Merge branch 'develop' of github.com:borglab/gtsam into feature/1dsfm
commit
0e6dc6a016
|
|
@ -0,0 +1,14 @@
|
|||
# This triggers Cython builds on `gtsam-manylinux-build`
|
||||
name: Trigger Python Builds
|
||||
on: push
|
||||
jobs:
|
||||
triggerCython:
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- name: Repository Dispatch
|
||||
uses: ProfFan/repository-dispatch@master
|
||||
with:
|
||||
token: ${{ secrets.PYTHON_CI_REPO_ACCESS_TOKEN }}
|
||||
repository: borglab/gtsam-manylinux-build
|
||||
event-type: cython-wrapper
|
||||
client-payload: '{"ref": "${{ github.ref }}", "sha": "${{ github.sha }}"}'
|
||||
|
|
@ -63,7 +63,7 @@ function configure()
|
|||
-DGTSAM_BUILD_EXAMPLES_ALWAYS=${GTSAM_BUILD_EXAMPLES_ALWAYS:-ON} \
|
||||
-DGTSAM_ALLOW_DEPRECATED_SINCE_V4=${GTSAM_ALLOW_DEPRECATED_SINCE_V4:-OFF} \
|
||||
-DGTSAM_BUILD_WITH_MARCH_NATIVE=OFF \
|
||||
-DCMAKE_VERBOSE_MAKEFILE=ON
|
||||
-DCMAKE_VERBOSE_MAKEFILE=OFF
|
||||
}
|
||||
|
||||
|
||||
|
|
|
|||
|
|
@ -14,7 +14,8 @@ addons:
|
|||
- clang-9
|
||||
- build-essential pkg-config
|
||||
- cmake
|
||||
- libpython-dev python-numpy
|
||||
- python3-dev libpython-dev
|
||||
- python3-numpy
|
||||
- libboost-all-dev
|
||||
|
||||
# before_install:
|
||||
|
|
@ -94,7 +95,7 @@ jobs:
|
|||
os: linux
|
||||
compiler: gcc
|
||||
env: CMAKE_BUILD_TYPE=Debug GTSAM_BUILD_UNSTABLE=OFF GTSAM_WITH_TBB=ON
|
||||
script: bash .travis.sh -b
|
||||
script: bash .travis.sh -t
|
||||
# -------- STAGE 2: TESTS -----------
|
||||
# on Mac, GCC
|
||||
- stage: test
|
||||
|
|
|
|||
|
|
@ -22,6 +22,7 @@ set (GTSAM_VERSION_STRING "${GTSAM_VERSION_MAJOR}.${GTSAM_VERSION_MINOR}.${GTSAM
|
|||
|
||||
set(CMAKE_MODULE_PATH "${CMAKE_MODULE_PATH}" "${CMAKE_CURRENT_SOURCE_DIR}/cmake")
|
||||
include(GtsamMakeConfigFile)
|
||||
include(GNUInstallDirs)
|
||||
|
||||
# Record the root dir for gtsam - needed during external builds, e.g., ROS
|
||||
set(GTSAM_SOURCE_ROOT_DIR ${CMAKE_CURRENT_SOURCE_DIR})
|
||||
|
|
|
|||
|
|
@ -12,6 +12,6 @@ gtsam_assign_source_folders("${cppunitlite_headers};${cppunitlite_src}") # MSVC
|
|||
|
||||
option(GTSAM_INSTALL_CPPUNITLITE "Enable/Disable installation of CppUnitLite library" ON)
|
||||
if (GTSAM_INSTALL_CPPUNITLITE)
|
||||
install(FILES ${cppunitlite_headers} DESTINATION include/CppUnitLite)
|
||||
install(TARGETS CppUnitLite EXPORT GTSAM-exports ARCHIVE DESTINATION lib)
|
||||
install(FILES ${cppunitlite_headers} DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}/CppUnitLite)
|
||||
install(TARGETS CppUnitLite EXPORT GTSAM-exports ARCHIVE DESTINATION ${CMAKE_INSTALL_LIBDIR})
|
||||
endif(GTSAM_INSTALL_CPPUNITLITE)
|
||||
|
|
|
|||
|
|
@ -87,6 +87,15 @@ endfunction()
|
|||
# - output_dir: The output directory
|
||||
function(build_cythonized_cpp target cpp_file output_lib_we output_dir)
|
||||
add_library(${target} MODULE ${cpp_file})
|
||||
|
||||
if(WIN32)
|
||||
# Use .pyd extension instead of .dll on Windows
|
||||
set_target_properties(${target} PROPERTIES SUFFIX ".pyd")
|
||||
|
||||
# Add full path to the Python library
|
||||
target_link_libraries(${target} ${PYTHON_LIBRARIES})
|
||||
endif()
|
||||
|
||||
if(APPLE)
|
||||
set(link_flags "-undefined dynamic_lookup")
|
||||
endif()
|
||||
|
|
|
|||
|
|
@ -7,6 +7,11 @@ if (GTSAM_INSTALL_CYTHON_TOOLBOX)
|
|||
add_subdirectory(gtsam_eigency)
|
||||
include_directories(${PROJECT_BINARY_DIR}/cython/gtsam_eigency)
|
||||
|
||||
# Fix for error "C1128: number of sections exceeded object file format limit"
|
||||
if(MSVC)
|
||||
add_compile_options(/bigobj)
|
||||
endif()
|
||||
|
||||
# wrap gtsam
|
||||
add_custom_target(gtsam_header DEPENDS "../gtsam.h")
|
||||
wrap_and_install_library_cython("../gtsam.h" # interface_header
|
||||
|
|
|
|||
|
|
@ -5,32 +5,27 @@ All Rights Reserved
|
|||
|
||||
See LICENSE for the license information
|
||||
|
||||
A script validating the ImuFactor inference.
|
||||
A script validating and demonstrating the ImuFactor inference.
|
||||
|
||||
Author: Frank Dellaert, Varun Agrawal
|
||||
"""
|
||||
|
||||
from __future__ import print_function
|
||||
|
||||
import math
|
||||
|
||||
import gtsam
|
||||
import matplotlib.pyplot as plt
|
||||
import numpy as np
|
||||
from gtsam import symbol_shorthand_B as B
|
||||
from gtsam import symbol_shorthand_V as V
|
||||
from gtsam import symbol_shorthand_X as X
|
||||
from gtsam.utils.plot import plot_pose3
|
||||
from mpl_toolkits.mplot3d import Axes3D
|
||||
|
||||
import gtsam
|
||||
from gtsam.utils.plot import plot_pose3
|
||||
from PreintegrationExample import POSES_FIG, PreintegrationExample
|
||||
|
||||
BIAS_KEY = int(gtsam.symbol(ord('b'), 0))
|
||||
|
||||
|
||||
def X(key):
|
||||
"""Create symbol for pose key."""
|
||||
return gtsam.symbol(ord('x'), key)
|
||||
|
||||
|
||||
def V(key):
|
||||
"""Create symbol for velocity key."""
|
||||
return gtsam.symbol(ord('v'), key)
|
||||
BIAS_KEY = B(0)
|
||||
|
||||
|
||||
np.set_printoptions(precision=3, suppress=True)
|
||||
|
|
@ -76,8 +71,14 @@ class ImuFactorExample(PreintegrationExample):
|
|||
initial.insert(BIAS_KEY, self.actualBias)
|
||||
for i in range(num_poses):
|
||||
state_i = self.scenario.navState(float(i))
|
||||
initial.insert(X(i), state_i.pose())
|
||||
initial.insert(V(i), state_i.velocity())
|
||||
|
||||
poseNoise = gtsam.Pose3.Expmap(np.random.randn(3)*0.1)
|
||||
pose = state_i.pose().compose(poseNoise)
|
||||
|
||||
velocity = state_i.velocity() + np.random.randn(3)*0.1
|
||||
|
||||
initial.insert(X(i), pose)
|
||||
initial.insert(V(i), velocity)
|
||||
|
||||
# simulate the loop
|
||||
i = 0 # state index
|
||||
|
|
@ -88,6 +89,12 @@ class ImuFactorExample(PreintegrationExample):
|
|||
measuredAcc = self.runner.measuredSpecificForce(t)
|
||||
pim.integrateMeasurement(measuredAcc, measuredOmega, self.dt)
|
||||
|
||||
poseNoise = gtsam.Pose3.Expmap(np.random.randn(3)*0.1)
|
||||
|
||||
actual_state_i = gtsam.NavState(
|
||||
actual_state_i.pose().compose(poseNoise),
|
||||
actual_state_i.velocity() + np.random.randn(3)*0.1)
|
||||
|
||||
# Plot IMU many times
|
||||
if k % 10 == 0:
|
||||
self.plotImu(t, measuredOmega, measuredAcc)
|
||||
|
|
@ -133,6 +140,9 @@ class ImuFactorExample(PreintegrationExample):
|
|||
pose_i = result.atPose3(X(i))
|
||||
plot_pose3(POSES_FIG, pose_i, 0.1)
|
||||
i += 1
|
||||
|
||||
gtsam.utils.plot.set_axes_equal(POSES_FIG)
|
||||
|
||||
print(result.atimuBias_ConstantBias(BIAS_KEY))
|
||||
|
||||
plt.ioff()
|
||||
|
|
|
|||
|
|
@ -8,27 +8,19 @@ from __future__ import print_function
|
|||
|
||||
import math
|
||||
|
||||
import matplotlib.pyplot as plt
|
||||
import numpy as np
|
||||
from mpl_toolkits.mplot3d import Axes3D # pylint: disable=W0611
|
||||
|
||||
import gtsam
|
||||
import gtsam.utils.plot as gtsam_plot
|
||||
import matplotlib.pyplot as plt
|
||||
import numpy as np
|
||||
from gtsam import (ISAM2, BetweenFactorConstantBias, Cal3_S2,
|
||||
ConstantTwistScenario, ImuFactor, NonlinearFactorGraph,
|
||||
PinholeCameraCal3_S2, Point3, Pose3,
|
||||
PriorFactorConstantBias, PriorFactorPose3,
|
||||
PriorFactorVector, Rot3, Values)
|
||||
|
||||
|
||||
def X(key):
|
||||
"""Create symbol for pose key."""
|
||||
return gtsam.symbol(ord('x'), key)
|
||||
|
||||
|
||||
def V(key):
|
||||
"""Create symbol for velocity key."""
|
||||
return gtsam.symbol(ord('v'), key)
|
||||
from gtsam import symbol_shorthand_B as B
|
||||
from gtsam import symbol_shorthand_V as V
|
||||
from gtsam import symbol_shorthand_X as X
|
||||
from mpl_toolkits.mplot3d import Axes3D # pylint: disable=W0611
|
||||
|
||||
|
||||
def vector3(x, y, z):
|
||||
|
|
@ -115,7 +107,7 @@ def IMU_example():
|
|||
newgraph.push_back(PriorFactorPose3(X(0), pose_0, noise))
|
||||
|
||||
# Add imu priors
|
||||
biasKey = gtsam.symbol(ord('b'), 0)
|
||||
biasKey = B(0)
|
||||
biasnoise = gtsam.noiseModel_Isotropic.Sigma(6, 0.1)
|
||||
biasprior = PriorFactorConstantBias(biasKey, gtsam.imuBias_ConstantBias(),
|
||||
biasnoise)
|
||||
|
|
|
|||
|
|
@ -13,9 +13,10 @@ Author: Alex Cunningham (C++), Kevin Deng & Frank Dellaert (Python)
|
|||
|
||||
from __future__ import print_function
|
||||
|
||||
import numpy as np
|
||||
|
||||
import gtsam
|
||||
import numpy as np
|
||||
from gtsam import symbol_shorthand_L as L
|
||||
from gtsam import symbol_shorthand_X as X
|
||||
|
||||
# Create noise models
|
||||
PRIOR_NOISE = gtsam.noiseModel_Diagonal.Sigmas(np.array([0.3, 0.3, 0.1]))
|
||||
|
|
@ -26,11 +27,11 @@ MEASUREMENT_NOISE = gtsam.noiseModel_Diagonal.Sigmas(np.array([0.1, 0.2]))
|
|||
graph = gtsam.NonlinearFactorGraph()
|
||||
|
||||
# Create the keys corresponding to unknown variables in the factor graph
|
||||
X1 = gtsam.symbol(ord('x'), 1)
|
||||
X2 = gtsam.symbol(ord('x'), 2)
|
||||
X3 = gtsam.symbol(ord('x'), 3)
|
||||
L1 = gtsam.symbol(ord('l'), 4)
|
||||
L2 = gtsam.symbol(ord('l'), 5)
|
||||
X1 = X(1)
|
||||
X2 = X(2)
|
||||
X3 = X(3)
|
||||
L1 = L(4)
|
||||
L2 = L(5)
|
||||
|
||||
# Add a prior on pose X1 at the origin. A prior factor consists of a mean and a noise model
|
||||
graph.add(gtsam.PriorFactorPose2(X1, gtsam.Pose2(0.0, 0.0, 0.0), PRIOR_NOISE))
|
||||
|
|
|
|||
|
|
@ -82,7 +82,7 @@ else:
|
|||
print ("Done!")
|
||||
|
||||
if args.plot:
|
||||
resultPoses = gtsam.extractPose2(result)
|
||||
resultPoses = gtsam.utilities_extractPose2(result)
|
||||
for i in range(resultPoses.shape[0]):
|
||||
plot.plot_pose2(1, gtsam.Pose2(resultPoses[i, :]))
|
||||
plt.show()
|
||||
|
|
|
|||
|
|
@ -65,7 +65,7 @@ else:
|
|||
print ("Done!")
|
||||
|
||||
if args.plot:
|
||||
resultPoses = gtsam.allPose3s(result)
|
||||
resultPoses = gtsam.utilities_allPose3s(result)
|
||||
for i in range(resultPoses.size()):
|
||||
plot.plot_pose3(1, resultPoses.atPose3(i))
|
||||
plt.show()
|
||||
|
|
|
|||
|
|
@ -1,7 +1,7 @@
|
|||
These examples are almost identical to the old handwritten python wrapper
|
||||
examples. However, there are just some slight name changes, for example
|
||||
`noiseModel.Diagonal` becomes `noiseModel_Diagonal` etc...
|
||||
Also, annoyingly, instead of `gtsam.Symbol('b', 0)` we now need to say `gtsam.symbol(ord('b'), 0))`
|
||||
Also, instead of `gtsam.Symbol('b', 0)` we can simply say `gtsam.symbol_shorthand_B(0)` or `B(0)` if we use python aliasing.
|
||||
|
||||
# Porting Progress
|
||||
|
||||
|
|
|
|||
|
|
@ -10,24 +10,20 @@ A structure-from-motion problem on a simulated dataset
|
|||
"""
|
||||
from __future__ import print_function
|
||||
|
||||
import gtsam
|
||||
import matplotlib.pyplot as plt
|
||||
import numpy as np
|
||||
|
||||
import gtsam
|
||||
from gtsam import symbol_shorthand_L as L
|
||||
from gtsam import symbol_shorthand_X as X
|
||||
from gtsam.examples import SFMdata
|
||||
from gtsam.gtsam import (Cal3_S2, DoglegOptimizer,
|
||||
GenericProjectionFactorCal3_S2, Marginals,
|
||||
NonlinearFactorGraph, Point3, Pose3,
|
||||
PriorFactorPoint3, PriorFactorPose3, Rot3,
|
||||
NonlinearFactorGraph, PinholeCameraCal3_S2, Point3,
|
||||
Pose3, PriorFactorPoint3, PriorFactorPose3, Rot3,
|
||||
SimpleCamera, Values)
|
||||
from gtsam.utils import plot
|
||||
|
||||
|
||||
def symbol(name: str, index: int) -> int:
|
||||
""" helper for creating a symbol without explicitly casting 'name' from str to int """
|
||||
return gtsam.symbol(ord(name), index)
|
||||
|
||||
|
||||
def main():
|
||||
"""
|
||||
Camera observations of landmarks (i.e. pixel coordinates) will be stored as Point2 (x, y).
|
||||
|
|
@ -74,7 +70,7 @@ def main():
|
|||
# Add a prior on pose x1. This indirectly specifies where the origin is.
|
||||
# 0.3 rad std on roll,pitch,yaw and 0.1m on x,y,z
|
||||
pose_noise = gtsam.noiseModel_Diagonal.Sigmas(np.array([0.3, 0.3, 0.3, 0.1, 0.1, 0.1]))
|
||||
factor = PriorFactorPose3(symbol('x', 0), poses[0], pose_noise)
|
||||
factor = PriorFactorPose3(X(0), poses[0], pose_noise)
|
||||
graph.push_back(factor)
|
||||
|
||||
# Simulated measurements from each camera pose, adding them to the factor graph
|
||||
|
|
@ -83,14 +79,14 @@ def main():
|
|||
for j, point in enumerate(points):
|
||||
measurement = camera.project(point)
|
||||
factor = GenericProjectionFactorCal3_S2(
|
||||
measurement, measurement_noise, symbol('x', i), symbol('l', j), K)
|
||||
measurement, measurement_noise, X(i), L(j), K)
|
||||
graph.push_back(factor)
|
||||
|
||||
# Because the structure-from-motion problem has a scale ambiguity, the problem is still under-constrained
|
||||
# Here we add a prior on the position of the first landmark. This fixes the scale by indicating the distance
|
||||
# between the first camera and the first landmark. All other landmark positions are interpreted using this scale.
|
||||
point_noise = gtsam.noiseModel_Isotropic.Sigma(3, 0.1)
|
||||
factor = PriorFactorPoint3(symbol('l', 0), points[0], point_noise)
|
||||
factor = PriorFactorPoint3(L(0), points[0], point_noise)
|
||||
graph.push_back(factor)
|
||||
graph.print_('Factor Graph:\n')
|
||||
|
||||
|
|
@ -99,10 +95,10 @@ def main():
|
|||
initial_estimate = Values()
|
||||
for i, pose in enumerate(poses):
|
||||
transformed_pose = pose.retract(0.1*np.random.randn(6,1))
|
||||
initial_estimate.insert(symbol('x', i), transformed_pose)
|
||||
initial_estimate.insert(X(i), transformed_pose)
|
||||
for j, point in enumerate(points):
|
||||
transformed_point = Point3(point.vector() + 0.1*np.random.randn(3))
|
||||
initial_estimate.insert(symbol('l', j), transformed_point)
|
||||
initial_estimate.insert(L(j), transformed_point)
|
||||
initial_estimate.print_('Initial Estimates:\n')
|
||||
|
||||
# Optimize the graph and print results
|
||||
|
|
|
|||
|
|
@ -10,8 +10,9 @@ This example will perform a relatively trivial optimization on
|
|||
a single variable with a single factor.
|
||||
"""
|
||||
|
||||
import numpy as np
|
||||
import gtsam
|
||||
import numpy as np
|
||||
from gtsam import symbol_shorthand_X as X
|
||||
|
||||
|
||||
def main():
|
||||
|
|
@ -33,7 +34,7 @@ def main():
|
|||
prior = gtsam.Rot2.fromAngle(np.deg2rad(30))
|
||||
prior.print_('goal angle')
|
||||
model = gtsam.noiseModel_Isotropic.Sigma(dim=1, sigma=np.deg2rad(1))
|
||||
key = gtsam.symbol(ord('x'), 1)
|
||||
key = X(1)
|
||||
factor = gtsam.PriorFactorRot2(key, prior, model)
|
||||
|
||||
"""
|
||||
|
|
|
|||
|
|
@ -13,23 +13,14 @@ Author: Duy-Nguyen Ta (C++), Frank Dellaert (Python)
|
|||
|
||||
from __future__ import print_function
|
||||
|
||||
import matplotlib.pyplot as plt
|
||||
import numpy as np
|
||||
from mpl_toolkits.mplot3d import Axes3D # pylint: disable=W0611
|
||||
|
||||
import gtsam
|
||||
import gtsam.utils.plot as gtsam_plot
|
||||
import matplotlib.pyplot as plt
|
||||
import numpy as np
|
||||
from gtsam import symbol_shorthand_L as L
|
||||
from gtsam import symbol_shorthand_X as X
|
||||
from gtsam.examples import SFMdata
|
||||
|
||||
|
||||
def X(i):
|
||||
"""Create key for pose i."""
|
||||
return int(gtsam.symbol(ord('x'), i))
|
||||
|
||||
|
||||
def L(j):
|
||||
"""Create key for landmark j."""
|
||||
return int(gtsam.symbol(ord('l'), j))
|
||||
from mpl_toolkits.mplot3d import Axes3D # pylint: disable=W0611
|
||||
|
||||
|
||||
def visual_ISAM2_plot(result):
|
||||
|
|
|
|||
|
|
@ -19,11 +19,8 @@ from gtsam.gtsam import (Cal3_S2, GenericProjectionFactorCal3_S2,
|
|||
NonlinearFactorGraph, NonlinearISAM, Point3, Pose3,
|
||||
PriorFactorPoint3, PriorFactorPose3, Rot3,
|
||||
PinholeCameraCal3_S2, Values)
|
||||
|
||||
|
||||
def symbol(name: str, index: int) -> int:
|
||||
""" helper for creating a symbol without explicitly casting 'name' from str to int """
|
||||
return gtsam.symbol(ord(name), index)
|
||||
from gtsam import symbol_shorthand_L as L
|
||||
from gtsam import symbol_shorthand_X as X
|
||||
|
||||
|
||||
def main():
|
||||
|
|
@ -58,7 +55,7 @@ def main():
|
|||
# Add factors for each landmark observation
|
||||
for j, point in enumerate(points):
|
||||
measurement = camera.project(point)
|
||||
factor = GenericProjectionFactorCal3_S2(measurement, camera_noise, symbol('x', i), symbol('l', j), K)
|
||||
factor = GenericProjectionFactorCal3_S2(measurement, camera_noise, X(i), L(j), K)
|
||||
graph.push_back(factor)
|
||||
|
||||
# Intentionally initialize the variables off from the ground truth
|
||||
|
|
@ -66,7 +63,7 @@ def main():
|
|||
initial_xi = pose.compose(noise)
|
||||
|
||||
# Add an initial guess for the current pose
|
||||
initial_estimate.insert(symbol('x', i), initial_xi)
|
||||
initial_estimate.insert(X(i), initial_xi)
|
||||
|
||||
# If this is the first iteration, add a prior on the first pose to set the coordinate frame
|
||||
# and a prior on the first landmark to set the scale
|
||||
|
|
@ -75,12 +72,12 @@ def main():
|
|||
if i == 0:
|
||||
# Add a prior on pose x0, with 0.3 rad std on roll,pitch,yaw and 0.1m x,y,z
|
||||
pose_noise = gtsam.noiseModel_Diagonal.Sigmas(np.array([0.3, 0.3, 0.3, 0.1, 0.1, 0.1]))
|
||||
factor = PriorFactorPose3(symbol('x', 0), poses[0], pose_noise)
|
||||
factor = PriorFactorPose3(X(0), poses[0], pose_noise)
|
||||
graph.push_back(factor)
|
||||
|
||||
# Add a prior on landmark l0
|
||||
point_noise = gtsam.noiseModel_Isotropic.Sigma(3, 0.1)
|
||||
factor = PriorFactorPoint3(symbol('l', 0), points[0], point_noise)
|
||||
factor = PriorFactorPoint3(L(0), points[0], point_noise)
|
||||
graph.push_back(factor)
|
||||
|
||||
# Add initial guesses to all observed landmarks
|
||||
|
|
@ -88,7 +85,7 @@ def main():
|
|||
for j, point in enumerate(points):
|
||||
# Intentionally initialize the variables off from the ground truth
|
||||
initial_lj = points[j].vector() + noise
|
||||
initial_estimate.insert(symbol('l', j), Point3(initial_lj))
|
||||
initial_estimate.insert(L(j), Point3(initial_lj))
|
||||
else:
|
||||
# Update iSAM with the new factors
|
||||
isam.update(graph, initial_estimate)
|
||||
|
|
|
|||
|
|
@ -15,17 +15,18 @@ from __future__ import print_function
|
|||
import unittest
|
||||
|
||||
import gtsam
|
||||
import numpy as np
|
||||
from gtsam import symbol_shorthand_X as X
|
||||
from gtsam.utils.test_case import GtsamTestCase
|
||||
|
||||
import numpy as np
|
||||
|
||||
def create_graph():
|
||||
"""Create a basic linear factor graph for testing"""
|
||||
graph = gtsam.GaussianFactorGraph()
|
||||
|
||||
x0 = gtsam.symbol(ord('x'), 0)
|
||||
x1 = gtsam.symbol(ord('x'), 1)
|
||||
x2 = gtsam.symbol(ord('x'), 2)
|
||||
x0 = X(0)
|
||||
x1 = X(1)
|
||||
x2 = X(2)
|
||||
|
||||
BETWEEN_NOISE = gtsam.noiseModel_Diagonal.Sigmas(np.ones(1))
|
||||
PRIOR_NOISE = gtsam.noiseModel_Diagonal.Sigmas(np.ones(1))
|
||||
|
|
|
|||
|
|
@ -35,5 +35,27 @@ class TestPriorFactor(GtsamTestCase):
|
|||
values.insert(key, priorVector)
|
||||
self.assertEqual(factor.error(values), 0)
|
||||
|
||||
def test_AddPrior(self):
|
||||
"""
|
||||
Test adding prior factors directly to factor graph via the .addPrior method.
|
||||
"""
|
||||
# define factor graph
|
||||
graph = gtsam.NonlinearFactorGraph()
|
||||
|
||||
# define and add Pose3 prior
|
||||
key = 5
|
||||
priorPose3 = gtsam.Pose3()
|
||||
model = gtsam.noiseModel_Unit.Create(6)
|
||||
graph.addPriorPose3(key, priorPose3, model)
|
||||
self.assertEqual(graph.size(), 1)
|
||||
|
||||
# define and add Vector prior
|
||||
key = 3
|
||||
priorVector = np.array([0., 0., 0.])
|
||||
model = gtsam.noiseModel_Unit.Create(3)
|
||||
graph.addPriorVector(key, priorVector, model)
|
||||
self.assertEqual(graph.size(), 2)
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
unittest.main()
|
||||
|
|
|
|||
|
|
@ -33,7 +33,7 @@ class TestDSFMap(GtsamTestCase):
|
|||
|
||||
# testing the merge feature of dsf
|
||||
dsf.merge(pair1, pair2)
|
||||
self.assertEquals(key(dsf.find(pair1)), key(dsf.find(pair2)))
|
||||
self.assertEqual(key(dsf.find(pair1)), key(dsf.find(pair2)))
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
|
|
|
|||
|
|
@ -0,0 +1,79 @@
|
|||
"""
|
||||
Unit tests for optimization that logs to comet.ml.
|
||||
Author: Jing Wu and Frank Dellaert
|
||||
"""
|
||||
# pylint: disable=invalid-name
|
||||
|
||||
import unittest
|
||||
from datetime import datetime
|
||||
|
||||
import gtsam
|
||||
import numpy as np
|
||||
from gtsam import Rot3
|
||||
from gtsam.utils.test_case import GtsamTestCase
|
||||
|
||||
from gtsam.utils.logging_optimizer import gtsam_optimize
|
||||
|
||||
KEY = 0
|
||||
MODEL = gtsam.noiseModel_Unit.Create(3)
|
||||
|
||||
|
||||
class TestOptimizeComet(GtsamTestCase):
|
||||
"""Check correct logging to comet.ml."""
|
||||
|
||||
def setUp(self):
|
||||
"""Set up a small Karcher mean optimization example."""
|
||||
# Grabbed from KarcherMeanFactor unit tests.
|
||||
R = Rot3.Expmap(np.array([0.1, 0, 0]))
|
||||
rotations = {R, R.inverse()} # mean is the identity
|
||||
self.expected = Rot3()
|
||||
|
||||
graph = gtsam.NonlinearFactorGraph()
|
||||
for R in rotations:
|
||||
graph.add(gtsam.PriorFactorRot3(KEY, R, MODEL))
|
||||
initial = gtsam.Values()
|
||||
initial.insert(KEY, R)
|
||||
self.params = gtsam.GaussNewtonParams()
|
||||
self.optimizer = gtsam.GaussNewtonOptimizer(
|
||||
graph, initial, self.params)
|
||||
|
||||
def test_simple_printing(self):
|
||||
"""Test with a simple hook."""
|
||||
|
||||
# Provide a hook that just prints
|
||||
def hook(_, error: float):
|
||||
print(error)
|
||||
|
||||
# Only thing we require from optimizer is an iterate method
|
||||
gtsam_optimize(self.optimizer, self.params, hook)
|
||||
|
||||
# Check that optimizing yields the identity.
|
||||
actual = self.optimizer.values()
|
||||
self.gtsamAssertEquals(actual.atRot3(KEY), self.expected, tol=1e-6)
|
||||
|
||||
@unittest.skip("Not a test we want run every time, as needs comet.ml account")
|
||||
def test_comet(self):
|
||||
"""Test with a comet hook."""
|
||||
from comet_ml import Experiment
|
||||
comet = Experiment(project_name="Testing",
|
||||
auto_output_logging="native")
|
||||
comet.log_dataset_info(name="Karcher", path="shonan")
|
||||
comet.add_tag("GaussNewton")
|
||||
comet.log_parameter("method", "GaussNewton")
|
||||
time = datetime.now()
|
||||
comet.set_name("GaussNewton-" + str(time.month) + "/" + str(time.day) + " "
|
||||
+ str(time.hour)+":"+str(time.minute)+":"+str(time.second))
|
||||
|
||||
# I want to do some comet thing here
|
||||
def hook(optimizer, error: float):
|
||||
comet.log_metric("Karcher error",
|
||||
error, optimizer.iterations())
|
||||
|
||||
gtsam_optimize(self.optimizer, self.params, hook)
|
||||
comet.end()
|
||||
|
||||
actual = self.optimizer.values()
|
||||
self.gtsamAssertEquals(actual.atRot3(KEY), self.expected)
|
||||
|
||||
if __name__ == "__main__":
|
||||
unittest.main()
|
||||
|
|
@ -0,0 +1,54 @@
|
|||
"""
|
||||
Optimization with logging via a hook.
|
||||
Author: Jing Wu and Frank Dellaert
|
||||
"""
|
||||
# pylint: disable=invalid-name
|
||||
|
||||
from typing import TypeVar
|
||||
|
||||
from gtsam import NonlinearOptimizer, NonlinearOptimizerParams
|
||||
import gtsam
|
||||
|
||||
T = TypeVar('T')
|
||||
|
||||
|
||||
def optimize(optimizer: T, check_convergence, hook):
|
||||
""" Given an optimizer and a convergence check, iterate until convergence.
|
||||
After each iteration, hook(optimizer, error) is called.
|
||||
After the function, use values and errors to get the result.
|
||||
Arguments:
|
||||
optimizer (T): needs an iterate and an error function.
|
||||
check_convergence: T * float * float -> bool
|
||||
hook -- hook function to record the error
|
||||
"""
|
||||
# the optimizer is created with default values which incur the error below
|
||||
current_error = optimizer.error()
|
||||
hook(optimizer, current_error)
|
||||
|
||||
# Iterative loop
|
||||
while True:
|
||||
# Do next iteration
|
||||
optimizer.iterate()
|
||||
new_error = optimizer.error()
|
||||
hook(optimizer, new_error)
|
||||
if check_convergence(optimizer, current_error, new_error):
|
||||
return
|
||||
current_error = new_error
|
||||
|
||||
|
||||
def gtsam_optimize(optimizer: NonlinearOptimizer,
|
||||
params: NonlinearOptimizerParams,
|
||||
hook):
|
||||
""" Given an optimizer and params, iterate until convergence.
|
||||
After each iteration, hook(optimizer) is called.
|
||||
After the function, use values and errors to get the result.
|
||||
Arguments:
|
||||
optimizer {NonlinearOptimizer} -- Nonlinear optimizer
|
||||
params {NonlinearOptimizarParams} -- Nonlinear optimizer parameters
|
||||
hook -- hook function to record the error
|
||||
"""
|
||||
def check_convergence(optimizer, current_error, new_error):
|
||||
return (optimizer.iterations() >= params.getMaxIterations()) or (
|
||||
gtsam.checkConvergence(params.getRelativeErrorTol(), params.getAbsoluteErrorTol(), params.getErrorTol(),
|
||||
current_error, new_error))
|
||||
optimize(optimizer, check_convergence, hook)
|
||||
|
|
@ -13,8 +13,9 @@ def set_axes_equal(fignum):
|
|||
Make axes of 3D plot have equal scale so that spheres appear as spheres,
|
||||
cubes as cubes, etc.. This is one possible solution to Matplotlib's
|
||||
ax.set_aspect('equal') and ax.axis('equal') not working for 3D.
|
||||
Input
|
||||
ax: a matplotlib axis, e.g., as output from plt.gca().
|
||||
|
||||
Args:
|
||||
fignum (int): An integer representing the figure number for Matplotlib.
|
||||
"""
|
||||
fig = plt.figure(fignum)
|
||||
ax = fig.gca(projection='3d')
|
||||
|
|
@ -34,7 +35,21 @@ def set_axes_equal(fignum):
|
|||
|
||||
|
||||
def ellipsoid(xc, yc, zc, rx, ry, rz, n):
|
||||
"""Numpy equivalent of Matlab's ellipsoid function"""
|
||||
"""
|
||||
Numpy equivalent of Matlab's ellipsoid function.
|
||||
|
||||
Args:
|
||||
xc (double): Center of ellipsoid in X-axis.
|
||||
yc (double): Center of ellipsoid in Y-axis.
|
||||
zc (double): Center of ellipsoid in Z-axis.
|
||||
rx (double): Radius of ellipsoid in X-axis.
|
||||
ry (double): Radius of ellipsoid in Y-axis.
|
||||
rz (double): Radius of ellipsoid in Z-axis.
|
||||
n (int): The granularity of the ellipsoid plotted.
|
||||
|
||||
Returns:
|
||||
tuple[numpy.ndarray]: The points in the x, y and z axes to use for the surface plot.
|
||||
"""
|
||||
u = np.linspace(0, 2*np.pi, n+1)
|
||||
v = np.linspace(0, np.pi, n+1)
|
||||
x = -rx * np.outer(np.cos(u), np.sin(v)).T
|
||||
|
|
@ -51,6 +66,14 @@ def plot_covariance_ellipse_3d(axes, origin, P, scale=1, n=8, alpha=0.5):
|
|||
Based on Maybeck Vol 1, page 366
|
||||
k=2.296 corresponds to 1 std, 68.26% of all probability
|
||||
k=11.82 corresponds to 3 std, 99.74% of all probability
|
||||
|
||||
Args:
|
||||
axes (matplotlib.axes.Axes): Matplotlib axes.
|
||||
origin (gtsam.Point3): The origin in the world frame.
|
||||
P (numpy.ndarray): The marginal covariance matrix of the 3D point which will be represented as an ellipse.
|
||||
scale (float): Scaling factor of the radii of the covariance ellipse.
|
||||
n (int): Defines the granularity of the ellipse. Higher values indicate finer ellipses.
|
||||
alpha (float): Transparency value for the plotted surface in the range [0, 1].
|
||||
"""
|
||||
k = 11.82
|
||||
U, S, _ = np.linalg.svd(P)
|
||||
|
|
@ -74,7 +97,15 @@ def plot_covariance_ellipse_3d(axes, origin, P, scale=1, n=8, alpha=0.5):
|
|||
|
||||
|
||||
def plot_pose2_on_axes(axes, pose, axis_length=0.1, covariance=None):
|
||||
"""Plot a 2D pose on given axis 'axes' with given 'axis_length'."""
|
||||
"""
|
||||
Plot a 2D pose on given axis `axes` with given `axis_length`.
|
||||
|
||||
Args:
|
||||
axes (matplotlib.axes.Axes): Matplotlib axes.
|
||||
pose (gtsam.Pose2): The pose to be plotted.
|
||||
axis_length (float): The length of the camera axes.
|
||||
covariance (numpy.ndarray): Marginal covariance matrix to plot the uncertainty of the estimation.
|
||||
"""
|
||||
# get rotation and translation (center)
|
||||
gRp = pose.rotation().matrix() # rotation from pose to global
|
||||
t = pose.translation()
|
||||
|
|
@ -105,22 +136,47 @@ def plot_pose2_on_axes(axes, pose, axis_length=0.1, covariance=None):
|
|||
|
||||
|
||||
def plot_pose2(fignum, pose, axis_length=0.1, covariance=None):
|
||||
"""Plot a 2D pose on given figure with given 'axis_length'."""
|
||||
"""
|
||||
Plot a 2D pose on given figure with given `axis_length`.
|
||||
|
||||
Args:
|
||||
fignum (int): Integer representing the figure number to use for plotting.
|
||||
pose (gtsam.Pose2): The pose to be plotted.
|
||||
axis_length (float): The length of the camera axes.
|
||||
covariance (numpy.ndarray): Marginal covariance matrix to plot the uncertainty of the estimation.
|
||||
"""
|
||||
# get figure object
|
||||
fig = plt.figure(fignum)
|
||||
axes = fig.gca()
|
||||
plot_pose2_on_axes(axes, pose, axis_length, covariance)
|
||||
plot_pose2_on_axes(axes, pose, axis_length=axis_length,
|
||||
covariance=covariance)
|
||||
|
||||
|
||||
def plot_point3_on_axes(axes, point, linespec, P=None):
|
||||
"""Plot a 3D point on given axis 'axes' with given 'linespec'."""
|
||||
"""
|
||||
Plot a 3D point on given axis `axes` with given `linespec`.
|
||||
|
||||
Args:
|
||||
axes (matplotlib.axes.Axes): Matplotlib axes.
|
||||
point (gtsam.Point3): The point to be plotted.
|
||||
linespec (string): String representing formatting options for Matplotlib.
|
||||
P (numpy.ndarray): Marginal covariance matrix to plot the uncertainty of the estimation.
|
||||
"""
|
||||
axes.plot([point.x()], [point.y()], [point.z()], linespec)
|
||||
if P is not None:
|
||||
plot_covariance_ellipse_3d(axes, point.vector(), P)
|
||||
|
||||
|
||||
def plot_point3(fignum, point, linespec, P=None):
|
||||
"""Plot a 3D point on given figure with given 'linespec'."""
|
||||
"""
|
||||
Plot a 3D point on given figure with given `linespec`.
|
||||
|
||||
Args:
|
||||
fignum (int): Integer representing the figure number to use for plotting.
|
||||
point (gtsam.Point3): The point to be plotted.
|
||||
linespec (string): String representing formatting options for Matplotlib.
|
||||
P (numpy.ndarray): Marginal covariance matrix to plot the uncertainty of the estimation.
|
||||
"""
|
||||
fig = plt.figure(fignum)
|
||||
axes = fig.gca(projection='3d')
|
||||
plot_point3_on_axes(axes, point, linespec, P)
|
||||
|
|
@ -128,10 +184,16 @@ def plot_point3(fignum, point, linespec, P=None):
|
|||
|
||||
def plot_3d_points(fignum, values, linespec="g*", marginals=None):
|
||||
"""
|
||||
Plots the Point3s in 'values', with optional covariances.
|
||||
Plots the Point3s in `values`, with optional covariances.
|
||||
Finds all the Point3 objects in the given Values object and plots them.
|
||||
If a Marginals object is given, this function will also plot marginal
|
||||
covariance ellipses for each point.
|
||||
|
||||
Args:
|
||||
fignum (int): Integer representing the figure number to use for plotting.
|
||||
values (gtsam.Values): Values dictionary consisting of points to be plotted.
|
||||
linespec (string): String representing formatting options for Matplotlib.
|
||||
covariance (numpy.ndarray): Marginal covariance matrix to plot the uncertainty of the estimation.
|
||||
"""
|
||||
|
||||
keys = values.keys()
|
||||
|
|
@ -142,19 +204,27 @@ def plot_3d_points(fignum, values, linespec="g*", marginals=None):
|
|||
key = keys.at(i)
|
||||
point = values.atPoint3(key)
|
||||
if marginals is not None:
|
||||
P = marginals.marginalCovariance(key);
|
||||
covariance = marginals.marginalCovariance(key)
|
||||
else:
|
||||
P = None
|
||||
covariance = None
|
||||
|
||||
plot_point3(fignum, point, linespec, P)
|
||||
plot_point3(fignum, point, linespec, covariance)
|
||||
|
||||
except RuntimeError:
|
||||
continue
|
||||
# I guess it's not a Point3
|
||||
|
||||
|
||||
def plot_pose3_on_axes(axes, pose, P=None, scale=1, axis_length=0.1):
|
||||
"""Plot a 3D pose on given axis 'axes' with given 'axis_length'."""
|
||||
def plot_pose3_on_axes(axes, pose, axis_length=0.1, P=None, scale=1):
|
||||
"""
|
||||
Plot a 3D pose on given axis `axes` with given `axis_length`.
|
||||
|
||||
Args:
|
||||
axes (matplotlib.axes.Axes): Matplotlib axes.
|
||||
point (gtsam.Point3): The point to be plotted.
|
||||
linespec (string): String representing formatting options for Matplotlib.
|
||||
P (numpy.ndarray): Marginal covariance matrix to plot the uncertainty of the estimation.
|
||||
"""
|
||||
# get rotation and translation (center)
|
||||
gRp = pose.rotation().matrix() # rotation from pose to global
|
||||
origin = pose.translation().vector()
|
||||
|
|
@ -181,15 +251,35 @@ def plot_pose3_on_axes(axes, pose, P=None, scale=1, axis_length=0.1):
|
|||
plot_covariance_ellipse_3d(axes, origin, gPp)
|
||||
|
||||
|
||||
def plot_pose3(fignum, pose, P, axis_length=0.1):
|
||||
"""Plot a 3D pose on given figure with given 'axis_length'."""
|
||||
def plot_pose3(fignum, pose, axis_length=0.1, P=None):
|
||||
"""
|
||||
Plot a 3D pose on given figure with given `axis_length`.
|
||||
|
||||
Args:
|
||||
fignum (int): Integer representing the figure number to use for plotting.
|
||||
pose (gtsam.Pose3): 3D pose to be plotted.
|
||||
linespec (string): String representing formatting options for Matplotlib.
|
||||
P (numpy.ndarray): Marginal covariance matrix to plot the uncertainty of the estimation.
|
||||
"""
|
||||
# get figure object
|
||||
fig = plt.figure(fignum)
|
||||
axes = fig.gca(projection='3d')
|
||||
plot_pose3_on_axes(axes, pose, P=P, axis_length=axis_length)
|
||||
plot_pose3_on_axes(axes, pose, P=P,
|
||||
axis_length=axis_length)
|
||||
|
||||
|
||||
def plot_trajectory(fignum, values, scale=1, marginals=None):
|
||||
pose3Values = gtsam.allPose3s(values)
|
||||
"""
|
||||
Plot a complete 3D trajectory using poses in `values`.
|
||||
|
||||
Args:
|
||||
fignum (int): Integer representing the figure number to use for plotting.
|
||||
values (gtsam.Values): Values dict containing the poses.
|
||||
scale (float): Value to scale the poses by.
|
||||
marginals (gtsam.Marginals): Marginalized probability values of the estimation.
|
||||
Used to plot uncertainty bounds.
|
||||
"""
|
||||
pose3Values = gtsam.utilities_allPose3s(values)
|
||||
keys = gtsam.KeyVector(pose3Values.keys())
|
||||
lastIndex = None
|
||||
|
||||
|
|
@ -209,11 +299,12 @@ def plot_trajectory(fignum, values, scale=1, marginals=None):
|
|||
pass
|
||||
|
||||
if marginals:
|
||||
P = marginals.marginalCovariance(lastKey)
|
||||
covariance = marginals.marginalCovariance(lastKey)
|
||||
else:
|
||||
P = None
|
||||
covariance = None
|
||||
|
||||
plot_pose3(fignum, lastPose, P, scale)
|
||||
plot_pose3(fignum, lastPose, P=covariance,
|
||||
axis_length=scale)
|
||||
|
||||
lastIndex = i
|
||||
|
||||
|
|
@ -223,11 +314,12 @@ def plot_trajectory(fignum, values, scale=1, marginals=None):
|
|||
try:
|
||||
lastPose = pose3Values.atPose3(lastKey)
|
||||
if marginals:
|
||||
P = marginals.marginalCovariance(lastKey)
|
||||
covariance = marginals.marginalCovariance(lastKey)
|
||||
else:
|
||||
P = None
|
||||
covariance = None
|
||||
|
||||
plot_pose3(fignum, lastPose, P, scale)
|
||||
plot_pose3(fignum, lastPose, P=covariance,
|
||||
axis_length=scale)
|
||||
|
||||
except:
|
||||
pass
|
||||
|
|
|
|||
|
|
@ -1,3 +1,3 @@
|
|||
Cython>=0.25.2
|
||||
backports_abc>=0.5
|
||||
numpy>=1.12.0
|
||||
numpy>=1.11.0
|
||||
|
|
|
|||
|
|
@ -35,7 +35,7 @@ setup(
|
|||
|
||||
packages=packages,
|
||||
package_data={package:
|
||||
[f for f in os.listdir(package.replace('.', os.path.sep)) if os.path.splitext(f)[1] in ('.so', '.dll')]
|
||||
[f for f in os.listdir(package.replace('.', os.path.sep)) if os.path.splitext(f)[1] in ('.so', '.pyd')]
|
||||
for package in packages
|
||||
},
|
||||
install_requires=[line.strip() for line in '''
|
||||
|
|
|
|||
|
|
@ -1,12 +0,0 @@
|
|||
# How to build a GTSAM debian package
|
||||
|
||||
To use the ``debuild`` command, install the ``devscripts`` package
|
||||
|
||||
sudo apt install devscripts
|
||||
|
||||
Change into the gtsam directory, then run:
|
||||
|
||||
debuild -us -uc -j4
|
||||
|
||||
Adjust the ``-j4`` depending on how many CPUs you want to build on in
|
||||
parallel.
|
||||
|
|
@ -1,5 +0,0 @@
|
|||
gtsam (4.0.0-1berndpfrommer) bionic; urgency=medium
|
||||
|
||||
* initial release
|
||||
|
||||
-- Bernd Pfrommer <bernd.pfrommer@gmail.com> Wed, 18 Jul 2018 20:36:44 -0400
|
||||
|
|
@ -1 +0,0 @@
|
|||
9
|
||||
|
|
@ -1,15 +0,0 @@
|
|||
Source: gtsam
|
||||
Section: libs
|
||||
Priority: optional
|
||||
Maintainer: Frank Dellaert <frank@cc.gatech.edu>
|
||||
Uploaders: Jose Luis Blanco Claraco <joseluisblancoc@gmail.com>, Bernd Pfrommer <bernd.pfrommer@gmail.com>
|
||||
Build-Depends: cmake, libboost-all-dev (>= 1.58), libeigen3-dev, libtbb-dev, debhelper (>=9)
|
||||
Standards-Version: 3.9.7
|
||||
Homepage: https://github.com/borglab/gtsam
|
||||
Vcs-Browser: https://github.com/borglab/gtsam
|
||||
|
||||
Package: libgtsam-dev
|
||||
Architecture: any
|
||||
Depends: ${shlibs:Depends}, ${misc:Depends}, libboost-serialization-dev, libboost-system-dev, libboost-filesystem-dev, libboost-thread-dev, libboost-program-options-dev, libboost-date-time-dev, libboost-timer-dev, libboost-chrono-dev, libboost-regex-dev
|
||||
Description: Georgia Tech Smoothing and Mapping Library
|
||||
gtsam: Georgia Tech Smoothing and Mapping library for SLAM type applications
|
||||
|
|
@ -1,15 +0,0 @@
|
|||
Format: https://www.debian.org/doc/packaging-manuals/copyright-format/1.0/
|
||||
Upstream-Name: gtsam
|
||||
Source: https://bitbucket.org/gtborg/gtsam.git
|
||||
|
||||
Files: *
|
||||
Copyright: 2017, Frank Dellaert
|
||||
License: BSD
|
||||
|
||||
Files: gtsam/3rdparty/CCOLAMD/*
|
||||
Copyright: 2005-2011, Univ. of Florida. Authors: Timothy A. Davis, Sivasankaran Rajamanickam, and Stefan Larimore. Closely based on COLAMD by Davis, Stefan Larimore, in collaboration with Esmond Ng, and John Gilbert. http://www.cise.ufl.edu/research/sparse
|
||||
License: GNU LESSER GENERAL PUBLIC LICENSE
|
||||
|
||||
Files: gtsam/3rdparty/Eigen/*
|
||||
Copyright: 2017, Multiple Authors
|
||||
License: MPL2
|
||||
|
|
@ -1,29 +0,0 @@
|
|||
#!/usr/bin/make -f
|
||||
# See debhelper(7) (uncomment to enable)
|
||||
# output every command that modifies files on the build system.
|
||||
export DH_VERBOSE = 1
|
||||
|
||||
# Makefile target name for running unit tests:
|
||||
GTSAM_TEST_TARGET = check
|
||||
|
||||
# see FEATURE AREAS in dpkg-buildflags(1)
|
||||
#export DEB_BUILD_MAINT_OPTIONS = hardening=+all
|
||||
|
||||
# see ENVIRONMENT in dpkg-buildflags(1)
|
||||
# package maintainers to append CFLAGS
|
||||
#export DEB_CFLAGS_MAINT_APPEND = -Wall -pedantic
|
||||
# package maintainers to append LDFLAGS
|
||||
#export DEB_LDFLAGS_MAINT_APPEND = -Wl,--as-needed
|
||||
|
||||
%:
|
||||
dh $@ --parallel
|
||||
|
||||
# dh_make generated override targets
|
||||
# This is example for Cmake (See https://bugs.debian.org/641051 )
|
||||
override_dh_auto_configure:
|
||||
dh_auto_configure -- -DCMAKE_BUILD_TYPE=RelWithDebInfo -DCMAKE_INSTALL_PREFIX=/usr -DGTSAM_BUILD_EXAMPLES_ALWAYS=OFF -DGTSAM_BUILD_TESTS=ON -DGTSAM_BUILD_WRAP=OFF -DGTSAM_BUILD_DOCS=OFF -DGTSAM_INSTALL_CPPUNITLITE=OFF -DGTSAM_INSTALL_GEOGRAPHICLIB=OFF -DGTSAM_BUILD_TYPE_POSTFIXES=OFF -DGTSAM_BUILD_WITH_MARCH_NATIVE=OFF
|
||||
|
||||
override_dh_auto_test-arch:
|
||||
# Tests for arch-dependent :
|
||||
echo "[override_dh_auto_test-arch]"
|
||||
dh_auto_build -O--buildsystem=cmake -- $(GTSAM_TEST_TARGET)
|
||||
|
|
@ -1 +0,0 @@
|
|||
3.0 (quilt)
|
||||
|
|
@ -2291,15 +2291,11 @@ uncalibration
|
|||
used in the residual).
|
||||
\end_layout
|
||||
|
||||
\begin_layout Standard
|
||||
\begin_inset Note Note
|
||||
status collapsed
|
||||
|
||||
\begin_layout Section
|
||||
Noise models of prior factors
|
||||
\end_layout
|
||||
|
||||
\begin_layout Plain Layout
|
||||
\begin_layout Standard
|
||||
The simplest way to describe noise models is by an example.
|
||||
Let's take a prior factor on a 3D pose
|
||||
\begin_inset Formula $x\in\SE 3$
|
||||
|
|
@ -2353,7 +2349,7 @@ e\left(x\right)=\norm{h\left(x\right)}_{\Sigma}^{2}=h\left(x\right)^{\t}\Sigma^{
|
|||
useful answer out quickly ]
|
||||
\end_layout
|
||||
|
||||
\begin_layout Plain Layout
|
||||
\begin_layout Standard
|
||||
The density induced by a noise model on the prior factor is Gaussian in
|
||||
the tangent space about the linearization point.
|
||||
Suppose that the pose is linearized at
|
||||
|
|
@ -2431,7 +2427,7 @@ Here we see that the update
|
|||
.
|
||||
\end_layout
|
||||
|
||||
\begin_layout Plain Layout
|
||||
\begin_layout Standard
|
||||
This means that to draw random pose samples, we actually draw random samples
|
||||
of
|
||||
\begin_inset Formula $\delta x$
|
||||
|
|
@ -2456,7 +2452,7 @@ This means that to draw random pose samples, we actually draw random samples
|
|||
Noise models of between factors
|
||||
\end_layout
|
||||
|
||||
\begin_layout Plain Layout
|
||||
\begin_layout Standard
|
||||
The noise model of a BetweenFactor is a bit more complicated.
|
||||
The unwhitened error is
|
||||
\begin_inset Formula
|
||||
|
|
@ -2516,11 +2512,6 @@ e\left(\delta x_{1}\right) & \approx\norm{\log\left(z^{-1}\left(x_{1}\exp\delta
|
|||
\end_inset
|
||||
|
||||
|
||||
\end_layout
|
||||
|
||||
\end_inset
|
||||
|
||||
|
||||
\end_layout
|
||||
|
||||
\end_body
|
||||
|
|
|
|||
Binary file not shown.
52
gtsam.h
52
gtsam.h
|
|
@ -281,7 +281,7 @@ virtual class Value {
|
|||
};
|
||||
|
||||
#include <gtsam/base/GenericValue.h>
|
||||
template<T = {Vector, gtsam::Point2, gtsam::Point3, gtsam::Rot2, gtsam::Rot3, gtsam::Pose2, gtsam::Pose3, gtsam::StereoPoint2, gtsam::Cal3_S2, gtsam::CalibratedCamera, gtsam::SimpleCamera, gtsam::imuBias::ConstantBias}>
|
||||
template<T = {Vector, Matrix, gtsam::Point2, gtsam::Point3, gtsam::Rot2, gtsam::Rot3, gtsam::Pose2, gtsam::Pose3, gtsam::StereoPoint2, gtsam::Cal3_S2, gtsam::Cal3DS2, gtsam::Cal3Bundler, gtsam::EssentialMatrix, gtsam::CalibratedCamera, gtsam::SimpleCamera, gtsam::imuBias::ConstantBias}>
|
||||
virtual class GenericValue : gtsam::Value {
|
||||
void serializable() const;
|
||||
};
|
||||
|
|
@ -1977,6 +1977,35 @@ size_t symbol(char chr, size_t index);
|
|||
char symbolChr(size_t key);
|
||||
size_t symbolIndex(size_t key);
|
||||
|
||||
namespace symbol_shorthand {
|
||||
size_t A(size_t j);
|
||||
size_t B(size_t j);
|
||||
size_t C(size_t j);
|
||||
size_t D(size_t j);
|
||||
size_t E(size_t j);
|
||||
size_t F(size_t j);
|
||||
size_t G(size_t j);
|
||||
size_t H(size_t j);
|
||||
size_t I(size_t j);
|
||||
size_t J(size_t j);
|
||||
size_t K(size_t j);
|
||||
size_t L(size_t j);
|
||||
size_t M(size_t j);
|
||||
size_t N(size_t j);
|
||||
size_t O(size_t j);
|
||||
size_t P(size_t j);
|
||||
size_t Q(size_t j);
|
||||
size_t R(size_t j);
|
||||
size_t S(size_t j);
|
||||
size_t T(size_t j);
|
||||
size_t U(size_t j);
|
||||
size_t V(size_t j);
|
||||
size_t W(size_t j);
|
||||
size_t X(size_t j);
|
||||
size_t Y(size_t j);
|
||||
size_t Z(size_t j);
|
||||
}///\namespace symbol
|
||||
|
||||
// Default keyformatter
|
||||
void PrintKeyList (const gtsam::KeyList& keys);
|
||||
void PrintKeyList (const gtsam::KeyList& keys, string s);
|
||||
|
|
@ -2050,6 +2079,9 @@ class NonlinearFactorGraph {
|
|||
gtsam::KeySet keys() const;
|
||||
gtsam::KeyVector keyVector() const;
|
||||
|
||||
template<T = {Vector, gtsam::Point2, gtsam::StereoPoint2, gtsam::Point3, gtsam::Rot2, gtsam::SO3, gtsam::SO4, gtsam::Rot3, gtsam::Pose2, gtsam::Pose3, gtsam::Cal3_S2,gtsam::CalibratedCamera, gtsam::SimpleCamera, gtsam::PinholeCameraCal3_S2, gtsam::imuBias::ConstantBias}>
|
||||
void addPrior(size_t key, const T& prior, const gtsam::noiseModel::Base* noiseModel);
|
||||
|
||||
// NonlinearFactorGraph
|
||||
void printErrors(const gtsam::Values& values) const;
|
||||
double error(const gtsam::Values& values) const;
|
||||
|
|
@ -2138,6 +2170,7 @@ class Values {
|
|||
void insert(size_t j, const gtsam::EssentialMatrix& essential_matrix);
|
||||
void insert(size_t j, const gtsam::PinholeCameraCal3_S2& simple_camera);
|
||||
void insert(size_t j, const gtsam::imuBias::ConstantBias& constant_bias);
|
||||
void insert(size_t j, const gtsam::NavState& nav_state);
|
||||
void insert(size_t j, Vector vector);
|
||||
void insert(size_t j, Matrix matrix);
|
||||
|
||||
|
|
@ -2155,10 +2188,11 @@ class Values {
|
|||
void update(size_t j, const gtsam::Cal3Bundler& cal3bundler);
|
||||
void update(size_t j, const gtsam::EssentialMatrix& essential_matrix);
|
||||
void update(size_t j, const gtsam::imuBias::ConstantBias& constant_bias);
|
||||
void update(size_t j, const gtsam::NavState& nav_state);
|
||||
void update(size_t j, Vector vector);
|
||||
void update(size_t j, Matrix matrix);
|
||||
|
||||
template<T = {gtsam::Point2, gtsam::Point3, gtsam::Rot2, gtsam::Pose2, gtsam::SO3, gtsam::SO4, gtsam::SOn, gtsam::Rot3, gtsam::Pose3, gtsam::Cal3_S2, gtsam::Cal3DS2, gtsam::Cal3Bundler, gtsam::EssentialMatrix, gtsam::imuBias::ConstantBias, Vector, Matrix}>
|
||||
template<T = {gtsam::Point2, gtsam::Point3, gtsam::Rot2, gtsam::Pose2, gtsam::SO3, gtsam::SO4, gtsam::SOn, gtsam::Rot3, gtsam::Pose3, gtsam::Cal3_S2, gtsam::Cal3DS2, gtsam::Cal3Bundler, gtsam::EssentialMatrix, gtsam::imuBias::ConstantBias, gtsam::NavState, Vector, Matrix}>
|
||||
T at(size_t j);
|
||||
|
||||
/// version for double
|
||||
|
|
@ -2260,6 +2294,8 @@ virtual class NonlinearOptimizerParams {
|
|||
bool checkConvergence(double relativeErrorTreshold,
|
||||
double absoluteErrorTreshold, double errorThreshold,
|
||||
double currentError, double newError);
|
||||
bool checkConvergence(const gtsam::NonlinearOptimizerParams& params,
|
||||
double currentError, double newError);
|
||||
|
||||
#include <gtsam/nonlinear/GaussNewtonOptimizer.h>
|
||||
virtual class GaussNewtonParams : gtsam::NonlinearOptimizerParams {
|
||||
|
|
@ -2495,7 +2531,7 @@ class NonlinearISAM {
|
|||
#include <gtsam/geometry/StereoPoint2.h>
|
||||
|
||||
#include <gtsam/nonlinear/PriorFactor.h>
|
||||
template<T = {Vector, gtsam::Point2, gtsam::StereoPoint2, gtsam::Point3, gtsam::Rot2, gtsam::SO3, gtsam::SO4, gtsam::Rot3, gtsam::Pose2, gtsam::Pose3, gtsam::Cal3_S2,gtsam::CalibratedCamera, gtsam::SimpleCamera, gtsam::PinholeCameraCal3_S2, gtsam::imuBias::ConstantBias}>
|
||||
template<T = {Vector, gtsam::Point2, gtsam::StereoPoint2, gtsam::Point3, gtsam::Rot2, gtsam::SO3, gtsam::SO4, gtsam::SOn, gtsam::Rot3, gtsam::Pose2, gtsam::Pose3, gtsam::Cal3_S2,gtsam::CalibratedCamera, gtsam::SimpleCamera, gtsam::PinholeCameraCal3_S2, gtsam::imuBias::ConstantBias}>
|
||||
virtual class PriorFactor : gtsam::NoiseModelFactor {
|
||||
PriorFactor(size_t key, const T& prior, const gtsam::noiseModel::Base* noiseModel);
|
||||
T prior() const;
|
||||
|
|
@ -2518,7 +2554,7 @@ virtual class BetweenFactor : gtsam::NoiseModelFactor {
|
|||
|
||||
|
||||
#include <gtsam/nonlinear/NonlinearEquality.h>
|
||||
template<T = {gtsam::Point2, gtsam::StereoPoint2, gtsam::Point3, gtsam::Rot2, gtsam::SO3, gtsam::SO4, gtsam::Rot3, gtsam::Pose2, gtsam::Pose3, gtsam::Cal3_S2, gtsam::CalibratedCamera, gtsam::SimpleCamera, gtsam::PinholeCameraCal3_S2, gtsam::imuBias::ConstantBias}>
|
||||
template<T = {gtsam::Point2, gtsam::StereoPoint2, gtsam::Point3, gtsam::Rot2, gtsam::SO3, gtsam::SO4, gtsam::SOn, gtsam::Rot3, gtsam::Pose2, gtsam::Pose3, gtsam::Cal3_S2, gtsam::CalibratedCamera, gtsam::SimpleCamera, gtsam::PinholeCameraCal3_S2, gtsam::imuBias::ConstantBias}>
|
||||
virtual class NonlinearEquality : gtsam::NoiseModelFactor {
|
||||
// Constructor - forces exact evaluation
|
||||
NonlinearEquality(size_t j, const T& feasible);
|
||||
|
|
@ -2759,8 +2795,10 @@ void save2D(const gtsam::NonlinearFactorGraph& graph,
|
|||
// std::vector<gtsam::BetweenFactor<Pose3>::shared_ptr>
|
||||
class BetweenFactorPose3s
|
||||
{
|
||||
BetweenFactorPose3s();
|
||||
size_t size() const;
|
||||
gtsam::BetweenFactorPose3* at(size_t i) const;
|
||||
void push_back(const gtsam::BetweenFactorPose3* factor);
|
||||
};
|
||||
|
||||
#include <gtsam/slam/InitializePose3.h>
|
||||
|
|
@ -2910,11 +2948,14 @@ class PreintegratedImuMeasurements {
|
|||
void integrateMeasurement(Vector measuredAcc, Vector measuredOmega,
|
||||
double deltaT);
|
||||
void resetIntegration();
|
||||
void resetIntegrationAndSetBias(const gtsam::imuBias::ConstantBias& biasHat);
|
||||
|
||||
Matrix preintMeasCov() const;
|
||||
double deltaTij() const;
|
||||
gtsam::Rot3 deltaRij() const;
|
||||
Vector deltaPij() const;
|
||||
Vector deltaVij() const;
|
||||
gtsam::imuBias::ConstantBias biasHat() const;
|
||||
Vector biasHatVector() const;
|
||||
gtsam::NavState predict(const gtsam::NavState& state_i,
|
||||
const gtsam::imuBias::ConstantBias& bias) const;
|
||||
|
|
@ -2969,11 +3010,14 @@ class PreintegratedCombinedMeasurements {
|
|||
void integrateMeasurement(Vector measuredAcc, Vector measuredOmega,
|
||||
double deltaT);
|
||||
void resetIntegration();
|
||||
void resetIntegrationAndSetBias(const gtsam::imuBias::ConstantBias& biasHat);
|
||||
|
||||
Matrix preintMeasCov() const;
|
||||
double deltaTij() const;
|
||||
gtsam::Rot3 deltaRij() const;
|
||||
Vector deltaPij() const;
|
||||
Vector deltaVij() const;
|
||||
gtsam::imuBias::ConstantBias biasHat() const;
|
||||
Vector biasHatVector() const;
|
||||
gtsam::NavState predict(const gtsam::NavState& state_i,
|
||||
const gtsam::imuBias::ConstantBias& bias) const;
|
||||
|
|
|
|||
|
|
@ -1,6 +1,6 @@
|
|||
# install CCOLAMD headers
|
||||
install(FILES CCOLAMD/Include/ccolamd.h DESTINATION include/gtsam/3rdparty/CCOLAMD)
|
||||
install(FILES SuiteSparse_config/SuiteSparse_config.h DESTINATION include/gtsam/3rdparty/SuiteSparse_config)
|
||||
install(FILES CCOLAMD/Include/ccolamd.h DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}/gtsam/3rdparty/CCOLAMD)
|
||||
install(FILES SuiteSparse_config/SuiteSparse_config.h DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}/gtsam/3rdparty/SuiteSparse_config)
|
||||
|
||||
if(NOT GTSAM_USE_SYSTEM_EIGEN)
|
||||
# Find plain .h files
|
||||
|
|
@ -12,12 +12,12 @@ if(NOT GTSAM_USE_SYSTEM_EIGEN)
|
|||
get_filename_component(filename ${eigen_dir} NAME)
|
||||
if (NOT ((${filename} MATCHES "CMakeLists.txt") OR (${filename} MATCHES "src") OR (${filename} MATCHES ".svn")))
|
||||
list(APPEND eigen_headers "${CMAKE_CURRENT_SOURCE_DIR}/Eigen/Eigen/${filename}")
|
||||
install(FILES Eigen/Eigen/${filename} DESTINATION include/gtsam/3rdparty/Eigen/Eigen)
|
||||
install(FILES Eigen/Eigen/${filename} DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}/gtsam/3rdparty/Eigen/Eigen)
|
||||
endif()
|
||||
endforeach(eigen_dir)
|
||||
|
||||
if(GTSAM_WITH_EIGEN_UNSUPPORTED)
|
||||
message("-- Installing Eigen Unsupported modules")
|
||||
message(STATUS "Installing Eigen Unsupported modules")
|
||||
# do the same for the unsupported eigen folder
|
||||
file(GLOB_RECURSE unsupported_eigen_headers "${CMAKE_CURRENT_SOURCE_DIR}/Eigen/unsupported/Eigen/*.h")
|
||||
|
||||
|
|
@ -26,7 +26,7 @@ if(NOT GTSAM_USE_SYSTEM_EIGEN)
|
|||
get_filename_component(filename ${unsupported_eigen_dir} NAME)
|
||||
if (NOT ((${filename} MATCHES "CMakeLists.txt") OR (${filename} MATCHES "src") OR (${filename} MATCHES "CXX11") OR (${filename} MATCHES ".svn")))
|
||||
list(APPEND unsupported_eigen_headers "${CMAKE_CURRENT_SOURCE_DIR}/Eigen/unsupported/Eigen/${filename}")
|
||||
install(FILES Eigen/unsupported/Eigen/${filename} DESTINATION include/gtsam/3rdparty/Eigen/unsupported/Eigen)
|
||||
install(FILES Eigen/unsupported/Eigen/${filename} DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}/gtsam/3rdparty/Eigen/unsupported/Eigen)
|
||||
endif()
|
||||
endforeach(unsupported_eigen_dir)
|
||||
endif()
|
||||
|
|
@ -37,12 +37,12 @@ if(NOT GTSAM_USE_SYSTEM_EIGEN)
|
|||
|
||||
# install Eigen - only the headers in our 3rdparty directory
|
||||
install(DIRECTORY Eigen/Eigen
|
||||
DESTINATION include/gtsam/3rdparty/Eigen
|
||||
DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}/gtsam/3rdparty/Eigen
|
||||
FILES_MATCHING PATTERN "*.h")
|
||||
|
||||
if(GTSAM_WITH_EIGEN_UNSUPPORTED)
|
||||
install(DIRECTORY Eigen/unsupported/Eigen
|
||||
DESTINATION include/gtsam/3rdparty/Eigen/unsupported/
|
||||
DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}/gtsam/3rdparty/Eigen/unsupported/
|
||||
FILES_MATCHING PATTERN "*.h")
|
||||
endif()
|
||||
|
||||
|
|
|
|||
|
|
@ -39,9 +39,9 @@ endif()
|
|||
add_dependencies(blas eigen_blas eigen_blas_static)
|
||||
|
||||
install(TARGETS eigen_blas eigen_blas_static
|
||||
RUNTIME DESTINATION bin
|
||||
LIBRARY DESTINATION lib
|
||||
ARCHIVE DESTINATION lib)
|
||||
RUNTIME DESTINATION ${CMAKE_INSTALL_BINDIR}
|
||||
LIBRARY DESTINATION ${CMAKE_INSTALL_LIBDIR}
|
||||
ARCHIVE DESTINATION ${CMAKE_INSTALL_LIBDIR})
|
||||
|
||||
if(EIGEN_Fortran_COMPILER_WORKS)
|
||||
|
||||
|
|
|
|||
|
|
@ -103,9 +103,9 @@ endif()
|
|||
add_dependencies(lapack eigen_lapack eigen_lapack_static)
|
||||
|
||||
install(TARGETS eigen_lapack eigen_lapack_static
|
||||
RUNTIME DESTINATION bin
|
||||
LIBRARY DESTINATION lib
|
||||
ARCHIVE DESTINATION lib)
|
||||
RUNTIME DESTINATION ${CMAKE_INSTALL_BINDIR}
|
||||
LIBRARY DESTINATION ${CMAKE_INSTALL_LIBDIR}
|
||||
ARCHIVE DESTINATION ${CMAKE_INSTALL_LIBDIR})
|
||||
|
||||
|
||||
|
||||
|
|
|
|||
|
|
@ -16,6 +16,6 @@ include_directories("test")
|
|||
add_subdirectory("test")
|
||||
|
||||
install(TARGETS GKlib
|
||||
ARCHIVE DESTINATION lib
|
||||
LIBRARY DESTINATION lib)
|
||||
install(FILES ${GKlib_includes} DESTINATION include)
|
||||
ARCHIVE DESTINATION ${CMAKE_INSTALL_LIBDIR}
|
||||
LIBRARY DESTINATION ${CMAKE_INSTALL_LIBDIR})
|
||||
install(FILES ${GKlib_includes} DESTINATION ${CMAKE_INSTALL_INCLUDEDIR})
|
||||
|
|
|
|||
|
|
@ -4,23 +4,26 @@ include_directories(.)
|
|||
file(GLOB metis_sources *.c)
|
||||
# Build libmetis.
|
||||
add_definitions(-fPIC)
|
||||
add_library(metis ${METIS_LIBRARY_TYPE} ${GKlib_sources} ${metis_sources})
|
||||
add_library(metis-gtsam ${METIS_LIBRARY_TYPE} ${GKlib_sources} ${metis_sources})
|
||||
if(UNIX)
|
||||
target_link_libraries(metis m)
|
||||
target_link_libraries(metis-gtsam m)
|
||||
endif()
|
||||
|
||||
if(WIN32)
|
||||
set_target_properties(metis PROPERTIES
|
||||
set_target_properties(metis-gtsam PROPERTIES
|
||||
PREFIX ""
|
||||
RUNTIME_OUTPUT_DIRECTORY "${PROJECT_BINARY_DIR}/../../../bin")
|
||||
endif()
|
||||
|
||||
if (APPLE)
|
||||
set_target_properties(metis PROPERTIES
|
||||
set_target_properties(metis-gtsam PROPERTIES
|
||||
INSTALL_NAME_DIR
|
||||
"${CMAKE_INSTALL_PREFIX}/lib")
|
||||
endif()
|
||||
|
||||
install(TARGETS metis EXPORT GTSAM-exports LIBRARY DESTINATION lib ARCHIVE DESTINATION lib RUNTIME DESTINATION bin)
|
||||
list(APPEND GTSAM_EXPORTED_TARGETS metis)
|
||||
install(TARGETS metis-gtsam EXPORT GTSAM-exports
|
||||
LIBRARY DESTINATION ${CMAKE_INSTALL_LIBDIR}
|
||||
ARCHIVE DESTINATION ${CMAKE_INSTALL_LIBDIR}
|
||||
RUNTIME DESTINATION ${CMAKE_INSTALL_BINDIR})
|
||||
list(APPEND GTSAM_EXPORTED_TARGETS metis-gtsam)
|
||||
set(GTSAM_EXPORTED_TARGETS "${GTSAM_EXPORTED_TARGETS}" PARENT_SCOPE)
|
||||
|
|
|
|||
|
|
@ -15,7 +15,7 @@ endforeach(prog)
|
|||
|
||||
if(METIS_INSTALL)
|
||||
install(TARGETS gpmetis ndmetis mpmetis m2gmetis graphchk cmpfillin
|
||||
RUNTIME DESTINATION bin)
|
||||
RUNTIME DESTINATION ${CMAKE_INSTALL_BINDIR})
|
||||
endif()
|
||||
|
||||
# Try to find subversion revision.
|
||||
|
|
|
|||
|
|
@ -49,7 +49,7 @@ endif()
|
|||
|
||||
# Common headers
|
||||
file(GLOB gtsam_core_headers "*.h")
|
||||
install(FILES ${gtsam_core_headers} DESTINATION include/gtsam)
|
||||
install(FILES ${gtsam_core_headers} DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}/gtsam)
|
||||
|
||||
# assemble core libaries
|
||||
foreach(subdir ${gtsam_subdirs})
|
||||
|
|
@ -86,10 +86,10 @@ configure_file(config.h.in config.h)
|
|||
set(library_name GTSAM) # For substitution in dllexport.h.in
|
||||
configure_file("${GTSAM_SOURCE_DIR}/cmake/dllexport.h.in" "dllexport.h")
|
||||
list(APPEND gtsam_srcs "${PROJECT_BINARY_DIR}/config.h" "${PROJECT_BINARY_DIR}/dllexport.h")
|
||||
install(FILES "${PROJECT_BINARY_DIR}/config.h" "${PROJECT_BINARY_DIR}/dllexport.h" DESTINATION include/gtsam)
|
||||
install(FILES "${PROJECT_BINARY_DIR}/config.h" "${PROJECT_BINARY_DIR}/dllexport.h" DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}/gtsam)
|
||||
|
||||
if(GTSAM_SUPPORT_NESTED_DISSECTION)
|
||||
list(APPEND GTSAM_ADDITIONAL_LIBRARIES metis)
|
||||
list(APPEND GTSAM_ADDITIONAL_LIBRARIES metis-gtsam)
|
||||
endif()
|
||||
|
||||
# Versions
|
||||
|
|
@ -172,12 +172,16 @@ if(WIN32) # Add 'lib' prefix to static library to avoid filename collision with
|
|||
endif()
|
||||
endif()
|
||||
|
||||
if(WIN32) # library to help with demangling variable names on Windows
|
||||
target_link_libraries(gtsam PRIVATE Dbghelp)
|
||||
endif()
|
||||
|
||||
install(
|
||||
TARGETS gtsam
|
||||
EXPORT GTSAM-exports
|
||||
LIBRARY DESTINATION lib
|
||||
ARCHIVE DESTINATION lib
|
||||
RUNTIME DESTINATION bin)
|
||||
LIBRARY DESTINATION ${CMAKE_INSTALL_LIBDIR}
|
||||
ARCHIVE DESTINATION ${CMAKE_INSTALL_LIBDIR}
|
||||
RUNTIME DESTINATION ${CMAKE_INSTALL_BINDIR})
|
||||
|
||||
list(APPEND GTSAM_EXPORTED_TARGETS gtsam)
|
||||
set(GTSAM_EXPORTED_TARGETS "${GTSAM_EXPORTED_TARGETS}" PARENT_SCOPE)
|
||||
|
|
|
|||
|
|
@ -20,6 +20,7 @@
|
|||
#pragma once
|
||||
|
||||
#include <gtsam/base/Manifold.h>
|
||||
#include <gtsam/base/types.h>
|
||||
#include <gtsam/base/Value.h>
|
||||
|
||||
#include <boost/make_shared.hpp>
|
||||
|
|
@ -83,7 +84,7 @@ public:
|
|||
|
||||
/// Virtual print function, uses traits
|
||||
virtual void print(const std::string& str) const {
|
||||
std::cout << "(" << typeid(T).name() << ") ";
|
||||
std::cout << "(" << demangle(typeid(T).name()) << ") ";
|
||||
traits<T>::Print(value_, str);
|
||||
}
|
||||
|
||||
|
|
@ -180,7 +181,7 @@ public:
|
|||
// Alignment, see https://eigen.tuxfamily.org/dox/group__TopicStructHavingEigenMembers.html
|
||||
enum { NeedsToAlign = (sizeof(T) % 16) == 0 };
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
||||
};
|
||||
|
||||
/// use this macro instead of BOOST_CLASS_EXPORT for GenericValues
|
||||
|
|
|
|||
|
|
@ -170,7 +170,7 @@ namespace internal {
|
|||
/// Assumes existence of: identity, dimension, localCoordinates, retract,
|
||||
/// and additionally Logmap, Expmap, compose, between, and inverse
|
||||
template<class Class>
|
||||
struct LieGroupTraits {
|
||||
struct LieGroupTraits: GetDimensionImpl<Class, Class::dimension> {
|
||||
typedef lie_group_tag structure_category;
|
||||
|
||||
/// @name Group
|
||||
|
|
@ -186,8 +186,6 @@ struct LieGroupTraits {
|
|||
typedef Eigen::Matrix<double, dimension, 1> TangentVector;
|
||||
typedef OptionalJacobian<dimension, dimension> ChartJacobian;
|
||||
|
||||
static int GetDimension(const Class&) {return dimension;}
|
||||
|
||||
static TangentVector Local(const Class& origin, const Class& other,
|
||||
ChartJacobian Horigin = boost::none, ChartJacobian Hother = boost::none) {
|
||||
return origin.localCoordinates(other, Horigin, Hother);
|
||||
|
|
|
|||
|
|
@ -72,7 +72,7 @@ struct HasManifoldPrereqs {
|
|||
|
||||
/// Extra manifold traits for fixed-dimension types
|
||||
template<class Class, int N>
|
||||
struct ManifoldImpl {
|
||||
struct GetDimensionImpl {
|
||||
// Compile-time dimensionality
|
||||
static int GetDimension(const Class&) {
|
||||
return N;
|
||||
|
|
@ -81,7 +81,7 @@ struct ManifoldImpl {
|
|||
|
||||
/// Extra manifold traits for variable-dimension types
|
||||
template<class Class>
|
||||
struct ManifoldImpl<Class, Eigen::Dynamic> {
|
||||
struct GetDimensionImpl<Class, Eigen::Dynamic> {
|
||||
// Run-time dimensionality
|
||||
static int GetDimension(const Class& m) {
|
||||
return m.dim();
|
||||
|
|
@ -92,7 +92,7 @@ struct ManifoldImpl<Class, Eigen::Dynamic> {
|
|||
/// To use this for your class type, define:
|
||||
/// template<> struct traits<Class> : public internal::ManifoldTraits<Class> { };
|
||||
template<class Class>
|
||||
struct ManifoldTraits: ManifoldImpl<Class, Class::dimension> {
|
||||
struct ManifoldTraits: GetDimensionImpl<Class, Class::dimension> {
|
||||
|
||||
// Check that Class has the necessary machinery
|
||||
BOOST_CONCEPT_ASSERT((HasManifoldPrereqs<Class>));
|
||||
|
|
@ -214,7 +214,7 @@ public:
|
|||
enum { NeedsToAlign = (sizeof(M1) % 16) == 0 || (sizeof(M2) % 16) == 0
|
||||
};
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
||||
};
|
||||
|
||||
// Define any direct product group to be a model of the multiplicative Group concept
|
||||
|
|
|
|||
|
|
@ -416,4 +416,3 @@ namespace gtsam {
|
|||
class CholeskyFailed;
|
||||
|
||||
}
|
||||
|
||||
|
|
|
|||
|
|
@ -0,0 +1,67 @@
|
|||
/* ----------------------------------------------------------------------------
|
||||
|
||||
* GTSAM Copyright 2020, Georgia Tech Research Corporation,
|
||||
* Atlanta, Georgia 30332-0415
|
||||
* All Rights Reserved
|
||||
* Authors: Frank Dellaert, et al. (see THANKS for the full author list)
|
||||
|
||||
* See LICENSE for the license information
|
||||
|
||||
* -------------------------------------------------------------------------- */
|
||||
|
||||
/**
|
||||
* @file make_shared.h
|
||||
* @brief make_shared trampoline function to ensure proper alignment
|
||||
* @author Fan Jiang
|
||||
*/
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <gtsam/base/types.h>
|
||||
|
||||
#include <Eigen/Core>
|
||||
|
||||
#include <boost/make_shared.hpp>
|
||||
|
||||
#include <type_traits>
|
||||
|
||||
namespace gtsam {
|
||||
/// An shorthand alias for accessing the ::type inside std::enable_if that can be used in a template directly
|
||||
template<bool B, class T = void>
|
||||
using enable_if_t = typename std::enable_if<B, T>::type;
|
||||
}
|
||||
|
||||
namespace gtsam {
|
||||
|
||||
/**
|
||||
* Add our own `make_shared` as a layer of wrapping on `boost::make_shared`
|
||||
* This solves the problem with the stock `make_shared` that custom alignment is not respected, causing SEGFAULTs
|
||||
* at runtime, which is notoriously hard to debug.
|
||||
*
|
||||
* Explanation
|
||||
* ===============
|
||||
* The template `needs_eigen_aligned_allocator<T>::value` will evaluate to `std::true_type` if the type alias
|
||||
* `_eigen_aligned_allocator_trait = void` is present in a class, which is automatically added by the
|
||||
* `GTSAM_MAKE_ALIGNED_OPERATOR_NEW` macro.
|
||||
*
|
||||
* This function declaration will only be taken when the above condition is true, so if some object does not need to
|
||||
* be aligned, `gtsam::make_shared` will fall back to the next definition, which is a simple wrapper for
|
||||
* `boost::make_shared`.
|
||||
*
|
||||
* @tparam T The type of object being constructed
|
||||
* @tparam Args Type of the arguments of the constructor
|
||||
* @param args Arguments of the constructor
|
||||
* @return The object created as a boost::shared_ptr<T>
|
||||
*/
|
||||
template<typename T, typename ... Args>
|
||||
gtsam::enable_if_t<needs_eigen_aligned_allocator<T>::value, boost::shared_ptr<T>> make_shared(Args &&... args) {
|
||||
return boost::allocate_shared<T>(Eigen::aligned_allocator<T>(), std::forward<Args>(args)...);
|
||||
}
|
||||
|
||||
/// Fall back to the boost version if no need for alignment
|
||||
template<typename T, typename ... Args>
|
||||
gtsam::enable_if_t<!needs_eigen_aligned_allocator<T>::value, boost::shared_ptr<T>> make_shared(Args &&... args) {
|
||||
return boost::make_shared<T>(std::forward<Args>(args)...);
|
||||
}
|
||||
|
||||
}
|
||||
|
|
@ -42,123 +42,218 @@
|
|||
|
||||
namespace gtsam {
|
||||
|
||||
// Serialization directly to strings in compressed format
|
||||
/** @name Standard serialization
|
||||
* Serialization in default compressed format
|
||||
*/
|
||||
///@{
|
||||
/// serializes to a stream
|
||||
template <class T>
|
||||
std::string serialize(const T& input) {
|
||||
std::ostringstream out_archive_stream;
|
||||
void serializeToStream(const T& input, std::ostream& out_archive_stream) {
|
||||
boost::archive::text_oarchive out_archive(out_archive_stream);
|
||||
out_archive << input;
|
||||
return out_archive_stream.str();
|
||||
}
|
||||
|
||||
/// deserializes from a stream
|
||||
template <class T>
|
||||
void deserialize(const std::string& serialized, T& output) {
|
||||
std::istringstream in_archive_stream(serialized);
|
||||
void deserializeFromStream(std::istream& in_archive_stream, T& output) {
|
||||
boost::archive::text_iarchive in_archive(in_archive_stream);
|
||||
in_archive >> output;
|
||||
}
|
||||
|
||||
/// serializes to a string
|
||||
template <class T>
|
||||
std::string serializeToString(const T& input) {
|
||||
std::ostringstream out_archive_stream;
|
||||
serializeToStream(input, out_archive_stream);
|
||||
return out_archive_stream.str();
|
||||
}
|
||||
|
||||
/// deserializes from a string
|
||||
template <class T>
|
||||
void deserializeFromString(const std::string& serialized, T& output) {
|
||||
std::istringstream in_archive_stream(serialized);
|
||||
deserializeFromStream(in_archive_stream, output);
|
||||
}
|
||||
|
||||
/// serializes to a file
|
||||
template <class T>
|
||||
bool serializeToFile(const T& input, const std::string& filename) {
|
||||
std::ofstream out_archive_stream(filename.c_str());
|
||||
if (!out_archive_stream.is_open())
|
||||
return false;
|
||||
boost::archive::text_oarchive out_archive(out_archive_stream);
|
||||
out_archive << input;
|
||||
if (!out_archive_stream.is_open()) return false;
|
||||
serializeToStream(input, out_archive_stream);
|
||||
out_archive_stream.close();
|
||||
return true;
|
||||
}
|
||||
|
||||
/// deserializes from a file
|
||||
template <class T>
|
||||
bool deserializeFromFile(const std::string& filename, T& output) {
|
||||
std::ifstream in_archive_stream(filename.c_str());
|
||||
if (!in_archive_stream.is_open())
|
||||
return false;
|
||||
boost::archive::text_iarchive in_archive(in_archive_stream);
|
||||
in_archive >> output;
|
||||
if (!in_archive_stream.is_open()) return false;
|
||||
deserializeFromStream(in_archive_stream, output);
|
||||
in_archive_stream.close();
|
||||
return true;
|
||||
}
|
||||
|
||||
// Serialization to XML format with named structures
|
||||
/// serializes to a string
|
||||
template <class T>
|
||||
std::string serializeXML(const T& input, const std::string& name="data") {
|
||||
std::ostringstream out_archive_stream;
|
||||
// braces to flush out_archive as it goes out of scope before taking str()
|
||||
// fixes crash with boost 1.66-1.68
|
||||
// see https://github.com/boostorg/serialization/issues/82
|
||||
{
|
||||
std::string serialize(const T& input) {
|
||||
return serializeToString(input);
|
||||
}
|
||||
|
||||
/// deserializes from a string
|
||||
template <class T>
|
||||
void deserialize(const std::string& serialized, T& output) {
|
||||
deserializeFromString(serialized, output);
|
||||
}
|
||||
///@}
|
||||
|
||||
/** @name XML Serialization
|
||||
* Serialization to XML format with named structures
|
||||
*/
|
||||
///@{
|
||||
/// serializes to a stream in XML
|
||||
template <class T>
|
||||
void serializeToXMLStream(const T& input, std::ostream& out_archive_stream,
|
||||
const std::string& name = "data") {
|
||||
boost::archive::xml_oarchive out_archive(out_archive_stream);
|
||||
out_archive << boost::serialization::make_nvp(name.c_str(), input);
|
||||
}
|
||||
return out_archive_stream.str();
|
||||
}
|
||||
|
||||
/// deserializes from a stream in XML
|
||||
template <class T>
|
||||
void deserializeXML(const std::string& serialized, T& output, const std::string& name="data") {
|
||||
std::istringstream in_archive_stream(serialized);
|
||||
void deserializeFromXMLStream(std::istream& in_archive_stream, T& output,
|
||||
const std::string& name = "data") {
|
||||
boost::archive::xml_iarchive in_archive(in_archive_stream);
|
||||
in_archive >> boost::serialization::make_nvp(name.c_str(), output);
|
||||
}
|
||||
|
||||
/// serializes to a string in XML
|
||||
template <class T>
|
||||
bool serializeToXMLFile(const T& input, const std::string& filename, const std::string& name="data") {
|
||||
std::ofstream out_archive_stream(filename.c_str());
|
||||
if (!out_archive_stream.is_open())
|
||||
return false;
|
||||
boost::archive::xml_oarchive out_archive(out_archive_stream);
|
||||
out_archive << boost::serialization::make_nvp(name.c_str(), input);;
|
||||
out_archive_stream.close();
|
||||
return true;
|
||||
}
|
||||
|
||||
template<class T>
|
||||
bool deserializeFromXMLFile(const std::string& filename, T& output, const std::string& name="data") {
|
||||
std::ifstream in_archive_stream(filename.c_str());
|
||||
if (!in_archive_stream.is_open())
|
||||
return false;
|
||||
boost::archive::xml_iarchive in_archive(in_archive_stream);
|
||||
in_archive >> boost::serialization::make_nvp(name.c_str(), output);
|
||||
in_archive_stream.close();
|
||||
return true;
|
||||
}
|
||||
|
||||
// Serialization to binary format with named structures
|
||||
template<class T>
|
||||
std::string serializeBinary(const T& input, const std::string& name="data") {
|
||||
std::string serializeToXMLString(const T& input,
|
||||
const std::string& name = "data") {
|
||||
std::ostringstream out_archive_stream;
|
||||
boost::archive::binary_oarchive out_archive(out_archive_stream);
|
||||
out_archive << boost::serialization::make_nvp(name.c_str(), input);
|
||||
serializeToXMLStream(input, out_archive_stream, name);
|
||||
return out_archive_stream.str();
|
||||
}
|
||||
|
||||
/// deserializes from a string in XML
|
||||
template <class T>
|
||||
void deserializeBinary(const std::string& serialized, T& output, const std::string& name="data") {
|
||||
void deserializeFromXMLString(const std::string& serialized, T& output,
|
||||
const std::string& name = "data") {
|
||||
std::istringstream in_archive_stream(serialized);
|
||||
boost::archive::binary_iarchive in_archive(in_archive_stream);
|
||||
in_archive >> boost::serialization::make_nvp(name.c_str(), output);
|
||||
deserializeFromXMLStream(in_archive_stream, output, name);
|
||||
}
|
||||
|
||||
/// serializes to an XML file
|
||||
template <class T>
|
||||
bool serializeToBinaryFile(const T& input, const std::string& filename, const std::string& name="data") {
|
||||
bool serializeToXMLFile(const T& input, const std::string& filename,
|
||||
const std::string& name = "data") {
|
||||
std::ofstream out_archive_stream(filename.c_str());
|
||||
if (!out_archive_stream.is_open())
|
||||
return false;
|
||||
boost::archive::binary_oarchive out_archive(out_archive_stream);
|
||||
out_archive << boost::serialization::make_nvp(name.c_str(), input);
|
||||
if (!out_archive_stream.is_open()) return false;
|
||||
serializeToXMLStream(input, out_archive_stream, name);
|
||||
out_archive_stream.close();
|
||||
return true;
|
||||
}
|
||||
|
||||
/// deserializes from an XML file
|
||||
template <class T>
|
||||
bool deserializeFromBinaryFile(const std::string& filename, T& output, const std::string& name="data") {
|
||||
bool deserializeFromXMLFile(const std::string& filename, T& output,
|
||||
const std::string& name = "data") {
|
||||
std::ifstream in_archive_stream(filename.c_str());
|
||||
if (!in_archive_stream.is_open())
|
||||
return false;
|
||||
boost::archive::binary_iarchive in_archive(in_archive_stream);
|
||||
in_archive >> boost::serialization::make_nvp(name.c_str(), output);
|
||||
if (!in_archive_stream.is_open()) return false;
|
||||
deserializeFromXMLStream(in_archive_stream, output, name);
|
||||
in_archive_stream.close();
|
||||
return true;
|
||||
}
|
||||
|
||||
} // \namespace gtsam
|
||||
/// serializes to a string in XML
|
||||
template <class T>
|
||||
std::string serializeXML(const T& input,
|
||||
const std::string& name = "data") {
|
||||
return serializeToXMLString(input, name);
|
||||
}
|
||||
|
||||
/// deserializes from a string in XML
|
||||
template <class T>
|
||||
void deserializeXML(const std::string& serialized, T& output,
|
||||
const std::string& name = "data") {
|
||||
deserializeFromXMLString(serialized, output, name);
|
||||
}
|
||||
///@}
|
||||
|
||||
/** @name Binary Serialization
|
||||
* Serialization to binary format with named structures
|
||||
*/
|
||||
///@{
|
||||
/// serializes to a stream in binary
|
||||
template <class T>
|
||||
void serializeToBinaryStream(const T& input, std::ostream& out_archive_stream,
|
||||
const std::string& name = "data") {
|
||||
boost::archive::binary_oarchive out_archive(out_archive_stream);
|
||||
out_archive << boost::serialization::make_nvp(name.c_str(), input);
|
||||
}
|
||||
|
||||
/// deserializes from a stream in binary
|
||||
template <class T>
|
||||
void deserializeFromBinaryStream(std::istream& in_archive_stream, T& output,
|
||||
const std::string& name = "data") {
|
||||
boost::archive::binary_iarchive in_archive(in_archive_stream);
|
||||
in_archive >> boost::serialization::make_nvp(name.c_str(), output);
|
||||
}
|
||||
|
||||
/// serializes to a string in binary
|
||||
template <class T>
|
||||
std::string serializeToBinaryString(const T& input,
|
||||
const std::string& name = "data") {
|
||||
std::ostringstream out_archive_stream;
|
||||
serializeToBinaryStream(input, out_archive_stream, name);
|
||||
return out_archive_stream.str();
|
||||
}
|
||||
|
||||
/// deserializes from a string in binary
|
||||
template <class T>
|
||||
void deserializeFromBinaryString(const std::string& serialized, T& output,
|
||||
const std::string& name = "data") {
|
||||
std::istringstream in_archive_stream(serialized);
|
||||
deserializeFromBinaryStream(in_archive_stream, output, name);
|
||||
}
|
||||
|
||||
/// serializes to a binary file
|
||||
template <class T>
|
||||
bool serializeToBinaryFile(const T& input, const std::string& filename,
|
||||
const std::string& name = "data") {
|
||||
std::ofstream out_archive_stream(filename.c_str());
|
||||
if (!out_archive_stream.is_open()) return false;
|
||||
serializeToBinaryStream(input, out_archive_stream, name);
|
||||
out_archive_stream.close();
|
||||
return true;
|
||||
}
|
||||
|
||||
/// deserializes from a binary file
|
||||
template <class T>
|
||||
bool deserializeFromBinaryFile(const std::string& filename, T& output,
|
||||
const std::string& name = "data") {
|
||||
std::ifstream in_archive_stream(filename.c_str());
|
||||
if (!in_archive_stream.is_open()) return false;
|
||||
deserializeFromBinaryStream(in_archive_stream, output, name);
|
||||
in_archive_stream.close();
|
||||
return true;
|
||||
}
|
||||
|
||||
/// serializes to a string in binary
|
||||
template <class T>
|
||||
std::string serializeBinary(const T& input,
|
||||
const std::string& name = "data") {
|
||||
return serializeToBinaryString(input, name);
|
||||
}
|
||||
|
||||
/// deserializes from a string in binary
|
||||
template <class T>
|
||||
void deserializeBinary(const std::string& serialized, T& output,
|
||||
const std::string& name = "data") {
|
||||
deserializeFromBinaryString(serialized, output, name);
|
||||
}
|
||||
///@}
|
||||
|
||||
} // namespace gtsam
|
||||
|
|
|
|||
|
|
@ -26,6 +26,7 @@
|
|||
#include <gtsam/base/serialization.h>
|
||||
|
||||
#include <boost/serialization/serialization.hpp>
|
||||
#include <boost/filesystem.hpp>
|
||||
|
||||
|
||||
// whether to print the serialized text to stdout
|
||||
|
|
@ -40,22 +41,37 @@ T create() {
|
|||
return T();
|
||||
}
|
||||
|
||||
// Creates or empties a folder in the build folder and returns the relative path
|
||||
boost::filesystem::path resetFilesystem(
|
||||
boost::filesystem::path folder = "actual") {
|
||||
boost::filesystem::remove_all(folder);
|
||||
boost::filesystem::create_directory(folder);
|
||||
return folder;
|
||||
}
|
||||
|
||||
// Templated round-trip serialization
|
||||
template<class T>
|
||||
void roundtrip(const T& input, T& output) {
|
||||
// Serialize
|
||||
std::string serialized = serialize(input);
|
||||
if (verbose) std::cout << serialized << std::endl << std::endl;
|
||||
|
||||
deserialize(serialized, output);
|
||||
}
|
||||
|
||||
// This version requires equality operator
|
||||
// Templated round-trip serialization using a file
|
||||
template<class T>
|
||||
void roundtripFile(const T& input, T& output) {
|
||||
boost::filesystem::path path = resetFilesystem()/"graph.dat";
|
||||
serializeToFile(input, path.string());
|
||||
deserializeFromFile(path.string(), output);
|
||||
}
|
||||
|
||||
// This version requires equality operator and uses string and file round-trips
|
||||
template<class T>
|
||||
bool equality(const T& input = T()) {
|
||||
T output = create<T>();
|
||||
T output = create<T>(), outputf = create<T>();
|
||||
roundtrip<T>(input,output);
|
||||
return input==output;
|
||||
roundtripFile<T>(input,outputf);
|
||||
return (input==output) && (input==outputf);
|
||||
}
|
||||
|
||||
// This version requires Testable
|
||||
|
|
@ -77,20 +93,26 @@ bool equalsDereferenced(const T& input) {
|
|||
// Templated round-trip serialization using XML
|
||||
template<class T>
|
||||
void roundtripXML(const T& input, T& output) {
|
||||
// Serialize
|
||||
std::string serialized = serializeXML<T>(input);
|
||||
if (verbose) std::cout << serialized << std::endl << std::endl;
|
||||
|
||||
// De-serialize
|
||||
deserializeXML(serialized, output);
|
||||
}
|
||||
|
||||
// Templated round-trip serialization using XML File
|
||||
template<class T>
|
||||
void roundtripXMLFile(const T& input, T& output) {
|
||||
boost::filesystem::path path = resetFilesystem()/"graph.xml";
|
||||
serializeToXMLFile(input, path.string());
|
||||
deserializeFromXMLFile(path.string(), output);
|
||||
}
|
||||
|
||||
// This version requires equality operator
|
||||
template<class T>
|
||||
bool equalityXML(const T& input = T()) {
|
||||
T output = create<T>();
|
||||
T output = create<T>(), outputf = create<T>();
|
||||
roundtripXML<T>(input,output);
|
||||
return input==output;
|
||||
roundtripXMLFile<T>(input,outputf);
|
||||
return (input==output) && (input==outputf);
|
||||
}
|
||||
|
||||
// This version requires Testable
|
||||
|
|
@ -112,20 +134,26 @@ bool equalsDereferencedXML(const T& input = T()) {
|
|||
// Templated round-trip serialization using XML
|
||||
template<class T>
|
||||
void roundtripBinary(const T& input, T& output) {
|
||||
// Serialize
|
||||
std::string serialized = serializeBinary<T>(input);
|
||||
if (verbose) std::cout << serialized << std::endl << std::endl;
|
||||
|
||||
// De-serialize
|
||||
deserializeBinary(serialized, output);
|
||||
}
|
||||
|
||||
// Templated round-trip serialization using Binary file
|
||||
template<class T>
|
||||
void roundtripBinaryFile(const T& input, T& output) {
|
||||
boost::filesystem::path path = resetFilesystem()/"graph.bin";
|
||||
serializeToBinaryFile(input, path.string());
|
||||
deserializeFromBinaryFile(path.string(), output);
|
||||
}
|
||||
|
||||
// This version requires equality operator
|
||||
template<class T>
|
||||
bool equalityBinary(const T& input = T()) {
|
||||
T output = create<T>();
|
||||
T output = create<T>(), outputf = create<T>();
|
||||
roundtripBinary<T>(input,output);
|
||||
return input==output;
|
||||
roundtripBinaryFile<T>(input,outputf);
|
||||
return (input==output) && (input==outputf);
|
||||
}
|
||||
|
||||
// This version requires Testable
|
||||
|
|
|
|||
|
|
@ -32,28 +32,6 @@ namespace gtsam {
|
|||
|
||||
namespace internal {
|
||||
|
||||
/* ************************************************************************* */
|
||||
template<typename NODE, typename DATA, typename VISITOR_POST>
|
||||
class PostOrderTask : public tbb::task
|
||||
{
|
||||
public:
|
||||
const boost::shared_ptr<NODE>& treeNode;
|
||||
boost::shared_ptr<DATA> myData;
|
||||
VISITOR_POST& visitorPost;
|
||||
|
||||
PostOrderTask(const boost::shared_ptr<NODE>& treeNode,
|
||||
const boost::shared_ptr<DATA>& myData, VISITOR_POST& visitorPost)
|
||||
: treeNode(treeNode), myData(myData), visitorPost(visitorPost) {}
|
||||
|
||||
tbb::task* execute()
|
||||
{
|
||||
// Run the post-order visitor
|
||||
(void) visitorPost(treeNode, *myData);
|
||||
|
||||
return nullptr;
|
||||
}
|
||||
};
|
||||
|
||||
/* ************************************************************************* */
|
||||
template<typename NODE, typename DATA, typename VISITOR_PRE, typename VISITOR_POST>
|
||||
class PreOrderTask : public tbb::task
|
||||
|
|
|
|||
|
|
@ -0,0 +1,67 @@
|
|||
/* ----------------------------------------------------------------------------
|
||||
|
||||
* GTSAM Copyright 2010, Georgia Tech Research Corporation,
|
||||
* Atlanta, Georgia 30332-0415
|
||||
* All Rights Reserved
|
||||
* Authors: Frank Dellaert, et al. (see THANKS for the full author list)
|
||||
|
||||
* See LICENSE for the license information
|
||||
|
||||
* -------------------------------------------------------------------------- */
|
||||
|
||||
/**
|
||||
* @file types.cpp
|
||||
* @brief Functions for handling type information
|
||||
* @author Varun Agrawal
|
||||
* @date May 18, 2020
|
||||
* @addtogroup base
|
||||
*/
|
||||
|
||||
#include <gtsam/base/types.h>
|
||||
|
||||
#ifdef _WIN32
|
||||
#define WIN32_LEAN_AND_MEAN
|
||||
#include <windows.h>
|
||||
#include <DbgHelp.h>
|
||||
#endif
|
||||
|
||||
#ifdef __GNUG__
|
||||
#include <cstdlib>
|
||||
#include <cxxabi.h>
|
||||
#include <string>
|
||||
#endif
|
||||
|
||||
namespace gtsam {
|
||||
|
||||
/// Pretty print Value type name
|
||||
std::string demangle(const char* name) {
|
||||
// by default set to the original mangled name
|
||||
std::string demangled_name = std::string(name);
|
||||
|
||||
#ifdef __GNUG__
|
||||
// g++ version of demangle
|
||||
char* demangled = nullptr;
|
||||
int status = -1; // some arbitrary value to eliminate the compiler warning
|
||||
demangled = abi::__cxa_demangle(name, nullptr, nullptr, &status),
|
||||
|
||||
demangled_name = (status == 0) ? std::string(demangled) : std::string(name);
|
||||
|
||||
std::free(demangled);
|
||||
|
||||
#elif _WIN32
|
||||
char undecorated_name[1024];
|
||||
|
||||
if (UnDecorateSymbolName(
|
||||
name, undecorated_name, sizeof(undecorated_name),
|
||||
UNDNAME_COMPLETE))
|
||||
{
|
||||
// successful conversion, take value from: undecorated_name
|
||||
demangled_name = std::string(undecorated_name);
|
||||
}
|
||||
// else keep using mangled name
|
||||
#endif
|
||||
|
||||
return demangled_name;
|
||||
}
|
||||
|
||||
} /* namespace gtsam */
|
||||
|
|
@ -53,6 +53,9 @@
|
|||
|
||||
namespace gtsam {
|
||||
|
||||
/// Function to demangle type name of variable, e.g. demangle(typeid(x).name())
|
||||
std::string demangle(const char* name);
|
||||
|
||||
/// Integer nonlinear key type
|
||||
typedef std::uint64_t Key;
|
||||
|
||||
|
|
@ -227,3 +230,50 @@ namespace std {
|
|||
#ifdef ERROR
|
||||
#undef ERROR
|
||||
#endif
|
||||
|
||||
namespace gtsam {
|
||||
|
||||
/// Convenience void_t as we assume C++11, it will not conflict the std one in C++17 as this is in `gtsam::`
|
||||
template<typename ...> using void_t = void;
|
||||
|
||||
/**
|
||||
* A SFINAE trait to mark classes that need special alignment.
|
||||
*
|
||||
* This is required to make boost::make_shared and etc respect alignment, which is essential for the Python
|
||||
* wrappers to work properly.
|
||||
*
|
||||
* Explanation
|
||||
* =============
|
||||
* When a GTSAM type is not declared with the type alias `_eigen_aligned_allocator_trait = void`, the first template
|
||||
* will be taken so `needs_eigen_aligned_allocator` will be resolved to `std::false_type`.
|
||||
*
|
||||
* Otherwise, it will resolve to the second template, which will be resolved to `std::true_type`.
|
||||
*
|
||||
* Please refer to `gtsam/base/make_shared.h` for an example.
|
||||
*/
|
||||
template<typename, typename = void_t<>>
|
||||
struct needs_eigen_aligned_allocator : std::false_type {
|
||||
};
|
||||
template<typename T>
|
||||
struct needs_eigen_aligned_allocator<T, void_t<typename T::_eigen_aligned_allocator_trait>> : std::true_type {
|
||||
};
|
||||
|
||||
}
|
||||
|
||||
/**
|
||||
* This marks a GTSAM object to require alignment. With this macro an object will automatically be allocated in aligned
|
||||
* memory when one uses `gtsam::make_shared`. It reduces future misalignment problems that is hard to debug.
|
||||
* See https://eigen.tuxfamily.org/dox/group__DenseMatrixManipulation__Alignement.html for detailed explanation.
|
||||
*/
|
||||
#define GTSAM_MAKE_ALIGNED_OPERATOR_NEW \
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW \
|
||||
using _eigen_aligned_allocator_trait = void;
|
||||
|
||||
/**
|
||||
* This marks a GTSAM object to require alignment. With this macro an object will automatically be allocated in aligned
|
||||
* memory when one uses `gtsam::make_shared`. It reduces future misalignment problems that is hard to debug.
|
||||
* See https://eigen.tuxfamily.org/dox/group__DenseMatrixManipulation__Alignement.html for detailed explanation.
|
||||
*/
|
||||
#define GTSAM_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign) \
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign) \
|
||||
using _eigen_aligned_allocator_trait = void;
|
||||
|
|
|
|||
|
|
@ -42,6 +42,9 @@
|
|||
// Whether we are using TBB (if TBB was found and GTSAM_WITH_TBB is enabled in CMake)
|
||||
#cmakedefine GTSAM_USE_TBB
|
||||
|
||||
// Whether we are using a TBB version higher than 2020
|
||||
#cmakedefine TBB_GREATER_EQUAL_2020
|
||||
|
||||
// Whether we are using system-Eigen or our own patched version
|
||||
#cmakedefine GTSAM_USE_SYSTEM_EIGEN
|
||||
|
||||
|
|
|
|||
|
|
@ -162,7 +162,7 @@ private:
|
|||
NeedsToAlign = (sizeof(B) % 16) == 0 || (sizeof(R) % 16) == 0
|
||||
};
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
||||
};
|
||||
|
||||
// Declare this to be both Testable and a Manifold
|
||||
|
|
|
|||
|
|
@ -24,7 +24,7 @@
|
|||
namespace gtsam {
|
||||
|
||||
/* ************************************************************************* */
|
||||
Cal3Fisheye::Cal3Fisheye(const Vector& v)
|
||||
Cal3Fisheye::Cal3Fisheye(const Vector9& v)
|
||||
: fx_(v[0]),
|
||||
fy_(v[1]),
|
||||
s_(v[2]),
|
||||
|
|
@ -50,76 +50,73 @@ Matrix3 Cal3Fisheye::K() const {
|
|||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
static Matrix29 D2dcalibration(const double xd, const double yd,
|
||||
const double xi, const double yi,
|
||||
const double t3, const double t5,
|
||||
const double t7, const double t9, const double r,
|
||||
Matrix2& DK) {
|
||||
// order: fx, fy, s, u0, v0
|
||||
Matrix25 DR1;
|
||||
DR1 << xd, 0.0, yd, 1.0, 0.0, 0.0, yd, 0.0, 0.0, 1.0;
|
||||
|
||||
// order: k1, k2, k3, k4
|
||||
Matrix24 DR2;
|
||||
DR2 << t3 * xi, t5 * xi, t7 * xi, t9 * xi, t3 * yi, t5 * yi, t7 * yi, t9 * yi;
|
||||
DR2 /= r;
|
||||
Matrix29 D;
|
||||
D << DR1, DK * DR2;
|
||||
return D;
|
||||
double Cal3Fisheye::Scaling(double r) {
|
||||
static constexpr double threshold = 1e-8;
|
||||
if (r > threshold || r < -threshold) {
|
||||
return atan(r) / r;
|
||||
} else {
|
||||
// Taylor expansion close to 0
|
||||
double r2 = r * r, r4 = r2 * r2;
|
||||
return 1.0 - r2 / 3 + r4 / 5;
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
static Matrix2 D2dintrinsic(const double xi, const double yi, const double r,
|
||||
const double td, const double t, const double tt,
|
||||
const double t4, const double t6, const double t8,
|
||||
const double k1, const double k2, const double k3,
|
||||
const double k4, const Matrix2& DK) {
|
||||
const double dr_dxi = xi / sqrt(xi * xi + yi * yi);
|
||||
const double dr_dyi = yi / sqrt(xi * xi + yi * yi);
|
||||
const double dt_dr = 1 / (1 + r * r);
|
||||
const double dtd_dt =
|
||||
1 + 3 * k1 * tt + 5 * k2 * t4 + 7 * k3 * t6 + 9 * k4 * t8;
|
||||
const double dtd_dxi = dtd_dt * dt_dr * dr_dxi;
|
||||
const double dtd_dyi = dtd_dt * dt_dr * dr_dyi;
|
||||
|
||||
const double rinv = 1 / r;
|
||||
const double rrinv = 1 / (r * r);
|
||||
const double dxd_dxi =
|
||||
dtd_dxi * xi * rinv + td * rinv + td * xi * (-rrinv) * dr_dxi;
|
||||
const double dxd_dyi = dtd_dyi * xi * rinv - td * xi * rrinv * dr_dyi;
|
||||
const double dyd_dxi = dtd_dxi * yi * rinv - td * yi * rrinv * dr_dxi;
|
||||
const double dyd_dyi =
|
||||
dtd_dyi * yi * rinv + td * rinv + td * yi * (-rrinv) * dr_dyi;
|
||||
|
||||
Matrix2 DR;
|
||||
DR << dxd_dxi, dxd_dyi, dyd_dxi, dyd_dyi;
|
||||
|
||||
return DK * DR;
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
Point2 Cal3Fisheye::uncalibrate(const Point2& p, OptionalJacobian<2, 9> H1,
|
||||
OptionalJacobian<2, 2> H2) const {
|
||||
const double xi = p.x(), yi = p.y();
|
||||
const double r = sqrt(xi * xi + yi * yi);
|
||||
const double r2 = xi * xi + yi * yi, r = sqrt(r2);
|
||||
const double t = atan(r);
|
||||
const double tt = t * t, t4 = tt * tt, t6 = tt * t4, t8 = t4 * t4;
|
||||
const double td = t * (1 + k1_ * tt + k2_ * t4 + k3_ * t6 + k4_ * t8);
|
||||
const double td_o_r = r > 1e-8 ? td / r : 1;
|
||||
const double xd = td_o_r * xi, yd = td_o_r * yi;
|
||||
const double t2 = t * t, t4 = t2 * t2, t6 = t2 * t4, t8 = t4 * t4;
|
||||
Vector5 K, T;
|
||||
K << 1, k1_, k2_, k3_, k4_;
|
||||
T << 1, t2, t4, t6, t8;
|
||||
const double scaling = Scaling(r);
|
||||
const double s = scaling * K.dot(T);
|
||||
const double xd = s * xi, yd = s * yi;
|
||||
Point2 uv(fx_ * xd + s_ * yd + u0_, fy_ * yd + v0_);
|
||||
|
||||
Matrix2 DK;
|
||||
if (H1 || H2) DK << fx_, s_, 0.0, fy_;
|
||||
|
||||
// Derivative for calibration parameters (2 by 9)
|
||||
if (H1)
|
||||
*H1 = D2dcalibration(xd, yd, xi, yi, t * tt, t * t4, t * t6, t * t8, r, DK);
|
||||
if (H1) {
|
||||
Matrix25 DR1;
|
||||
// order: fx, fy, s, u0, v0
|
||||
DR1 << xd, 0.0, yd, 1.0, 0.0, 0.0, yd, 0.0, 0.0, 1.0;
|
||||
|
||||
// order: k1, k2, k3, k4
|
||||
Matrix24 DR2;
|
||||
auto T4 = T.tail<4>().transpose();
|
||||
DR2 << xi * T4, yi * T4;
|
||||
*H1 << DR1, DK * scaling * DR2;
|
||||
}
|
||||
|
||||
// Derivative for points in intrinsic coords (2 by 2)
|
||||
if (H2)
|
||||
*H2 =
|
||||
D2dintrinsic(xi, yi, r, td, t, tt, t4, t6, t8, k1_, k2_, k3_, k4_, DK);
|
||||
if (H2) {
|
||||
const double dtd_dt =
|
||||
1 + 3 * k1_ * t2 + 5 * k2_ * t4 + 7 * k3_ * t6 + 9 * k4_ * t8;
|
||||
const double dt_dr = 1 / (1 + r2);
|
||||
const double rinv = 1 / r;
|
||||
const double dr_dxi = xi * rinv;
|
||||
const double dr_dyi = yi * rinv;
|
||||
const double dtd_dxi = dtd_dt * dt_dr * dr_dxi;
|
||||
const double dtd_dyi = dtd_dt * dt_dr * dr_dyi;
|
||||
|
||||
const double td = t * K.dot(T);
|
||||
const double rrinv = 1 / r2;
|
||||
const double dxd_dxi =
|
||||
dtd_dxi * dr_dxi + td * rinv - td * xi * rrinv * dr_dxi;
|
||||
const double dxd_dyi = dtd_dyi * dr_dxi - td * xi * rrinv * dr_dyi;
|
||||
const double dyd_dxi = dtd_dxi * dr_dyi - td * yi * rrinv * dr_dxi;
|
||||
const double dyd_dyi =
|
||||
dtd_dyi * dr_dyi + td * rinv - td * yi * rrinv * dr_dyi;
|
||||
|
||||
Matrix2 DR;
|
||||
DR << dxd_dxi, dxd_dyi, dyd_dxi, dyd_dyi;
|
||||
|
||||
*H2 = DK * DR;
|
||||
}
|
||||
|
||||
return uv;
|
||||
}
|
||||
|
|
@ -157,39 +154,10 @@ Point2 Cal3Fisheye::calibrate(const Point2& uv, const double tol) const {
|
|||
return pi;
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
Matrix2 Cal3Fisheye::D2d_intrinsic(const Point2& p) const {
|
||||
const double xi = p.x(), yi = p.y();
|
||||
const double r = sqrt(xi * xi + yi * yi);
|
||||
const double t = atan(r);
|
||||
const double tt = t * t, t4 = tt * tt, t6 = t4 * tt, t8 = t4 * t4;
|
||||
const double td = t * (1 + k1_ * tt + k2_ * t4 + k3_ * t6 + k4_ * t8);
|
||||
|
||||
Matrix2 DK;
|
||||
DK << fx_, s_, 0.0, fy_;
|
||||
|
||||
return D2dintrinsic(xi, yi, r, td, t, tt, t4, t6, t8, k1_, k2_, k3_, k4_, DK);
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
Matrix29 Cal3Fisheye::D2d_calibration(const Point2& p) const {
|
||||
const double xi = p.x(), yi = p.y();
|
||||
const double r = sqrt(xi * xi + yi * yi);
|
||||
const double t = atan(r);
|
||||
const double tt = t * t, t4 = tt * tt, t6 = tt * t4, t8 = t4 * t4;
|
||||
const double td = t * (1 + k1_ * tt + k2_ * t4 + k3_ * t6 + k4_ * t8);
|
||||
const double xd = td / r * xi, yd = td / r * yi;
|
||||
|
||||
Matrix2 DK;
|
||||
DK << fx_, s_, 0.0, fy_;
|
||||
return D2dcalibration(xd, yd, xi, yi, t * tt, t * t4, t * t6, t * t8, r, DK);
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
void Cal3Fisheye::print(const std::string& s_) const {
|
||||
gtsam::print((Matrix)K(), s_ + ".K");
|
||||
gtsam::print(Vector(k()), s_ + ".k");
|
||||
;
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
|
|
|
|||
|
|
@ -20,6 +20,8 @@
|
|||
|
||||
#include <gtsam/geometry/Point2.h>
|
||||
|
||||
#include <string>
|
||||
|
||||
namespace gtsam {
|
||||
|
||||
/**
|
||||
|
|
@ -43,7 +45,7 @@ namespace gtsam {
|
|||
* [u; v; 1] = K*[x_d; y_d; 1]
|
||||
*/
|
||||
class GTSAM_EXPORT Cal3Fisheye {
|
||||
protected:
|
||||
private:
|
||||
double fx_, fy_, s_, u0_, v0_; // focal length, skew and principal point
|
||||
double k1_, k2_, k3_, k4_; // fisheye distortion coefficients
|
||||
|
||||
|
|
@ -78,7 +80,7 @@ class GTSAM_EXPORT Cal3Fisheye {
|
|||
/// @name Advanced Constructors
|
||||
/// @{
|
||||
|
||||
Cal3Fisheye(const Vector& v);
|
||||
explicit Cal3Fisheye(const Vector9& v);
|
||||
|
||||
/// @}
|
||||
/// @name Standard Interface
|
||||
|
|
@ -120,6 +122,9 @@ class GTSAM_EXPORT Cal3Fisheye {
|
|||
/// Return all parameters as a vector
|
||||
Vector9 vector() const;
|
||||
|
||||
/// Helper function that calculates atan(r)/r
|
||||
static double Scaling(double r);
|
||||
|
||||
/**
|
||||
* @brief convert intrinsic coordinates [x_i; y_i] to (distorted) image
|
||||
* coordinates [u; v]
|
||||
|
|
@ -136,13 +141,6 @@ class GTSAM_EXPORT Cal3Fisheye {
|
|||
/// y_i]
|
||||
Point2 calibrate(const Point2& p, const double tol = 1e-5) const;
|
||||
|
||||
/// Derivative of uncalibrate wrpt intrinsic coordinates [x_i; y_i]
|
||||
Matrix2 D2d_intrinsic(const Point2& p) const;
|
||||
|
||||
/// Derivative of uncalibrate wrpt the calibration parameters
|
||||
/// [fx, fy, s, u0, v0, k1, k2, k3, k4]
|
||||
Matrix29 D2d_calibration(const Point2& p) const;
|
||||
|
||||
/// @}
|
||||
/// @name Testable
|
||||
/// @{
|
||||
|
|
|
|||
|
|
@ -319,7 +319,7 @@ private:
|
|||
}
|
||||
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
};
|
||||
|
||||
template<class CAMERA>
|
||||
|
|
|
|||
|
|
@ -212,7 +212,7 @@ class EssentialMatrix {
|
|||
/// @}
|
||||
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
};
|
||||
|
||||
template<>
|
||||
|
|
|
|||
|
|
@ -325,7 +325,7 @@ private:
|
|||
}
|
||||
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
};
|
||||
|
||||
// manifold traits
|
||||
|
|
|
|||
|
|
@ -222,7 +222,7 @@ private:
|
|||
}
|
||||
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
};
|
||||
// end of class PinholeBaseK
|
||||
|
||||
|
|
@ -425,7 +425,7 @@ private:
|
|||
}
|
||||
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
};
|
||||
// end of class PinholePose
|
||||
|
||||
|
|
|
|||
|
|
@ -317,7 +317,7 @@ public:
|
|||
|
||||
public:
|
||||
// Align for Point2, which is either derived from, or is typedef, of Vector2
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
}; // Pose2
|
||||
|
||||
/** specialization for pose2 wedge function (generic template in Lie.h) */
|
||||
|
|
|
|||
|
|
@ -355,7 +355,7 @@ public:
|
|||
#ifdef GTSAM_USE_QUATERNIONS
|
||||
// Align if we are using Quaternions
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
#endif
|
||||
};
|
||||
// Pose3 class
|
||||
|
|
|
|||
|
|
@ -544,7 +544,7 @@ namespace gtsam {
|
|||
#ifdef GTSAM_USE_QUATERNIONS
|
||||
// only align if quaternion, Matrix3 has no alignment requirements
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
#endif
|
||||
};
|
||||
|
||||
|
|
|
|||
|
|
@ -261,13 +261,13 @@ Vector3 SO3::Logmap(const SO3& Q, ChartJacobian H) {
|
|||
|
||||
// when trace == -1, i.e., when theta = +-pi, +-3pi, +-5pi, etc.
|
||||
// we do something special
|
||||
if (std::abs(tr + 1.0) < 1e-10) {
|
||||
if (std::abs(R33 + 1.0) > 1e-10)
|
||||
if (tr + 1.0 < 1e-10) {
|
||||
if (std::abs(R33 + 1.0) > 1e-5)
|
||||
omega = (M_PI / sqrt(2.0 + 2.0 * R33)) * Vector3(R13, R23, 1.0 + R33);
|
||||
else if (std::abs(R22 + 1.0) > 1e-10)
|
||||
else if (std::abs(R22 + 1.0) > 1e-5)
|
||||
omega = (M_PI / sqrt(2.0 + 2.0 * R22)) * Vector3(R12, 1.0 + R22, R32);
|
||||
else
|
||||
// if(std::abs(R.r1_.x()+1.0) > 1e-10) This is implicit
|
||||
// if(std::abs(R.r1_.x()+1.0) > 1e-5) This is implicit
|
||||
omega = (M_PI / sqrt(2.0 + 2.0 * R11)) * Vector3(1.0 + R11, R21, R31);
|
||||
} else {
|
||||
double magnitude;
|
||||
|
|
|
|||
|
|
@ -33,9 +33,10 @@ using namespace std;
|
|||
|
||||
namespace gtsam {
|
||||
|
||||
// TODO(frank): is this better than SOn::Random?
|
||||
// /* *************************************************************************
|
||||
// */ static Vector3 randomOmega(boost::mt19937 &rng) {
|
||||
// static boost::uniform_real<double> randomAngle(-M_PI, M_PI);
|
||||
// static std::uniform_real_distribution<double> randomAngle(-M_PI, M_PI);
|
||||
// return Unit3::Random(rng).unitVector() * randomAngle(rng);
|
||||
// }
|
||||
|
||||
|
|
@ -58,9 +59,9 @@ Matrix4 SO4::Hat(const Vector6& xi) {
|
|||
Y(0, 1) = -xi(5);
|
||||
Y(0, 2) = +xi(4);
|
||||
Y(1, 2) = -xi(3);
|
||||
Y(0, 3) = -xi(2);
|
||||
Y(1, 3) = +xi(1);
|
||||
Y(2, 3) = -xi(0);
|
||||
Y(0, 3) = +xi(2);
|
||||
Y(1, 3) = -xi(1);
|
||||
Y(2, 3) = +xi(0);
|
||||
return Y - Y.transpose();
|
||||
}
|
||||
|
||||
|
|
@ -72,9 +73,9 @@ Vector6 SO4::Vee(const Matrix4& X) {
|
|||
xi(5) = -X(0, 1);
|
||||
xi(4) = +X(0, 2);
|
||||
xi(3) = -X(1, 2);
|
||||
xi(2) = -X(0, 3);
|
||||
xi(1) = +X(1, 3);
|
||||
xi(0) = -X(2, 3);
|
||||
xi(2) = +X(0, 3);
|
||||
xi(1) = -X(1, 3);
|
||||
xi(0) = +X(2, 3);
|
||||
return xi;
|
||||
}
|
||||
|
||||
|
|
@ -208,9 +209,9 @@ GTSAM_EXPORT Matrix3 topLeft(const SO4& Q, OptionalJacobian<9, 6> H) {
|
|||
if (H) {
|
||||
const Vector3 m1 = M.col(0), m2 = M.col(1), m3 = M.col(2),
|
||||
q = R.topRightCorner<3, 1>();
|
||||
*H << Z_3x1, Z_3x1, q, Z_3x1, -m3, m2, //
|
||||
Z_3x1, -q, Z_3x1, m3, Z_3x1, -m1, //
|
||||
q, Z_3x1, Z_3x1, -m2, m1, Z_3x1;
|
||||
*H << Z_3x1, Z_3x1, -q, Z_3x1, -m3, m2, //
|
||||
Z_3x1, q, Z_3x1, m3, Z_3x1, -m1, //
|
||||
-q, Z_3x1, Z_3x1, -m2, m1, Z_3x1;
|
||||
}
|
||||
return M;
|
||||
}
|
||||
|
|
@ -221,9 +222,9 @@ GTSAM_EXPORT Matrix43 stiefel(const SO4& Q, OptionalJacobian<12, 6> H) {
|
|||
const Matrix43 M = R.leftCols<3>();
|
||||
if (H) {
|
||||
const auto &m1 = R.col(0), m2 = R.col(1), m3 = R.col(2), q = R.col(3);
|
||||
*H << Z_4x1, Z_4x1, q, Z_4x1, -m3, m2, //
|
||||
Z_4x1, -q, Z_4x1, m3, Z_4x1, -m1, //
|
||||
q, Z_4x1, Z_4x1, -m2, m1, Z_4x1;
|
||||
*H << Z_4x1, Z_4x1, -q, Z_4x1, -m3, m2, //
|
||||
Z_4x1, q, Z_4x1, m3, Z_4x1, -m1, //
|
||||
-q, Z_4x1, Z_4x1, -m2, m1, Z_4x1;
|
||||
}
|
||||
return M;
|
||||
}
|
||||
|
|
|
|||
|
|
@ -38,11 +38,12 @@ Matrix SOn::Hat(const Vector& xi) {
|
|||
const size_t dmin = (n - 1) * (n - 2) / 2;
|
||||
X.topLeftCorner(n - 1, n - 1) = Hat(xi.tail(dmin));
|
||||
|
||||
// determine sign of last element (signs alternate)
|
||||
double sign = pow(-1.0, xi.size());
|
||||
// Now fill last row and column
|
||||
double sign = 1.0;
|
||||
for (size_t i = 0; i < n - 1; i++) {
|
||||
const size_t j = n - 2 - i;
|
||||
X(n - 1, j) = sign * xi(i);
|
||||
X(n - 1, j) = -sign * xi(i);
|
||||
X(j, n - 1) = -X(n - 1, j);
|
||||
sign = -sign;
|
||||
}
|
||||
|
|
@ -67,10 +68,10 @@ Vector SOn::Vee(const Matrix& X) {
|
|||
Vector xi(d);
|
||||
|
||||
// Fill first n-1 spots from last row of X
|
||||
double sign = 1.0;
|
||||
double sign = pow(-1.0, xi.size());
|
||||
for (size_t i = 0; i < n - 1; i++) {
|
||||
const size_t j = n - 2 - i;
|
||||
xi(i) = sign * X(n - 1, j);
|
||||
xi(i) = -sign * X(n - 1, j);
|
||||
sign = -sign;
|
||||
}
|
||||
|
||||
|
|
|
|||
|
|
@ -20,14 +20,15 @@
|
|||
|
||||
#include <gtsam/base/Lie.h>
|
||||
#include <gtsam/base/Manifold.h>
|
||||
#include <gtsam/base/make_shared.h>
|
||||
#include <gtsam/dllexport.h>
|
||||
|
||||
#include <Eigen/Core>
|
||||
|
||||
#include <random>
|
||||
#include <iostream> // TODO(frank): how to avoid?
|
||||
#include <string>
|
||||
#include <type_traits>
|
||||
#include <vector>
|
||||
#include <random>
|
||||
|
||||
namespace gtsam {
|
||||
|
||||
|
|
@ -53,7 +54,7 @@ class SO : public LieGroup<SO<N>, internal::DimensionSO(N)> {
|
|||
using VectorN2 = Eigen::Matrix<double, internal::NSquaredSO(N), 1>;
|
||||
using MatrixDD = Eigen::Matrix<double, dimension, dimension>;
|
||||
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW_IF(true)
|
||||
|
||||
protected:
|
||||
MatrixNN matrix_; ///< Rotation matrix
|
||||
|
|
@ -93,6 +94,16 @@ class SO : public LieGroup<SO<N>, internal::DimensionSO(N)> {
|
|||
return SO(R);
|
||||
}
|
||||
|
||||
/// Named constructor from lower dimensional matrix
|
||||
template <typename Derived, int N_ = N, typename = IsDynamic<N_>>
|
||||
static SO Lift(size_t n, const Eigen::MatrixBase<Derived> &R) {
|
||||
Matrix Q = Matrix::Identity(n, n);
|
||||
size_t p = R.rows();
|
||||
assert(p < n && R.cols() == p);
|
||||
Q.topLeftCorner(p, p) = R;
|
||||
return SO(Q);
|
||||
}
|
||||
|
||||
/// Construct dynamic SO(n) from Fixed SO<M>
|
||||
template <int M, int N_ = N, typename = IsDynamic<N_>>
|
||||
explicit SO(const SO<M>& R) : matrix_(R.matrix()) {}
|
||||
|
|
@ -207,11 +218,11 @@ class SO : public LieGroup<SO<N>, internal::DimensionSO(N)> {
|
|||
* etc... For example, the vector-space isomorphic to so(5) is laid out as:
|
||||
* a b c d | u v w | x y | z
|
||||
* where the latter elements correspond to "telescoping" sub-algebras:
|
||||
* 0 -z y -w d
|
||||
* z 0 -x v -c
|
||||
* -y x 0 -u b
|
||||
* w -v u 0 -a
|
||||
* -d c -b a 0
|
||||
* 0 -z y w -d
|
||||
* z 0 -x -v c
|
||||
* -y x 0 u -b
|
||||
* -w v -u 0 a
|
||||
* d -c b -a 0
|
||||
* This scheme behaves exactly as expected for SO(2) and SO(3).
|
||||
*/
|
||||
static MatrixNN Hat(const TangentVector& xi);
|
||||
|
|
|
|||
|
|
@ -214,7 +214,7 @@ private:
|
|||
/// @}
|
||||
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
};
|
||||
|
||||
// Define GTSAM traits
|
||||
|
|
|
|||
|
|
@ -10,17 +10,18 @@
|
|||
* -------------------------------------------------------------------------- */
|
||||
|
||||
/**
|
||||
* @file testCal3Fisheye.cpp
|
||||
* @file testCal3DFisheye.cpp
|
||||
* @brief Unit tests for fisheye calibration class
|
||||
* @author ghaggin
|
||||
*/
|
||||
|
||||
#include <CppUnitLite/TestHarness.h>
|
||||
#include <gtsam/base/Testable.h>
|
||||
#include <gtsam/base/numericalDerivative.h>
|
||||
#include <gtsam/geometry/Cal3Fisheye.h>
|
||||
#include <gtsam/geometry/Point3.h>
|
||||
|
||||
#include <CppUnitLite/TestHarness.h>
|
||||
|
||||
using namespace gtsam;
|
||||
|
||||
GTSAM_CONCEPT_TESTABLE_INST(Cal3Fisheye)
|
||||
|
|
@ -30,12 +31,27 @@ static const double fx = 250, fy = 260, s = 0.1, u0 = 320, v0 = 240;
|
|||
static Cal3Fisheye K(fx, fy, s, u0, v0, -0.013721808247486035,
|
||||
0.020727425669427896, -0.012786476702685545,
|
||||
0.0025242267320687625);
|
||||
static Point2 p(2, 3);
|
||||
static Point2 kTestPoint2(2, 3);
|
||||
|
||||
/* ************************************************************************* */
|
||||
TEST(Cal3Fisheye, assert_equal) { CHECK(assert_equal(K, K, 1e-5)); }
|
||||
|
||||
/* ************************************************************************* */
|
||||
TEST(Cal3Fisheye, retract) {
|
||||
Cal3Fisheye expected(K.fx() + 1, K.fy() + 2, K.skew() + 3, K.px() + 4,
|
||||
K.py() + 5, K.k1() + 6, K.k2() + 7, K.k3() + 8,
|
||||
K.k4() + 9);
|
||||
Vector d(9);
|
||||
d << 1, 2, 3, 4, 5, 6, 7, 8, 9;
|
||||
Cal3Fisheye actual = K.retract(d);
|
||||
CHECK(assert_equal(expected, actual, 1e-7));
|
||||
CHECK(assert_equal(d, K.localCoordinates(actual), 1e-7));
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
TEST(Cal3Fisheye, uncalibrate1) {
|
||||
// Calculate the solution
|
||||
const double xi = p.x(), yi = p.y();
|
||||
const double xi = kTestPoint2.x(), yi = kTestPoint2.y();
|
||||
const double r = sqrt(xi * xi + yi * yi);
|
||||
const double t = atan(r);
|
||||
const double tt = t * t, t4 = tt * tt, t6 = tt * t4, t8 = t4 * t4;
|
||||
|
|
@ -46,32 +62,42 @@ TEST(Cal3Fisheye, uncalibrate1) {
|
|||
|
||||
Point2 uv_sol(v[0] / v[2], v[1] / v[2]);
|
||||
|
||||
Point2 uv = K.uncalibrate(p);
|
||||
Point2 uv = K.uncalibrate(kTestPoint2);
|
||||
CHECK(assert_equal(uv, uv_sol));
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
/**
|
||||
* Check that a point at (0,0) projects to the
|
||||
* image center.
|
||||
*/
|
||||
TEST(Cal3Fisheye, uncalibrate2) {
|
||||
Point2 pz(0, 0);
|
||||
auto uv = K.uncalibrate(pz);
|
||||
CHECK(assert_equal(uv, Point2(u0, v0)));
|
||||
// For numerical derivatives
|
||||
Point2 f(const Cal3Fisheye& k, const Point2& pt) { return k.uncalibrate(pt); }
|
||||
|
||||
/* ************************************************************************* */
|
||||
TEST(Cal3Fisheye, Derivatives) {
|
||||
Matrix H1, H2;
|
||||
K.uncalibrate(kTestPoint2, H1, H2);
|
||||
CHECK(assert_equal(numericalDerivative21(f, K, kTestPoint2, 1e-7), H1, 1e-5));
|
||||
CHECK(assert_equal(numericalDerivative22(f, K, kTestPoint2, 1e-7), H2, 1e-5));
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
/**
|
||||
* This test uses cv2::fisheye::projectPoints to test that uncalibrate
|
||||
* properly projects a point into the image plane. One notable difference
|
||||
* between opencv and the Cal3Fisheye::uncalibrate function is the skew
|
||||
* parameter. The equivalence is alpha = s/fx.
|
||||
*
|
||||
*
|
||||
* Python script to project points with fisheye model in OpenCv
|
||||
* (script run with OpenCv version 4.2.0 and Numpy version 1.18.2)
|
||||
*/
|
||||
// Check that a point at (0,0) projects to the image center.
|
||||
TEST(Cal3Fisheye, uncalibrate2) {
|
||||
Point2 pz(0, 0);
|
||||
Matrix H1, H2;
|
||||
auto uv = K.uncalibrate(pz, H1, H2);
|
||||
CHECK(assert_equal(uv, Point2(u0, v0)));
|
||||
CHECK(assert_equal(numericalDerivative21(f, K, pz, 1e-7), H1, 1e-5));
|
||||
// TODO(frank): the second jacobian is all NaN for the image center!
|
||||
// CHECK(assert_equal(numericalDerivative22(f, K, pz, 1e-7), H2, 1e-5));
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
// This test uses cv2::fisheye::projectPoints to test that uncalibrate
|
||||
// properly projects a point into the image plane. One notable difference
|
||||
// between opencv and the Cal3Fisheye::uncalibrate function is the skew
|
||||
// parameter. The equivalence is alpha = s/fx.
|
||||
//
|
||||
// Python script to project points with fisheye model in OpenCv
|
||||
// (script run with OpenCv version 4.2.0 and Numpy version 1.18.2)
|
||||
// clang-format off
|
||||
/*
|
||||
===========================================================
|
||||
|
|
@ -94,6 +120,7 @@ tvec = np.float64([[0.,0.,0.]]);
|
|||
imagePoints, jacobian = cv2.fisheye.projectPoints(objpts, rvec, tvec, cameraMatrix, distCoeffs, alpha=alpha)
|
||||
np.set_printoptions(precision=14)
|
||||
print(imagePoints)
|
||||
|
||||
===========================================================
|
||||
* Script output: [[[457.82638130304935 408.18905848512986]]]
|
||||
*/
|
||||
|
|
@ -134,21 +161,18 @@ TEST(Cal3Fisheye, calibrate1) {
|
|||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
/**
|
||||
* Check that calibrate returns (0,0) for the image center
|
||||
*/
|
||||
// Check that calibrate returns (0,0) for the image center
|
||||
TEST(Cal3Fisheye, calibrate2) {
|
||||
Point2 uv(u0, v0);
|
||||
auto xi_hat = K.calibrate(uv);
|
||||
CHECK(assert_equal(xi_hat, Point2(0, 0)))
|
||||
}
|
||||
|
||||
/**
|
||||
* Run calibrate on OpenCv test from uncalibrate3
|
||||
* (script shown above)
|
||||
* 3d point: (23, 27, 31)
|
||||
* 2d point in image plane: (457.82638130304935, 408.18905848512986)
|
||||
*/
|
||||
/* ************************************************************************* */
|
||||
// Run calibrate on OpenCv test from uncalibrate3
|
||||
// (script shown above)
|
||||
// 3d point: (23, 27, 31)
|
||||
// 2d point in image plane: (457.82638130304935, 408.18905848512986)
|
||||
TEST(Cal3Fisheye, calibrate3) {
|
||||
Point3 p3(23, 27, 31);
|
||||
Point2 xi(p3.x() / p3.z(), p3.y() / p3.z());
|
||||
|
|
@ -157,47 +181,6 @@ TEST(Cal3Fisheye, calibrate3) {
|
|||
CHECK(assert_equal(xi_hat, xi));
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
// For numerical derivatives
|
||||
Point2 uncalibrate_(const Cal3Fisheye& k, const Point2& pt) {
|
||||
return k.uncalibrate(pt);
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
TEST(Cal3Fisheye, Duncalibrate1) {
|
||||
Matrix computed;
|
||||
K.uncalibrate(p, computed, boost::none);
|
||||
Matrix numerical = numericalDerivative21(uncalibrate_, K, p, 1e-7);
|
||||
CHECK(assert_equal(numerical, computed, 1e-5));
|
||||
Matrix separate = K.D2d_calibration(p);
|
||||
CHECK(assert_equal(numerical, separate, 1e-5));
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
TEST(Cal3Fisheye, Duncalibrate2) {
|
||||
Matrix computed;
|
||||
K.uncalibrate(p, boost::none, computed);
|
||||
Matrix numerical = numericalDerivative22(uncalibrate_, K, p, 1e-7);
|
||||
CHECK(assert_equal(numerical, computed, 1e-5));
|
||||
Matrix separate = K.D2d_intrinsic(p);
|
||||
CHECK(assert_equal(numerical, separate, 1e-5));
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
TEST(Cal3Fisheye, assert_equal) { CHECK(assert_equal(K, K, 1e-5)); }
|
||||
|
||||
/* ************************************************************************* */
|
||||
TEST(Cal3Fisheye, retract) {
|
||||
Cal3Fisheye expected(K.fx() + 1, K.fy() + 2, K.skew() + 3, K.px() + 4,
|
||||
K.py() + 5, K.k1() + 6, K.k2() + 7, K.k3() + 8,
|
||||
K.k4() + 9);
|
||||
Vector d(9);
|
||||
d << 1, 2, 3, 4, 5, 6, 7, 8, 9;
|
||||
Cal3Fisheye actual = K.retract(d);
|
||||
CHECK(assert_equal(expected, actual, 1e-7));
|
||||
CHECK(assert_equal(d, K.localCoordinates(actual), 1e-7));
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
int main() {
|
||||
TestResult tr;
|
||||
|
|
|
|||
|
|
@ -2,10 +2,10 @@
|
|||
#include <gtsam/base/Testable.h>
|
||||
#include <gtsam/base/numericalDerivative.h>
|
||||
#include <gtsam/geometry/Line3.h>
|
||||
#include <gtsam/slam/expressions.h>
|
||||
#include <gtsam/slam/PriorFactor.h>
|
||||
#include <gtsam/nonlinear/ExpressionFactor.h>
|
||||
#include <gtsam/nonlinear/expressionTesting.h>
|
||||
#include <gtsam/slam/PriorFactor.h>
|
||||
#include <gtsam/slam/expressions.h>
|
||||
|
||||
using namespace gtsam;
|
||||
|
||||
|
|
@ -146,7 +146,7 @@ TEST(Line3, projection) {
|
|||
SharedNoiseModel model = noiseModel::Isotropic::Sigma(2, 0.1);
|
||||
Unit3_ projected_(wL_, &Line3::project);
|
||||
ExpressionFactor<Unit3> f(model, expected, projected_);
|
||||
EXPECT_CORRECT_FACTOR_JACOBIANS(f, val, 1e-5, 1e-7);
|
||||
EXPECT_CORRECT_FACTOR_JACOBIANS(f, val, 1e-5, 1e-5);
|
||||
}
|
||||
|
||||
int main() {
|
||||
|
|
|
|||
|
|
@ -181,14 +181,13 @@ TEST( Rot3, retract)
|
|||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
TEST(Rot3, log)
|
||||
{
|
||||
TEST(Rot3, log) {
|
||||
static const double PI = boost::math::constants::pi<double>();
|
||||
Vector w;
|
||||
Rot3 R;
|
||||
|
||||
#define CHECK_OMEGA(X, Y, Z) \
|
||||
w = (Vector(3) << (double)X, (double)Y, double(Z)).finished(); \
|
||||
w = (Vector(3) << X, Y, Z).finished(); \
|
||||
R = Rot3::Rodrigues(w); \
|
||||
EXPECT(assert_equal(w, Rot3::Logmap(R), 1e-12));
|
||||
|
||||
|
|
@ -230,7 +229,7 @@ TEST(Rot3, log)
|
|||
|
||||
// Check 360 degree rotations
|
||||
#define CHECK_OMEGA_ZERO(X, Y, Z) \
|
||||
w = (Vector(3) << (double)X, (double)Y, double(Z)).finished(); \
|
||||
w = (Vector(3) << X, Y, Z).finished(); \
|
||||
R = Rot3::Rodrigues(w); \
|
||||
EXPECT(assert_equal((Vector)Z_3x1, Rot3::Logmap(R)));
|
||||
|
||||
|
|
@ -238,6 +237,25 @@ TEST(Rot3, log)
|
|||
CHECK_OMEGA_ZERO(0, 2.0 * PI, 0)
|
||||
CHECK_OMEGA_ZERO(0, 0, 2.0 * PI)
|
||||
CHECK_OMEGA_ZERO(x * 2. * PI, y * 2. * PI, z * 2. * PI)
|
||||
|
||||
// Check problematic case from Lund dataset vercingetorix.g2o
|
||||
// This is an almost rotation with determinant not *quite* 1.
|
||||
Rot3 Rlund(-0.98582676, -0.03958746, -0.16303092, //
|
||||
-0.03997006, -0.88835923, 0.45740671, //
|
||||
-0.16293753, 0.45743998, 0.87418537);
|
||||
|
||||
// Rot3's Logmap returns different, but equivalent compacted
|
||||
// axis-angle vectors depending on whether Rot3 is implemented
|
||||
// by Quaternions or SO3.
|
||||
#if defined(GTSAM_USE_QUATERNIONS)
|
||||
// Quaternion bounds angle to [-pi, pi] resulting in ~179.9 degrees
|
||||
EXPECT(assert_equal(Vector3(0.264451979, -0.742197651, -3.04098211),
|
||||
(Vector)Rot3::Logmap(Rlund), 1e-8));
|
||||
#else
|
||||
// SO3 does not bound angle resulting in ~180.1 degrees
|
||||
EXPECT(assert_equal(Vector3(-0.264544406, 0.742217405, 3.04117314),
|
||||
(Vector)Rot3::Logmap(Rlund), 1e-8));
|
||||
#endif
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
|
|
@ -536,16 +554,15 @@ TEST( Rot3, logmapStability ) {
|
|||
TEST(Rot3, quaternion) {
|
||||
// NOTE: This is also verifying the ability to convert Vector to Quaternion
|
||||
Quaternion q1(0.710997408193224, 0.360544029310185, 0.594459869568306, 0.105395217842782);
|
||||
Rot3 R1 = Rot3((Matrix)(Matrix(3, 3) <<
|
||||
0.271018623057411, 0.278786459830371, 0.921318086098018,
|
||||
Rot3 R1(0.271018623057411, 0.278786459830371, 0.921318086098018,
|
||||
0.578529366719085, 0.717799701969298, -0.387385285854279,
|
||||
-0.769319620053772, 0.637998195662053, 0.033250932803219).finished());
|
||||
-0.769319620053772, 0.637998195662053, 0.033250932803219);
|
||||
|
||||
Quaternion q2(0.263360579192421, 0.571813128030932, 0.494678363680335, 0.599136268678053);
|
||||
Rot3 R2 = Rot3((Matrix)(Matrix(3, 3) <<
|
||||
-0.207341903877828, 0.250149415542075, 0.945745528564780,
|
||||
Quaternion q2(0.263360579192421, 0.571813128030932, 0.494678363680335,
|
||||
0.599136268678053);
|
||||
Rot3 R2(-0.207341903877828, 0.250149415542075, 0.945745528564780,
|
||||
0.881304914479026, -0.371869043667957, 0.291573424846290,
|
||||
0.424630407073532, 0.893945571198514, -0.143353873763946).finished());
|
||||
0.424630407073532, 0.893945571198514, -0.143353873763946);
|
||||
|
||||
// Check creating Rot3 from quaternion
|
||||
EXPECT(assert_equal(R1, Rot3(q1)));
|
||||
|
|
|
|||
|
|
@ -46,7 +46,7 @@ TEST(SOn, SO0) {
|
|||
EXPECT_LONGS_EQUAL(Eigen::Dynamic, SOn::dimension);
|
||||
EXPECT_LONGS_EQUAL(Eigen::Dynamic, SOn::Dim());
|
||||
EXPECT_LONGS_EQUAL(0, R.dim());
|
||||
EXPECT_LONGS_EQUAL(-1, traits<SOn>::GetDimension(R));
|
||||
EXPECT_LONGS_EQUAL(0, traits<SOn>::GetDimension(R));
|
||||
}
|
||||
|
||||
//******************************************************************************
|
||||
|
|
@ -56,7 +56,7 @@ TEST(SOn, SO5) {
|
|||
EXPECT_LONGS_EQUAL(Eigen::Dynamic, SOn::dimension);
|
||||
EXPECT_LONGS_EQUAL(Eigen::Dynamic, SOn::Dim());
|
||||
EXPECT_LONGS_EQUAL(10, R.dim());
|
||||
EXPECT_LONGS_EQUAL(-1, traits<SOn>::GetDimension(R));
|
||||
EXPECT_LONGS_EQUAL(10, traits<SOn>::GetDimension(R));
|
||||
}
|
||||
|
||||
//******************************************************************************
|
||||
|
|
@ -95,32 +95,42 @@ TEST(SOn, Random) {
|
|||
|
||||
//******************************************************************************
|
||||
TEST(SOn, HatVee) {
|
||||
Vector6 v;
|
||||
v << 1, 2, 3, 4, 5, 6;
|
||||
Vector10 v;
|
||||
v << 1, 2, 3, 4, 5, 6, 7, 8, 9, 10;
|
||||
|
||||
Matrix expected2(2, 2);
|
||||
expected2 << 0, -1, 1, 0;
|
||||
const auto actual2 = SOn::Hat(v.head<1>());
|
||||
CHECK(assert_equal(expected2, actual2));
|
||||
CHECK(assert_equal((Vector)v.head<1>(), SOn::Vee(actual2)));
|
||||
EXPECT(assert_equal(expected2, actual2));
|
||||
EXPECT(assert_equal((Vector)v.head<1>(), SOn::Vee(actual2)));
|
||||
|
||||
Matrix expected3(3, 3);
|
||||
expected3 << 0, -3, 2, //
|
||||
3, 0, -1, //
|
||||
-2, 1, 0;
|
||||
const auto actual3 = SOn::Hat(v.head<3>());
|
||||
CHECK(assert_equal(expected3, actual3));
|
||||
CHECK(assert_equal(skewSymmetric(1, 2, 3), actual3));
|
||||
CHECK(assert_equal((Vector)v.head<3>(), SOn::Vee(actual3)));
|
||||
EXPECT(assert_equal(expected3, actual3));
|
||||
EXPECT(assert_equal(skewSymmetric(1, 2, 3), actual3));
|
||||
EXPECT(assert_equal((Vector)v.head<3>(), SOn::Vee(actual3)));
|
||||
|
||||
Matrix expected4(4, 4);
|
||||
expected4 << 0, -6, 5, -3, //
|
||||
6, 0, -4, 2, //
|
||||
-5, 4, 0, -1, //
|
||||
3, -2, 1, 0;
|
||||
const auto actual4 = SOn::Hat(v);
|
||||
CHECK(assert_equal(expected4, actual4));
|
||||
CHECK(assert_equal((Vector)v, SOn::Vee(actual4)));
|
||||
expected4 << 0, -6, 5, 3, //
|
||||
6, 0, -4, -2, //
|
||||
-5, 4, 0, 1, //
|
||||
-3, 2, -1, 0;
|
||||
const auto actual4 = SOn::Hat(v.head<6>());
|
||||
EXPECT(assert_equal(expected4, actual4));
|
||||
EXPECT(assert_equal((Vector)v.head<6>(), SOn::Vee(actual4)));
|
||||
|
||||
Matrix expected5(5, 5);
|
||||
expected5 << 0,-10, 9, 7, -4, //
|
||||
10, 0, -8, -6, 3, //
|
||||
-9, 8, 0, 5, -2, //
|
||||
-7, 6, -5, 0, 1, //
|
||||
4, -3, 2, -1, 0;
|
||||
const auto actual5 = SOn::Hat(v);
|
||||
EXPECT(assert_equal(expected5, actual5));
|
||||
EXPECT(assert_equal((Vector)v, SOn::Vee(actual5)));
|
||||
}
|
||||
|
||||
//******************************************************************************
|
||||
|
|
|
|||
|
|
@ -215,7 +215,7 @@ struct CameraProjectionMatrix {
|
|||
private:
|
||||
const Matrix3 K_;
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
};
|
||||
|
||||
/**
|
||||
|
|
|
|||
|
|
@ -0,0 +1,33 @@
|
|||
/* ----------------------------------------------------------------------------
|
||||
|
||||
* GTSAM Copyright 2010, Georgia Tech Research Corporation,
|
||||
* Atlanta, Georgia 30332-0415
|
||||
* All Rights Reserved
|
||||
* Authors: Frank Dellaert, et al. (see THANKS for the full author list)
|
||||
|
||||
* See LICENSE for the license information
|
||||
|
||||
* -------------------------------------------------------------------------- */
|
||||
|
||||
/**
|
||||
* @file GaussianFactor.cpp
|
||||
* @brief A factor with a quadratic error function - a Gaussian
|
||||
* @brief GaussianFactor
|
||||
* @author Fan Jiang
|
||||
*/
|
||||
|
||||
// \callgraph
|
||||
|
||||
#include <gtsam/linear/GaussianFactor.h>
|
||||
#include <gtsam/linear/VectorValues.h>
|
||||
|
||||
namespace gtsam {
|
||||
|
||||
/* ************************************************************************* */
|
||||
VectorValues GaussianFactor::hessianDiagonal() const {
|
||||
VectorValues d;
|
||||
hessianDiagonalAdd(d);
|
||||
return d;
|
||||
}
|
||||
|
||||
}
|
||||
|
|
@ -100,7 +100,10 @@ namespace gtsam {
|
|||
virtual Matrix information() const = 0;
|
||||
|
||||
/// Return the diagonal of the Hessian for this factor
|
||||
virtual VectorValues hessianDiagonal() const = 0;
|
||||
VectorValues hessianDiagonal() const;
|
||||
|
||||
/// Add the current diagonal to a VectorValues instance
|
||||
virtual void hessianDiagonalAdd(VectorValues& d) const = 0;
|
||||
|
||||
/// Raw memory access version of hessianDiagonal
|
||||
virtual void hessianDiagonal(double* d) const = 0;
|
||||
|
|
|
|||
|
|
@ -255,8 +255,7 @@ namespace gtsam {
|
|||
VectorValues d;
|
||||
for (const sharedFactor& factor : *this) {
|
||||
if(factor){
|
||||
VectorValues di = factor->hessianDiagonal();
|
||||
d.addInPlace_(di);
|
||||
factor->hessianDiagonalAdd(d);
|
||||
}
|
||||
}
|
||||
return d;
|
||||
|
|
|
|||
|
|
@ -302,12 +302,14 @@ Matrix HessianFactor::information() const {
|
|||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
VectorValues HessianFactor::hessianDiagonal() const {
|
||||
VectorValues d;
|
||||
void HessianFactor::hessianDiagonalAdd(VectorValues &d) const {
|
||||
for (DenseIndex j = 0; j < (DenseIndex)size(); ++j) {
|
||||
d.emplace(keys_[j], info_.diagonal(j));
|
||||
auto result = d.emplace(keys_[j], info_.diagonal(j));
|
||||
if(!result.second) {
|
||||
// if emplace fails, it returns an iterator to the existing element, which we add to:
|
||||
result.first->second += info_.diagonal(j);
|
||||
}
|
||||
}
|
||||
return d;
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
|
|
|
|||
|
|
@ -293,8 +293,11 @@ namespace gtsam {
|
|||
*/
|
||||
Matrix information() const override;
|
||||
|
||||
/// Return the diagonal of the Hessian for this factor
|
||||
VectorValues hessianDiagonal() const override;
|
||||
/// Add the current diagonal to a VectorValues instance
|
||||
void hessianDiagonalAdd(VectorValues& d) const override;
|
||||
|
||||
/// Using the base method
|
||||
using Base::hessianDiagonal;
|
||||
|
||||
/// Raw memory access version of hessianDiagonal
|
||||
void hessianDiagonal(double* d) const override;
|
||||
|
|
|
|||
|
|
@ -542,21 +542,31 @@ Matrix JacobianFactor::information() const {
|
|||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
VectorValues JacobianFactor::hessianDiagonal() const {
|
||||
VectorValues d;
|
||||
void JacobianFactor::hessianDiagonalAdd(VectorValues& d) const {
|
||||
for (size_t pos = 0; pos < size(); ++pos) {
|
||||
Key j = keys_[pos];
|
||||
size_t nj = Ab_(pos).cols();
|
||||
Vector dj(nj);
|
||||
auto result = d.emplace(j, nj);
|
||||
|
||||
Vector& dj = result.first->second;
|
||||
|
||||
for (size_t k = 0; k < nj; ++k) {
|
||||
Vector column_k = Ab_(pos).col(k);
|
||||
if (model_)
|
||||
model_->whitenInPlace(column_k);
|
||||
Eigen::Ref<const Vector> column_k = Ab_(pos).col(k);
|
||||
if (model_) {
|
||||
Vector column_k_copy = column_k;
|
||||
model_->whitenInPlace(column_k_copy);
|
||||
if(!result.second)
|
||||
dj(k) += dot(column_k_copy, column_k_copy);
|
||||
else
|
||||
dj(k) = dot(column_k_copy, column_k_copy);
|
||||
} else {
|
||||
if (!result.second)
|
||||
dj(k) += dot(column_k, column_k);
|
||||
else
|
||||
dj(k) = dot(column_k, column_k);
|
||||
}
|
||||
d.emplace(j, dj);
|
||||
}
|
||||
return d;
|
||||
}
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
|
|
|
|||
|
|
@ -215,8 +215,11 @@ namespace gtsam {
|
|||
*/
|
||||
Matrix information() const override;
|
||||
|
||||
/// Return the diagonal of the Hessian for this factor
|
||||
VectorValues hessianDiagonal() const override;
|
||||
/// Using the base method
|
||||
using Base::hessianDiagonal;
|
||||
|
||||
/// Add the current diagonal to a VectorValues instance
|
||||
void hessianDiagonalAdd(VectorValues& d) const override;
|
||||
|
||||
/// Raw memory access version of hessianDiagonal
|
||||
void hessianDiagonal(double* d) const override;
|
||||
|
|
|
|||
|
|
@ -183,21 +183,21 @@ void BlockJacobiPreconditioner::clean() {
|
|||
}
|
||||
|
||||
/***************************************************************************************/
|
||||
boost::shared_ptr<Preconditioner> createPreconditioner(const boost::shared_ptr<PreconditionerParameters> parameters) {
|
||||
|
||||
if ( DummyPreconditionerParameters::shared_ptr dummy = boost::dynamic_pointer_cast<DummyPreconditionerParameters>(parameters) ) {
|
||||
boost::shared_ptr<Preconditioner> createPreconditioner(
|
||||
const boost::shared_ptr<PreconditionerParameters> params) {
|
||||
using boost::dynamic_pointer_cast;
|
||||
if (dynamic_pointer_cast<DummyPreconditionerParameters>(params)) {
|
||||
return boost::make_shared<DummyPreconditioner>();
|
||||
}
|
||||
else if ( BlockJacobiPreconditionerParameters::shared_ptr blockJacobi = boost::dynamic_pointer_cast<BlockJacobiPreconditionerParameters>(parameters) ) {
|
||||
} else if (dynamic_pointer_cast<BlockJacobiPreconditionerParameters>(
|
||||
params)) {
|
||||
return boost::make_shared<BlockJacobiPreconditioner>();
|
||||
}
|
||||
else if ( SubgraphPreconditionerParameters::shared_ptr subgraph = boost::dynamic_pointer_cast<SubgraphPreconditionerParameters>(parameters) ) {
|
||||
} else if (auto subgraph =
|
||||
dynamic_pointer_cast<SubgraphPreconditionerParameters>(
|
||||
params)) {
|
||||
return boost::make_shared<SubgraphPreconditioner>(*subgraph);
|
||||
}
|
||||
|
||||
throw invalid_argument("createPreconditioner: unexpected preconditioner parameter type");
|
||||
throw invalid_argument(
|
||||
"createPreconditioner: unexpected preconditioner parameter type");
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
|
||||
} // namespace gtsam
|
||||
|
|
|
|||
|
|
@ -102,10 +102,8 @@ public:
|
|||
DMap(y + D * keys_[pos]) += Ab_(pos).transpose() * Ax;
|
||||
}
|
||||
|
||||
/// Expose base class hessianDiagonal
|
||||
virtual VectorValues hessianDiagonal() const {
|
||||
return JacobianFactor::hessianDiagonal();
|
||||
}
|
||||
/// Using the base method
|
||||
using GaussianFactor::hessianDiagonal;
|
||||
|
||||
/// Raw memory access version of hessianDiagonal
|
||||
void hessianDiagonal(double* d) const {
|
||||
|
|
|
|||
|
|
@ -96,20 +96,6 @@ namespace gtsam {
|
|||
return result.first;
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
VectorValues::iterator VectorValues::emplace(Key j, const Vector& value) {
|
||||
#ifdef TBB_GREATER_EQUAL_2020
|
||||
std::pair<iterator, bool> result = values_.emplace(j, value);
|
||||
#else
|
||||
std::pair<iterator, bool> result = values_.insert(std::make_pair(j, value));
|
||||
#endif
|
||||
if(!result.second)
|
||||
throw std::invalid_argument(
|
||||
"Requested to emplace variable '" + DefaultKeyFormatter(j)
|
||||
+ "' already in this VectorValues.");
|
||||
return result.first;
|
||||
}
|
||||
|
||||
/* ************************************************************************* */
|
||||
void VectorValues::update(const VectorValues& values)
|
||||
{
|
||||
|
|
|
|||
|
|
@ -179,7 +179,14 @@ namespace gtsam {
|
|||
* j is already used.
|
||||
* @param value The vector to be inserted.
|
||||
* @param j The index with which the value will be associated. */
|
||||
iterator emplace(Key j, const Vector& value);
|
||||
template<class... Args>
|
||||
inline std::pair<VectorValues::iterator, bool> emplace(Key j, Args&&... args) {
|
||||
#if ! defined(GTSAM_USE_TBB) || defined (TBB_GREATER_EQUAL_2020)
|
||||
return values_.emplace(std::piecewise_construct, std::forward_as_tuple(j), std::forward_as_tuple(args...));
|
||||
#else
|
||||
return values_.insert(std::make_pair(j, Vector(std::forward<Args>(args)...)));
|
||||
#endif
|
||||
}
|
||||
|
||||
/** Insert a vector \c value with key \c j. Throws an invalid_argument exception if the key \c
|
||||
* j is already used.
|
||||
|
|
@ -197,7 +204,7 @@ namespace gtsam {
|
|||
* and an iterator to the existing value is returned, along with 'false'. If the value did not
|
||||
* exist, it is inserted and an iterator pointing to the new element, along with 'true', is
|
||||
* returned. */
|
||||
std::pair<iterator, bool> tryInsert(Key j, const Vector& value) {
|
||||
inline std::pair<iterator, bool> tryInsert(Key j, const Vector& value) {
|
||||
#ifdef TBB_GREATER_EQUAL_2020
|
||||
return values_.emplace(j, value);
|
||||
#else
|
||||
|
|
|
|||
|
|
@ -98,8 +98,13 @@ namespace gtsam
|
|||
// Insert solution into a VectorValues
|
||||
DenseIndex vectorPosition = 0;
|
||||
for(GaussianConditional::const_iterator frontal = c.beginFrontals(); frontal != c.endFrontals(); ++frontal) {
|
||||
VectorValues::const_iterator r =
|
||||
collectedResult.emplace(*frontal, solution.segment(vectorPosition, c.getDim(frontal)));
|
||||
auto result = collectedResult.emplace(*frontal, solution.segment(vectorPosition, c.getDim(frontal)));
|
||||
if(!result.second)
|
||||
throw std::runtime_error(
|
||||
"Internal error while optimizing clique. Trying to insert key '" + DefaultKeyFormatter(*frontal)
|
||||
+ "' that exists.");
|
||||
|
||||
VectorValues::const_iterator r = result.first;
|
||||
myData.cliqueResults.emplace(r->first, r);
|
||||
vectorPosition += c.getDim(frontal);
|
||||
}
|
||||
|
|
|
|||
|
|
@ -139,7 +139,7 @@ private:
|
|||
}
|
||||
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
};
|
||||
|
||||
/// traits
|
||||
|
|
@ -219,7 +219,7 @@ private:
|
|||
}
|
||||
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
};
|
||||
|
||||
/// traits
|
||||
|
|
|
|||
|
|
@ -100,7 +100,7 @@ private:
|
|||
}
|
||||
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
};
|
||||
|
||||
|
||||
|
|
@ -210,7 +210,7 @@ public:
|
|||
}
|
||||
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
};
|
||||
|
||||
/**
|
||||
|
|
@ -332,7 +332,7 @@ private:
|
|||
}
|
||||
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
};
|
||||
// class CombinedImuFactor
|
||||
|
||||
|
|
|
|||
|
|
@ -171,7 +171,7 @@ private:
|
|||
|
||||
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
/// @}
|
||||
|
||||
}; // ConstantBias class
|
||||
|
|
|
|||
|
|
@ -69,7 +69,7 @@ struct GTSAM_EXPORT PreintegratedRotationParams {
|
|||
#ifdef GTSAM_USE_QUATERNIONS
|
||||
// Align if we are using Quaternions
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
#endif
|
||||
};
|
||||
|
||||
|
|
@ -182,7 +182,7 @@ class GTSAM_EXPORT PreintegratedRotation {
|
|||
#ifdef GTSAM_USE_QUATERNIONS
|
||||
// Align if we are using Quaternions
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
#endif
|
||||
};
|
||||
|
||||
|
|
|
|||
|
|
@ -115,20 +115,21 @@ void PreintegrationBase::integrateMeasurement(const Vector3& measuredAcc,
|
|||
NavState PreintegrationBase::predict(const NavState& state_i,
|
||||
const imuBias::ConstantBias& bias_i, OptionalJacobian<9, 9> H1,
|
||||
OptionalJacobian<9, 6> H2) const {
|
||||
// TODO(frank): make sure this stuff is still correct
|
||||
Matrix96 D_biasCorrected_bias;
|
||||
Vector9 biasCorrected = biasCorrectedDelta(bias_i,
|
||||
H2 ? &D_biasCorrected_bias : 0);
|
||||
H2 ? &D_biasCorrected_bias : nullptr);
|
||||
|
||||
// Correct for initial velocity and gravity
|
||||
Matrix9 D_delta_state, D_delta_biasCorrected;
|
||||
Vector9 xi = state_i.correctPIM(biasCorrected, deltaTij_, p().n_gravity,
|
||||
p().omegaCoriolis, p().use2ndOrderCoriolis, H1 ? &D_delta_state : 0,
|
||||
H2 ? &D_delta_biasCorrected : 0);
|
||||
p().omegaCoriolis, p().use2ndOrderCoriolis, H1 ? &D_delta_state : nullptr,
|
||||
H2 ? &D_delta_biasCorrected : nullptr);
|
||||
|
||||
// Use retract to get back to NavState manifold
|
||||
Matrix9 D_predict_state, D_predict_delta;
|
||||
NavState state_j = state_i.retract(xi, D_predict_state, D_predict_delta);
|
||||
NavState state_j = state_i.retract(xi,
|
||||
H1 ? &D_predict_state : nullptr,
|
||||
H2 || H2 ? &D_predict_delta : nullptr);
|
||||
if (H1)
|
||||
*H1 = D_predict_state + D_predict_delta * D_delta_state;
|
||||
if (H2)
|
||||
|
|
|
|||
|
|
@ -214,7 +214,7 @@ class GTSAM_EXPORT PreintegrationBase {
|
|||
#endif
|
||||
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
};
|
||||
|
||||
} /// namespace gtsam
|
||||
|
|
|
|||
|
|
@ -84,7 +84,7 @@ protected:
|
|||
#ifdef GTSAM_USE_QUATERNIONS
|
||||
// Align if we are using Quaternions
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
#endif
|
||||
};
|
||||
|
||||
|
|
|
|||
|
|
@ -141,7 +141,7 @@ private:
|
|||
}
|
||||
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
};
|
||||
|
||||
} /// namespace gtsam
|
||||
|
|
|
|||
|
|
@ -342,7 +342,7 @@ TEST( AHRSFactor, fistOrderExponential ) {
|
|||
//******************************************************************************
|
||||
TEST( AHRSFactor, FirstOrderPreIntegratedMeasurements ) {
|
||||
// Linearization point
|
||||
Vector3 bias; ///< Current estimate of rotation rate bias
|
||||
Vector3 bias = Vector3::Zero(); ///< Current estimate of rotation rate bias
|
||||
|
||||
Pose3 body_P_sensor(Rot3::Expmap(Vector3(0, 0.1, 0.1)), Point3(1, 0, 1));
|
||||
|
||||
|
|
|
|||
|
|
@ -209,7 +209,7 @@ private:
|
|||
// Alignment, see https://eigen.tuxfamily.org/dox/group__TopicStructHavingEigenMembers.html
|
||||
enum { NeedsToAlign = (sizeof(T) % 16) == 0 };
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
||||
};
|
||||
// ExpressionFactor
|
||||
|
||||
|
|
|
|||
|
|
@ -175,7 +175,7 @@ public:
|
|||
|
||||
/// @}
|
||||
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
|
||||
private:
|
||||
|
||||
|
|
@ -265,7 +265,7 @@ public:
|
|||
traits<X>::Print(value_, "Value");
|
||||
}
|
||||
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
|
||||
private:
|
||||
|
||||
|
|
@ -331,7 +331,7 @@ public:
|
|||
return traits<X>::Local(x1,x2);
|
||||
}
|
||||
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW
|
||||
|
||||
private:
|
||||
|
||||
|
|
|
|||
|
|
@ -147,13 +147,15 @@ VectorValues NonlinearOptimizer::solve(const GaussianFactorGraph& gfg,
|
|||
} else if (params.isIterative()) {
|
||||
// Conjugate Gradient -> needs params.iterativeParams
|
||||
if (!params.iterativeParams)
|
||||
throw std::runtime_error("NonlinearOptimizer::solve: cg parameter has to be assigned ...");
|
||||
throw std::runtime_error(
|
||||
"NonlinearOptimizer::solve: cg parameter has to be assigned ...");
|
||||
|
||||
if (boost::shared_ptr<PCGSolverParameters> pcg =
|
||||
boost::dynamic_pointer_cast<PCGSolverParameters>(params.iterativeParams)) {
|
||||
if (auto pcg = boost::dynamic_pointer_cast<PCGSolverParameters>(
|
||||
params.iterativeParams)) {
|
||||
delta = PCGSolver(*pcg).optimize(gfg);
|
||||
} else if (boost::shared_ptr<SubgraphSolverParameters> spcg =
|
||||
boost::dynamic_pointer_cast<SubgraphSolverParameters>(params.iterativeParams)) {
|
||||
} else if (auto spcg =
|
||||
boost::dynamic_pointer_cast<SubgraphSolverParameters>(
|
||||
params.iterativeParams)) {
|
||||
if (!params.ordering)
|
||||
throw std::runtime_error("SubgraphSolver needs an ordering");
|
||||
delta = SubgraphSolver(gfg, *spcg, *params.ordering).optimize();
|
||||
|
|
|
|||
|
|
@ -114,7 +114,7 @@ namespace gtsam {
|
|||
// Alignment, see https://eigen.tuxfamily.org/dox/group__TopicStructHavingEigenMembers.html
|
||||
enum { NeedsToAlign = (sizeof(T) % 16) == 0 };
|
||||
public:
|
||||
EIGEN_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
||||
GTSAM_MAKE_ALIGNED_OPERATOR_NEW_IF(NeedsToAlign)
|
||||
};
|
||||
|
||||
} /// namespace gtsam
|
||||
|
|
|
|||
Some files were not shown because too many files have changed in this diff Show More
Loading…
Reference in New Issue