|
||||||
|
|
||||||
|
# -- Options for LaTeX output ---------------------------------------------
|
||||||
|
|
||||||
|
latex_elements = {
|
||||||
|
# The paper size ('letterpaper' or 'a4paper').
|
||||||
|
#'papersize': 'letterpaper',
|
||||||
|
|
||||||
|
# The font size ('10pt', '11pt' or '12pt').
|
||||||
|
#'pointsize': '10pt',
|
||||||
|
|
||||||
|
# Additional stuff for the LaTeX preamble.
|
||||||
|
'preamble': '\DeclareUnicodeCharacter{00A0}{}',
|
||||||
|
|
||||||
|
# Latex figure (float) alignment
|
||||||
|
#'figure_align': 'htbp',
|
||||||
|
}
|
||||||
|
|
||||||
|
# Grouping the document tree into LaTeX files. List of tuples
|
||||||
|
# (source start file, target name, title,
|
||||||
|
# author, documentclass [howto, manual, or own class]).
|
||||||
|
latex_documents = [
|
||||||
|
(master_doc, 'pybind11.tex', 'pybind11 Documentation',
|
||||||
|
'Wenzel Jakob', 'manual'),
|
||||||
|
]
|
||||||
|
|
||||||
|
# The name of an image file (relative to this directory) to place at the top of
|
||||||
|
# the title page.
|
||||||
|
# latex_logo = 'pybind11-logo.png'
|
||||||
|
|
||||||
|
# For "manual" documents, if this is true, then toplevel headings are parts,
|
||||||
|
# not chapters.
|
||||||
|
#latex_use_parts = False
|
||||||
|
|
||||||
|
# If true, show page references after internal links.
|
||||||
|
#latex_show_pagerefs = False
|
||||||
|
|
||||||
|
# If true, show URL addresses after external links.
|
||||||
|
#latex_show_urls = False
|
||||||
|
|
||||||
|
# Documents to append as an appendix to all manuals.
|
||||||
|
#latex_appendices = []
|
||||||
|
|
||||||
|
# If false, no module index is generated.
|
||||||
|
#latex_domain_indices = True
|
||||||
|
|
||||||
|
|
||||||
|
# -- Options for manual page output ---------------------------------------
|
||||||
|
|
||||||
|
# One entry per manual page. List of tuples
|
||||||
|
# (source start file, name, description, authors, manual section).
|
||||||
|
man_pages = [
|
||||||
|
(master_doc, 'pybind11', 'pybind11 Documentation',
|
||||||
|
[author], 1)
|
||||||
|
]
|
||||||
|
|
||||||
|
# If true, show URL addresses after external links.
|
||||||
|
#man_show_urls = False
|
||||||
|
|
||||||
|
|
||||||
|
# -- Options for Texinfo output -------------------------------------------
|
||||||
|
|
||||||
|
# Grouping the document tree into Texinfo files. List of tuples
|
||||||
|
# (source start file, target name, title, author,
|
||||||
|
# dir menu entry, description, category)
|
||||||
|
texinfo_documents = [
|
||||||
|
(master_doc, 'pybind11', 'pybind11 Documentation',
|
||||||
|
author, 'pybind11', 'One line description of project.',
|
||||||
|
'Miscellaneous'),
|
||||||
|
]
|
||||||
|
|
||||||
|
# Documents to append as an appendix to all manuals.
|
||||||
|
#texinfo_appendices = []
|
||||||
|
|
||||||
|
# If false, no module index is generated.
|
||||||
|
#texinfo_domain_indices = True
|
||||||
|
|
||||||
|
# How to display URL addresses: 'footnote', 'no', or 'inline'.
|
||||||
|
#texinfo_show_urls = 'footnote'
|
||||||
|
|
||||||
|
# If true, do not generate a @detailmenu in the "Top" node's menu.
|
||||||
|
#texinfo_no_detailmenu = False
|
||||||
|
|
||||||
|
primary_domain = 'cpp'
|
||||||
|
highlight_language = 'cpp'
|
||||||
|
|
||||||
|
|
||||||
|
def generate_doxygen_xml(app):
|
||||||
|
build_dir = os.path.join(app.confdir, '.build')
|
||||||
|
if not os.path.exists(build_dir):
|
||||||
|
os.mkdir(build_dir)
|
||||||
|
|
||||||
|
try:
|
||||||
|
subprocess.call(['doxygen', '--version'])
|
||||||
|
retcode = subprocess.call(['doxygen'], cwd=app.confdir)
|
||||||
|
if retcode < 0:
|
||||||
|
sys.stderr.write("doxygen error code: {}\n".format(-retcode))
|
||||||
|
except OSError as e:
|
||||||
|
sys.stderr.write("doxygen execution failed: {}\n".format(e))
|
||||||
|
|
||||||
|
|
||||||
|
def setup(app):
|
||||||
|
"""Add hook for building doxygen xml when needed"""
|
||||||
|
app.connect("builder-inited", generate_doxygen_xml)
|
|
@ -0,0 +1,297 @@
|
||||||
|
Frequently asked questions
|
||||||
|
##########################
|
||||||
|
|
||||||
|
"ImportError: dynamic module does not define init function"
|
||||||
|
===========================================================
|
||||||
|
|
||||||
|
1. Make sure that the name specified in PYBIND11_MODULE is identical to the
|
||||||
|
filename of the extension library (without prefixes such as .so)
|
||||||
|
|
||||||
|
2. If the above did not fix the issue, you are likely using an incompatible
|
||||||
|
version of Python (for instance, the extension library was compiled against
|
||||||
|
Python 2, while the interpreter is running on top of some version of Python
|
||||||
|
3, or vice versa).
|
||||||
|
|
||||||
|
"Symbol not found: ``__Py_ZeroStruct`` / ``_PyInstanceMethod_Type``"
|
||||||
|
========================================================================
|
||||||
|
|
||||||
|
See the first answer.
|
||||||
|
|
||||||
|
"SystemError: dynamic module not initialized properly"
|
||||||
|
======================================================
|
||||||
|
|
||||||
|
See the first answer.
|
||||||
|
|
||||||
|
The Python interpreter immediately crashes when importing my module
|
||||||
|
===================================================================
|
||||||
|
|
||||||
|
See the first answer.
|
||||||
|
|
||||||
|
CMake doesn't detect the right Python version
|
||||||
|
=============================================
|
||||||
|
|
||||||
|
The CMake-based build system will try to automatically detect the installed
|
||||||
|
version of Python and link against that. When this fails, or when there are
|
||||||
|
multiple versions of Python and it finds the wrong one, delete
|
||||||
|
``CMakeCache.txt`` and then invoke CMake as follows:
|
||||||
|
|
||||||
|
.. code-block:: bash
|
||||||
|
|
||||||
|
cmake -DPYTHON_EXECUTABLE:FILEPATH=<path-to-python-executable> .
|
||||||
|
|
||||||
|
.. _faq_reference_arguments:
|
||||||
|
|
||||||
|
Limitations involving reference arguments
|
||||||
|
=========================================
|
||||||
|
|
||||||
|
In C++, it's fairly common to pass arguments using mutable references or
|
||||||
|
mutable pointers, which allows both read and write access to the value
|
||||||
|
supplied by the caller. This is sometimes done for efficiency reasons, or to
|
||||||
|
realize functions that have multiple return values. Here are two very basic
|
||||||
|
examples:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void increment(int &i) { i++; }
|
||||||
|
void increment_ptr(int *i) { (*i)++; }
|
||||||
|
|
||||||
|
In Python, all arguments are passed by reference, so there is no general
|
||||||
|
issue in binding such code from Python.
|
||||||
|
|
||||||
|
However, certain basic Python types (like ``str``, ``int``, ``bool``,
|
||||||
|
``float``, etc.) are **immutable**. This means that the following attempt
|
||||||
|
to port the function to Python doesn't have the same effect on the value
|
||||||
|
provided by the caller -- in fact, it does nothing at all.
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
def increment(i):
|
||||||
|
i += 1 # nope..
|
||||||
|
|
||||||
|
pybind11 is also affected by such language-level conventions, which means that
|
||||||
|
binding ``increment`` or ``increment_ptr`` will also create Python functions
|
||||||
|
that don't modify their arguments.
|
||||||
|
|
||||||
|
Although inconvenient, one workaround is to encapsulate the immutable types in
|
||||||
|
a custom type that does allow modifications.
|
||||||
|
|
||||||
|
An other alternative involves binding a small wrapper lambda function that
|
||||||
|
returns a tuple with all output arguments (see the remainder of the
|
||||||
|
documentation for examples on binding lambda functions). An example:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
int foo(int &i) { i++; return 123; }
|
||||||
|
|
||||||
|
and the binding code
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("foo", [](int i) { int rv = foo(i); return std::make_tuple(rv, i); });
|
||||||
|
|
||||||
|
|
||||||
|
How can I reduce the build time?
|
||||||
|
================================
|
||||||
|
|
||||||
|
It's good practice to split binding code over multiple files, as in the
|
||||||
|
following example:
|
||||||
|
|
||||||
|
:file:`example.cpp`:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void init_ex1(py::module &);
|
||||||
|
void init_ex2(py::module &);
|
||||||
|
/* ... */
|
||||||
|
|
||||||
|
PYBIND11_MODULE(example, m) {
|
||||||
|
init_ex1(m);
|
||||||
|
init_ex2(m);
|
||||||
|
/* ... */
|
||||||
|
}
|
||||||
|
|
||||||
|
:file:`ex1.cpp`:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void init_ex1(py::module &m) {
|
||||||
|
m.def("add", [](int a, int b) { return a + b; });
|
||||||
|
}
|
||||||
|
|
||||||
|
:file:`ex2.cpp`:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
void init_ex2(py::module &m) {
|
||||||
|
m.def("sub", [](int a, int b) { return a - b; });
|
||||||
|
}
|
||||||
|
|
||||||
|
:command:`python`:
|
||||||
|
|
||||||
|
.. code-block:: pycon
|
||||||
|
|
||||||
|
>>> import example
|
||||||
|
>>> example.add(1, 2)
|
||||||
|
3
|
||||||
|
>>> example.sub(1, 1)
|
||||||
|
0
|
||||||
|
|
||||||
|
As shown above, the various ``init_ex`` functions should be contained in
|
||||||
|
separate files that can be compiled independently from one another, and then
|
||||||
|
linked together into the same final shared object. Following this approach
|
||||||
|
will:
|
||||||
|
|
||||||
|
1. reduce memory requirements per compilation unit.
|
||||||
|
|
||||||
|
2. enable parallel builds (if desired).
|
||||||
|
|
||||||
|
3. allow for faster incremental builds. For instance, when a single class
|
||||||
|
definition is changed, only a subset of the binding code will generally need
|
||||||
|
to be recompiled.
|
||||||
|
|
||||||
|
"recursive template instantiation exceeded maximum depth of 256"
|
||||||
|
================================================================
|
||||||
|
|
||||||
|
If you receive an error about excessive recursive template evaluation, try
|
||||||
|
specifying a larger value, e.g. ``-ftemplate-depth=1024`` on GCC/Clang. The
|
||||||
|
culprit is generally the generation of function signatures at compile time
|
||||||
|
using C++14 template metaprogramming.
|
||||||
|
|
||||||
|
.. _`faq:hidden_visibility`:
|
||||||
|
|
||||||
|
"‘SomeClass’ declared with greater visibility than the type of its field ‘SomeClass::member’ [-Wattributes]"
|
||||||
|
============================================================================================================
|
||||||
|
|
||||||
|
This error typically indicates that you are compiling without the required
|
||||||
|
``-fvisibility`` flag. pybind11 code internally forces hidden visibility on
|
||||||
|
all internal code, but if non-hidden (and thus *exported*) code attempts to
|
||||||
|
include a pybind type (for example, ``py::object`` or ``py::list``) you can run
|
||||||
|
into this warning.
|
||||||
|
|
||||||
|
To avoid it, make sure you are specifying ``-fvisibility=hidden`` when
|
||||||
|
compiling pybind code.
|
||||||
|
|
||||||
|
As to why ``-fvisibility=hidden`` is necessary, because pybind modules could
|
||||||
|
have been compiled under different versions of pybind itself, it is also
|
||||||
|
important that the symbols defined in one module do not clash with the
|
||||||
|
potentially-incompatible symbols defined in another. While Python extension
|
||||||
|
modules are usually loaded with localized symbols (under POSIX systems
|
||||||
|
typically using ``dlopen`` with the ``RTLD_LOCAL`` flag), this Python default
|
||||||
|
can be changed, but even if it isn't it is not always enough to guarantee
|
||||||
|
complete independence of the symbols involved when not using
|
||||||
|
``-fvisibility=hidden``.
|
||||||
|
|
||||||
|
Additionally, ``-fvisiblity=hidden`` can deliver considerably binary size
|
||||||
|
savings. (See the following section for more details).
|
||||||
|
|
||||||
|
|
||||||
|
.. _`faq:symhidden`:
|
||||||
|
|
||||||
|
How can I create smaller binaries?
|
||||||
|
==================================
|
||||||
|
|
||||||
|
To do its job, pybind11 extensively relies on a programming technique known as
|
||||||
|
*template metaprogramming*, which is a way of performing computation at compile
|
||||||
|
time using type information. Template metaprogamming usually instantiates code
|
||||||
|
involving significant numbers of deeply nested types that are either completely
|
||||||
|
removed or reduced to just a few instructions during the compiler's optimization
|
||||||
|
phase. However, due to the nested nature of these types, the resulting symbol
|
||||||
|
names in the compiled extension library can be extremely long. For instance,
|
||||||
|
the included test suite contains the following symbol:
|
||||||
|
|
||||||
|
.. only:: html
|
||||||
|
|
||||||
|
.. code-block:: none
|
||||||
|
|
||||||
|
__ZN8pybind1112cpp_functionC1Iv8Example2JRNSt3__16vectorINS3_12basic_stringIwNS3_11char_traitsIwEENS3_9allocatorIwEEEENS8_ISA_EEEEEJNS_4nameENS_7siblingENS_9is_methodEA28_cEEEMT0_FT_DpT1_EDpRKT2_
|
||||||
|
|
||||||
|
.. only:: not html
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
__ZN8pybind1112cpp_functionC1Iv8Example2JRNSt3__16vectorINS3_12basic_stringIwNS3_11char_traitsIwEENS3_9allocatorIwEEEENS8_ISA_EEEEEJNS_4nameENS_7siblingENS_9is_methodEA28_cEEEMT0_FT_DpT1_EDpRKT2_
|
||||||
|
|
||||||
|
which is the mangled form of the following function type:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
pybind11::cpp_function::cpp_function<void, Example2, std::__1::vector<std::__1::basic_string<wchar_t, std::__1::char_traits<wchar_t>, std::__1::allocator<wchar_t> >, std::__1::allocator<std::__1::basic_string<wchar_t, std::__1::char_traits<wchar_t>, std::__1::allocator<wchar_t> > > >&, pybind11::name, pybind11::sibling, pybind11::is_method, char [28]>(void (Example2::*)(std::__1::vector<std::__1::basic_string<wchar_t, std::__1::char_traits<wchar_t>, std::__1::allocator<wchar_t> >, std::__1::allocator<std::__1::basic_string<wchar_t, std::__1::char_traits<wchar_t>, std::__1::allocator<wchar_t> > > >&), pybind11::name const&, pybind11::sibling const&, pybind11::is_method const&, char const (&) [28])
|
||||||
|
|
||||||
|
The memory needed to store just the mangled name of this function (196 bytes)
|
||||||
|
is larger than the actual piece of code (111 bytes) it represents! On the other
|
||||||
|
hand, it's silly to even give this function a name -- after all, it's just a
|
||||||
|
tiny cog in a bigger piece of machinery that is not exposed to the outside
|
||||||
|
world. So we'll generally only want to export symbols for those functions which
|
||||||
|
are actually called from the outside.
|
||||||
|
|
||||||
|
This can be achieved by specifying the parameter ``-fvisibility=hidden`` to GCC
|
||||||
|
and Clang, which sets the default symbol visibility to *hidden*, which has a
|
||||||
|
tremendous impact on the final binary size of the resulting extension library.
|
||||||
|
(On Visual Studio, symbols are already hidden by default, so nothing needs to
|
||||||
|
be done there.)
|
||||||
|
|
||||||
|
In addition to decreasing binary size, ``-fvisibility=hidden`` also avoids
|
||||||
|
potential serious issues when loading multiple modules and is required for
|
||||||
|
proper pybind operation. See the previous FAQ entry for more details.
|
||||||
|
|
||||||
|
Working with ancient Visual Studio 2008 builds on Windows
|
||||||
|
=========================================================
|
||||||
|
|
||||||
|
The official Windows distributions of Python are compiled using truly
|
||||||
|
ancient versions of Visual Studio that lack good C++11 support. Some users
|
||||||
|
implicitly assume that it would be impossible to load a plugin built with
|
||||||
|
Visual Studio 2015 into a Python distribution that was compiled using Visual
|
||||||
|
Studio 2008. However, no such issue exists: it's perfectly legitimate to
|
||||||
|
interface DLLs that are built with different compilers and/or C libraries.
|
||||||
|
Common gotchas to watch out for involve not ``free()``-ing memory region
|
||||||
|
that that were ``malloc()``-ed in another shared library, using data
|
||||||
|
structures with incompatible ABIs, and so on. pybind11 is very careful not
|
||||||
|
to make these types of mistakes.
|
||||||
|
|
||||||
|
Inconsistent detection of Python version in CMake and pybind11
|
||||||
|
==============================================================
|
||||||
|
|
||||||
|
The functions ``find_package(PythonInterp)`` and ``find_package(PythonLibs)`` provided by CMake
|
||||||
|
for Python version detection are not used by pybind11 due to unreliability and limitations that make
|
||||||
|
them unsuitable for pybind11's needs. Instead pybind provides its own, more reliable Python detection
|
||||||
|
CMake code. Conflicts can arise, however, when using pybind11 in a project that *also* uses the CMake
|
||||||
|
Python detection in a system with several Python versions installed.
|
||||||
|
|
||||||
|
This difference may cause inconsistencies and errors if *both* mechanisms are used in the same project. Consider the following
|
||||||
|
Cmake code executed in a system with Python 2.7 and 3.x installed:
|
||||||
|
|
||||||
|
.. code-block:: cmake
|
||||||
|
|
||||||
|
find_package(PythonInterp)
|
||||||
|
find_package(PythonLibs)
|
||||||
|
find_package(pybind11)
|
||||||
|
|
||||||
|
It will detect Python 2.7 and pybind11 will pick it as well.
|
||||||
|
|
||||||
|
In contrast this code:
|
||||||
|
|
||||||
|
.. code-block:: cmake
|
||||||
|
|
||||||
|
find_package(pybind11)
|
||||||
|
find_package(PythonInterp)
|
||||||
|
find_package(PythonLibs)
|
||||||
|
|
||||||
|
will detect Python 3.x for pybind11 and may crash on ``find_package(PythonLibs)`` afterwards.
|
||||||
|
|
||||||
|
It is advised to avoid using ``find_package(PythonInterp)`` and ``find_package(PythonLibs)`` from CMake and rely
|
||||||
|
on pybind11 in detecting Python version. If this is not possible CMake machinery should be called *before* including pybind11.
|
||||||
|
|
||||||
|
How to cite this project?
|
||||||
|
=========================
|
||||||
|
|
||||||
|
We suggest the following BibTeX template to cite pybind11 in scientific
|
||||||
|
discourse:
|
||||||
|
|
||||||
|
.. code-block:: bash
|
||||||
|
|
||||||
|
@misc{pybind11,
|
||||||
|
author = {Wenzel Jakob and Jason Rhinelander and Dean Moldovan},
|
||||||
|
year = {2017},
|
||||||
|
note = {https://github.com/pybind/pybind11},
|
||||||
|
title = {pybind11 -- Seamless operability between C++11 and Python}
|
||||||
|
}
|
|
@ -0,0 +1,47 @@
|
||||||
|
.. only: not latex
|
||||||
|
|
||||||
|
.. image:: pybind11-logo.png
|
||||||
|
|
||||||
|
pybind11 --- Seamless operability between C++11 and Python
|
||||||
|
==========================================================
|
||||||
|
|
||||||
|
.. only: not latex
|
||||||
|
|
||||||
|
Contents:
|
||||||
|
|
||||||
|
.. toctree::
|
||||||
|
:maxdepth: 1
|
||||||
|
|
||||||
|
intro
|
||||||
|
changelog
|
||||||
|
upgrade
|
||||||
|
|
||||||
|
.. toctree::
|
||||||
|
:caption: The Basics
|
||||||
|
:maxdepth: 2
|
||||||
|
|
||||||
|
basics
|
||||||
|
classes
|
||||||
|
compiling
|
||||||
|
|
||||||
|
.. toctree::
|
||||||
|
:caption: Advanced Topics
|
||||||
|
:maxdepth: 2
|
||||||
|
|
||||||
|
advanced/functions
|
||||||
|
advanced/classes
|
||||||
|
advanced/exceptions
|
||||||
|
advanced/smart_ptrs
|
||||||
|
advanced/cast/index
|
||||||
|
advanced/pycpp/index
|
||||||
|
advanced/embedding
|
||||||
|
advanced/misc
|
||||||
|
|
||||||
|
.. toctree::
|
||||||
|
:caption: Extra Information
|
||||||
|
:maxdepth: 1
|
||||||
|
|
||||||
|
faq
|
||||||
|
benchmark
|
||||||
|
limitations
|
||||||
|
reference
|
|
@ -0,0 +1,93 @@
|
||||||
|
.. image:: pybind11-logo.png
|
||||||
|
|
||||||
|
About this project
|
||||||
|
==================
|
||||||
|
**pybind11** is a lightweight header-only library that exposes C++ types in Python
|
||||||
|
and vice versa, mainly to create Python bindings of existing C++ code. Its
|
||||||
|
goals and syntax are similar to the excellent `Boost.Python`_ library by David
|
||||||
|
Abrahams: to minimize boilerplate code in traditional extension modules by
|
||||||
|
inferring type information using compile-time introspection.
|
||||||
|
|
||||||
|
.. _Boost.Python: http://www.boost.org/doc/libs/release/libs/python/doc/index.html
|
||||||
|
|
||||||
|
The main issue with Boost.Python—and the reason for creating such a similar
|
||||||
|
project—is Boost. Boost is an enormously large and complex suite of utility
|
||||||
|
libraries that works with almost every C++ compiler in existence. This
|
||||||
|
compatibility has its cost: arcane template tricks and workarounds are
|
||||||
|
necessary to support the oldest and buggiest of compiler specimens. Now that
|
||||||
|
C++11-compatible compilers are widely available, this heavy machinery has
|
||||||
|
become an excessively large and unnecessary dependency.
|
||||||
|
Think of this library as a tiny self-contained version of Boost.Python with
|
||||||
|
everything stripped away that isn't relevant for binding generation. Without
|
||||||
|
comments, the core header files only require ~4K lines of code and depend on
|
||||||
|
Python (2.7 or 3.x, or PyPy2.7 >= 5.7) and the C++ standard library. This
|
||||||
|
compact implementation was possible thanks to some of the new C++11 language
|
||||||
|
features (specifically: tuples, lambda functions and variadic templates). Since
|
||||||
|
its creation, this library has grown beyond Boost.Python in many ways, leading
|
||||||
|
to dramatically simpler binding code in many common situations.
|
||||||
|
|
||||||
|
Core features
|
||||||
|
*************
|
||||||
|
The following core C++ features can be mapped to Python
|
||||||
|
|
||||||
|
- Functions accepting and returning custom data structures per value, reference, or pointer
|
||||||
|
- Instance methods and static methods
|
||||||
|
- Overloaded functions
|
||||||
|
- Instance attributes and static attributes
|
||||||
|
- Arbitrary exception types
|
||||||
|
- Enumerations
|
||||||
|
- Callbacks
|
||||||
|
- Iterators and ranges
|
||||||
|
- Custom operators
|
||||||
|
- Single and multiple inheritance
|
||||||
|
- STL data structures
|
||||||
|
- Smart pointers with reference counting like ``std::shared_ptr``
|
||||||
|
- Internal references with correct reference counting
|
||||||
|
- C++ classes with virtual (and pure virtual) methods can be extended in Python
|
||||||
|
|
||||||
|
Goodies
|
||||||
|
*******
|
||||||
|
In addition to the core functionality, pybind11 provides some extra goodies:
|
||||||
|
|
||||||
|
- Python 2.7, 3.x, and PyPy (PyPy2.7 >= 5.7) are supported with an
|
||||||
|
implementation-agnostic interface.
|
||||||
|
|
||||||
|
- It is possible to bind C++11 lambda functions with captured variables. The
|
||||||
|
lambda capture data is stored inside the resulting Python function object.
|
||||||
|
|
||||||
|
- pybind11 uses C++11 move constructors and move assignment operators whenever
|
||||||
|
possible to efficiently transfer custom data types.
|
||||||
|
|
||||||
|
- It's easy to expose the internal storage of custom data types through
|
||||||
|
Pythons' buffer protocols. This is handy e.g. for fast conversion between
|
||||||
|
C++ matrix classes like Eigen and NumPy without expensive copy operations.
|
||||||
|
|
||||||
|
- pybind11 can automatically vectorize functions so that they are transparently
|
||||||
|
applied to all entries of one or more NumPy array arguments.
|
||||||
|
|
||||||
|
- Python's slice-based access and assignment operations can be supported with
|
||||||
|
just a few lines of code.
|
||||||
|
|
||||||
|
- Everything is contained in just a few header files; there is no need to link
|
||||||
|
against any additional libraries.
|
||||||
|
|
||||||
|
- Binaries are generally smaller by a factor of at least 2 compared to
|
||||||
|
equivalent bindings generated by Boost.Python. A recent pybind11 conversion
|
||||||
|
of `PyRosetta`_, an enormous Boost.Python binding project, reported a binary
|
||||||
|
size reduction of **5.4x** and compile time reduction by **5.8x**.
|
||||||
|
|
||||||
|
- Function signatures are precomputed at compile time (using ``constexpr``),
|
||||||
|
leading to smaller binaries.
|
||||||
|
|
||||||
|
- With little extra effort, C++ types can be pickled and unpickled similar to
|
||||||
|
regular Python objects.
|
||||||
|
|
||||||
|
.. _PyRosetta: http://graylab.jhu.edu/RosettaCon2016/PyRosetta-4.pdf
|
||||||
|
|
||||||
|
Supported compilers
|
||||||
|
*******************
|
||||||
|
|
||||||
|
1. Clang/LLVM (any non-ancient version with C++11 support)
|
||||||
|
2. GCC 4.8 or newer
|
||||||
|
3. Microsoft Visual Studio 2015 or newer
|
||||||
|
4. Intel C++ compiler v17 or newer (v16 with pybind11 v2.0 and v15 with pybind11 v2.0 and a `workaround <https://github.com/pybind/pybind11/issues/276>`_ )
|
Some files were not shown because too many files have changed in this diff Show More
Loading…
Reference in New Issue